diff options
Diffstat (limited to 'src/cmd/compile')
118 files changed, 12323 insertions, 6520 deletions
diff --git a/src/cmd/compile/internal/amd64/galign.go b/src/cmd/compile/internal/amd64/galign.go index 14721ea35b..461ef2ada1 100644 --- a/src/cmd/compile/internal/amd64/galign.go +++ b/src/cmd/compile/internal/amd64/galign.go @@ -18,12 +18,7 @@ var ( ) func betypeinit() { - gc.Widthptr = 8 - gc.Widthint = 8 - gc.Widthreg = 8 if obj.Getgoarch() == "amd64p32" { - gc.Widthptr = 4 - gc.Widthint = 4 addptr = x86.AADDL movptr = x86.AMOVL leaptr = x86.ALEAL @@ -42,12 +37,9 @@ func Main() { resvd = append(resvd, x86.REG_BP) } - gc.Thearch.Thechar = '6' - gc.Thearch.Thestring = "amd64" - gc.Thearch.Thelinkarch = &x86.Linkamd64 + gc.Thearch.LinkArch = &x86.Linkamd64 if obj.Getgoarch() == "amd64p32" { - gc.Thearch.Thestring = "amd64p32" - gc.Thearch.Thelinkarch = &x86.Linkamd64p32 + gc.Thearch.LinkArch = &x86.Linkamd64p32 } gc.Thearch.REGSP = x86.REGSP gc.Thearch.REGCTXT = x86.REGCTXT diff --git a/src/cmd/compile/internal/amd64/gsubr.go b/src/cmd/compile/internal/amd64/gsubr.go index 456fa7cbae..e3535f3244 100644 --- a/src/cmd/compile/internal/amd64/gsubr.go +++ b/src/cmd/compile/internal/amd64/gsubr.go @@ -722,7 +722,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry %v-%v", gc.Oconv(op, 0), t) + gc.Fatalf("optoas: no entry %v-%v", op, t) case OADDR_ | gc.TPTR32: a = x86.ALEAL diff --git a/src/cmd/compile/internal/amd64/ssa.go b/src/cmd/compile/internal/amd64/ssa.go index 3f8e0ece12..6557287caa 100644 --- a/src/cmd/compile/internal/amd64/ssa.go +++ b/src/cmd/compile/internal/amd64/ssa.go @@ -62,7 +62,7 @@ func ssaMarkMoves(s *gc.SSAGenState, b *ssa.Block) { } for i := len(b.Values) - 1; i >= 0; i-- { v := b.Values[i] - if flive && (v.Op == ssa.OpAMD64MOVBconst || v.Op == ssa.OpAMD64MOVWconst || v.Op == ssa.OpAMD64MOVLconst || v.Op == ssa.OpAMD64MOVQconst) { + if flive && (v.Op == ssa.OpAMD64MOVLconst || v.Op == ssa.OpAMD64MOVQconst) { // The "mark" is any non-nil Aux value. v.Aux = v } @@ -160,7 +160,7 @@ func opregreg(op obj.As, dest, src int16) *obj.Prog { func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { s.SetLineno(v.Line) switch v.Op { - case ssa.OpAMD64ADDQ, ssa.OpAMD64ADDL, ssa.OpAMD64ADDW, ssa.OpAMD64ADDB: + case ssa.OpAMD64ADDQ, ssa.OpAMD64ADDL: r := gc.SSARegNum(v) r1 := gc.SSARegNum(v.Args[0]) r2 := gc.SSARegNum(v.Args[1]) @@ -192,74 +192,23 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.To.Type = obj.TYPE_REG p.To.Reg = r } - // 2-address opcode arithmetic, symmetric - case ssa.OpAMD64ADDSS, ssa.OpAMD64ADDSD, - ssa.OpAMD64ANDQ, ssa.OpAMD64ANDL, ssa.OpAMD64ANDW, ssa.OpAMD64ANDB, - ssa.OpAMD64ORQ, ssa.OpAMD64ORL, ssa.OpAMD64ORW, ssa.OpAMD64ORB, - ssa.OpAMD64XORQ, ssa.OpAMD64XORL, ssa.OpAMD64XORW, ssa.OpAMD64XORB, - ssa.OpAMD64MULQ, ssa.OpAMD64MULL, ssa.OpAMD64MULW, ssa.OpAMD64MULB, - ssa.OpAMD64MULSS, ssa.OpAMD64MULSD, ssa.OpAMD64PXOR: - r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - y := gc.SSARegNum(v.Args[1]) - if x != r && y != r { - opregreg(moveByType(v.Type), r, x) - x = r - } - p := gc.Prog(v.Op.Asm()) - p.From.Type = obj.TYPE_REG - p.To.Type = obj.TYPE_REG - p.To.Reg = r - if x == r { - p.From.Reg = y - } else { - p.From.Reg = x - } - // 2-address opcode arithmetic, not symmetric - case ssa.OpAMD64SUBQ, ssa.OpAMD64SUBL, ssa.OpAMD64SUBW, ssa.OpAMD64SUBB: - r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - y := gc.SSARegNum(v.Args[1]) - var neg bool - if y == r { - // compute -(y-x) instead - x, y = y, x - neg = true - } - if x != r { - opregreg(moveByType(v.Type), r, x) - } - opregreg(v.Op.Asm(), r, y) - - if neg { - if v.Op == ssa.OpAMD64SUBQ { - p := gc.Prog(x86.ANEGQ) - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } else { // Avoids partial registers write - p := gc.Prog(x86.ANEGL) - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } - } - case ssa.OpAMD64SUBSS, ssa.OpAMD64SUBSD, ssa.OpAMD64DIVSS, ssa.OpAMD64DIVSD: + // 2-address opcode arithmetic + case ssa.OpAMD64SUBQ, ssa.OpAMD64SUBL, + ssa.OpAMD64MULQ, ssa.OpAMD64MULL, + ssa.OpAMD64ANDQ, ssa.OpAMD64ANDL, + ssa.OpAMD64ORQ, ssa.OpAMD64ORL, + ssa.OpAMD64XORQ, ssa.OpAMD64XORL, + ssa.OpAMD64SHLQ, ssa.OpAMD64SHLL, + ssa.OpAMD64SHRQ, ssa.OpAMD64SHRL, ssa.OpAMD64SHRW, ssa.OpAMD64SHRB, + ssa.OpAMD64SARQ, ssa.OpAMD64SARL, ssa.OpAMD64SARW, ssa.OpAMD64SARB, + ssa.OpAMD64ADDSS, ssa.OpAMD64ADDSD, ssa.OpAMD64SUBSS, ssa.OpAMD64SUBSD, + ssa.OpAMD64MULSS, ssa.OpAMD64MULSD, ssa.OpAMD64DIVSS, ssa.OpAMD64DIVSD, + ssa.OpAMD64PXOR: r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - y := gc.SSARegNum(v.Args[1]) - if y == r && x != r { - // r/y := x op r/y, need to preserve x and rewrite to - // r/y := r/y op x15 - x15 := int16(x86.REG_X15) - // register move y to x15 - // register move x to y - // rename y with x15 - opregreg(moveByType(v.Type), x15, y) - opregreg(moveByType(v.Type), r, x) - y = x15 - } else if x != r { - opregreg(moveByType(v.Type), r, x) + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } - opregreg(v.Op.Asm(), r, y) + opregreg(v.Op.Asm(), r, gc.SSARegNum(v.Args[1])) case ssa.OpAMD64DIVQ, ssa.OpAMD64DIVL, ssa.OpAMD64DIVW, ssa.OpAMD64DIVQU, ssa.OpAMD64DIVLU, ssa.OpAMD64DIVWU, @@ -372,48 +321,21 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { // Do a 64-bit add, the overflow goes into the carry. // Shift right once and pull the carry back into the 63rd bit. r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - y := gc.SSARegNum(v.Args[1]) - if x != r && y != r { - opregreg(moveByType(v.Type), r, x) - x = r + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } p := gc.Prog(x86.AADDQ) p.From.Type = obj.TYPE_REG p.To.Type = obj.TYPE_REG p.To.Reg = r - if x == r { - p.From.Reg = y - } else { - p.From.Reg = x - } + p.From.Reg = gc.SSARegNum(v.Args[1]) p = gc.Prog(x86.ARCRQ) p.From.Type = obj.TYPE_CONST p.From.Offset = 1 p.To.Type = obj.TYPE_REG p.To.Reg = r - case ssa.OpAMD64SHLQ, ssa.OpAMD64SHLL, ssa.OpAMD64SHLW, ssa.OpAMD64SHLB, - ssa.OpAMD64SHRQ, ssa.OpAMD64SHRL, ssa.OpAMD64SHRW, ssa.OpAMD64SHRB, - ssa.OpAMD64SARQ, ssa.OpAMD64SARL, ssa.OpAMD64SARW, ssa.OpAMD64SARB: - x := gc.SSARegNum(v.Args[0]) - r := gc.SSARegNum(v) - if x != r { - if r == x86.REG_CX { - v.Fatalf("can't implement %s, target and shift both in CX", v.LongString()) - } - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } - p := gc.Prog(v.Op.Asm()) - p.From.Type = obj.TYPE_REG - p.From.Reg = gc.SSARegNum(v.Args[1]) // should be CX - p.To.Type = obj.TYPE_REG - p.To.Reg = r - case ssa.OpAMD64ADDQconst, ssa.OpAMD64ADDLconst, ssa.OpAMD64ADDWconst, ssa.OpAMD64ADDBconst: + case ssa.OpAMD64ADDQconst, ssa.OpAMD64ADDLconst: r := gc.SSARegNum(v) a := gc.SSARegNum(v.Args[0]) if r == a { @@ -433,7 +355,8 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.To.Type = obj.TYPE_REG p.To.Reg = r return - } else if v.AuxInt == -1 { + } + if v.AuxInt == -1 { var asm obj.As if v.Op == ssa.OpAMD64ADDQconst { asm = x86.ADECQ @@ -444,14 +367,13 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.To.Type = obj.TYPE_REG p.To.Reg = r return - } else { - p := gc.Prog(v.Op.Asm()) - p.From.Type = obj.TYPE_CONST - p.From.Offset = v.AuxInt - p.To.Type = obj.TYPE_REG - p.To.Reg = r - return } + p := gc.Prog(v.Op.Asm()) + p.From.Type = obj.TYPE_CONST + p.From.Offset = v.AuxInt + p.To.Type = obj.TYPE_REG + p.To.Reg = r + return } var asm obj.As if v.Op == ssa.OpAMD64ADDQconst { @@ -469,17 +391,11 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { case ssa.OpAMD64CMOVQEQconst, ssa.OpAMD64CMOVLEQconst, ssa.OpAMD64CMOVWEQconst, ssa.OpAMD64CMOVQNEconst, ssa.OpAMD64CMOVLNEconst, ssa.OpAMD64CMOVWNEconst: r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - // Arg0 is in/out, move in to out if not already same - if r != x { - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } - // Constant into AX, after arg0 movement in case arg0 is in AX + // Constant into AX p := gc.Prog(moveByType(v.Type)) p.From.Type = obj.TYPE_CONST p.From.Offset = v.AuxInt @@ -492,15 +408,10 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.To.Type = obj.TYPE_REG p.To.Reg = r - case ssa.OpAMD64MULQconst, ssa.OpAMD64MULLconst, ssa.OpAMD64MULWconst, ssa.OpAMD64MULBconst: + case ssa.OpAMD64MULQconst, ssa.OpAMD64MULLconst: r := gc.SSARegNum(v) - x := gc.SSARegNum(v.Args[0]) - if r != x { - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } p := gc.Prog(v.Op.Asm()) p.From.Type = obj.TYPE_CONST @@ -508,87 +419,22 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.To.Type = obj.TYPE_REG p.To.Reg = r // TODO: Teach doasm to compile the three-address multiply imul $c, r1, r2 - // instead of using the MOVQ above. + // then we don't need to use resultInArg0 for these ops. //p.From3 = new(obj.Addr) //p.From3.Type = obj.TYPE_REG //p.From3.Reg = gc.SSARegNum(v.Args[0]) - case ssa.OpAMD64SUBQconst, ssa.OpAMD64SUBLconst, ssa.OpAMD64SUBWconst, ssa.OpAMD64SUBBconst: - x := gc.SSARegNum(v.Args[0]) - r := gc.SSARegNum(v) - // We have 3-op add (lea), so transforming a = b - const into - // a = b + (- const), saves us 1 instruction. We can't fit - // - (-1 << 31) into 4 bytes offset in lea. - // We handle 2-address just fine below. - if v.AuxInt == -1<<31 || x == r { - if x != r { - // This code compensates for the fact that the register allocator - // doesn't understand 2-address instructions yet. TODO: fix that. - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } - p := gc.Prog(v.Op.Asm()) - p.From.Type = obj.TYPE_CONST - p.From.Offset = v.AuxInt - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } else if x == r && v.AuxInt == -1 { - var asm obj.As - // x = x - (-1) is the same as x++ - // See OpAMD64ADDQconst comments about inc vs add $1,reg - if v.Op == ssa.OpAMD64SUBQconst { - asm = x86.AINCQ - } else { - asm = x86.AINCL - } - p := gc.Prog(asm) - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } else if x == r && v.AuxInt == 1 { - var asm obj.As - if v.Op == ssa.OpAMD64SUBQconst { - asm = x86.ADECQ - } else { - asm = x86.ADECL - } - p := gc.Prog(asm) - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } else { - var asm obj.As - if v.Op == ssa.OpAMD64SUBQconst { - asm = x86.ALEAQ - } else { - asm = x86.ALEAL - } - p := gc.Prog(asm) - p.From.Type = obj.TYPE_MEM - p.From.Reg = x - p.From.Offset = -v.AuxInt - p.To.Type = obj.TYPE_REG - p.To.Reg = r - } - case ssa.OpAMD64ANDQconst, ssa.OpAMD64ANDLconst, ssa.OpAMD64ANDWconst, ssa.OpAMD64ANDBconst, - ssa.OpAMD64ORQconst, ssa.OpAMD64ORLconst, ssa.OpAMD64ORWconst, ssa.OpAMD64ORBconst, - ssa.OpAMD64XORQconst, ssa.OpAMD64XORLconst, ssa.OpAMD64XORWconst, ssa.OpAMD64XORBconst, - ssa.OpAMD64SHLQconst, ssa.OpAMD64SHLLconst, ssa.OpAMD64SHLWconst, - ssa.OpAMD64SHLBconst, ssa.OpAMD64SHRQconst, ssa.OpAMD64SHRLconst, ssa.OpAMD64SHRWconst, - ssa.OpAMD64SHRBconst, ssa.OpAMD64SARQconst, ssa.OpAMD64SARLconst, ssa.OpAMD64SARWconst, - ssa.OpAMD64SARBconst, ssa.OpAMD64ROLQconst, ssa.OpAMD64ROLLconst, ssa.OpAMD64ROLWconst, - ssa.OpAMD64ROLBconst: - // This code compensates for the fact that the register allocator - // doesn't understand 2-address instructions yet. TODO: fix that. - x := gc.SSARegNum(v.Args[0]) + case ssa.OpAMD64SUBQconst, ssa.OpAMD64SUBLconst, + ssa.OpAMD64ANDQconst, ssa.OpAMD64ANDLconst, + ssa.OpAMD64ORQconst, ssa.OpAMD64ORLconst, + ssa.OpAMD64XORQconst, ssa.OpAMD64XORLconst, + ssa.OpAMD64SHLQconst, ssa.OpAMD64SHLLconst, + ssa.OpAMD64SHRQconst, ssa.OpAMD64SHRLconst, ssa.OpAMD64SHRWconst, ssa.OpAMD64SHRBconst, + ssa.OpAMD64SARQconst, ssa.OpAMD64SARLconst, ssa.OpAMD64SARWconst, ssa.OpAMD64SARBconst, + ssa.OpAMD64ROLQconst, ssa.OpAMD64ROLLconst, ssa.OpAMD64ROLWconst, ssa.OpAMD64ROLBconst: r := gc.SSARegNum(v) - if x != r { - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } p := gc.Prog(v.Op.Asm()) p.From.Type = obj.TYPE_CONST @@ -651,7 +497,7 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { p.From.Offset = v.AuxInt p.To.Type = obj.TYPE_REG p.To.Reg = gc.SSARegNum(v.Args[0]) - case ssa.OpAMD64MOVBconst, ssa.OpAMD64MOVWconst, ssa.OpAMD64MOVLconst, ssa.OpAMD64MOVQconst: + case ssa.OpAMD64MOVLconst, ssa.OpAMD64MOVQconst: x := gc.SSARegNum(v) p := gc.Prog(v.Op.Asm()) p.From.Type = obj.TYPE_CONST @@ -966,17 +812,12 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { if gc.Maxarg < v.AuxInt { gc.Maxarg = v.AuxInt } - case ssa.OpAMD64NEGQ, ssa.OpAMD64NEGL, ssa.OpAMD64NEGW, ssa.OpAMD64NEGB, + case ssa.OpAMD64NEGQ, ssa.OpAMD64NEGL, ssa.OpAMD64BSWAPQ, ssa.OpAMD64BSWAPL, - ssa.OpAMD64NOTQ, ssa.OpAMD64NOTL, ssa.OpAMD64NOTW, ssa.OpAMD64NOTB: - x := gc.SSARegNum(v.Args[0]) + ssa.OpAMD64NOTQ, ssa.OpAMD64NOTL: r := gc.SSARegNum(v) - if x != r { - p := gc.Prog(moveByType(v.Type)) - p.From.Type = obj.TYPE_REG - p.From.Reg = x - p.To.Type = obj.TYPE_REG - p.To.Reg = r + if r != gc.SSARegNum(v.Args[0]) { + v.Fatalf("input[0] and output not in same register %s", v.LongString()) } p := gc.Prog(v.Op.Asm()) p.To.Type = obj.TYPE_REG diff --git a/src/cmd/compile/internal/arm/cgen64.go b/src/cmd/compile/internal/arm/cgen64.go index 337bf03179..33e840615c 100644 --- a/src/cmd/compile/internal/arm/cgen64.go +++ b/src/cmd/compile/internal/arm/cgen64.go @@ -19,7 +19,7 @@ func cgen64(n *gc.Node, res *gc.Node) { if res.Op != gc.OINDREG && res.Op != gc.ONAME { gc.Dump("n", n) gc.Dump("res", res) - gc.Fatalf("cgen64 %v of %v", gc.Oconv(n.Op, 0), gc.Oconv(res.Op, 0)) + gc.Fatalf("cgen64 %v of %v", n.Op, res.Op) } l := n.Left @@ -35,7 +35,7 @@ func cgen64(n *gc.Node, res *gc.Node) { split64(l, &lo1, &hi1) switch n.Op { default: - gc.Fatalf("cgen64 %v", gc.Oconv(n.Op, 0)) + gc.Fatalf("cgen64 %v", n.Op) case gc.OMINUS: var lo2 gc.Node @@ -793,7 +793,7 @@ func cmp64(nl *gc.Node, nr *gc.Node, op gc.Op, likely int, to *obj.Prog) { var br *obj.Prog switch op { default: - gc.Fatalf("cmp64 %v %v", gc.Oconv(op, 0), t) + gc.Fatalf("cmp64 %v %v", op, t) // cmp hi // bne L diff --git a/src/cmd/compile/internal/arm/galign.go b/src/cmd/compile/internal/arm/galign.go index e05f4d06bb..afd86e44c8 100644 --- a/src/cmd/compile/internal/arm/galign.go +++ b/src/cmd/compile/internal/arm/galign.go @@ -11,15 +11,10 @@ import ( ) func betypeinit() { - gc.Widthptr = 4 - gc.Widthint = 4 - gc.Widthreg = 4 } func Main() { - gc.Thearch.Thechar = '5' - gc.Thearch.Thestring = "arm" - gc.Thearch.Thelinkarch = &arm.Linkarm + gc.Thearch.LinkArch = &arm.Linkarm gc.Thearch.REGSP = arm.REGSP gc.Thearch.REGCTXT = arm.REGCTXT gc.Thearch.REGCALLX = arm.REG_R1 diff --git a/src/cmd/compile/internal/arm/gsubr.go b/src/cmd/compile/internal/arm/gsubr.go index 26da2e2081..73905f18ce 100644 --- a/src/cmd/compile/internal/arm/gsubr.go +++ b/src/cmd/compile/internal/arm/gsubr.go @@ -719,7 +719,7 @@ func raddr(n *gc.Node, p *obj.Prog) { gc.Naddr(&a, n) if a.Type != obj.TYPE_REG { if n != nil { - gc.Fatalf("bad in raddr: %v", gc.Oconv(n.Op, 0)) + gc.Fatalf("bad in raddr: %v", n.Op) } else { gc.Fatalf("bad in raddr: <null>") } @@ -790,7 +790,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry %v-%v etype %v simtype %v", gc.Oconv(op, 0), t, gc.Types[t.Etype], gc.Types[gc.Simtype[t.Etype]]) + gc.Fatalf("optoas: no entry %v-%v etype %v simtype %v", op, t, gc.Types[t.Etype], gc.Types[gc.Simtype[t.Etype]]) /* case CASE(OADDR, TPTR32): a = ALEAL; diff --git a/src/cmd/compile/internal/arm/ssa.go b/src/cmd/compile/internal/arm/ssa.go index e6211d00b7..ca10f1c508 100644 --- a/src/cmd/compile/internal/arm/ssa.go +++ b/src/cmd/compile/internal/arm/ssa.go @@ -91,8 +91,10 @@ func ssaGenValue(s *gc.SSAGenState, v *ssa.Value) { case ssa.OpARMCMP: p := gc.Prog(v.Op.Asm()) p.From.Type = obj.TYPE_REG - p.From.Reg = gc.SSARegNum(v.Args[0]) - p.Reg = gc.SSARegNum(v.Args[1]) + // Special layout in ARM assembly + // Comparing to x86, the operands of ARM's CMP are reversed. + p.From.Reg = gc.SSARegNum(v.Args[1]) + p.Reg = gc.SSARegNum(v.Args[0]) case ssa.OpARMMOVWload: p := gc.Prog(v.Op.Asm()) p.From.Type = obj.TYPE_MEM @@ -142,7 +144,7 @@ func ssaGenBlock(s *gc.SSAGenState, b, next *ssa.Block) { case ssa.BlockRet: gc.Prog(obj.ARET) case ssa.BlockARMLT: - p := gc.Prog(arm.ABGE) + p := gc.Prog(arm.ABLT) p.To.Type = obj.TYPE_BRANCH s.Branches = append(s.Branches, gc.Branch{p, b.Succs[0]}) p = gc.Prog(obj.AJMP) diff --git a/src/cmd/compile/internal/arm64/galign.go b/src/cmd/compile/internal/arm64/galign.go index 7e1226fee1..7acc4e08eb 100644 --- a/src/cmd/compile/internal/arm64/galign.go +++ b/src/cmd/compile/internal/arm64/galign.go @@ -10,15 +10,10 @@ import ( ) func betypeinit() { - gc.Widthptr = 8 - gc.Widthint = 8 - gc.Widthreg = 8 } func Main() { - gc.Thearch.Thechar = '7' - gc.Thearch.Thestring = "arm64" - gc.Thearch.Thelinkarch = &arm64.Linkarm64 + gc.Thearch.LinkArch = &arm64.Linkarm64 gc.Thearch.REGSP = arm64.REGSP gc.Thearch.REGCTXT = arm64.REGCTXT gc.Thearch.REGCALLX = arm64.REGRT1 @@ -34,6 +29,8 @@ func Main() { gc.Thearch.Betypeinit = betypeinit gc.Thearch.Cgen_hmul = cgen_hmul + gc.Thearch.AddSetCarry = AddSetCarry + gc.Thearch.RightShiftWithCarry = RightShiftWithCarry gc.Thearch.Cgen_shift = cgen_shift gc.Thearch.Clearfat = clearfat gc.Thearch.Defframe = defframe diff --git a/src/cmd/compile/internal/arm64/ggen.go b/src/cmd/compile/internal/arm64/ggen.go index 9abd901d7a..bddfed631a 100644 --- a/src/cmd/compile/internal/arm64/ggen.go +++ b/src/cmd/compile/internal/arm64/ggen.go @@ -252,6 +252,53 @@ func dodiv(op gc.Op, nl *gc.Node, nr *gc.Node, res *gc.Node) { } } +// RightShiftWithCarry generates a constant unsigned +// right shift with carry. +// +// res = n >> shift // with carry +func RightShiftWithCarry(n *gc.Node, shift uint, res *gc.Node) { + // Extra 1 is for carry bit. + maxshift := uint(n.Type.Width*8 + 1) + if shift == 0 { + gmove(n, res) + } else if shift < maxshift { + // 1. clear rightmost bit of target + var n1 gc.Node + gc.Nodconst(&n1, n.Type, 1) + gins(optoas(gc.ORSH, n.Type), &n1, n) + gins(optoas(gc.OLSH, n.Type), &n1, n) + // 2. add carry flag to target + var n2 gc.Node + gc.Nodconst(&n1, n.Type, 0) + gc.Regalloc(&n2, n.Type, nil) + gins(optoas(gc.OAS, n.Type), &n1, &n2) + gins(arm64.AADC, &n2, n) + // 3. right rotate 1 bit + gc.Nodconst(&n1, n.Type, 1) + gins(arm64.AROR, &n1, n) + + // ARM64 backend doesn't eliminate shifts by 0. It is manually checked here. + if shift > 1 { + var n3 gc.Node + gc.Nodconst(&n3, n.Type, int64(shift-1)) + cgen_shift(gc.ORSH, true, n, &n3, res) + } else { + gmove(n, res) + } + gc.Regfree(&n2) + } else { + gc.Fatalf("RightShiftWithCarry: shift(%v) is bigger than max size(%v)", shift, maxshift) + } +} + +// AddSetCarry generates add and set carry. +// +// res = nl + nr // with carry flag set +func AddSetCarry(nl *gc.Node, nr *gc.Node, res *gc.Node) { + gins(arm64.AADDS, nl, nr) + gmove(nr, res) +} + /* * generate high multiply: * res = (nl*nr) >> width diff --git a/src/cmd/compile/internal/arm64/gsubr.go b/src/cmd/compile/internal/arm64/gsubr.go index 4d64e790af..f193291d01 100644 --- a/src/cmd/compile/internal/arm64/gsubr.go +++ b/src/cmd/compile/internal/arm64/gsubr.go @@ -567,7 +567,7 @@ func raddr(n *gc.Node, p *obj.Prog) { gc.Naddr(&a, n) if a.Type != obj.TYPE_REG { if n != nil { - gc.Fatalf("bad in raddr: %v", gc.Oconv(n.Op, 0)) + gc.Fatalf("bad in raddr: %v", n.Op) } else { gc.Fatalf("bad in raddr: <null>") } @@ -579,7 +579,7 @@ func raddr(n *gc.Node, p *obj.Prog) { func gcmp(as obj.As, lhs *gc.Node, rhs *gc.Node) *obj.Prog { if lhs.Op != gc.OREGISTER { - gc.Fatalf("bad operands to gcmp: %v %v", gc.Oconv(lhs.Op, 0), gc.Oconv(rhs.Op, 0)) + gc.Fatalf("bad operands to gcmp: %v %v", lhs.Op, rhs.Op) } p := rawgins(as, rhs, nil) @@ -622,7 +622,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry for op=%v type=%v", gc.Oconv(op, 0), t) + gc.Fatalf("optoas: no entry for op=%v type=%v", op, t) case OEQ_ | gc.TBOOL, OEQ_ | gc.TINT8, @@ -890,18 +890,6 @@ func optoas(op gc.Op, t *gc.Type) obj.As { ORSH_ | gc.TINT64: a = arm64.AASR - // TODO(minux): handle rotates - //case CASE(ORROTC, TINT8): - //case CASE(ORROTC, TUINT8): - //case CASE(ORROTC, TINT16): - //case CASE(ORROTC, TUINT16): - //case CASE(ORROTC, TINT32): - //case CASE(ORROTC, TUINT32): - //case CASE(ORROTC, TINT64): - //case CASE(ORROTC, TUINT64): - // a = 0//??? RLDC?? - // break; - case OHMUL_ | gc.TINT64: a = arm64.ASMULH diff --git a/src/cmd/compile/internal/arm64/peep.go b/src/cmd/compile/internal/arm64/peep.go index 887353c889..22be1afebc 100644 --- a/src/cmd/compile/internal/arm64/peep.go +++ b/src/cmd/compile/internal/arm64/peep.go @@ -534,10 +534,13 @@ func copyu(p *obj.Prog, v *obj.Addr, s *obj.Addr) int { return 0 case arm64.AADD, /* read p->from, read p->reg, write p->to */ + arm64.AADDS, arm64.ASUB, + arm64.AADC, arm64.AAND, arm64.AORR, arm64.AEOR, + arm64.AROR, arm64.AMUL, arm64.ASMULL, arm64.AUMULL, diff --git a/src/cmd/compile/internal/arm64/prog.go b/src/cmd/compile/internal/arm64/prog.go index 3091c4a840..d504d0f0ee 100644 --- a/src/cmd/compile/internal/arm64/prog.go +++ b/src/cmd/compile/internal/arm64/prog.go @@ -59,6 +59,9 @@ var progtable = [arm64.ALAST & obj.AMask]obj.ProgInfo{ arm64.ALSR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, arm64.AASR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, arm64.ACMP & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead}, + arm64.AADC & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite | gc.UseCarry}, + arm64.AROR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + arm64.AADDS & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite | gc.SetCarry}, // Floating point. arm64.AFADDD & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RegRead | gc.RightWrite}, diff --git a/src/cmd/compile/internal/gc/alg.go b/src/cmd/compile/internal/gc/alg.go index e9b5afe838..136612d56f 100644 --- a/src/cmd/compile/internal/gc/alg.go +++ b/src/cmd/compile/internal/gc/alg.go @@ -127,11 +127,10 @@ func algtype1(t *Type) (AlgKind, *Type) { } return AINTER, nil - case TARRAY: - if t.IsSlice() { - return ANOEQ, t - } + case TSLICE: + return ANOEQ, t + case TARRAY: a, bad := algtype1(t.Elem()) switch a { case AMEM: @@ -219,10 +218,6 @@ func genhash(sym *Sym, t *Type) { Fatalf("genhash %v", t) case TARRAY: - if t.IsSlice() { - Fatalf("genhash %v", t) - } - // An array of pure memory would be handled by the // standard algorithm, so the element type must not be // pure memory. @@ -316,11 +311,12 @@ func genhash(sym *Sym, t *Type) { // for a struct containing a reflect.Value, which itself has // an unexported field of type unsafe.Pointer. old_safemode := safemode + safemode = false - safemode = 0 Disable_checknil++ funccompile(fn) Disable_checknil-- + safemode = old_safemode } @@ -398,10 +394,6 @@ func geneq(sym *Sym, t *Type) { Fatalf("geneq %v", t) case TARRAY: - if t.IsSlice() { - Fatalf("geneq %v", t) - } - // An array of pure memory would be handled by the // standard memequal, so the element type must not be // pure memory. Even if we unrolled the range loop, @@ -509,7 +501,7 @@ func geneq(sym *Sym, t *Type) { // for a struct containing a reflect.Value, which itself has // an unexported field of type unsafe.Pointer. old_safemode := safemode - safemode = 0 + safemode = false // Disable checknils while compiling this code. // We are comparing a struct or an array, diff --git a/src/cmd/compile/internal/gc/align.go b/src/cmd/compile/internal/gc/align.go index b7ed9f19b9..8123041318 100644 --- a/src/cmd/compile/internal/gc/align.go +++ b/src/cmd/compile/internal/gc/align.go @@ -198,11 +198,11 @@ func dowidth(t *Type) { // make fake type to check later to // trigger channel argument check. - t1 := typWrapper(TCHANARGS, t) + t1 := typChanArgs(t) checkwidth(t1) case TCHANARGS: - t1 := t.Wrapped() + t1 := t.ChanArgs() dowidth(t1) // just in case if t1.Elem().Width >= 1<<16 { Yyerror("channel element type too large (>64kB)") @@ -238,32 +238,34 @@ func dowidth(t *Type) { if t.Elem() == nil { break } - if t.IsArray() { - dowidth(t.Elem()) - if t.Elem().Width != 0 { - cap := (uint64(Thearch.MAXWIDTH) - 1) / uint64(t.Elem().Width) - if uint64(t.NumElem()) > cap { - Yyerror("type %v larger than address space", Tconv(t, FmtLong)) - } - } - - w = t.NumElem() * t.Elem().Width - t.Align = t.Elem().Align - } else if t.IsSlice() { - w = int64(sizeof_Array) - checkwidth(t.Elem()) - t.Align = uint8(Widthptr) - } else if t.isDDDArray() { + if t.isDDDArray() { if !t.Broke { Yyerror("use of [...] array outside of array literal") t.Broke = true } - } else { - Fatalf("dowidth %v", t) // probably [...]T + break + } + + dowidth(t.Elem()) + if t.Elem().Width != 0 { + cap := (uint64(Thearch.MAXWIDTH) - 1) / uint64(t.Elem().Width) + if uint64(t.NumElem()) > cap { + Yyerror("type %v larger than address space", Tconv(t, FmtLong)) + } } + w = t.NumElem() * t.Elem().Width + t.Align = t.Elem().Align + + case TSLICE: + if t.Elem() == nil { + break + } + w = int64(sizeof_Array) + checkwidth(t.Elem()) + t.Align = uint8(Widthptr) case TSTRUCT: - if t.Funarg { + if t.IsFuncArgStruct() { Fatalf("dowidth fn struct %v", t) } w = widstruct(t, t, 0, 1) @@ -271,18 +273,18 @@ func dowidth(t *Type) { // make fake type to check later to // trigger function argument computation. case TFUNC: - t1 := typWrapper(TFUNCARGS, t) + t1 := typFuncArgs(t) checkwidth(t1) w = int64(Widthptr) // width of func type is pointer // function is 3 cated structures; // compute their widths as side-effect. case TFUNCARGS: - t1 := t.Wrapped() + t1 := t.FuncArgs() w = widstruct(t1, t1.Recvs(), 0, 0) w = widstruct(t1, t1.Params(), w, Widthreg) w = widstruct(t1, t1.Results(), w, Widthreg) - t1.Argwid = w + t1.Extra.(*FuncType).Argwid = w if w%int64(Widthreg) != 0 { Warn("bad type %v %d\n", t1, w) } @@ -335,7 +337,7 @@ func checkwidth(t *Type) { // function arg structs should not be checked // outside of the enclosing function. - if t.Funarg { + if t.IsFuncArgStruct() { Fatalf("checkwidth %v", t) } @@ -386,7 +388,7 @@ func Argsize(t *Type) int { } } - w = (w + int64(Widthptr) - 1) &^ (int64(Widthptr) - 1) + w = Rnd(w, int64(Widthptr)) if int64(int(w)) != w { Fatalf("argsize too big") } diff --git a/src/cmd/compile/internal/gc/bexport.go b/src/cmd/compile/internal/gc/bexport.go index 8968ce8924..53662620aa 100644 --- a/src/cmd/compile/internal/gc/bexport.go +++ b/src/cmd/compile/internal/gc/bexport.go @@ -36,32 +36,27 @@ If the field is a pointer to another object, that object is serialized, recursively. Otherwise the field is written. Non-pointer fields are all encoded as integer or string values. -Only packages and types may be referred to more than once. When getting -to a package or type that was not serialized before, an integer _index_ +Some objects (packages, types) may be referred to more than once. When +reaching an object that was not serialized before, an integer _index_ is assigned to it, starting at 0. In this case, the encoding starts with an integer _tag_ < 0. The tag value indicates the kind of object -(package or type) that follows and that this is the first time that we -see this object. If the package or tag was already serialized, the encoding -starts with the respective package or type index >= 0. An importer can -trivially determine if a package or type needs to be read in for the first -time (tag < 0) and entered into the respective package or type table, or -if the package or type was seen already (index >= 0), in which case the -index is used to look up the object in a table. +that follows and that this is the first time that we see this object. +If the object was already serialized, the encoding is simply the object +index >= 0. An importer can trivially determine if an object needs to +be read in for the first time (tag < 0) and entered into the respective +object table, or if the object was seen already (index >= 0), in which +case the index is used to look up the object in a table. Before exporting or importing, the type tables are populated with the predeclared types (int, string, error, unsafe.Pointer, etc.). This way they are automatically encoded with a known and fixed type index. -TODO(gri) We may consider using the same sharing for other items -that are written out, such as strings, or possibly symbols (*Sym). - Encoding format: The export data starts with a single byte indicating the encoding format (compact, or with debugging information), followed by a version string -(so we can evolve the encoding if need be), the name of the imported -package, and a string containing platform-specific information for that -package. +(so we can evolve the encoding if need be), and then the package object +for the exported package (with an empty path). After this header, two lists of objects and the list of inlined function bodies follows. @@ -74,11 +69,17 @@ the previously imported type pointer so that we have exactly one version (i.e., one pointer) for each named type (and read but discard the current type encoding). Unnamed types simply encode their respective fields. -In the encoding, some lists start with the list length (incl. strings). -Some lists are terminated with an end marker (usually for lists where -we may not know the length a priori). +In the encoding, some lists start with the list length. Some lists are +terminated with an end marker (usually for lists where we may not know +the length a priori). + +Integers use variable-length encoding for compact representation. -All integer values use variable-length encoding for compact representation. +Strings are canonicalized similar to objects that may occur multiple times: +If the string was exported already, it is represented by its index only. +Otherwise, the export data starts with the negative string length (negative, +so we can distinguish from string index), followed by the string bytes. +The empty string is mapped to index 0. The exporter and importer are completely symmetric in implementation: For each encoding routine there is a matching and symmetric decoding routine. @@ -90,9 +91,9 @@ importer. package gc import ( + "bufio" "bytes" "cmd/compile/internal/big" - "cmd/internal/obj" "encoding/binary" "fmt" "sort" @@ -109,12 +110,13 @@ import ( // // NOTE: This flag is the first flag to enable if importing dies because of // (suspected) format errors, and whenever a change is made to the format. -// Having debugFormat enabled increases the export data size massively (by -// several factors) - avoid running with the flag enabled in general. const debugFormat = false // default: false -// TODO(gri) remove eventually -const forceNewExport = false // force new export format - DO NOT SUBMIT with this flag set +// forceObjFileStability enforces additional constraints in export data +// and other parts of the compiler to eliminate object file differences +// only due to the choice of export format. +// TODO(gri) disable and remove once there is only one export format again +const forceObjFileStability = true const exportVersion = "v0" @@ -126,10 +128,18 @@ const exportVersion = "v0" const exportInlined = true // default: true type exporter struct { - out *obj.Biobuf + out *bufio.Writer + + // object -> index maps, indexed in order of serialization + strIndex map[string]int pkgIndex map[*Pkg]int typIndex map[*Type]int - inlined []*Func + funcList []*Func + + // position encoding + posInfoFormat bool + prevFile string + prevLine int // debugging support written int // bytes written @@ -137,13 +147,18 @@ type exporter struct { trace bool } -// Export writes the exportlist for localpkg to out and returns the number of bytes written. -func Export(out *obj.Biobuf, trace bool) int { +// export writes the exportlist for localpkg to out and returns the number of bytes written. +func export(out *bufio.Writer, trace bool) int { p := exporter{ out: out, + strIndex: map[string]int{"": 0}, // empty string is mapped to 0 pkgIndex: make(map[*Pkg]int), typIndex: make(map[*Type]int), - trace: trace, + // don't emit pos info for builtin packages + // (not needed and avoids path name diffs in builtin.go between + // Windows and non-Windows machines, exposed via builtin_test.go) + posInfoFormat: Debug['A'] == 0, + trace: trace, } // first byte indicates low-level encoding format @@ -151,7 +166,10 @@ func Export(out *obj.Biobuf, trace bool) int { if debugFormat { format = 'd' } - p.byte(format) + p.rawByte(format) + + // posInfo exported or not? + p.bool(p.posInfoFormat) // --- generic export data --- @@ -184,22 +202,12 @@ func Export(out *obj.Biobuf, trace bool) int { Fatalf("exporter: local package path not empty: %q", localpkg.Path) } p.pkg(localpkg) - - // write compiler-specific flags - // TODO(gri) move this into the compiler-specific export data section - { - var flags string - if safemode != 0 { - flags = "safe" - } - p.string(flags) - } if p.trace { p.tracef("\n") } // export objects - + // // First, export all exported (package-level) objects; i.e., all objects // in the current exportlist. These objects represent all information // required to import this package and type-check against it; i.e., this @@ -272,6 +280,12 @@ func Export(out *obj.Biobuf, trace bool) int { } } + // write compiler-specific flags + p.bool(safemode) + if p.trace { + p.tracef("\n") + } + // Phase 2: Export objects added to exportlist during phase 1. // Don't use range since exportlist may grow during this phase // and we want to export all remaining objects. @@ -328,27 +342,39 @@ func Export(out *obj.Biobuf, trace bool) int { // --- inlined function bodies --- if p.trace { - p.tracef("\n--- inlined function bodies ---\n[ ") + p.tracef("\n--- inlined function bodies ---\n") if p.indent != 0 { Fatalf("exporter: incorrect indentation") } } - // write inlined function bodies - p.int(len(p.inlined)) - if p.trace { - p.tracef("]\n") - } - for _, f := range p.inlined { - if p.trace { - p.tracef("\n----\nfunc { %s }\n", Hconv(f.Inl, FmtSharp)) - } - p.stmtList(f.Inl) - if p.trace { - p.tracef("\n") + // write inlineable function bodies + objcount = 0 + for i, f := range p.funcList { + if f != nil { + // function has inlineable body: + // write index and body + if p.trace { + p.tracef("\n----\nfunc { %s }\n", Hconv(f.Inl, FmtSharp)) + } + p.int(i) + p.stmtList(f.Inl) + if p.trace { + p.tracef("\n") + } + objcount++ } } + // indicate end of list + if p.trace { + p.tracef("\n") + } + p.int(-1) // invalid index terminates list + + // for self-verification only (redundant) + p.int(objcount) + if p.trace { p.tracef("\n--- end ---\n") } @@ -413,6 +439,7 @@ func (p *exporter) obj(sym *Sym) { } p.tag(constTag) + p.pos(n) // TODO(gri) In inlined functions, constants are used directly // so they should never occur as re-exported objects. We may // not need the qualified name here. See also comment above. @@ -441,6 +468,7 @@ func (p *exporter) obj(sym *Sym) { if n.Type.Etype == TFUNC && n.Class == PFUNC { // function p.tag(funcTag) + p.pos(n) p.qualifiedName(sym) sig := sym.Def.Type @@ -449,10 +477,9 @@ func (p *exporter) obj(sym *Sym) { p.paramList(sig.Params(), inlineable) p.paramList(sig.Results(), inlineable) - index := -1 + var f *Func if inlineable { - index = len(p.inlined) - p.inlined = append(p.inlined, sym.Def.Func) + f = sym.Def.Func // TODO(gri) re-examine reexportdeplist: // Because we can trivially export types // in-place, we don't need to collect types @@ -460,23 +487,48 @@ func (p *exporter) obj(sym *Sym) { // With an adjusted reexportdeplist used only // by the binary exporter, we can also avoid // the global exportlist. - reexportdeplist(sym.Def.Func.Inl) + reexportdeplist(f.Inl) } - p.int(index) + p.funcList = append(p.funcList, f) } else { // variable p.tag(varTag) + p.pos(n) p.qualifiedName(sym) p.typ(sym.Def.Type) } default: - Fatalf("exporter: unexpected export symbol: %v %v", Oconv(n.Op, 0), sym) + Fatalf("exporter: unexpected export symbol: %v %v", n.Op, sym) } } +func (p *exporter) pos(n *Node) { + if !p.posInfoFormat { + return + } + + var file string + var line int + if n != nil { + file, line = Ctxt.LineHist.AbsFileLine(int(n.Lineno)) + } + + if file == p.prevFile && line != p.prevLine { + // common case: write delta-encoded line number + p.int(line - p.prevLine) // != 0 + } else { + // uncommon case: filename changed, or line didn't change + p.int(0) + p.string(file) + p.int(line) + p.prevFile = file + } + p.prevLine = line +} + func isInlineable(n *Node) bool { - if exportInlined && n != nil && n.Func != nil && len(n.Func.Inl.Slice()) != 0 { + if exportInlined && n != nil && n.Func != nil && n.Func.Inl.Len() != 0 { // when lazily typechecking inlined bodies, some re-exported ones may not have been typechecked yet. // currently that can leave unresolved ONONAMEs in import-dot-ed packages in the wrong package if Debug['l'] < 2 { @@ -515,19 +567,20 @@ func (p *exporter) typ(t *Type) { p.typIndex[t] = len(p.typIndex) // pick off named types - if sym := t.Sym; sym != nil { + if tsym := t.Sym; tsym != nil { // Predeclared types should have been found in the type map. if t.Orig == t { Fatalf("exporter: predeclared type missing from type map?") } - // TODO(gri) The assertion below seems incorrect (crashes during all.bash). - // we expect the respective definition to point to us - // if sym.Def.Type != t { - // Fatalf("exporter: type definition doesn't point to us?") - // } + + n := typenod(t) + if n.Type != t { + Fatalf("exporter: named type definition incorrectly set up") + } p.tag(namedTag) - p.qualifiedName(sym) + p.pos(n) + p.qualifiedName(tsym) // write underlying type p.typ(t.Orig) @@ -559,6 +612,7 @@ func (p *exporter) typ(t *Type) { Fatalf("invalid symbol name: %s (%v)", m.Sym.Name, m.Sym) } + p.pos(m.Sym.Def) p.fieldSym(m.Sym, false) sig := m.Type @@ -569,13 +623,12 @@ func (p *exporter) typ(t *Type) { p.paramList(sig.Params(), inlineable) p.paramList(sig.Results(), inlineable) - index := -1 + var f *Func if inlineable { - index = len(p.inlined) - p.inlined = append(p.inlined, mfn.Func) + f = mfn.Func reexportdeplist(mfn.Func.Inl) } - p.int(index) + p.funcList = append(p.funcList, f) } if p.trace && len(methods) > 0 { @@ -591,18 +644,18 @@ func (p *exporter) typ(t *Type) { if t.isDDDArray() { Fatalf("array bounds should be known at export time: %v", t) } - if t.IsArray() { - p.tag(arrayTag) - p.int64(t.NumElem()) - } else { - p.tag(sliceTag) - } + p.tag(arrayTag) + p.int64(t.NumElem()) + p.typ(t.Elem()) + + case TSLICE: + p.tag(sliceTag) p.typ(t.Elem()) case TDDDFIELD: // see p.param use of TDDDFIELD p.tag(dddTag) - p.typ(t.Wrapped()) + p.typ(t.DDDField()) case TSTRUCT: p.tag(structTag) @@ -664,17 +717,10 @@ func (p *exporter) fieldList(t *Type) { } func (p *exporter) field(f *Field) { + p.pos(f.Sym.Def) p.fieldName(f.Sym, f) p.typ(f.Type) - p.note(f.Note) -} - -func (p *exporter) note(n *string) { - var s string - if n != nil { - s = *n - } - p.string(s) + p.string(f.Note) } func (p *exporter) methodList(t *Type) { @@ -693,6 +739,7 @@ func (p *exporter) methodList(t *Type) { } func (p *exporter) method(m *Field) { + p.pos(m.Sym.Def) p.fieldName(m.Sym, m) p.paramList(m.Type.Params(), false) p.paramList(m.Type.Results(), false) @@ -742,7 +789,7 @@ func basetypeName(t *Type) string { } func (p *exporter) paramList(params *Type, numbered bool) { - if !params.IsStruct() || !params.Funarg { + if !params.IsFuncArgStruct() { Fatalf("exporter: parameter list expected") } @@ -768,7 +815,7 @@ func (p *exporter) param(q *Field, n int, numbered bool) { t := q.Type if q.Isddd { // create a fake type to encode ... just for the p.typ call - t = typWrapper(TDDDFIELD, t.Elem()) + t = typDDDField(t.Elem()) } p.typ(t) if n > 0 { @@ -779,16 +826,17 @@ func (p *exporter) param(q *Field, n int, numbered bool) { // supply the parameter package here. We need the package // when the function is inlined so we can properly resolve // the name. - // TODO(gri) should do this only once per function/method + // TODO(gri) This is compiler-specific. Try using importpkg + // here and then update the symbols if we find an inlined + // body only. Otherwise, the parameter name is ignored and + // the package doesn't matter. This would remove an int + // (likely 1 byte) for each named parameter. p.pkg(q.Sym.Pkg) } // TODO(gri) This is compiler-specific (escape info). // Move into compiler-specific section eventually? // (Not having escape info causes tests to fail, e.g. runtime GCInfoTest) - // - // TODO(gri) The q.Note is much more verbose that necessary and - // adds significantly to export data size. FIX THIS. - p.note(q.Note) + p.string(q.Note) } func parName(f *Field, numbered bool) string { @@ -827,7 +875,7 @@ func parName(f *Field, numbered bool) string { // Functions that can be inlined use numbered parameters so we can distingish them // from other names in their context after inlining (i.e., the parameter numbering // is a form of parameter rewriting). See issue 4326 for an example and test case. - if numbered { + if forceObjFileStability || numbered { if !strings.Contains(name, "·") && f.Nname != nil && f.Nname.Name != nil && f.Nname.Name.Vargen > 0 { name = fmt.Sprintf("%s·%d", name, f.Nname.Name.Vargen) // append Vargen } @@ -1132,12 +1180,15 @@ func (p *exporter) expr(n *Node) { case OSLICE, OSLICESTR, OSLICEARR: p.op(OSLICE) p.expr(n.Left) - p.expr(n.Right) + low, high, _ := n.SliceBounds() + p.exprsOrNil(low, high) case OSLICE3, OSLICE3ARR: p.op(OSLICE3) p.expr(n.Left) - p.expr(n.Right) + low, high, max := n.SliceBounds() + p.exprsOrNil(low, high) + p.expr(max) case OCOPY, OCOMPLEX: p.op(op) @@ -1215,7 +1266,7 @@ func (p *exporter) expr(n *Node) { p.op(ODCLCONST) default: - Fatalf("exporter: CANNOT EXPORT: %s\nPlease notify gri@\n", opnames[n.Op]) + Fatalf("exporter: CANNOT EXPORT: %s\nPlease notify gri@\n", n.Op) } } @@ -1262,12 +1313,11 @@ func (p *exporter) stmt(n *Node) { // unimplemented - handled by default case case OAS, OASWB: - p.op(op) // Don't export "v = <N>" initializing statements, hope they're always // preceded by the DCL which will be re-parsed and typecheck to reproduce // the "v = <N>" again. - // TODO(gri) if n.Right == nil, don't emit anything - if p.bool(n.Right != nil) { + if n.Right != nil { + p.op(OAS) p.expr(n.Left) p.expr(n.Right) } @@ -1280,16 +1330,14 @@ func (p *exporter) stmt(n *Node) { p.expr(n.Right) } + case OAS2DOTTYPE, OAS2FUNC, OAS2MAPR, OAS2RECV: + fallthrough + case OAS2: p.op(OAS2) p.exprList(n.List) p.exprList(n.Rlist) - case OAS2DOTTYPE, OAS2FUNC, OAS2MAPR, OAS2RECV: - p.op(op) - p.exprList(n.List) - p.exprList(n.Rlist) - case ORETURN: p.op(ORETURN) p.exprList(n.List) @@ -1328,11 +1376,15 @@ func (p *exporter) stmt(n *Node) { p.stmtList(n.List) case OCASE, OXCASE: - p.op(op) + p.op(OXCASE) p.stmtList(n.List) p.stmtList(n.Nbody) - case OBREAK, OCONTINUE, OGOTO, OFALL, OXFALL: + case OFALL: + op = OXFALL + fallthrough + + case OBREAK, OCONTINUE, OGOTO, OXFALL: p.op(op) p.exprsOrNil(n.Left, nil) @@ -1344,7 +1396,7 @@ func (p *exporter) stmt(n *Node) { p.expr(n.Left) default: - Fatalf("exporter: CANNOT EXPORT: %s\nPlease notify gri@\n", opnames[n.Op]) + Fatalf("exporter: CANNOT EXPORT: %s\nPlease notify gri@\n", n.Op) } } @@ -1432,7 +1484,7 @@ func (p *exporter) bool(b bool) bool { func (p *exporter) op(op Op) { if p.trace { p.tracef("[") - defer p.tracef("= %s] ", opnames[op]) + defer p.tracef("= %s] ", op) } p.int(int(op)) @@ -1488,9 +1540,17 @@ func (p *exporter) string(s string) { if p.trace { p.tracef("%q ", s) } - p.rawInt64(int64(len(s))) + // if we saw the string before, write its index (>= 0) + // (the empty string is mapped to 0) + if i, ok := p.strIndex[s]; ok { + p.rawInt64(int64(i)) + return + } + // otherwise, remember string and write its negative length and bytes + p.strIndex[s] = len(p.strIndex) + p.rawInt64(-int64(len(s))) for i := 0; i < len(s); i++ { - p.byte(s[i]) + p.rawByte(s[i]) } } @@ -1498,7 +1558,7 @@ func (p *exporter) string(s string) { // it easy for a reader to detect if it is "out of sync". Used only // if debugFormat is set. func (p *exporter) marker(m byte) { - p.byte(m) + p.rawByte(m) // Uncomment this for help tracking down the location // of an incorrect marker when running in debugFormat. // if p.trace { @@ -1512,12 +1572,12 @@ func (p *exporter) rawInt64(x int64) { var tmp [binary.MaxVarintLen64]byte n := binary.PutVarint(tmp[:], x) for i := 0; i < n; i++ { - p.byte(tmp[i]) + p.rawByte(tmp[i]) } } -// byte is the bottleneck interface to write to p.out. -// byte escapes b as follows (any encoding does that +// rawByte is the bottleneck interface to write to p.out. +// rawByte escapes b as follows (any encoding does that // hides '$'): // // '$' => '|' 'S' @@ -1525,7 +1585,8 @@ func (p *exporter) rawInt64(x int64) { // // Necessary so other tools can find the end of the // export data by searching for "$$". -func (p *exporter) byte(b byte) { +// rawByte should only be used by low-level encoders. +func (p *exporter) rawByte(b byte) { switch b { case '$': // write '$' as '|' 'S' @@ -1533,10 +1594,10 @@ func (p *exporter) byte(b byte) { fallthrough case '|': // write '|' as '|' '|' - obj.Bputc(p.out, '|') + p.out.WriteByte('|') p.written++ } - obj.Bputc(p.out, b) + p.out.WriteByte(b) p.written++ } diff --git a/src/cmd/compile/internal/gc/bimport.go b/src/cmd/compile/internal/gc/bimport.go index 8c53372b80..6fe30cdba9 100644 --- a/src/cmd/compile/internal/gc/bimport.go +++ b/src/cmd/compile/internal/gc/bimport.go @@ -20,12 +20,19 @@ import ( // changes to bimport.go and bexport.go. type importer struct { - in *bufio.Reader - buf []byte // for reading strings - bufarray [64]byte // initial underlying array for buf, large enough to avoid allocation when compiling std lib + in *bufio.Reader + buf []byte // reused for reading strings + + // object lists, in order of deserialization + strList []string pkgList []*Pkg typList []*Type - inlined []*Node // functions with pending inlined function bodies + funcList []*Node // nil entry means already declared + + // position encoding + posInfoFormat bool + prevFile string + prevLine int // debugging support debugFormat bool @@ -34,11 +41,13 @@ type importer struct { // Import populates importpkg from the serialized package data. func Import(in *bufio.Reader) { - p := importer{in: in} - p.buf = p.bufarray[:] + p := importer{ + in: in, + strList: []string{""}, // empty string is mapped to 0 + } // read low-level encoding format - switch format := p.byte(); format { + switch format := p.rawByte(); format { case 'c': // compact format - nothing to do case 'd': @@ -47,6 +56,8 @@ func Import(in *bufio.Reader) { Fatalf("importer: invalid encoding format in export data: got %q; want 'c' or 'd'", format) } + p.posInfoFormat = p.bool() + // --- generic export data --- if v := p.string(); v != exportVersion { @@ -58,12 +69,6 @@ func Import(in *bufio.Reader) { // read package data p.pkg() - if p.pkgList[0] != importpkg { - Fatalf("importer: imported package not found in pkgList[0]") - } - - // read compiler-specific flags - importpkg.Safe = p.string() == "safe" // defer some type-checking until all types are read in completely // (parser.go:import_package) @@ -73,7 +78,7 @@ func Import(in *bufio.Reader) { // read objects - // Phase 1 + // phase 1 objcount := 0 for { tag := p.tagOrIndex() @@ -91,7 +96,10 @@ func Import(in *bufio.Reader) { // --- compiler-specific export data --- - // Phase 2 + // read compiler-specific flags + importpkg.Safe = p.bool() + + // phase 2 objcount = 0 for { tag := p.tagOrIndex() @@ -107,23 +115,46 @@ func Import(in *bufio.Reader) { Fatalf("importer: got %d objects; want %d", objcount, count) } - // read inlined functions bodies + // read inlineable functions bodies if dclcontext != PEXTERN { Fatalf("importer: unexpected context %d", dclcontext) } - bcount := p.int() // consistency check only - if bcount != len(p.inlined) { - Fatalf("importer: expected %d inlined function bodies; got %d", bcount, len(p.inlined)) - } - for _, f := range p.inlined { + objcount = 0 + for i0 := -1; ; { + i := p.int() // index of function with inlineable body + if i < 0 { + break + } + + // don't process the same function twice + if i <= i0 { + Fatalf("importer: index not increasing: %d <= %d", i, i0) + } + i0 = i + if Funcdepth != 0 { Fatalf("importer: unexpected Funcdepth %d", Funcdepth) } - if f != nil { - // function body not yet imported - read body and set it + + // Note: In the original code, funchdr and funcbody are called for + // all functions (that were not yet imported). Now, we are calling + // them only for functions with inlineable bodies. funchdr does + // parameter renaming which doesn't matter if we don't have a body. + + if f := p.funcList[i]; f != nil { + // function not yet imported - read body and set it funchdr(f) - f.Func.Inl.Set(p.stmtList()) + body := p.stmtList() + if body == nil { + // Make sure empty body is not interpreted as + // no inlineable body (see also parser.fnbody) + // (not doing so can cause significant performance + // degradation due to unnecessary calls to empty + // functions). + body = []*Node{Nod(OEMPTY, nil, nil)} + } + f.Func.Inl.Set(body) funcbody(f) } else { // function already imported - read body but discard declarations @@ -131,6 +162,13 @@ func Import(in *bufio.Reader) { p.stmtList() dclcontext = PEXTERN } + + objcount++ + } + + // self-verification + if count := p.int(); count != objcount { + Fatalf("importer: got %d functions; want %d", objcount, count) } if dclcontext != PEXTERN { @@ -171,7 +209,12 @@ func (p *importer) pkg() *Pkg { Fatalf("importer: bad path in import: %q", path) } - // an empty path denotes the package we are currently importing + // an empty path denotes the package we are currently importing; + // it must be the first package we see + if (path == "") != (len(p.pkgList) == 0) { + panic(fmt.Sprintf("package path %q for pkg index %d", path, len(p.pkgList))) + } + pkg := importpkg if path != "" { pkg = mkpkg(path) @@ -197,6 +240,7 @@ func idealType(typ *Type) *Type { func (p *importer) obj(tag int) { switch tag { case constTag: + p.pos() sym := p.qualifiedName() typ := p.typ() val := p.value(typ) @@ -206,68 +250,66 @@ func (p *importer) obj(tag int) { p.typ() case varTag: + p.pos() sym := p.qualifiedName() typ := p.typ() importvar(sym, typ) case funcTag: + p.pos() sym := p.qualifiedName() params := p.paramList() result := p.paramList() - inl := p.int() sig := functype(nil, params, result) importsym(sym, ONAME) if sym.Def != nil && sym.Def.Op == ONAME { - if Eqtype(sig, sym.Def.Type) { - // function was imported before (via another import) - dclcontext = PDISCARD // since we skip funchdr below - } else { + // function was imported before (via another import) + if !Eqtype(sig, sym.Def.Type) { Fatalf("importer: inconsistent definition for func %v during import\n\t%v\n\t%v", sym, sym.Def.Type, sig) } - } - - var n *Node - if dclcontext != PDISCARD { - n = newfuncname(sym) - n.Type = sig - declare(n, PFUNC) - if inl < 0 { - funchdr(n) - } - } - - if inl >= 0 { - // function has inlined body - collect for later - if inl != len(p.inlined) { - Fatalf("importer: inlined index = %d; want %d", inl, len(p.inlined)) - } - p.inlined = append(p.inlined, n) - } - - // parser.go:hidden_import - if dclcontext == PDISCARD { - dclcontext = PEXTERN // since we skip the funcbody below + p.funcList = append(p.funcList, nil) break } - if inl < 0 { - funcbody(n) - } - importlist = append(importlist, n) // TODO(gri) may only be needed for inlineable functions + n := newfuncname(sym) + n.Type = sig + declare(n, PFUNC) + p.funcList = append(p.funcList, n) + importlist = append(importlist, n) if Debug['E'] > 0 { fmt.Printf("import [%q] func %v \n", importpkg.Path, n) - if Debug['m'] > 2 && len(n.Func.Inl.Slice()) != 0 { + if Debug['m'] > 2 && n.Func.Inl.Len() != 0 { fmt.Printf("inl body: %v\n", n.Func.Inl) } } default: - Fatalf("importer: unexpected object tag") + Fatalf("importer: unexpected object (tag = %d)", tag) } } +func (p *importer) pos() { + if !p.posInfoFormat { + return + } + + file := p.prevFile + line := p.prevLine + + if delta := p.int(); delta != 0 { + line += delta + } else { + file = p.string() + line = p.int() + p.prevFile = file + } + p.prevLine = line + + // TODO(gri) register new position +} + func (p *importer) newtyp(etype EType) *Type { t := typ(etype) p.typList = append(p.typList, t) @@ -286,6 +328,7 @@ func (p *importer) typ() *Type { switch i { case namedTag: // parser.go:hidden_importsym + p.pos() tsym := p.qualifiedName() // parser.go:hidden_pkgtype @@ -311,28 +354,19 @@ func (p *importer) typ() *Type { for i := p.int(); i > 0; i-- { // parser.go:hidden_fndcl + p.pos() sym := p.fieldSym() recv := p.paramList() // TODO(gri) do we need a full param list for the receiver? params := p.paramList() result := p.paramList() - inl := p.int() n := methodname1(newname(sym), recv[0].Right) n.Type = functype(recv[0], params, result) checkwidth(n.Type) addmethod(sym, n.Type, tsym.Pkg, false, false) - if inl < 0 { - funchdr(n) - } - - if inl >= 0 { - // method has inlined body - collect for later - if inl != len(p.inlined) { - Fatalf("importer: inlined index = %d; want %d", inl, len(p.inlined)) - } - p.inlined = append(p.inlined, n) - } + p.funcList = append(p.funcList, n) + importlist = append(importlist, n) // (comment from parser.go) // inl.C's inlnode in on a dotmeth node expects to find the inlineable body as @@ -341,15 +375,9 @@ func (p *importer) typ() *Type { // this back link here we avoid special casing there. n.Type.SetNname(n) - // parser.go:hidden_import - if inl < 0 { - funcbody(n) - } - importlist = append(importlist, n) // TODO(gri) may only be needed for inlineable functions - if Debug['E'] > 0 { fmt.Printf("import [%q] meth %v \n", importpkg.Path, n) - if Debug['m'] > 2 && len(n.Func.Inl.Slice()) != 0 { + if Debug['m'] > 2 && n.Func.Inl.Len() != 0 { fmt.Printf("inl body: %v\n", n.Func.Inl) } } @@ -357,18 +385,20 @@ func (p *importer) typ() *Type { dclcontext = savedContext - case arrayTag, sliceTag: + case arrayTag: t = p.newtyp(TARRAY) - if i == arrayTag { - t.SetNumElem(p.int64()) - } else { - t.SetNumElem(sliceBound) - } - t.Type = p.typ() + bound := p.int64() + elem := p.typ() + t.Extra = &ArrayType{Elem: elem, Bound: bound} + + case sliceTag: + t = p.newtyp(TSLICE) + elem := p.typ() + t.Extra = SliceType{Elem: elem} case dddTag: t = p.newtyp(TDDDFIELD) - t.Type = p.typ() + t.Extra = DDDFieldType{T: p.typ()} case structTag: t = p.newtyp(TSTRUCT) @@ -376,7 +406,7 @@ func (p *importer) typ() *Type { case pointerTag: t = p.newtyp(Tptr) - t.Type = p.typ() + t.Extra = PtrType{Elem: p.typ()} case signatureTag: t = p.newtyp(TFUNC) @@ -393,13 +423,15 @@ func (p *importer) typ() *Type { case mapTag: t = p.newtyp(TMAP) - t.Down = p.typ() // key - t.Type = p.typ() // val + mt := t.MapType() + mt.Key = p.typ() + mt.Val = p.typ() case chanTag: t = p.newtyp(TCHAN) - t.Chan = ChanDir(p.int()) - t.Type = p.typ() + ct := t.ChanType() + ct.Dir = ChanDir(p.int()) + ct.Elem = p.typ() default: Fatalf("importer: unexpected type (tag = %d)", i) @@ -419,23 +451,22 @@ func (p *importer) qualifiedName() *Sym { } // parser.go:hidden_structdcl_list -func (p *importer) fieldList() []*Node { - i := p.int() - if i == 0 { - return nil - } - n := make([]*Node, i) - for i := range n { - n[i] = p.field() +func (p *importer) fieldList() (fields []*Node) { + if n := p.int(); n > 0 { + fields = make([]*Node, n) + for i := range fields { + fields[i] = p.field() + } } - return n + return } // parser.go:hidden_structdcl func (p *importer) field() *Node { + p.pos() sym := p.fieldName() typ := p.typ() - note := p.note() + note := p.string() var n *Node if sym.Name != "" { @@ -444,7 +475,7 @@ func (p *importer) field() *Node { // anonymous field - typ must be T or *T and T must be a type name s := typ.Sym if s == nil && typ.IsPtr() { - s = typ.Type.Sym // deref + s = typ.Elem().Sym // deref } pkg := importpkg if sym != nil { @@ -453,33 +484,25 @@ func (p *importer) field() *Node { n = embedded(s, pkg) n.Right = typenod(typ) } - n.SetVal(note) + n.SetVal(Val{U: note}) return n } -func (p *importer) note() (v Val) { - if s := p.string(); s != "" { - v.U = s - } - return -} - // parser.go:hidden_interfacedcl_list -func (p *importer) methodList() []*Node { - i := p.int() - if i == 0 { - return nil - } - n := make([]*Node, i) - for i := range n { - n[i] = p.method() +func (p *importer) methodList() (methods []*Node) { + if n := p.int(); n > 0 { + methods = make([]*Node, n) + for i := range methods { + methods[i] = p.method() + } } - return n + return } // parser.go:hidden_interfacedcl func (p *importer) method() *Node { + p.pos() sym := p.fieldName() params := p.paramList() result := p.paramList() @@ -531,7 +554,7 @@ func (p *importer) param(named bool) *Node { isddd := false if typ.Etype == TDDDFIELD { // TDDDFIELD indicates wrapped ... slice type - typ = typSlice(typ.Wrapped()) + typ = typSlice(typ.DDDField()) isddd = true } @@ -551,7 +574,7 @@ func (p *importer) param(named bool) *Node { // TODO(gri) This is compiler-specific (escape info). // Move into compiler-specific section eventually? - n.SetVal(p.note()) + n.SetVal(Val{U: p.string()}) return n } @@ -636,6 +659,10 @@ func (p *importer) float(x *Mpflt) { // re-establish the syntax tree's invariants. At some future point we might be // able to avoid this round-about way and create the rewritten nodes directly, // possibly avoiding a lot of duplicate work (name resolution, type checking). +// +// Refined nodes (e.g., ODOTPTR as a refinement of OXDOT) are exported as their +// unrefined nodes (since this is what the importer uses). The respective case +// entries are unreachable in the importer. func (p *importer) stmtList() []*Node { var list []*Node @@ -797,9 +824,19 @@ func (p *importer) node() *Node { // case OINDEX, OINDEXMAP, OSLICE, OSLICESTR, OSLICEARR, OSLICE3, OSLICE3ARR: // unreachable - mapped to cases below by exporter - case OINDEX, OSLICE, OSLICE3: + case OINDEX: return Nod(op, p.expr(), p.expr()) + case OSLICE, OSLICE3: + n := Nod(op, p.expr(), nil) + low, high := p.exprsOrNil() + var max *Node + if n.Op.IsSlice3() { + max = p.expr() + } + n.SetSliceBounds(low, high, max) + return n + case OCOPY, OCOMPLEX: n := builtinCall(op) n.List.Set([]*Node{p.expr(), p.expr()}) @@ -881,14 +918,11 @@ func (p *importer) node() *Node { // case ODCLFIELD: // unimplemented - case OAS, OASWB: - if p.bool() { - lhs := p.expr() - rhs := p.expr() - return Nod(OAS, lhs, rhs) - } - // TODO(gri) we should not have emitted anything here - return Nod(OEMPTY, nil, nil) + // case OAS, OASWB: + // unreachable - mapped to OAS case below by exporter + + case OAS: + return Nod(OAS, p.expr(), p.expr()) case OASOP: n := Nod(OASOP, nil, nil) @@ -902,15 +936,10 @@ func (p *importer) node() *Node { } return n - case OAS2: - lhs := p.exprList() - rhs := p.exprList() - n := Nod(OAS2, nil, nil) - n.List.Set(lhs) - n.Rlist.Set(rhs) - return n + // case OAS2DOTTYPE, OAS2FUNC, OAS2MAPR, OAS2RECV: + // unreachable - mapped to OAS2 case below by exporter - case OAS2DOTTYPE, OAS2FUNC, OAS2MAPR, OAS2RECV: + case OAS2: n := Nod(OAS2, nil, nil) n.List.Set(p.exprList()) n.Rlist.Set(p.exprList()) @@ -964,7 +993,10 @@ func (p *importer) node() *Node { popdcl() return n - case OCASE, OXCASE: + // case OCASE, OXCASE: + // unreachable - mapped to OXCASE case below by exporter + + case OXCASE: markdcl() n := Nod(OXCASE, nil, nil) n.List.Set(p.exprList()) @@ -974,10 +1006,10 @@ func (p *importer) node() *Node { popdcl() return n - case OBREAK, OCONTINUE, OGOTO, OFALL, OXFALL: - if op == OFALL { - op = OXFALL - } + // case OFALL: + // unreachable - mapped to OXFALL case below by exporter + + case OBREAK, OCONTINUE, OGOTO, OXFALL: left, _ := p.exprsOrNil() return Nod(op, left, nil) @@ -993,7 +1025,7 @@ func (p *importer) node() *Node { return nil default: - Fatalf("importer: %s (%d) node not yet supported", opnames[op], op) + Fatalf("importer: %s (%d) node not yet supported", op, op) panic("unreachable") // satisfy compiler } } @@ -1067,29 +1099,31 @@ func (p *importer) int64() int64 { } func (p *importer) string() string { - if p.debugFormat { + if debugFormat { p.marker('s') } - - // TODO(gri) should we intern strings here? - - if n := int(p.rawInt64()); n > 0 { - if cap(p.buf) < n { - p.buf = make([]byte, n) - } else { - p.buf = p.buf[:n] - } - for i := range p.buf { - p.buf[i] = p.byte() - } - return string(p.buf) + // if the string was seen before, i is its index (>= 0) + // (the empty string is at index 0) + i := p.rawInt64() + if i >= 0 { + return p.strList[i] } - - return "" + // otherwise, i is the negative string length (< 0) + if n := int(-i); n <= cap(p.buf) { + p.buf = p.buf[:n] + } else { + p.buf = make([]byte, n) + } + for i := range p.buf { + p.buf[i] = p.rawByte() + } + s := string(p.buf) + p.strList = append(p.strList, s) + return s } func (p *importer) marker(want byte) { - if got := p.byte(); got != want { + if got := p.rawByte(); got != want { Fatalf("importer: incorrect marker: got %c; want %c (pos = %d)", got, want, p.read) } @@ -1110,12 +1144,13 @@ func (p *importer) rawInt64() int64 { // needed for binary.ReadVarint in rawInt64 func (p *importer) ReadByte() (byte, error) { - return p.byte(), nil + return p.rawByte(), nil } -// byte is the bottleneck interface for reading from p.in. +// rawByte is the bottleneck interface for reading from p.in. // It unescapes '|' 'S' to '$' and '|' '|' to '|'. -func (p *importer) byte() byte { +// rawByte should only be used by low-level decoders. +func (p *importer) rawByte() byte { c, err := p.in.ReadByte() p.read++ if err != nil { diff --git a/src/cmd/compile/internal/gc/builtin.go b/src/cmd/compile/internal/gc/builtin.go index 411c7b8605..cc64e73f25 100644 --- a/src/cmd/compile/internal/gc/builtin.go +++ b/src/cmd/compile/internal/gc/builtin.go @@ -3,135 +3,106 @@ package gc const runtimeimport = "" + - "package runtime safe\n" + - "func @\"\".newobject (@\"\".typ·2 *byte) (? *any)\n" + - "func @\"\".panicindex ()\n" + - "func @\"\".panicslice ()\n" + - "func @\"\".panicdivide ()\n" + - "func @\"\".throwreturn ()\n" + - "func @\"\".throwinit ()\n" + - "func @\"\".panicwrap (? string, ? string, ? string)\n" + - "func @\"\".gopanic (? interface {})\n" + - "func @\"\".gorecover (? *int32) (? interface {})\n" + - "func @\"\".printbool (? bool)\n" + - "func @\"\".printfloat (? float64)\n" + - "func @\"\".printint (? int64)\n" + - "func @\"\".printhex (? uint64)\n" + - "func @\"\".printuint (? uint64)\n" + - "func @\"\".printcomplex (? complex128)\n" + - "func @\"\".printstring (? string)\n" + - "func @\"\".printpointer (? any)\n" + - "func @\"\".printiface (? any)\n" + - "func @\"\".printeface (? any)\n" + - "func @\"\".printslice (? any)\n" + - "func @\"\".printnl ()\n" + - "func @\"\".printsp ()\n" + - "func @\"\".printlock ()\n" + - "func @\"\".printunlock ()\n" + - "func @\"\".concatstring2 (? *[32]byte, ? string, ? string) (? string)\n" + - "func @\"\".concatstring3 (? *[32]byte, ? string, ? string, ? string) (? string)\n" + - "func @\"\".concatstring4 (? *[32]byte, ? string, ? string, ? string, ? string) (? string)\n" + - "func @\"\".concatstring5 (? *[32]byte, ? string, ? string, ? string, ? string, ? string) (? string)\n" + - "func @\"\".concatstrings (? *[32]byte, ? []string) (? string)\n" + - "func @\"\".cmpstring (? string, ? string) (? int)\n" + - "func @\"\".eqstring (? string, ? string) (? bool)\n" + - "func @\"\".intstring (? *[4]byte, ? int64) (? string)\n" + - "func @\"\".slicebytetostring (? *[32]byte, ? []byte) (? string)\n" + - "func @\"\".slicebytetostringtmp (? []byte) (? string)\n" + - "func @\"\".slicerunetostring (? *[32]byte, ? []rune) (? string)\n" + - "func @\"\".stringtoslicebyte (? *[32]byte, ? string) (? []byte)\n" + - "func @\"\".stringtoslicebytetmp (? string) (? []byte)\n" + - "func @\"\".stringtoslicerune (? *[32]rune, ? string) (? []rune)\n" + - "func @\"\".stringiter (? string, ? int) (? int)\n" + - "func @\"\".stringiter2 (? string, ? int) (@\"\".retk·1 int, @\"\".retv·2 rune)\n" + - "func @\"\".slicecopy (@\"\".to·2 any, @\"\".fr·3 any, @\"\".wid·4 uintptr \"unsafe-uintptr\") (? int)\n" + - "func @\"\".slicestringcopy (@\"\".to·2 any, @\"\".fr·3 any) (? int)\n" + - "func @\"\".convI2E (@\"\".elem·2 any) (@\"\".ret·1 any)\n" + - "func @\"\".convI2I (@\"\".typ·2 *byte, @\"\".elem·3 any) (@\"\".ret·1 any)\n" + - "func @\"\".convT2E (@\"\".typ·2 *byte, @\"\".elem·3 *any, @\"\".buf·4 *any) (@\"\".ret·1 any)\n" + - "func @\"\".convT2I (@\"\".tab·2 *byte, @\"\".elem·3 *any, @\"\".buf·4 *any) (@\"\".ret·1 any)\n" + - "func @\"\".assertE2E (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertE2E2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".assertE2I (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertE2I2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".assertE2T (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertE2T2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".assertI2E (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertI2E2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".assertI2I (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertI2I2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".assertI2T (@\"\".typ·1 *byte, @\"\".iface·2 any, @\"\".ret·3 *any)\n" + - "func @\"\".assertI2T2 (@\"\".typ·2 *byte, @\"\".iface·3 any, @\"\".ret·4 *any) (? bool)\n" + - "func @\"\".panicdottype (@\"\".have·1 *byte, @\"\".want·2 *byte, @\"\".iface·3 *byte)\n" + - "func @\"\".ifaceeq (@\"\".i1·2 any, @\"\".i2·3 any) (@\"\".ret·1 bool)\n" + - "func @\"\".efaceeq (@\"\".i1·2 any, @\"\".i2·3 any) (@\"\".ret·1 bool)\n" + - "func @\"\".makemap (@\"\".mapType·2 *byte, @\"\".hint·3 int64, @\"\".mapbuf·4 *any, @\"\".bucketbuf·5 *any) (@\"\".hmap·1 map[any]any)\n" + - "func @\"\".mapaccess1 (@\"\".mapType·2 *byte, @\"\".hmap·3 map[any]any, @\"\".key·4 *any) (@\"\".val·1 *any)\n" + - "func @\"\".mapaccess1_fast32 (@\"\".mapType·2 *byte, @\"\".hmap·3 map[any]any, @\"\".key·4 any) (@\"\".val·1 *any)\n" + - "func @\"\".mapaccess1_fast64 (@\"\".mapType·2 *byte, @\"\".hmap·3 map[any]any, @\"\".key·4 any) (@\"\".val·1 *any)\n" + - "func @\"\".mapaccess1_faststr (@\"\".mapType·2 *byte, @\"\".hmap·3 map[any]any, @\"\".key·4 any) (@\"\".val·1 *any)\n" + - "func @\"\".mapaccess2 (@\"\".mapType·3 *byte, @\"\".hmap·4 map[any]any, @\"\".key·5 *any) (@\"\".val·1 *any, @\"\".pres·2 bool)\n" + - "func @\"\".mapaccess2_fast32 (@\"\".mapType·3 *byte, @\"\".hmap·4 map[any]any, @\"\".key·5 any) (@\"\".val·1 *any, @\"\".pres·2 bool)\n" + - "func @\"\".mapaccess2_fast64 (@\"\".mapType·3 *byte, @\"\".hmap·4 map[any]any, @\"\".key·5 any) (@\"\".val·1 *any, @\"\".pres·2 bool)\n" + - "func @\"\".mapaccess2_faststr (@\"\".mapType·3 *byte, @\"\".hmap·4 map[any]any, @\"\".key·5 any) (@\"\".val·1 *any, @\"\".pres·2 bool)\n" + - "func @\"\".mapassign1 (@\"\".mapType·1 *byte, @\"\".hmap·2 map[any]any, @\"\".key·3 *any, @\"\".val·4 *any)\n" + - "func @\"\".mapiterinit (@\"\".mapType·1 *byte, @\"\".hmap·2 map[any]any, @\"\".hiter·3 *any)\n" + - "func @\"\".mapdelete (@\"\".mapType·1 *byte, @\"\".hmap·2 map[any]any, @\"\".key·3 *any)\n" + - "func @\"\".mapiternext (@\"\".hiter·1 *any)\n" + - "func @\"\".makechan (@\"\".chanType·2 *byte, @\"\".hint·3 int64) (@\"\".hchan·1 chan any)\n" + - "func @\"\".chanrecv1 (@\"\".chanType·1 *byte, @\"\".hchan·2 <-chan any, @\"\".elem·3 *any)\n" + - "func @\"\".chanrecv2 (@\"\".chanType·2 *byte, @\"\".hchan·3 <-chan any, @\"\".elem·4 *any) (? bool)\n" + - "func @\"\".chansend1 (@\"\".chanType·1 *byte, @\"\".hchan·2 chan<- any, @\"\".elem·3 *any)\n" + - "func @\"\".closechan (@\"\".hchan·1 any)\n" + - "var @\"\".writeBarrier struct { @\"\".enabled bool; @\"\".needed bool; @\"\".cgo bool }\n" + - "func @\"\".writebarrierptr (@\"\".dst·1 *any, @\"\".src·2 any)\n" + - "func @\"\".typedmemmove (@\"\".typ·1 *byte, @\"\".dst·2 *any, @\"\".src·3 *any)\n" + - "func @\"\".typedslicecopy (@\"\".typ·2 *byte, @\"\".dst·3 any, @\"\".src·4 any) (? int)\n" + - "func @\"\".selectnbsend (@\"\".chanType·2 *byte, @\"\".hchan·3 chan<- any, @\"\".elem·4 *any) (? bool)\n" + - "func @\"\".selectnbrecv (@\"\".chanType·2 *byte, @\"\".elem·3 *any, @\"\".hchan·4 <-chan any) (? bool)\n" + - "func @\"\".selectnbrecv2 (@\"\".chanType·2 *byte, @\"\".elem·3 *any, @\"\".received·4 *bool, @\"\".hchan·5 <-chan any) (? bool)\n" + - "func @\"\".newselect (@\"\".sel·1 *byte, @\"\".selsize·2 int64, @\"\".size·3 int32)\n" + - "func @\"\".selectsend (@\"\".sel·2 *byte, @\"\".hchan·3 chan<- any, @\"\".elem·4 *any) (@\"\".selected·1 bool)\n" + - "func @\"\".selectrecv (@\"\".sel·2 *byte, @\"\".hchan·3 <-chan any, @\"\".elem·4 *any) (@\"\".selected·1 bool)\n" + - "func @\"\".selectrecv2 (@\"\".sel·2 *byte, @\"\".hchan·3 <-chan any, @\"\".elem·4 *any, @\"\".received·5 *bool) (@\"\".selected·1 bool)\n" + - "func @\"\".selectdefault (@\"\".sel·2 *byte) (@\"\".selected·1 bool)\n" + - "func @\"\".selectgo (@\"\".sel·1 *byte)\n" + - "func @\"\".block ()\n" + - "func @\"\".makeslice (@\"\".typ·2 *byte, @\"\".nel·3 int64, @\"\".cap·4 int64) (@\"\".ary·1 []any)\n" + - "func @\"\".growslice (@\"\".typ·2 *byte, @\"\".old·3 []any, @\"\".cap·4 int) (@\"\".ary·1 []any)\n" + - "func @\"\".memmove (@\"\".to·1 *any, @\"\".frm·2 *any, @\"\".length·3 uintptr \"unsafe-uintptr\")\n" + - "func @\"\".memclr (@\"\".ptr·1 *byte, @\"\".length·2 uintptr \"unsafe-uintptr\")\n" + - "func @\"\".memequal (@\"\".x·2 *any, @\"\".y·3 *any, @\"\".size·4 uintptr \"unsafe-uintptr\") (? bool)\n" + - "func @\"\".memequal8 (@\"\".x·2 *any, @\"\".y·3 *any) (? bool)\n" + - "func @\"\".memequal16 (@\"\".x·2 *any, @\"\".y·3 *any) (? bool)\n" + - "func @\"\".memequal32 (@\"\".x·2 *any, @\"\".y·3 *any) (? bool)\n" + - "func @\"\".memequal64 (@\"\".x·2 *any, @\"\".y·3 *any) (? bool)\n" + - "func @\"\".memequal128 (@\"\".x·2 *any, @\"\".y·3 *any) (? bool)\n" + - "func @\"\".int64div (? int64, ? int64) (? int64)\n" + - "func @\"\".uint64div (? uint64, ? uint64) (? uint64)\n" + - "func @\"\".int64mod (? int64, ? int64) (? int64)\n" + - "func @\"\".uint64mod (? uint64, ? uint64) (? uint64)\n" + - "func @\"\".float64toint64 (? float64) (? int64)\n" + - "func @\"\".float64touint64 (? float64) (? uint64)\n" + - "func @\"\".int64tofloat64 (? int64) (? float64)\n" + - "func @\"\".uint64tofloat64 (? uint64) (? float64)\n" + - "func @\"\".complex128div (@\"\".num·2 complex128, @\"\".den·3 complex128) (@\"\".quo·1 complex128)\n" + - "func @\"\".racefuncenter (? uintptr \"unsafe-uintptr\")\n" + - "func @\"\".racefuncexit ()\n" + - "func @\"\".raceread (? uintptr \"unsafe-uintptr\")\n" + - "func @\"\".racewrite (? uintptr \"unsafe-uintptr\")\n" + - "func @\"\".racereadrange (@\"\".addr·1 uintptr \"unsafe-uintptr\", @\"\".size·2 uintptr \"unsafe-uintptr\")\n" + - "func @\"\".racewriterange (@\"\".addr·1 uintptr \"unsafe-uintptr\", @\"\".size·2 uintptr \"unsafe-uintptr\")\n" + - "func @\"\".msanread (@\"\".addr·1 uintptr \"unsafe-uintptr\", @\"\".size·2 uintptr \"unsafe-uintptr\")\n" + - "func @\"\".msanwrite (@\"\".addr·1 uintptr \"unsafe-uintptr\", @\"\".size·2 uintptr \"unsafe-uintptr\")\n" + - "\n" + - "$$\n" + "c\x00\x03v0\x01\rruntime\x00\t\x11newobject\x00\x02\x17\"\vtyp·2\x00\x00\x01" + + "\x17:\x00\t\x13panicindex\x00\x00\x00\t\x13panicslice\x00\x00\x00\t\x15panic" + + "divide\x00\x00\x00\t\x15throwreturn\x00\x00\x00\t\x11throwinit\x00\x00\x00\t" + + "\x11panicwrap\x00\x05 \x00 \x00 \x00\x00\t\rgopanic\x00\x01\x1b\x00\x00\x00\x00\t\x11gor" + + "ecover\x00\x01\x17\b\x00\x01\x1b\x00\x00\x00\t\x11printbool\x00\x01\x00\x00\x00\t\x13printf" + + "loat\x00\x01\x1a\x00\x00\t\x0fprintint\x00\x01\n\x00\x00\t\x0fprinthex\x00\x01\x14\x00\x00\t" + + "\x11printuint\x00\x01\x14\x00\x00\t\x17printcomplex\x00\x01\x1e\x00\x00\t\x15prin" + + "tstring\x00\x01 \x00\x00\t\x17printpointer\x00\x01:\x00\x00\t\x13printif" + + "ace\x00\x01:\x00\x00\t\x13printeface\x00\x01:\x00\x00\t\x13printslice\x00\x01:" + + "\x00\x00\t\rprintnl\x00\x00\x00\t\rprintsp\x00\x00\x00\t\x11printlock\x00\x00\x00" + + "\t\x15printunlock\x00\x00\x00\t\x19concatstring2\x00\x05\x17\x0f@\"\x00 \x00" + + " \x00\x01 \x00\t\x19concatstring3\x00\a\x17\x0f@\"\x00 \x00 \x00 \x00\x01 \x00\t\x19co" + + "ncatstring4\x00\t\x17\x0f@\"\x00 \x00 \x00 \x00 \x00\x01 \x00\t\x19concatstr" + + "ing5\x00\v\x17\x0f@\"\x00 \x00 \x00 \x00 \x00 \x00\x01 \x00\t\x19concatstrings\x00" + + "\x03\x17\x0f@\"\x00\x11 \x00\x01 \x00\t\x11cmpstring\x00\x03 \x00 \x00\x01\x02\x00\t\x0feqstri" + + "ng\x00\x03 \x00 \x00\x01\x00\x00\t\x11intstring\x00\x03\x17\x0f\b\"\x00\n\x00\x01 \x00\t!slic" + + "ebytetostring\x00\x03\x17\x0f@\"\x00\x11\"\x00\x01 \x00\t'slicebytetos" + + "tringtmp\x00\x01\x11\"\x00\x01 \x00\t!slicerunetostring\x00\x03\x17\x0f@" + + "\"\x00\x11|S\x00\x01 \x00\t!stringtoslicebyte\x00\x03\x17\x0f@\"\x00 \x00\x01\x11\"" + + "\x00\t'stringtoslicebytetmp\x00\x01 \x00\x01\x11\"\x00\t!stringt" + + "oslicerune\x00\x03\x17\x0f@|S\x00 \x00\x01\x11|S\x00\t\x13stringiter\x00\x03 " + + "\x00\x02\x00\x01\x02\x00\t\x15stringiter2\x00\x03 \x00\x02\x00\x04\x02\rretk·1\x00\x00|S\r" + + "retv·2\x00\x00\t\x11slicecopy\x00\x06:\tto·2\x00\x00:\tfr·3\x00\x00" + + "\x16\vwid·4\x00\x1bunsafe-uintptr\x01\x02\x00\t\x1dslicestring" + + "copy\x00\x04:^\x00\x00:`\x00\x00\x01\x02\x00\t\rconvI2E\x00\x02:\relem·2\x00\x00\x02" + + ":\vret·1\x00\x00\t\rconvI2I\x00\x04\x17\"\b\x00\x00:\relem·3\x00\x00\x02:l" + + "\x00\x00\t\rconvT2E\x00\x06\x17\"\b\x00\x00>p\x00\x00>\vbuf·4\x00\x00\x02:l\x00\x00\t\rc" + + "onvT2I\x00\x06\x17\"\vtab·2\x00\x00>p\x00\x00>t\x00\x00\x02:l\x00\x00\t\x11assert" + + "E2E\x00\x06\x17\"\vtyp·1\x00\x00:\x0fiface·2\x00\x00>\vret·3\x00\x00\x00\t" + + "\x13assertE2E2\x00\x06\x17\"\b\x00\x00:\x0fiface·3\x00\x00>\vret·4\x00\x00" + + "\x01\x00\x00\t\x11assertE2I\x00\x06\x17\"||\x00\x00:~\x00\x00>\x80\x01\x00\x00\x00\t\x13assert" + + "E2I2\x00\x06\x17\"\b\x00\x00:\x84\x01\x00\x00>\x86\x01\x00\x00\x01\x00\x00\t\x11assertE2T\x00\x06\x17\"|" + + "|\x00\x00:~\x00\x00>\x80\x01\x00\x00\x00\t\x13assertE2T2\x00\x06\x17\"\b\x00\x00:\x84\x01\x00\x00>\x86\x01" + + "\x00\x00\x01\x00\x00\t\x11assertI2E\x00\x06\x17\"||\x00\x00:~\x00\x00>\x80\x01\x00\x00\x00\t\x13asse" + + "rtI2E2\x00\x06\x17\"\b\x00\x00:\x84\x01\x00\x00>\x86\x01\x00\x00\x01\x00\x00\t\x11assertI2I\x00\x06\x17" + + "\"||\x00\x00:~\x00\x00>\x80\x01\x00\x00\x00\t\x13assertI2I2\x00\x06\x17\"\b\x00\x00:\x84\x01\x00\x00>" + + "\x86\x01\x00\x00\x01\x00\x00\t\x11assertI2T\x00\x06\x17\"||\x00\x00:~\x00\x00>\x80\x01\x00\x00\x00\t\x13as" + + "sertI2T2\x00\x06\x17\"\b\x00\x00:\x84\x01\x00\x00>\x86\x01\x00\x00\x01\x00\x00\t\x17panicdotty" + + "pe\x00\x06\x17\"\rhave·1\x00\x00\x9a\x01\rwant·2\x00\x00\x9a\x01\x84\x01\x00\x00\x00\t\rifa" + + "ceeq\x00\x04:\ti1·2\x00\x00:\ti2·3\x00\x00\x02\x00l\x00\x00\t\refaceeq\x00\x04" + + ":\xa4\x01\x00\x00:\xa6\x01\x00\x00\x02\x00l\x00\x00\t\rmakemap\x00\b\x17\"\x13mapType·2\x00" + + "\x00\n\rhint·3\x00\x00>\x11mapbuf·4\x00\x00>\x17bucketbuf·5\x00" + + "\x00\x02\x1d::\rhmap·1\x00\x00\t\x13mapaccess1\x00\x06\x17\"\xac\x01\x00\x00\x1d::\rh" + + "map·3\x00\x00>\vkey·4\x00\x00\x02>\vval·1\x00\x00\t!mapaccess" + + "1_fast32\x00\x06\x17\"\xac\x01\x00\x00\x1d::\xb8\x01\x00\x00:\xba\x01\x00\x00\x02>\xbc\x01\x00\x00\t!mapa" + + "ccess1_fast64\x00\x06\x17\"\xac\x01\x00\x00\x1d::\xb8\x01\x00\x00:\xba\x01\x00\x00\x02>\xbc\x01\x00\x00\t" + + "#mapaccess1_faststr\x00\x06\x17\"\xac\x01\x00\x00\x1d::\xb8\x01\x00\x00:\xba\x01\x00\x00\x02" + + ">\xbc\x01\x00\x00\t\x1bmapaccess1_fat\x00\b\x17\"\xac\x01\x00\x00\x1d::\xb8\x01\x00\x00>\xba\x01\x00" + + "\x00\x17\"\rzero·5\x00\x00\x02>\xbc\x01\x00\x00\t\x13mapaccess2\x00\x06\x17\"\x13mapT" + + "ype·3\x00\x00\x1d::\rhmap·4\x00\x00>\vkey·5\x00\x00\x04>\xbc\x01\x00\x00\x00\rp" + + "res·2\x00\x00\t!mapaccess2_fast32\x00\x06\x17\"\xca\x01\x00\x00\x1d::\xcc\x01" + + "\x00\x00:\xce\x01\x00\x00\x04>\xbc\x01\x00\x00\x00\xd0\x01\x00\x00\t!mapaccess2_fast64\x00\x06\x17" + + "\"\xca\x01\x00\x00\x1d::\xcc\x01\x00\x00:\xce\x01\x00\x00\x04>\xbc\x01\x00\x00\x00\xd0\x01\x00\x00\t#mapaccess2" + + "_faststr\x00\x06\x17\"\xca\x01\x00\x00\x1d::\xcc\x01\x00\x00:\xce\x01\x00\x00\x04>\xbc\x01\x00\x00\x00\xd0\x01\x00\x00\t" + + "\x1bmapaccess2_fat\x00\b\x17\"\xca\x01\x00\x00\x1d::\xcc\x01\x00\x00>\xce\x01\x00\x00\x17\"\rze" + + "ro·6\x00\x00\x04>\xbc\x01\x00\x00\x00\xd0\x01\x00\x00\t\x13mapassign1\x00\b\x17\"\x13mapTy" + + "pe·1\x00\x00\x1d::\rhmap·2\x00\x00>\vkey·3\x00\x00>\vval·4\x00\x00" + + "\x00\t\x15mapiterinit\x00\x06\x17\"\xde\x01\x00\x00\x1d::\xe0\x01\x00\x00>\x0fhiter·3\x00" + + "\x00\x00\t\x11mapdelete\x00\x06\x17\"\xde\x01\x00\x00\x1d::\xe0\x01\x00\x00>\xe2\x01\x00\x00\x00\t\x15mapi" + + "ternext\x00\x02>\x0fhiter·1\x00\x00\x00\t\x0fmakechan\x00\x04\x17\"\x15cha" + + "nType·2\x00\x00\n\xae\x01\x00\x00\x02\x1f\x06:\x0fhchan·1\x00\x00\t\x11chanrecv" + + "1\x00\x06\x17\"\x15chanType·1\x00\x00\x1f\x02:\x0fhchan·2\x00\x00>p\x00\x00\x00\t\x11" + + "chanrecv2\x00\x06\x17\"\xf2\x01\x00\x00\x1f\x02:\x0fhchan·3\x00\x00>\relem·4" + + "\x00\x00\x01\x00\x00\t\x11chansend1\x00\x06\x17\"\xf8\x01\x00\x00\x1f\x04:\xfa\x01\x00\x00>p\x00\x00\x00\t\x11cl" + + "osechan\x00\x02:\xf4\x01\x00\x00\x00\a\x17writeBarrier\x00\x15\x06\renabled" + + "\x00\x00\x00\vneeded\x00\x00\x00\x05cgo\x00\x00\x00\t\x1dwritebarrierptr\x00\x04>" + + "\vdst·1\x00\x00:\vsrc·2\x00\x00\x00\t\x17typedmemmove\x00\x06\x17\"||" + + "\x00\x00>\vdst·2\x00\x00>\vsrc·3\x00\x00\x00\t\x1btypedslicecopy\x00" + + "\x06\x17\"\b\x00\x00:\vdst·3\x00\x00:\vsrc·4\x00\x00\x01\x02\x00\t\x17selectnbs" + + "end\x00\x06\x17\"\xf2\x01\x00\x00\x1f\x04:\xfe\x01\x00\x00>\x80\x02\x00\x00\x01\x00\x00\t\x17selectnbrecv" + + "\x00\x06\x17\"\xf2\x01\x00\x00>p\x00\x00\x1f\x02:\x0fhchan·4\x00\x00\x01\x00\x00\t\x19selectnbr" + + "ecv2\x00\b\x17\"\xf2\x01\x00\x00>p\x00\x00\x17\x00\x15received·4\x00\x00\x1f\x02:\x0fhcha" + + "n·5\x00\x00\x01\x00\x00\t\x11newselect\x00\x06\x17\"\vsel·1\x00\x00\n\x13selsi" + + "ze·2\x00\x00\b\rsize·3\x00\x00\x00\t\x13selectsend\x00\x06\x17\"\vsel\xc2" + + "\xb72\x00\x00\x1f\x04:\xfe\x01\x00\x00>\x80\x02\x00\x00\x02\x00\x15selected·1\x00\x00\t\x13select" + + "recv\x00\x06\x17\"\xb6\x02\x00\x00\x1f\x02:\xfe\x01\x00\x00>\x80\x02\x00\x00\x02\x00\xb8\x02\x00\x00\t\x15selectre" + + "cv2\x00\b\x17\"\xb6\x02\x00\x00\x1f\x02:\xfe\x01\x00\x00>\x80\x02\x00\x00\xf8\x01\x15received·5\x00\x00\x02" + + "\x00\xb8\x02\x00\x00\t\x19selectdefault\x00\x02\x17\"\xb6\x02\x00\x00\x02\x00\xb8\x02\x00\x00\t\x0fsele" + + "ctgo\x00\x02\x17\"\xae\x02\x00\x00\x00\t\tblock\x00\x00\x00\t\x11makeslice\x00\x06\x17\"\b\x00" + + "\x00\n\vnel·3\x00\x00\n\vcap·4\x00\x00\x02\x11:\vary·1\x00\x00\t\x11grows" + + "lice\x00\x06\x17\"\b\x00\x00\x11:\vold·3\x00\x00\x02\xca\x02\x00\x00\x02\x11:\xcc\x02\x00\x00\t\rmemm" + + "ove\x00\x06>\tto·1\x00\x00>\vfrm·2\x00\x00\x16\x11length·3\x00d\x00\t\v" + + "memclr\x00\x04\x17\"\vptr·1\x00\x00\x16\x11length·2\x00d\x00\t\x0fmemeq" + + "ual\x00\x06>\ax·2\x00\x00>\ay·3\x00\x00\x16\rsize·4\x00d\x01\x00\x00\t\x11mem" + + "equal8\x00\x04>\xe2\x02\x00\x00>\xe4\x02\x00\x00\x01\x00\x00\t\x13memequal16\x00\x04>\xe2\x02\x00\x00" + + ">\xe4\x02\x00\x00\x01\x00\x00\t\x13memequal32\x00\x04>\xe2\x02\x00\x00>\xe4\x02\x00\x00\x01\x00\x00\t\x13mem" + + "equal64\x00\x04>\xe2\x02\x00\x00>\xe4\x02\x00\x00\x01\x00\x00\t\x15memequal128\x00\x04>\xe2\x02" + + "\x00\x00>\xe4\x02\x00\x00\x01\x00\x00\t\x0fint64div\x00\x03\n\x00\n\x00\x01\n\x00\t\x11uint64div" + + "\x00\x03\x14\x00\x14\x00\x01\x14\x00\t\x0fint64mod\x00\x03\n\x00\n\x00\x01\n\x00\t\x11uint64mod\x00" + + "\x03\x14\x00\x14\x00\x01\x14\x00\t\x1bfloat64toint64\x00\x01\x1a\x00\x01\n\x00\t\x1dfloat64" + + "touint64\x00\x01\x1a\x00\x01\x14\x00\t\x1bint64tofloat64\x00\x01\n\x00\x01\x1a\x00\t\x1d" + + "uint64tofloat64\x00\x01\x14\x00\x01\x1a\x00\t\x19complex128div\x00\x04\x1e" + + "\vnum·2\x00\x00\x1e\vden·3\x00\x00\x02\x1e\vquo·1\x00\x00\t\x19racefunc" + + "enter\x00\x01\x16d\x00\t\x17racefuncexit\x00\x00\x00\t\x0fraceread\x00\x01\x16" + + "d\x00\t\x11racewrite\x00\x01\x16d\x00\t\x19racereadrange\x00\x04\x16\radd" + + "r·1\x00d\x16\rsize·2\x00d\x00\t\x1bracewriterange\x00\x04\x16\x94\x03\x00" + + "d\x16\x96\x03\x00d\x00\t\x0fmsanread\x00\x04\x16\x94\x03\x00d\x16\x96\x03\x00d\x00\t\x11msanwrit" + + "e\x00\x04\x16\x94\x03\x00d\x16\x96\x03\x00d\x00\v\xf4\x01\x02\v\x00\x01\x00\n$$\n" const unsafeimport = "" + - "package unsafe\n" + - "type @\"\".Pointer uintptr\n" + - "func @\"\".Offsetof (? any) (? uintptr)\n" + - "func @\"\".Sizeof (? any) (? uintptr)\n" + - "func @\"\".Alignof (? any) (? uintptr)\n" + - "\n" + - "$$\n" + "c\x00\x03v0\x01\vunsafe\x00\x05\r\rPointer\x00\x16\x00\t\x0fOffsetof\x00\x01:" + + "\x00\x01\x16\x00\t\vSizeof\x00\x01:\x00\x01\x16\x00\t\rAlignof\x00\x01:\x00\x01\x16\x00\v\b\x00\v\x00" + + "\x01\x00\n$$\n" diff --git a/src/cmd/compile/internal/gc/builtin/runtime.go b/src/cmd/compile/internal/gc/builtin/runtime.go index 584368a144..e9316cb313 100644 --- a/src/cmd/compile/internal/gc/builtin/runtime.go +++ b/src/cmd/compile/internal/gc/builtin/runtime.go @@ -89,10 +89,12 @@ func mapaccess1(mapType *byte, hmap map[any]any, key *any) (val *any) func mapaccess1_fast32(mapType *byte, hmap map[any]any, key any) (val *any) func mapaccess1_fast64(mapType *byte, hmap map[any]any, key any) (val *any) func mapaccess1_faststr(mapType *byte, hmap map[any]any, key any) (val *any) +func mapaccess1_fat(mapType *byte, hmap map[any]any, key *any, zero *byte) (val *any) func mapaccess2(mapType *byte, hmap map[any]any, key *any) (val *any, pres bool) func mapaccess2_fast32(mapType *byte, hmap map[any]any, key any) (val *any, pres bool) func mapaccess2_fast64(mapType *byte, hmap map[any]any, key any) (val *any, pres bool) func mapaccess2_faststr(mapType *byte, hmap map[any]any, key any) (val *any, pres bool) +func mapaccess2_fat(mapType *byte, hmap map[any]any, key *any, zero *byte) (val *any, pres bool) func mapassign1(mapType *byte, hmap map[any]any, key *any, val *any) func mapiterinit(mapType *byte, hmap map[any]any, hiter *any) func mapdelete(mapType *byte, hmap map[any]any, key *any) diff --git a/src/cmd/compile/internal/gc/cgen.go b/src/cmd/compile/internal/gc/cgen.go index c594ad4c11..fd57fbd4a7 100644 --- a/src/cmd/compile/internal/gc/cgen.go +++ b/src/cmd/compile/internal/gc/cgen.go @@ -7,6 +7,7 @@ package gc import ( "cmd/internal/obj" "cmd/internal/obj/ppc64" + "cmd/internal/sys" "fmt" ) @@ -88,7 +89,7 @@ func cgen_wb(n, res *Node, wb bool) { if !res.Addable { if n.Ullman > res.Ullman { - if Ctxt.Arch.Regsize == 4 && Is64(n.Type) { + if Ctxt.Arch.RegSize == 4 && Is64(n.Type) { var n1 Node Tempname(&n1, n.Type) Cgen(n, &n1) @@ -127,7 +128,7 @@ func cgen_wb(n, res *Node, wb bool) { f = false } - if !n.Type.IsComplex() && Ctxt.Arch.Regsize == 8 && !wb { + if !n.Type.IsComplex() && Ctxt.Arch.RegSize == 8 && !wb { a := Thearch.Optoas(OAS, res.Type) var addr obj.Addr if Thearch.Sudoaddable(a, res, &addr) { @@ -151,7 +152,7 @@ func cgen_wb(n, res *Node, wb bool) { } } - if Ctxt.Arch.Thechar == '8' { + if Ctxt.Arch.Family == sys.I386 { // no registers to speak of var n1, n2 Node Tempname(&n1, n.Type) @@ -203,7 +204,7 @@ func cgen_wb(n, res *Node, wb bool) { // Write barrier now handled. Code below this line can ignore wb. - if Ctxt.Arch.Thechar == '5' { // TODO(rsc): Maybe more often? + if Ctxt.Arch.Family == sys.ARM { // TODO(rsc): Maybe more often? // if both are addressable, move if n.Addable && res.Addable { if Is64(n.Type) || Is64(res.Type) || n.Op == OREGISTER || res.Op == OREGISTER || n.Type.IsComplex() || res.Type.IsComplex() { @@ -246,12 +247,12 @@ func cgen_wb(n, res *Node, wb bool) { return } - if (Ctxt.Arch.Thechar == '6' || Ctxt.Arch.Thechar == '8') && n.Addable { + if Ctxt.Arch.InFamily(sys.AMD64, sys.I386, sys.S390X) && n.Addable { Thearch.Gmove(n, res) return } - if Ctxt.Arch.Thechar == '0' || Ctxt.Arch.Thechar == '7' || Ctxt.Arch.Thechar == '9' { + if Ctxt.Arch.InFamily(sys.ARM64, sys.MIPS64, sys.PPC64) { // if both are addressable, move if n.Addable { if n.Op == OREGISTER || res.Op == OREGISTER { @@ -268,7 +269,7 @@ func cgen_wb(n, res *Node, wb bool) { } // if n is sudoaddable generate addr and move - if Ctxt.Arch.Thechar == '5' && !Is64(n.Type) && !Is64(res.Type) && !n.Type.IsComplex() && !res.Type.IsComplex() { + if Ctxt.Arch.Family == sys.ARM && !Is64(n.Type) && !Is64(res.Type) && !n.Type.IsComplex() && !res.Type.IsComplex() { a := Thearch.Optoas(OAS, n.Type) var addr obj.Addr if Thearch.Sudoaddable(a, n, &addr) { @@ -310,7 +311,7 @@ func cgen_wb(n, res *Node, wb bool) { } // 64-bit ops are hard on 32-bit machine. - if Ctxt.Arch.Regsize == 4 && (Is64(n.Type) || Is64(res.Type) || n.Left != nil && Is64(n.Left.Type)) { + if Ctxt.Arch.RegSize == 4 && (Is64(n.Type) || Is64(res.Type) || n.Left != nil && Is64(n.Left.Type)) { switch n.Op { // math goes to cgen64. case OMINUS, @@ -334,7 +335,7 @@ func cgen_wb(n, res *Node, wb bool) { return } - if !n.Type.IsComplex() && Ctxt.Arch.Regsize == 8 { + if !n.Type.IsComplex() && Ctxt.Arch.RegSize == 8 { a := Thearch.Optoas(OAS, n.Type) var addr obj.Addr if Thearch.Sudoaddable(a, n, &addr) { @@ -401,11 +402,11 @@ func cgen_wb(n, res *Node, wb bool) { Regalloc(&n1, nl.Type, res) Cgen(nl, &n1) - if Ctxt.Arch.Thechar == '5' { + if Ctxt.Arch.Family == sys.ARM { var n2 Node Nodconst(&n2, nl.Type, 0) Thearch.Gins(a, &n2, &n1) - } else if Ctxt.Arch.Thechar == '7' { + } else if Ctxt.Arch.Family == sys.ARM64 { Thearch.Gins(a, &n1, &n1) } else { Thearch.Gins(a, nil, &n1) @@ -452,7 +453,7 @@ func cgen_wb(n, res *Node, wb bool) { return } - if Ctxt.Arch.Thechar == '8' { + if Ctxt.Arch.Family == sys.I386 { var n1 Node var n2 Node Tempname(&n2, n.Type) @@ -465,7 +466,7 @@ func cgen_wb(n, res *Node, wb bool) { var n1 Node var n2 Node - if Ctxt.Arch.Thechar == '5' { + if Ctxt.Arch.Family == sys.ARM { if nl.Addable && !Is64(nl.Type) { Regalloc(&n1, nl.Type, res) Thearch.Gmove(nl, &n1) @@ -707,7 +708,7 @@ sbop: // symmetric binary abop: // asymmetric binary var n1 Node var n2 Node - if Ctxt.Arch.Thechar == '8' { + if Ctxt.Arch.Family == sys.I386 { // no registers, sigh if Smallintconst(nr) { var n1 Node @@ -751,14 +752,14 @@ abop: // asymmetric binary Regalloc(&n1, nl.Type, res) Cgen(nl, &n1) - if Smallintconst(nr) && Ctxt.Arch.Thechar != '0' && Ctxt.Arch.Thechar != '5' && Ctxt.Arch.Thechar != '7' && Ctxt.Arch.Thechar != '9' { // TODO(rsc): Check opcode for arm + if Smallintconst(nr) && Ctxt.Arch.Family != sys.MIPS64 && Ctxt.Arch.Family != sys.ARM && Ctxt.Arch.Family != sys.ARM64 && Ctxt.Arch.Family != sys.PPC64 { // TODO(rsc): Check opcode for arm n2 = *nr } else { Regalloc(&n2, nr.Type, nil) Cgen(nr, &n2) } } else { - if Smallintconst(nr) && Ctxt.Arch.Thechar != '0' && Ctxt.Arch.Thechar != '5' && Ctxt.Arch.Thechar != '7' && Ctxt.Arch.Thechar != '9' { // TODO(rsc): Check opcode for arm + if Smallintconst(nr) && Ctxt.Arch.Family != sys.MIPS64 && Ctxt.Arch.Family != sys.ARM && Ctxt.Arch.Family != sys.ARM64 && Ctxt.Arch.Family != sys.PPC64 { // TODO(rsc): Check opcode for arm n2 = *nr } else { Regalloc(&n2, nr.Type, res) @@ -876,8 +877,8 @@ func cgen_wbfat(n, res *Node) { // cgen_norm moves n1 to res, truncating to expected type if necessary. // n1 is a register, and cgen_norm frees it. func cgen_norm(n, n1, res *Node) { - switch Ctxt.Arch.Thechar { - case '6', '8': + switch Ctxt.Arch.Family { + case sys.AMD64, sys.I386: // We use sized math, so the result is already truncated. default: switch n.Op { @@ -945,7 +946,7 @@ func Cgenr(n *Node, a *Node, res *Node) { OCALLINTER: var n1 Node Igen(n, &n1, res) - Regalloc(a, Types[Tptr], &n1) + Regalloc(a, n.Type, &n1) Thearch.Gmove(&n1, a) Regfree(&n1) @@ -977,10 +978,14 @@ func Agenr(n *Node, a *Node, res *Node) { case OIND: Cgenr(n.Left, a, res) - Cgen_checknil(a) + if !n.Left.NonNil { + Cgen_checknil(a) + } else if Debug_checknil != 0 && n.Lineno > 1 { + Warnl(n.Lineno, "removed nil check") + } case OINDEX: - if Ctxt.Arch.Thechar == '5' { + if Ctxt.Arch.Family == sys.ARM { var p2 *obj.Prog // to be patched to panicindex. w := uint32(n.Type.Width) bounded := Debug['B'] != 0 || n.Bounded @@ -1127,7 +1132,7 @@ func Agenr(n *Node, a *Node, res *Node) { Regfree(&n2) break } - if Ctxt.Arch.Thechar == '8' { + if Ctxt.Arch.Family == sys.I386 { var p2 *obj.Prog // to be patched to panicindex. w := uint32(n.Type.Width) bounded := Debug['B'] != 0 || n.Bounded @@ -1586,7 +1591,11 @@ func Agen(n *Node, res *Node) { case OIND: Cgen(nl, res) - Cgen_checknil(res) + if !nl.NonNil { + Cgen_checknil(res) + } else if Debug_checknil != 0 && n.Lineno > 1 { + Warnl(n.Lineno, "removed nil check") + } case ODOT: Agen(nl, res) @@ -1596,7 +1605,11 @@ func Agen(n *Node, res *Node) { case ODOTPTR: Cgen(nl, res) - Cgen_checknil(res) + if !nl.NonNil { + Cgen_checknil(res) + } else if Debug_checknil != 0 && n.Lineno > 1 { + Warnl(n.Lineno, "removed nil check") + } if n.Xoffset != 0 { addOffset(res, n.Xoffset) } @@ -1604,7 +1617,7 @@ func Agen(n *Node, res *Node) { } func addOffset(res *Node, offset int64) { - if Ctxt.Arch.Thechar == '6' || Ctxt.Arch.Thechar == '8' { + if Ctxt.Arch.InFamily(sys.AMD64, sys.I386) { Thearch.Gins(Thearch.Optoas(OADD, Types[Tptr]), Nodintconst(offset), res) return } @@ -1657,7 +1670,11 @@ func Igen(n *Node, a *Node, res *Node) { case ODOTPTR: Cgenr(n.Left, a, res) - Cgen_checknil(a) + if !n.Left.NonNil { + Cgen_checknil(a) + } else if Debug_checknil != 0 && n.Lineno > 1 { + Warnl(n.Lineno, "removed nil check") + } a.Op = OINDREG a.Xoffset += n.Xoffset a.Type = n.Type @@ -1790,7 +1807,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { } if !n.Type.IsBoolean() { - Fatalf("bgen: bad type %v for %v", n.Type, Oconv(n.Op, 0)) + Fatalf("bgen: bad type %v for %v", n.Type, n.Op) } for n.Op == OCONVNOP { @@ -1825,13 +1842,14 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { return case ONAME: + // Some architectures might need a temporary or other help here, + // but they don't support direct generation of a bool value yet. + // We can fix that as we go. + mayNeedTemp := Ctxt.Arch.InFamily(sys.ARM, sys.ARM64, sys.MIPS64, sys.PPC64, sys.S390X) + if genval { - // 5g, 7g, and 9g might need a temporary or other help here, - // but they don't support direct generation of a bool value yet. - // We can fix that as we go. - switch Ctxt.Arch.Thechar { - case '0', '5', '7', '9': - Fatalf("genval 0g, 5g, 7g, 9g ONAMES not fully implemented") + if mayNeedTemp { + Fatalf("genval ONAMES not fully implemented") } Cgen(n, res) if !wantTrue { @@ -1840,7 +1858,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { return } - if n.Addable && Ctxt.Arch.Thechar != '0' && Ctxt.Arch.Thechar != '5' && Ctxt.Arch.Thechar != '7' && Ctxt.Arch.Thechar != '9' { + if n.Addable && !mayNeedTemp { // no need for a temporary bgenNonZero(n, nil, wantTrue, likely, to) return @@ -1977,7 +1995,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { return } - if Ctxt.Arch.Regsize == 4 && Is64(nr.Type) { + if Ctxt.Arch.RegSize == 4 && Is64(nr.Type) { if genval { // TODO: Teach Cmp64 to generate boolean values and remove this. bvgenjump(n, res, wantTrue, false) @@ -2015,7 +2033,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { Regfree(&n2) } else { var n1 Node - if !nl.Addable && Ctxt.Arch.Thechar == '8' { + if !nl.Addable && Ctxt.Arch.Family == sys.I386 { Tempname(&n1, nl.Type) } else { Regalloc(&n1, nl.Type, nil) @@ -2024,13 +2042,13 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { Cgen(nl, &n1) nl = &n1 - if Smallintconst(nr) && Ctxt.Arch.Thechar != '0' && Ctxt.Arch.Thechar != '9' { + if Smallintconst(nr) && Ctxt.Arch.Family != sys.MIPS64 && Ctxt.Arch.Family != sys.PPC64 { Thearch.Gins(Thearch.Optoas(OCMP, nr.Type), nl, nr) bins(nr.Type, res, op, likely, to) return } - if !nr.Addable && Ctxt.Arch.Thechar == '8' { + if !nr.Addable && Ctxt.Arch.Family == sys.I386 { nr = CgenTemp(nr) } @@ -2044,13 +2062,13 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { l, r := nl, nr // On x86, only < and <= work right with NaN; reverse if needed - if Ctxt.Arch.Thechar == '6' && nl.Type.IsFloat() && (op == OGT || op == OGE) { + if Ctxt.Arch.Family == sys.AMD64 && nl.Type.IsFloat() && (op == OGT || op == OGE) { l, r = r, l op = Brrev(op) } // MIPS does not have CMP instruction - if Ctxt.Arch.Thechar == '0' { + if Ctxt.Arch.Family == sys.MIPS64 { p := Thearch.Ginscmp(op, nr.Type, l, r, likely) Patch(p, to) return @@ -2062,8 +2080,8 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { // Handle floating point special cases. // Note that 8g has Bgen_float and is handled above. if nl.Type.IsFloat() { - switch Ctxt.Arch.Thechar { - case '5': + switch Ctxt.Arch.Family { + case sys.ARM: if genval { Fatalf("genval 5g Isfloat special cases not implemented") } @@ -2077,7 +2095,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { Patch(p, Pc) } return - case '6': + case sys.AMD64: switch n.Op { case OEQ: // neither NE nor P @@ -2111,7 +2129,7 @@ func bgenx(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { } return } - case '7', '9': + case sys.ARM64, sys.PPC64: if genval { Fatalf("genval 7g, 9g Isfloat special cases not implemented") } @@ -2143,7 +2161,7 @@ func bgenNonZero(n, res *Node, wantTrue bool, likely int, to *obj.Prog) { } // MIPS does not have CMP instruction - if Thearch.Thechar == '0' { + if Thearch.LinkArch.Family == sys.MIPS64 { p := Gbranch(Thearch.Optoas(op, n.Type), n.Type, likely) Naddr(&p.From, n) Patch(p, to) @@ -2352,7 +2370,7 @@ func Ginscall(f *Node, proc int) { // into the instruction stream. Thearch.Ginsnop() - if Thearch.Thechar == '9' { + if Thearch.LinkArch.Family == sys.PPC64 { // On ppc64, when compiling Go into position // independent code on ppc64le we insert an // instruction to reload the TOC pointer from the @@ -2361,7 +2379,7 @@ func Ginscall(f *Node, proc int) { // If the MOVD is not needed, insert a hardware NOP // so that the same number of instructions are used // on ppc64 in both shared and non-shared modes. - if Ctxt.Flag_shared != 0 { + if Ctxt.Flag_shared { p := Thearch.Gins(ppc64.AMOVD, nil, nil) p.From.Type = obj.TYPE_MEM p.From.Offset = 24 @@ -2436,7 +2454,7 @@ func Ginscall(f *Node, proc int) { func cgen_callinter(n *Node, res *Node, proc int) { i := n.Left if i.Op != ODOTINTER { - Fatalf("cgen_callinter: not ODOTINTER %v", Oconv(i.Op, 0)) + Fatalf("cgen_callinter: not ODOTINTER %v", i.Op) } i = i.Left // interface @@ -2620,24 +2638,70 @@ func cgen_ret(n *Node) { } } +// hasHMUL64 reports whether the architecture supports 64-bit +// signed and unsigned high multiplication (OHMUL). +func hasHMUL64() bool { + switch Ctxt.Arch.Family { + case sys.AMD64, sys.S390X, sys.ARM64: + return true + case sys.ARM, sys.I386, sys.MIPS64, sys.PPC64: + return false + } + Fatalf("unknown architecture") + return false +} + +// hasRROTC64 reports whether the architecture supports 64-bit +// rotate through carry instructions (ORROTC). +func hasRROTC64() bool { + switch Ctxt.Arch.Family { + case sys.AMD64: + return true + case sys.ARM, sys.ARM64, sys.I386, sys.MIPS64, sys.PPC64, sys.S390X: + return false + } + Fatalf("unknown architecture") + return false +} + +func hasRightShiftWithCarry() bool { + switch Ctxt.Arch.Family { + case sys.ARM64: + return true + case sys.AMD64, sys.ARM, sys.I386, sys.MIPS64, sys.PPC64, sys.S390X: + return false + } + Fatalf("unknown architecture") + return false +} + +func hasAddSetCarry() bool { + switch Ctxt.Arch.Family { + case sys.ARM64: + return true + case sys.AMD64, sys.ARM, sys.I386, sys.MIPS64, sys.PPC64, sys.S390X: + return false + } + Fatalf("unknown architecture") + return false +} + // generate division according to op, one of: // res = nl / nr // res = nl % nr func cgen_div(op Op, nl *Node, nr *Node, res *Node) { var w int - // TODO(rsc): arm64 needs to support the relevant instructions - // in peep and optoas in order to enable this. - // TODO(rsc): ppc64 needs to support the relevant instructions - // in peep and optoas in order to enable this. - if nr.Op != OLITERAL || Ctxt.Arch.Thechar == '0' || Ctxt.Arch.Thechar == '7' || Ctxt.Arch.Thechar == '9' { + // Architectures need to support 64-bit high multiplications + // (OHMUL) in order to perform divide by constant optimizations. + if nr.Op != OLITERAL || !hasHMUL64() { goto longdiv } w = int(nl.Type.Width * 8) // Front end handled 32-bit division. We only need to handle 64-bit. - // try to do division by multiply by (2^w)/d - // see hacker's delight chapter 10 + // Try to do division using multiplication: (2^w)/d. + // See Hacker's Delight, chapter 10. switch Simtype[nl.Type.Etype] { default: goto longdiv @@ -2650,6 +2714,18 @@ func cgen_div(op Op, nl *Node, nr *Node, res *Node) { if m.Bad != 0 { break } + + // In order to add the numerator we need to be able to + // avoid overflow. This is done by shifting the result of the + // addition right by 1 and inserting the carry bit into + // the MSB. For now this needs the RROTC instruction. + // TODO(mundaym): Hacker's Delight 2nd ed. chapter 10 proposes + // an alternative sequence of instructions for architectures + // (TODO: MIPS64, PPC64, S390X) that do not have a shift + // right with carry instruction. + if m.Ua != 0 && !hasRROTC64() && !hasRightShiftWithCarry() { + goto longdiv + } if op == OMOD { goto longmod } @@ -2663,13 +2739,21 @@ func cgen_div(op Op, nl *Node, nr *Node, res *Node) { Thearch.Cgen_hmul(&n1, &n2, &n3) if m.Ua != 0 { - // need to add numerator accounting for overflow - Thearch.Gins(Thearch.Optoas(OADD, nl.Type), &n1, &n3) + // Need to add numerator accounting for overflow. + if hasAddSetCarry() { + Thearch.AddSetCarry(&n1, &n3, &n3) + } else { + Thearch.Gins(Thearch.Optoas(OADD, nl.Type), &n1, &n3) + } - Nodconst(&n2, nl.Type, 1) - Thearch.Gins(Thearch.Optoas(ORROTC, nl.Type), &n2, &n3) - Nodconst(&n2, nl.Type, int64(m.S)-1) - Thearch.Gins(Thearch.Optoas(ORSH, nl.Type), &n2, &n3) + if !hasRROTC64() { + Thearch.RightShiftWithCarry(&n3, uint(m.S), &n3) + } else { + Nodconst(&n2, nl.Type, 1) + Thearch.Gins(Thearch.Optoas(ORROTC, nl.Type), &n2, &n3) + Nodconst(&n2, nl.Type, int64(m.S)-1) + Thearch.Gins(Thearch.Optoas(ORSH, nl.Type), &n2, &n3) + } } else { Nodconst(&n2, nl.Type, int64(m.S)) Thearch.Gins(Thearch.Optoas(ORSH, nl.Type), &n2, &n3) // shift dx @@ -2701,7 +2785,7 @@ func cgen_div(op Op, nl *Node, nr *Node, res *Node) { Thearch.Cgen_hmul(&n1, &n2, &n3) if m.Sm < 0 { - // need to add numerator + // Need to add numerator (cannot overflow). Thearch.Gins(Thearch.Optoas(OADD, nl.Type), &n1, &n3) } @@ -2714,8 +2798,8 @@ func cgen_div(op Op, nl *Node, nr *Node, res *Node) { Thearch.Gins(Thearch.Optoas(OSUB, nl.Type), &n1, &n3) // added if m.Sd < 0 { - // this could probably be removed - // by factoring it into the multiplier + // This could probably be removed by factoring it into + // the multiplier. Thearch.Gins(Thearch.Optoas(OMINUS, nl.Type), nil, &n3) } @@ -2727,14 +2811,14 @@ func cgen_div(op Op, nl *Node, nr *Node, res *Node) { goto longdiv - // division and mod using (slow) hardware instruction + // Division and mod using (slow) hardware instruction. longdiv: Thearch.Dodiv(op, nl, nr, res) return - // mod using formula A%B = A-(A/B*B) but - // we know that there is a fast algorithm for A/B + // Mod using formula A%B = A-(A/B*B) but + // we know that there is a fast algorithm for A/B. longmod: var n1 Node Regalloc(&n1, nl.Type, res) @@ -2744,11 +2828,6 @@ longmod: Regalloc(&n2, nl.Type, nil) cgen_div(ODIV, &n1, nr, &n2) a := Thearch.Optoas(OMUL, nl.Type) - if w == 8 { - // use 2-operand 16-bit multiply - // because there is no 2-operand 8-bit multiply - a = Thearch.Optoas(OMUL, Types[TINT16]) // XXX was IMULW - } if !Smallintconst(nr) { var n3 Node @@ -2844,7 +2923,7 @@ func cgen_append(n, res *Node) { arg.Addable = true arg.Xoffset = Ctxt.FixedFrameSize() arg.Type = Ptrto(Types[TUINT8]) - Cgen(typename(res.Type), &arg) + Cgen(typename(res.Type.Elem()), &arg) arg.Xoffset += int64(Widthptr) arg.Type = Types[Tptr] @@ -2995,7 +3074,7 @@ func cgen_slice(n, res *Node, wb bool) { regalloc := Regalloc ginscon := Thearch.Ginscon gins := Thearch.Gins - if Thearch.Thechar == '8' { + if Thearch.LinkArch.Family == sys.I386 { regalloc = func(n *Node, t *Type, reuse *Node) { Tempname(n, t) } @@ -3058,15 +3137,7 @@ func cgen_slice(n, res *Node, wb bool) { x.Xoffset -= 2 * int64(Widthptr) } - var x1, x2, x3 *Node // unevaluated index arguments - x1 = n.Right.Left - switch n.Op { - default: - x2 = n.Right.Right - case OSLICE3, OSLICE3ARR: - x2 = n.Right.Right.Left - x3 = n.Right.Right.Right - } + x1, x2, x3 := n.SliceBounds() // unevaluated index arguments // load computes src into targ, but if src refers to the len or cap of n.Left, // load copies those from xlen, xcap, loading xlen if needed. @@ -3238,7 +3309,7 @@ func cgen_slice(n, res *Node, wb bool) { compare := func(n1, n2 *Node) { // n1 might be a 64-bit constant, even on 32-bit architectures, // but it will be represented in 32 bits. - if Ctxt.Arch.Regsize == 4 && Is64(n1.Type) { + if Ctxt.Arch.RegSize == 4 && Is64(n1.Type) { if n1.Val().U.(*Mpint).CmpInt64(1<<31) >= 0 { Fatalf("missed slice out of bounds check") } diff --git a/src/cmd/compile/internal/gc/closure.go b/src/cmd/compile/internal/gc/closure.go index 80c8d309af..d2cb9ebf1e 100644 --- a/src/cmd/compile/internal/gc/closure.go +++ b/src/cmd/compile/internal/gc/closure.go @@ -194,7 +194,7 @@ func makeclosure(func_ *Node) *Node { xfunc.Nbody.Set(func_.Nbody.Slice()) xfunc.Func.Dcl = append(func_.Func.Dcl, xfunc.Func.Dcl...) func_.Func.Dcl = nil - if len(xfunc.Nbody.Slice()) == 0 { + if xfunc.Nbody.Len() == 0 { Fatalf("empty body - won't generate any code") } xfunc = typecheck(xfunc, Etop) @@ -419,7 +419,7 @@ func closuredebugruntimecheck(r *Node) { Warnl(r.Lineno, "stack closure, captured vars = %v", r.Func.Cvars) } } - if compiling_runtime > 0 && r.Esc == EscHeap { + if compiling_runtime && r.Esc == EscHeap { yyerrorl(r.Lineno, "heap-allocated closure, not allowed in runtime.") } } diff --git a/src/cmd/compile/internal/gc/const.go b/src/cmd/compile/internal/gc/const.go index 5c9a67c8b5..e0f5e977fe 100644 --- a/src/cmd/compile/internal/gc/const.go +++ b/src/cmd/compile/internal/gc/const.go @@ -10,6 +10,59 @@ import ( "strings" ) +// Ctype describes the constant kind of an "ideal" (untyped) constant. +type Ctype int8 + +const ( + CTxxx Ctype = iota + + CTINT + CTRUNE + CTFLT + CTCPLX + CTSTR + CTBOOL + CTNIL +) + +type Val struct { + // U contains one of: + // bool bool when n.ValCtype() == CTBOOL + // *Mpint int when n.ValCtype() == CTINT, rune when n.ValCtype() == CTRUNE + // *Mpflt float when n.ValCtype() == CTFLT + // *Mpcplx pair of floats when n.ValCtype() == CTCPLX + // string string when n.ValCtype() == CTSTR + // *Nilval when n.ValCtype() == CTNIL + U interface{} +} + +func (v Val) Ctype() Ctype { + switch x := v.U.(type) { + default: + Fatalf("unexpected Ctype for %T", v.U) + panic("not reached") + case nil: + return 0 + case *NilVal: + return CTNIL + case bool: + return CTBOOL + case *Mpint: + if x.Rune { + return CTRUNE + } + return CTINT + case *Mpflt: + return CTFLT + case *Mpcplx: + return CTCPLX + case string: + return CTSTR + } +} + +type NilVal struct{} + // IntLiteral returns the Node's literal value as an integer. func (n *Node) IntLiteral() (x int64, ok bool) { switch { @@ -173,16 +226,13 @@ func convlit1(n *Node, t *Type, explicit bool, reuse canReuseNode) *Node { case OCOMPLEX: if n.Type.Etype == TIDEAL { switch t.Etype { - // If trying to convert to non-complex type, - // leave as complex128 and let typechecker complain. default: + // If trying to convert to non-complex type, + // leave as complex128 and let typechecker complain. t = Types[TCOMPLEX128] fallthrough - - //fallthrough case TCOMPLEX128: n.Type = t - n.Left = convlit(n.Left, Types[TFLOAT64]) n.Right = convlit(n.Right, Types[TFLOAT64]) @@ -231,9 +281,7 @@ func convlit1(n *Node, t *Type, explicit bool, reuse canReuseNode) *Node { return n case TARRAY: - if !t.IsSlice() { - goto bad - } + goto bad case TPTR32, TPTR64, @@ -241,6 +289,7 @@ func convlit1(n *Node, t *Type, explicit bool, reuse canReuseNode) *Node { TMAP, TCHAN, TFUNC, + TSLICE, TUNSAFEPTR: break @@ -326,22 +375,22 @@ bad: } func copyval(v Val) Val { - switch v.Ctype() { - case CTINT, CTRUNE: + switch u := v.U.(type) { + case *Mpint: i := new(Mpint) - i.Set(v.U.(*Mpint)) - i.Rune = v.U.(*Mpint).Rune + i.Set(u) + i.Rune = u.Rune v.U = i - case CTFLT: + case *Mpflt: f := newMpflt() - f.Set(v.U.(*Mpflt)) + f.Set(u) v.U = f - case CTCPLX: + case *Mpcplx: c := new(Mpcplx) - c.Real.Set(&v.U.(*Mpcplx).Real) - c.Imag.Set(&v.U.(*Mpcplx).Imag) + c.Real.Set(&u.Real) + c.Imag.Set(&u.Imag) v.U = c } @@ -349,16 +398,16 @@ func copyval(v Val) Val { } func tocplx(v Val) Val { - switch v.Ctype() { - case CTINT, CTRUNE: + switch u := v.U.(type) { + case *Mpint: c := new(Mpcplx) - c.Real.SetInt(v.U.(*Mpint)) + c.Real.SetInt(u) c.Imag.SetFloat64(0.0) v.U = c - case CTFLT: + case *Mpflt: c := new(Mpcplx) - c.Real.Set(v.U.(*Mpflt)) + c.Real.Set(u) c.Imag.SetFloat64(0.0) v.U = c } @@ -367,17 +416,17 @@ func tocplx(v Val) Val { } func toflt(v Val) Val { - switch v.Ctype() { - case CTINT, CTRUNE: + switch u := v.U.(type) { + case *Mpint: f := newMpflt() - f.SetInt(v.U.(*Mpint)) + f.SetInt(u) v.U = f - case CTCPLX: + case *Mpcplx: f := newMpflt() - f.Set(&v.U.(*Mpcplx).Real) - if v.U.(*Mpcplx).Imag.CmpFloat64(0) != 0 { - Yyerror("constant %v%vi truncated to real", Fconv(&v.U.(*Mpcplx).Real, FmtSharp), Fconv(&v.U.(*Mpcplx).Imag, FmtSharp|FmtSign)) + f.Set(&u.Real) + if u.Imag.CmpFloat64(0) != 0 { + Yyerror("constant %v%vi truncated to real", Fconv(&u.Real, FmtSharp), Fconv(&u.Imag, FmtSharp|FmtSign)) } v.U = f } @@ -386,31 +435,33 @@ func toflt(v Val) Val { } func toint(v Val) Val { - switch v.Ctype() { - case CTRUNE: - i := new(Mpint) - i.Set(v.U.(*Mpint)) - v.U = i + switch u := v.U.(type) { + case *Mpint: + if u.Rune { + i := new(Mpint) + i.Set(u) + v.U = i + } - case CTFLT: + case *Mpflt: i := new(Mpint) - if f := v.U.(*Mpflt); i.SetFloat(f) < 0 { + if i.SetFloat(u) < 0 { msg := "constant %v truncated to integer" // provide better error message if SetFloat failed because f was too large - if f.Val.IsInt() { + if u.Val.IsInt() { msg = "constant %v overflows integer" } - Yyerror(msg, Fconv(f, FmtSharp)) + Yyerror(msg, Fconv(u, FmtSharp)) } v.U = i - case CTCPLX: + case *Mpcplx: i := new(Mpint) - if i.SetFloat(&v.U.(*Mpcplx).Real) < 0 { - Yyerror("constant %v%vi truncated to integer", Fconv(&v.U.(*Mpcplx).Real, FmtSharp), Fconv(&v.U.(*Mpcplx).Imag, FmtSharp|FmtSign)) + if i.SetFloat(&u.Real) < 0 { + Yyerror("constant %v%vi truncated to integer", Fconv(&u.Real, FmtSharp), Fconv(&u.Imag, FmtSharp|FmtSign)) } - if v.U.(*Mpcplx).Imag.CmpFloat64(0) != 0 { - Yyerror("constant %v%vi truncated to real", Fconv(&v.U.(*Mpcplx).Real, FmtSharp), Fconv(&v.U.(*Mpcplx).Imag, FmtSharp|FmtSign)) + if u.Imag.CmpFloat64(0) != 0 { + Yyerror("constant %v%vi truncated to real", Fconv(&u.Real, FmtSharp), Fconv(&u.Imag, FmtSharp|FmtSign)) } v.U = i } @@ -419,30 +470,25 @@ func toint(v Val) Val { } func doesoverflow(v Val, t *Type) bool { - switch v.Ctype() { - case CTINT, CTRUNE: + switch u := v.U.(type) { + case *Mpint: if !t.IsInteger() { Fatalf("overflow: %v integer constant", t) } - if v.U.(*Mpint).Cmp(Minintval[t.Etype]) < 0 || v.U.(*Mpint).Cmp(Maxintval[t.Etype]) > 0 { - return true - } + return u.Cmp(Minintval[t.Etype]) < 0 || u.Cmp(Maxintval[t.Etype]) > 0 - case CTFLT: + case *Mpflt: if !t.IsFloat() { Fatalf("overflow: %v floating-point constant", t) } - if v.U.(*Mpflt).Cmp(minfltval[t.Etype]) <= 0 || v.U.(*Mpflt).Cmp(maxfltval[t.Etype]) >= 0 { - return true - } + return u.Cmp(minfltval[t.Etype]) <= 0 || u.Cmp(maxfltval[t.Etype]) >= 0 - case CTCPLX: + case *Mpcplx: if !t.IsComplex() { Fatalf("overflow: %v complex constant", t) } - if v.U.(*Mpcplx).Real.Cmp(minfltval[t.Etype]) <= 0 || v.U.(*Mpcplx).Real.Cmp(maxfltval[t.Etype]) >= 0 || v.U.(*Mpcplx).Imag.Cmp(minfltval[t.Etype]) <= 0 || v.U.(*Mpcplx).Imag.Cmp(maxfltval[t.Etype]) >= 0 { - return true - } + return u.Real.Cmp(minfltval[t.Etype]) <= 0 || u.Real.Cmp(maxfltval[t.Etype]) >= 0 || + u.Imag.Cmp(minfltval[t.Etype]) <= 0 || u.Imag.Cmp(maxfltval[t.Etype]) >= 0 } return false @@ -466,21 +512,16 @@ func overflow(v Val, t *Type) { } func tostr(v Val) Val { - switch v.Ctype() { - case CTINT, CTRUNE: + switch u := v.U.(type) { + case *Mpint: var i int64 = 0xFFFD - if u := v.U.(*Mpint); u.Cmp(Minintval[TUINT32]) >= 0 && u.Cmp(Maxintval[TUINT32]) <= 0 { + if u.Cmp(Minintval[TUINT32]) >= 0 && u.Cmp(Maxintval[TUINT32]) <= 0 { i = u.Int64() } - v = Val{} v.U = string(i) - case CTFLT: - Yyerror("no float -> string") - fallthrough - - case CTNIL: - v = Val{} + case *NilVal: + // Can happen because of string([]byte(nil)). v.U = "" } @@ -654,7 +695,7 @@ func evconst(n *Node) { switch uint32(n.Op)<<16 | uint32(v.Ctype()) { default: if n.Diag == 0 { - Yyerror("illegal constant expression %v %v", Oconv(n.Op, 0), nl.Type) + Yyerror("illegal constant expression %v %v", n.Op, nl.Type) n.Diag = 1 } return @@ -667,8 +708,6 @@ func evconst(n *Node) { break } fallthrough - - // fall through case OCONV_ | CTINT_, OCONV_ | CTRUNE_, OCONV_ | CTFLT_, @@ -1140,7 +1179,7 @@ setfalse: illegal: if n.Diag == 0 { - Yyerror("illegal constant expression: %v %v %v", nl.Type, Oconv(n.Op, 0), nr.Type) + Yyerror("illegal constant expression: %v %v %v", nl.Type, n.Op, nr.Type) n.Diag = 1 } } diff --git a/src/cmd/compile/internal/gc/cplx.go b/src/cmd/compile/internal/gc/cplx.go index b0fa70b0ad..9bb2027520 100644 --- a/src/cmd/compile/internal/gc/cplx.go +++ b/src/cmd/compile/internal/gc/cplx.go @@ -89,8 +89,9 @@ func subnode(nr *Node, ni *Node, nc *Node) { t := Types[tc] if nc.Op == OLITERAL { - nodfconst(nr, t, &nc.Val().U.(*Mpcplx).Real) - nodfconst(ni, t, &nc.Val().U.(*Mpcplx).Imag) + u := nc.Val().U.(*Mpcplx) + nodfconst(nr, t, &u.Real) + nodfconst(ni, t, &u.Imag) return } @@ -398,7 +399,7 @@ func Complexgen(n *Node, res *Node) { switch n.Op { default: Dump("complexgen: unknown op", n) - Fatalf("complexgen: unknown op %v", Oconv(n.Op, 0)) + Fatalf("complexgen: unknown op %v", n.Op) case ODOT, ODOTPTR, @@ -457,7 +458,7 @@ func Complexgen(n *Node, res *Node) { switch n.Op { default: - Fatalf("complexgen: unknown op %v", Oconv(n.Op, 0)) + Fatalf("complexgen: unknown op %v", n.Op) case OCONV: Complexmove(nl, res) diff --git a/src/cmd/compile/internal/gc/dcl.go b/src/cmd/compile/internal/gc/dcl.go index bd5a1f6f07..6d46d9a73c 100644 --- a/src/cmd/compile/internal/gc/dcl.go +++ b/src/cmd/compile/internal/gc/dcl.go @@ -11,21 +11,29 @@ import ( "strings" ) -func dflag() bool { - if Debug['d'] == 0 { - return false - } - if Debug['y'] != 0 { - return true - } - if incannedimport != 0 { - return false - } - return true -} +// Declaration stack & operations + +var externdcl []*Node -// declaration stack & operations -func dcopy(a *Sym, b *Sym) { +var blockgen int32 // max block number + +var block int32 // current block number + +// dclstack maintains a stack of shadowed symbol declarations so that +// popdcl can restore their declarations when a block scope ends. +// The stack is maintained as a linked list, using Sym's Link field. +// +// In practice, the "stack" actually ends up forming a tree: goto and label +// statements record the current state of dclstack so that checkgoto can +// validate that a goto statement does not jump over any declarations or +// into a new block scope. +// +// Finally, the Syms in this list are not "real" Syms as they don't actually +// represent object names. Sym is just a convenient type for saving shadowed +// Sym definitions, and only a subset of its fields are actually used. +var dclstack *Sym + +func dcopy(a, b *Sym) { a.Pkg = b.Pkg a.Name = b.Name a.Def = b.Def @@ -41,15 +49,16 @@ func push() *Sym { return d } +// pushdcl pushes the current declaration for symbol s (if any) so that +// it can be shadowed by a new declaration within a nested block scope. func pushdcl(s *Sym) *Sym { d := push() dcopy(d, s) - if dflag() { - fmt.Printf("\t%v push %v %p\n", linestr(lineno), s, s.Def) - } return d } +// popdcl pops the innermost block scope and restores all symbol declarations +// to their previous state. func popdcl() { d := dclstack for ; d != nil && d.Name != ""; d = d.Link { @@ -57,9 +66,6 @@ func popdcl() { lno := s.Lastlineno dcopy(s, d) d.Lastlineno = lno - if dflag() { - fmt.Printf("\t%v pop %v %p\n", linestr(lineno), s, s.Def) - } } if d == nil { @@ -70,6 +76,7 @@ func popdcl() { block = d.Block } +// markdcl records the start of a new block scope for declarations. func markdcl() { d := push() d.Name = "" // used as a mark in fifo @@ -104,6 +111,7 @@ func testdclstack() { } } +// redeclare emits a diagnostic about symbol s being redeclared somewhere. func redeclare(s *Sym, where string) { if s.Lastlineno == 0 { var tmp string @@ -137,6 +145,8 @@ var vargen int var declare_typegen int +// declare records that Node n declares symbol n.Sym in the specified +// declaration context. func declare(n *Node, ctxt Class) { if ctxt == PDISCARD { return @@ -165,9 +175,6 @@ func declare(n *Node, ctxt Class) { gen := 0 if ctxt == PEXTERN { externdcl = append(externdcl, n) - if dflag() { - fmt.Printf("\t%v global decl %v %p\n", linestr(lineno), s, n) - } } else { if Curfn == nil && ctxt == PAUTO { Fatalf("automatic outside function") @@ -318,8 +325,7 @@ func constiter(vl []*Node, t *Node, cl []*Node) []*Node { return vv } -// this generates a new name node, -// typically for labels or other one-off names. +// newname returns a new ONAME Node associated with symbol s. func newname(s *Sym) *Node { if s == nil { Fatalf("newname nil") @@ -364,17 +370,14 @@ func typenod(t *Type) *Node { return t.Nod } -// this will return an old name -// that has already been pushed on the -// declaration list. a diagnostic is -// generated if no name has been defined. +// oldname returns the Node that declares symbol s in the current scope. +// If no such Node currently exists, an ONONAME Node is returned instead. func oldname(s *Sym) *Node { n := s.Def if n == nil { - // maybe a top-level name will come along - // to give this a definition later. - // walkdef will check s->def again once - // all the input source has been processed. + // Maybe a top-level declaration will come along later to + // define s. resolve will check s.Def again once all input + // source has been processed. n = newname(s) n.Op = ONONAME n.Name.Iota = iota_ // save current iota value in const declarations @@ -548,7 +551,7 @@ func funchdr(n *Node) { func funcargs(nt *Node) { if nt.Op != OTFUNC { - Fatalf("funcargs %v", Oconv(nt.Op, 0)) + Fatalf("funcargs %v", nt.Op) } // re-start the variable generation number @@ -562,7 +565,7 @@ func funcargs(nt *Node) { if nt.Left != nil { n := nt.Left if n.Op != ODCLFIELD { - Fatalf("funcargs receiver %v", Oconv(n.Op, 0)) + Fatalf("funcargs receiver %v", n.Op) } if n.Left != nil { n.Left.Op = ONAME @@ -577,7 +580,7 @@ func funcargs(nt *Node) { for _, n := range nt.List.Slice() { if n.Op != ODCLFIELD { - Fatalf("funcargs in %v", Oconv(n.Op, 0)) + Fatalf("funcargs in %v", n.Op) } if n.Left != nil { n.Left.Op = ONAME @@ -595,7 +598,7 @@ func funcargs(nt *Node) { var i int = 0 for _, n := range nt.Rlist.Slice() { if n.Op != ODCLFIELD { - Fatalf("funcargs out %v", Oconv(n.Op, 0)) + Fatalf("funcargs out %v", n.Op) } if n.Left == nil { @@ -716,10 +719,10 @@ func checkembeddedtype(t *Type) { } } - if t.IsPtr() { + if t.IsPtr() || t.IsUnsafePtr() { Yyerror("embedded type cannot be a pointer") - } else if t.Etype == TFORW && t.Embedlineno == 0 { - t.Embedlineno = lineno + } else if t.Etype == TFORW && t.ForwardType().Embedlineno == 0 { + t.ForwardType().Embedlineno = lineno } } @@ -752,17 +755,13 @@ func structfield(n *Node) *Field { f.Broke = true } - switch n.Val().Ctype() { - case CTSTR: - f.Note = new(string) - *f.Note = n.Val().U.(string) - + switch u := n.Val().U.(type) { + case string: + f.Note = u default: Yyerror("field annotation must be string") - fallthrough - - case CTxxx: - f.Note = nil + case nil: + // noop } if n.Left != nil && n.Left.Op == ONAME { @@ -830,7 +829,7 @@ func tostruct0(t *Type, l []*Node) { func tofunargs(l []*Node) *Type { t := typ(TSTRUCT) - t.Funarg = true + t.StructType().Funarg = true fields := make([]*Field, len(l)) for i, n := range l { @@ -1036,11 +1035,11 @@ func functype0(t *Type, this *Node, in, out []*Node) { t.Broke = true } - t.Outnamed = false + t.FuncType().Outnamed = false if len(out) > 0 && out[0].Left != nil && out[0].Left.Orig != nil { s := out[0].Left.Orig.Sym if s != nil && (s.Name[0] != '~' || s.Name[1] != 'r') { // ~r%d is the name invented for an unnamed result - t.Outnamed = true + t.FuncType().Outnamed = true } } } @@ -1305,7 +1304,7 @@ func makefuncsym(s *Sym) { if isblanksym(s) { return } - if compiling_runtime != 0 && s.Name == "getg" { + if compiling_runtime && s.Name == "getg" { // runtime.getg() is not a real function and so does // not get a funcsym. return @@ -1415,7 +1414,7 @@ func (c *nowritebarrierrecChecker) visitcall(n *Node) { if fn == nil || fn.Op != ONAME || fn.Class != PFUNC || fn.Name.Defn == nil { return } - if (compiling_runtime != 0 || fn.Sym.Pkg == Runtimepkg) && fn.Sym.Name == "allocm" { + if (compiling_runtime || fn.Sym.Pkg == Runtimepkg) && fn.Sym.Name == "allocm" { return } defn := fn.Name.Defn diff --git a/src/cmd/compile/internal/gc/esc.go b/src/cmd/compile/internal/gc/esc.go index 9b8f134178..52c09e47f9 100644 --- a/src/cmd/compile/internal/gc/esc.go +++ b/src/cmd/compile/internal/gc/esc.go @@ -522,7 +522,7 @@ func escfunc(e *EscState, func_ *Node) { if ln.Type != nil && !haspointers(ln.Type) { break } - if len(Curfn.Nbody.Slice()) == 0 && !Curfn.Noescape { + if Curfn.Nbody.Len() == 0 && !Curfn.Noescape { ln.Esc = EscHeap } else { ln.Esc = EscNone // prime for escflood later @@ -998,8 +998,8 @@ func escassign(e *EscState, dst, src *Node, step *EscStep) { if Debug['m'] > 2 { fmt.Printf("%v:[%d] %v escassign: %v(%v)[%v] = %v(%v)[%v]\n", linestr(lineno), e.loopdepth, funcSym(Curfn), - Nconv(dst, FmtShort), Jconv(dst, FmtShort), Oconv(dst.Op, 0), - Nconv(src, FmtShort), Jconv(src, FmtShort), Oconv(src.Op, 0)) + Nconv(dst, FmtShort), Jconv(dst, FmtShort), dst.Op, + Nconv(src, FmtShort), Jconv(src, FmtShort), src.Op) } setlineno(dst) @@ -1181,7 +1181,7 @@ func escassign(e *EscState, dst, src *Node, step *EscStep) { var tags [1 << (bitsPerOutputInTag + EscReturnBits)]string // mktag returns the string representation for an escape analysis tag. -func mktag(mask int) *string { +func mktag(mask int) string { switch mask & EscMask { case EscNone, EscReturn: break @@ -1191,22 +1191,22 @@ func mktag(mask int) *string { } if mask < len(tags) && tags[mask] != "" { - return &tags[mask] + return tags[mask] } s := fmt.Sprintf("esc:0x%x", mask) if mask < len(tags) { tags[mask] = s } - return &s + return s } // parsetag decodes an escape analysis tag and returns the esc value. -func parsetag(note *string) uint16 { - if note == nil || !strings.HasPrefix(*note, "esc:") { +func parsetag(note string) uint16 { + if !strings.HasPrefix(note, "esc:") { return EscUnknown } - n, _ := strconv.ParseInt((*note)[4:], 0, 0) + n, _ := strconv.ParseInt(note[4:], 0, 0) em := uint16(n) if em == 0 { return EscNone @@ -1268,7 +1268,7 @@ func describeEscape(em uint16) string { // escassignfromtag models the input-to-output assignment flow of one of a function // calls arguments, where the flow is encoded in "note". -func escassignfromtag(e *EscState, note *string, dsts Nodes, src *Node) uint16 { +func escassignfromtag(e *EscState, note string, dsts Nodes, src *Node) uint16 { em := parsetag(note) if src.Op == OLITERAL { return em @@ -1435,7 +1435,7 @@ func esccall(e *EscState, n *Node, up *Node) { ll := n.List if n.List.Len() == 1 { a := n.List.First() - if a.Type.IsStruct() && a.Type.Funarg { // f(g()). + if a.Type.IsFuncArgStruct() { // f(g()) ll = e.nodeEscState(a).Escretval } } @@ -1469,7 +1469,7 @@ func esccall(e *EscState, n *Node, up *Node) { nE := e.nodeEscState(n) if fn != nil && fn.Op == ONAME && fn.Class == PFUNC && - fn.Name.Defn != nil && len(fn.Name.Defn.Nbody.Slice()) != 0 && fn.Name.Param.Ntype != nil && fn.Name.Defn.Esc < EscFuncTagged { + fn.Name.Defn != nil && fn.Name.Defn.Nbody.Len() != 0 && fn.Name.Param.Ntype != nil && fn.Name.Defn.Esc < EscFuncTagged { if Debug['m'] > 3 { fmt.Printf("%v::esccall:: %v in recursive group\n", linestr(lineno), Nconv(n, FmtShort)) } @@ -1741,7 +1741,7 @@ func escwalkBody(e *EscState, level Level, dst *Node, src *Node, step *EscStep, if Debug['m'] > 2 { fmt.Printf("escwalk: level:%d depth:%d %.*s op=%v %v(%v) scope:%v[%d] extraloopdepth=%v\n", - level, e.pdepth, e.pdepth, "\t\t\t\t\t\t\t\t\t\t", Oconv(src.Op, 0), Nconv(src, FmtShort), Jconv(src, FmtShort), e.curfnSym(src), srcE.Escloopdepth, extraloopdepth) + level, e.pdepth, e.pdepth, "\t\t\t\t\t\t\t\t\t\t", src.Op, Nconv(src, FmtShort), Jconv(src, FmtShort), e.curfnSym(src), srcE.Escloopdepth, extraloopdepth) } e.pdepth++ @@ -1969,7 +1969,7 @@ func esctag(e *EscState, func_ *Node) { // External functions are assumed unsafe, // unless //go:noescape is given before the declaration. - if len(func_.Nbody.Slice()) == 0 { + if func_.Nbody.Len() == 0 { if func_.Noescape { for _, t := range func_.Type.Params().Fields().Slice() { if haspointers(t.Type) { @@ -1997,7 +1997,7 @@ func esctag(e *EscState, func_ *Node) { } Warnl(func_.Lineno, "%v assuming %v is unsafe uintptr", funcSym(func_), name) } - t.Note = &unsafeUintptrTag + t.Note = unsafeUintptrTag } } diff --git a/src/cmd/compile/internal/gc/export.go b/src/cmd/compile/internal/gc/export.go index 9fc6e56275..4b48c53b91 100644 --- a/src/cmd/compile/internal/gc/export.go +++ b/src/cmd/compile/internal/gc/export.go @@ -7,7 +7,7 @@ package gc import ( "bufio" "bytes" - "cmd/internal/obj" + "cmd/internal/bio" "fmt" "sort" "unicode" @@ -15,8 +15,8 @@ import ( ) var ( - newexport int // if set, use new export format - Debug_export int // if set, print debugging information about export data + newexport bool // if set, use new export format + Debug_export int // if set, print debugging information about export data exportsize int ) @@ -203,7 +203,7 @@ func reexportdep(n *Node) { t := n.Type switch t.Etype { - case TARRAY, TCHAN, TPTR32, TPTR64: + case TARRAY, TCHAN, TPTR32, TPTR64, TSLICE: if t.Sym == nil { t = t.Elem() } @@ -252,7 +252,7 @@ func dumpexportvar(s *Sym) { dumpexporttype(t) if t.Etype == TFUNC && n.Class == PFUNC { - if n.Func != nil && len(n.Func.Inl.Slice()) != 0 { + if n.Func != nil && n.Func.Inl.Len() != 0 { // when lazily typechecking inlined bodies, some re-exported ones may not have been typechecked yet. // currently that can leave unresolved ONONAMEs in import-dot-ed packages in the wrong package if Debug['l'] < 2 { @@ -303,7 +303,7 @@ func dumpexporttype(t *Type) { case TMAP: dumpexporttype(t.Val()) dumpexporttype(t.Key()) - case TARRAY, TCHAN, TPTR32, TPTR64: + case TARRAY, TCHAN, TPTR32, TPTR64, TSLICE: dumpexporttype(t.Elem()) } @@ -323,7 +323,7 @@ func dumpexporttype(t *Type) { if f.Nointerface { exportf("\t//go:nointerface\n") } - if f.Type.Nname() != nil && len(f.Type.Nname().Func.Inl.Slice()) != 0 { // nname was set by caninl + if f.Type.Nname() != nil && f.Type.Nname().Func.Inl.Len() != 0 { // nname was set by caninl // when lazily typechecking inlined bodies, some re-exported ones may not have been typechecked yet. // currently that can leave unresolved ONONAMEs in import-dot-ed packages in the wrong package @@ -354,7 +354,7 @@ func dumpsym(s *Sym) { switch s.Def.Op { default: - Yyerror("unexpected export symbol: %v %v", Oconv(s.Def.Op, 0), s) + Yyerror("unexpected export symbol: %v %v", s.Def.Op, s) case OLITERAL: dumpexportconst(s) @@ -377,15 +377,15 @@ func dumpexport() { } size := 0 // size of export section without enclosing markers - if forceNewExport || newexport != 0 { + if newexport { // binary export // The linker also looks for the $$ marker - use char after $$ to distinguish format. exportf("\n$$B\n") // indicate binary format if debugFormat { // save a copy of the export data var copy bytes.Buffer - bcopy := obj.Binitw(©) - size = Export(bcopy, Debug_export != 0) + bcopy := bufio.NewWriter(©) + size = export(bcopy, Debug_export != 0) bcopy.Flush() // flushing to bytes.Buffer cannot fail if n, err := bout.Write(copy.Bytes()); n != size || err != nil { Fatalf("error writing export data: got %d bytes, want %d bytes, err = %v", n, size, err) @@ -407,7 +407,7 @@ func dumpexport() { pkgs = savedPkgs pkgMap = savedPkgMap } else { - size = Export(bout, Debug_export != 0) + size = export(bout.Writer, Debug_export != 0) } exportf("\n$$\n") } else { @@ -417,7 +417,7 @@ func dumpexport() { exportf("\n$$\n") // indicate textual format exportsize = 0 exportf("package %s", localpkg.Name) - if safemode != 0 { + if safemode { exportf(" safe") } exportf("\n") @@ -577,7 +577,7 @@ func importtype(pt *Type, t *Type) { } func dumpasmhdr() { - b, err := obj.Bopenw(asmhdr) + b, err := bio.Create(asmhdr) if err != nil { Fatalf("%v", err) } @@ -592,7 +592,7 @@ func dumpasmhdr() { case OTYPE: t := n.Type - if !t.IsStruct() || t.Map != nil || t.Funarg { + if !t.IsStruct() || t.StructType().Map != nil || t.IsFuncArgStruct() { break } fmt.Fprintf(b, "#define %s__size %d\n", t.Sym.Name, int(t.Width)) @@ -604,5 +604,5 @@ func dumpasmhdr() { } } - obj.Bterm(b) + b.Close() } diff --git a/src/cmd/compile/internal/gc/fmt.go b/src/cmd/compile/internal/gc/fmt.go index ab9bad3c2a..2c3afb0ecc 100644 --- a/src/cmd/compile/internal/gc/fmt.go +++ b/src/cmd/compile/internal/gc/fmt.go @@ -193,7 +193,7 @@ var goopnames = []string{ } // Fmt "%O": Node opcodes -func Oconv(o Op, flag FmtFlag) string { +func oconv(o Op, flag FmtFlag) string { if (flag&FmtSharp != 0) || fmtmode != FDbg { if o >= 0 && int(o) < len(goopnames) && goopnames[o] != "" { return goopnames[o] @@ -319,6 +319,12 @@ func Jconv(n *Node, flag FmtFlag) string { if n.Assigned { buf.WriteString(" assigned") } + if n.Bounded { + buf.WriteString(" bounded") + } + if n.NonNil { + buf.WriteString(" nonnil") + } if c == 0 && n.Used { fmt.Fprintf(&buf, " used(%v)", n.Used) @@ -328,16 +334,17 @@ func Jconv(n *Node, flag FmtFlag) string { // Fmt "%V": Values func Vconv(v Val, flag FmtFlag) string { - switch v.Ctype() { - case CTINT: - if (flag&FmtSharp != 0) || fmtmode == FExp { - return Bconv(v.U.(*Mpint), FmtSharp) + switch u := v.U.(type) { + case *Mpint: + if !u.Rune { + if (flag&FmtSharp != 0) || fmtmode == FExp { + return Bconv(u, FmtSharp) + } + return Bconv(u, 0) } - return Bconv(v.U.(*Mpint), 0) - case CTRUNE: - x := v.U.(*Mpint).Int64() - if ' ' <= x && x < 0x80 && x != '\\' && x != '\'' { + x := u.Int64() + if ' ' <= x && x < utf8.RuneSelf && x != '\\' && x != '\'' { return fmt.Sprintf("'%c'", int(x)) } if 0 <= x && x < 1<<16 { @@ -346,39 +353,39 @@ func Vconv(v Val, flag FmtFlag) string { if 0 <= x && x <= utf8.MaxRune { return fmt.Sprintf("'\\U%08x'", uint64(x)) } - return fmt.Sprintf("('\\x00' + %v)", v.U.(*Mpint)) + return fmt.Sprintf("('\\x00' + %v)", u) - case CTFLT: + case *Mpflt: if (flag&FmtSharp != 0) || fmtmode == FExp { - return Fconv(v.U.(*Mpflt), 0) + return Fconv(u, 0) } - return Fconv(v.U.(*Mpflt), FmtSharp) + return Fconv(u, FmtSharp) - case CTCPLX: + case *Mpcplx: if (flag&FmtSharp != 0) || fmtmode == FExp { - return fmt.Sprintf("(%v+%vi)", &v.U.(*Mpcplx).Real, &v.U.(*Mpcplx).Imag) + return fmt.Sprintf("(%v+%vi)", &u.Real, &u.Imag) } if v.U.(*Mpcplx).Real.CmpFloat64(0) == 0 { - return fmt.Sprintf("%vi", Fconv(&v.U.(*Mpcplx).Imag, FmtSharp)) + return fmt.Sprintf("%vi", Fconv(&u.Imag, FmtSharp)) } if v.U.(*Mpcplx).Imag.CmpFloat64(0) == 0 { - return Fconv(&v.U.(*Mpcplx).Real, FmtSharp) + return Fconv(&u.Real, FmtSharp) } if v.U.(*Mpcplx).Imag.CmpFloat64(0) < 0 { - return fmt.Sprintf("(%v%vi)", Fconv(&v.U.(*Mpcplx).Real, FmtSharp), Fconv(&v.U.(*Mpcplx).Imag, FmtSharp)) + return fmt.Sprintf("(%v%vi)", Fconv(&u.Real, FmtSharp), Fconv(&u.Imag, FmtSharp)) } - return fmt.Sprintf("(%v+%vi)", Fconv(&v.U.(*Mpcplx).Real, FmtSharp), Fconv(&v.U.(*Mpcplx).Imag, FmtSharp)) + return fmt.Sprintf("(%v+%vi)", Fconv(&u.Real, FmtSharp), Fconv(&u.Imag, FmtSharp)) - case CTSTR: - return strconv.Quote(v.U.(string)) + case string: + return strconv.Quote(u) - case CTBOOL: - if v.U.(bool) { + case bool: + if u { return "true" } return "false" - case CTNIL: + case *NilVal: return "nil" } @@ -416,6 +423,7 @@ var etnames = []string{ TPTR64: "PTR64", TFUNC: "FUNC", TARRAY: "ARRAY", + TSLICE: "SLICE", TSTRUCT: "STRUCT", TCHAN: "CHAN", TMAP: "MAP", @@ -445,6 +453,10 @@ func (e EType) String() string { return Econv(e) } +func (o Op) String() string { + return oconv(o, 0) +} + // Fmt "%S": syms func symfmt(s *Sym, flag FmtFlag) string { if s.Pkg != nil && flag&FmtShort == 0 { @@ -574,7 +586,7 @@ func typefmt(t *Type, flag FmtFlag) string { if fmtmode == FDbg { fmtmode = 0 - str := Econv(t.Etype) + "-" + typefmt(t, flag) + str := t.Etype.String() + "-" + typefmt(t, flag) fmtmode = FDbg return str } @@ -587,12 +599,12 @@ func typefmt(t *Type, flag FmtFlag) string { return "*" + t.Elem().String() case TARRAY: - if t.IsArray() { - return fmt.Sprintf("[%d]%v", t.NumElem(), t.Elem()) - } if t.isDDDArray() { return "[...]" + t.Elem().String() } + return fmt.Sprintf("[%d]%v", t.NumElem(), t.Elem()) + + case TSLICE: return "[]" + t.Elem().String() case TCHAN: @@ -671,26 +683,27 @@ func typefmt(t *Type, flag FmtFlag) string { return buf.String() case TSTRUCT: - if t.Map != nil { + if m := t.StructType().Map; m != nil { + mt := m.MapType() // Format the bucket struct for map[x]y as map.bucket[x]y. // This avoids a recursive print that generates very long names. - if t.Map.Bucket == t { - return "map.bucket[" + t.Map.Key().String() + "]" + t.Map.Val().String() + if mt.Bucket == t { + return "map.bucket[" + m.Key().String() + "]" + m.Val().String() } - if t.Map.Hmap == t { - return "map.hdr[" + t.Map.Key().String() + "]" + t.Map.Val().String() + if mt.Hmap == t { + return "map.hdr[" + m.Key().String() + "]" + m.Val().String() } - if t.Map.Hiter == t { - return "map.iter[" + t.Map.Key().String() + "]" + t.Map.Val().String() + if mt.Hiter == t { + return "map.iter[" + m.Key().String() + "]" + m.Val().String() } Yyerror("unknown internal map type") } var buf bytes.Buffer - if t.Funarg { + if t.IsFuncArgStruct() { buf.WriteString("(") var flag1 FmtFlag if fmtmode == FTypeId || fmtmode == FErr { // no argument names on function signature, and no "noescape"/"nosplit" tags @@ -735,15 +748,18 @@ func typefmt(t *Type, flag FmtFlag) string { if fmtmode == FExp { Fatalf("cannot use TDDDFIELD with old exporter") } - return fmt.Sprintf("%v <%v> %v", Econv(t.Etype), t.Sym, t.Wrapped()) + return fmt.Sprintf("%v <%v> %v", t.Etype, t.Sym, t.DDDField()) + + case Txxx: + return "Txxx" } if fmtmode == FExp { - Fatalf("missing %v case during export", Econv(t.Etype)) + Fatalf("missing %v case during export", t.Etype) } // Don't know how to handle - fall back to detailed prints. - return fmt.Sprintf("%v <%v> %v", Econv(t.Etype), t.Sym, t.Elem()) + return fmt.Sprintf("%v <%v> %v", t.Etype, t.Sym, t.Elem()) } // Statements which may be rendered with a simplestmt as init. @@ -824,7 +840,7 @@ func stmtfmt(n *Node) string { break } - f += fmt.Sprintf("%v %v= %v", n.Left, Oconv(Op(n.Etype), FmtSharp), n.Right) + f += fmt.Sprintf("%v %v= %v", n.Left, oconv(Op(n.Etype), FmtSharp), n.Right) case OAS2: if n.Colas && !complexinit { @@ -898,11 +914,11 @@ func stmtfmt(n *Node) string { case OSELECT, OSWITCH: if fmtmode == FErr { - f += fmt.Sprintf("%v statement", Oconv(n.Op, 0)) + f += fmt.Sprintf("%v statement", n.Op) break } - f += Oconv(n.Op, FmtSharp) + f += oconv(n.Op, FmtSharp) if simpleinit { f += fmt.Sprintf(" %v;", n.Ninit.First()) } @@ -925,9 +941,9 @@ func stmtfmt(n *Node) string { OFALL, OXFALL: if n.Left != nil { - f += fmt.Sprintf("%v %v", Oconv(n.Op, FmtSharp), n.Left) + f += fmt.Sprintf("%v %v", oconv(n.Op, FmtSharp), n.Left) } else { - f += Oconv(n.Op, FmtSharp) + f += oconv(n.Op, FmtSharp) } case OEMPTY: @@ -1180,7 +1196,7 @@ func exprfmt(n *Node, prec int) string { if fmtmode == FErr { return "func literal" } - if len(n.Nbody.Slice()) != 0 { + if n.Nbody.Len() != 0 { return fmt.Sprintf("%v { %v }", n.Type, n.Nbody) } return fmt.Sprintf("%v { %v }", n.Type, n.Name.Param.Closure.Nbody) @@ -1296,20 +1312,32 @@ func exprfmt(n *Node, prec int) string { f += fmt.Sprintf(".(%v)", n.Type) return f - case OINDEX, - OINDEXMAP, - OSLICE, - OSLICESTR, - OSLICEARR, - OSLICE3, - OSLICE3ARR: - var f string - f += exprfmt(n.Left, nprec) - f += fmt.Sprintf("[%v]", n.Right) - return f + case OINDEX, OINDEXMAP: + return fmt.Sprintf("%s[%v]", exprfmt(n.Left, nprec), n.Right) + + case OSLICE, OSLICESTR, OSLICEARR, OSLICE3, OSLICE3ARR: + var buf bytes.Buffer + buf.WriteString(exprfmt(n.Left, nprec)) + buf.WriteString("[") + low, high, max := n.SliceBounds() + if low != nil { + buf.WriteString(low.String()) + } + buf.WriteString(":") + if high != nil { + buf.WriteString(high.String()) + } + if n.Op.IsSlice3() { + buf.WriteString(":") + if max != nil { + buf.WriteString(max.String()) + } + } + buf.WriteString("]") + return buf.String() case OCOPY, OCOMPLEX: - return fmt.Sprintf("%v(%v, %v)", Oconv(n.Op, FmtSharp), n.Left, n.Right) + return fmt.Sprintf("%v(%v, %v)", oconv(n.Op, FmtSharp), n.Left, n.Right) case OCONV, OCONVIFACE, @@ -1341,12 +1369,12 @@ func exprfmt(n *Node, prec int) string { OPRINT, OPRINTN: if n.Left != nil { - return fmt.Sprintf("%v(%v)", Oconv(n.Op, FmtSharp), n.Left) + return fmt.Sprintf("%v(%v)", oconv(n.Op, FmtSharp), n.Left) } if n.Isddd { - return fmt.Sprintf("%v(%v...)", Oconv(n.Op, FmtSharp), Hconv(n.List, FmtComma)) + return fmt.Sprintf("%v(%v...)", oconv(n.Op, FmtSharp), Hconv(n.List, FmtComma)) } - return fmt.Sprintf("%v(%v)", Oconv(n.Op, FmtSharp), Hconv(n.List, FmtComma)) + return fmt.Sprintf("%v(%v)", oconv(n.Op, FmtSharp), Hconv(n.List, FmtComma)) case OCALL, OCALLFUNC, OCALLINTER, OCALLMETH, OGETG: var f string @@ -1380,9 +1408,9 @@ func exprfmt(n *Node, prec int) string { ORECV: var f string if n.Left.Op == n.Op { - f += fmt.Sprintf("%v ", Oconv(n.Op, FmtSharp)) + f += fmt.Sprintf("%v ", oconv(n.Op, FmtSharp)) } else { - f += Oconv(n.Op, FmtSharp) + f += oconv(n.Op, FmtSharp) } f += exprfmt(n.Left, nprec+1) return f @@ -1411,7 +1439,7 @@ func exprfmt(n *Node, prec int) string { var f string f += exprfmt(n.Left, nprec) - f += fmt.Sprintf(" %v ", Oconv(n.Op, FmtSharp)) + f += fmt.Sprintf(" %v ", oconv(n.Op, FmtSharp)) f += exprfmt(n.Right, nprec+1) return f @@ -1432,7 +1460,7 @@ func exprfmt(n *Node, prec int) string { var f string f += exprfmt(n.Left, nprec) // TODO(marvin): Fix Node.EType type union. - f += fmt.Sprintf(" %v ", Oconv(Op(n.Etype), FmtSharp)) + f += fmt.Sprintf(" %v ", oconv(Op(n.Etype), FmtSharp)) f += exprfmt(n.Right, nprec+1) return f @@ -1444,7 +1472,7 @@ func exprfmt(n *Node, prec int) string { } } - return fmt.Sprintf("<node %v>", Oconv(n.Op, 0)) + return fmt.Sprintf("<node %v>", n.Op) } func nodefmt(n *Node, flag FmtFlag) string { @@ -1499,40 +1527,40 @@ func nodedump(n *Node, flag FmtFlag) string { } if n.Ninit.Len() != 0 { - fmt.Fprintf(&buf, "%v-init%v", Oconv(n.Op, 0), n.Ninit) + fmt.Fprintf(&buf, "%v-init%v", n.Op, n.Ninit) indent(&buf) } } switch n.Op { default: - fmt.Fprintf(&buf, "%v%v", Oconv(n.Op, 0), Jconv(n, 0)) + fmt.Fprintf(&buf, "%v%v", n.Op, Jconv(n, 0)) case OREGISTER, OINDREG: - fmt.Fprintf(&buf, "%v-%v%v", Oconv(n.Op, 0), obj.Rconv(int(n.Reg)), Jconv(n, 0)) + fmt.Fprintf(&buf, "%v-%v%v", n.Op, obj.Rconv(int(n.Reg)), Jconv(n, 0)) case OLITERAL: - fmt.Fprintf(&buf, "%v-%v%v", Oconv(n.Op, 0), Vconv(n.Val(), 0), Jconv(n, 0)) + fmt.Fprintf(&buf, "%v-%v%v", n.Op, Vconv(n.Val(), 0), Jconv(n, 0)) case ONAME, ONONAME: if n.Sym != nil { - fmt.Fprintf(&buf, "%v-%v%v", Oconv(n.Op, 0), n.Sym, Jconv(n, 0)) + fmt.Fprintf(&buf, "%v-%v%v", n.Op, n.Sym, Jconv(n, 0)) } else { - fmt.Fprintf(&buf, "%v%v", Oconv(n.Op, 0), Jconv(n, 0)) + fmt.Fprintf(&buf, "%v%v", n.Op, Jconv(n, 0)) } if recur && n.Type == nil && n.Name != nil && n.Name.Param != nil && n.Name.Param.Ntype != nil { indent(&buf) - fmt.Fprintf(&buf, "%v-ntype%v", Oconv(n.Op, 0), n.Name.Param.Ntype) + fmt.Fprintf(&buf, "%v-ntype%v", n.Op, n.Name.Param.Ntype) } case OASOP: - fmt.Fprintf(&buf, "%v-%v%v", Oconv(n.Op, 0), Oconv(Op(n.Etype), 0), Jconv(n, 0)) + fmt.Fprintf(&buf, "%v-%v%v", n.Op, Op(n.Etype), Jconv(n, 0)) case OTYPE: - fmt.Fprintf(&buf, "%v %v%v type=%v", Oconv(n.Op, 0), n.Sym, Jconv(n, 0), n.Type) + fmt.Fprintf(&buf, "%v %v%v type=%v", n.Op, n.Sym, Jconv(n, 0), n.Type) if recur && n.Type == nil && n.Name.Param.Ntype != nil { indent(&buf) - fmt.Fprintf(&buf, "%v-ntype%v", Oconv(n.Op, 0), n.Name.Param.Ntype) + fmt.Fprintf(&buf, "%v-ntype%v", n.Op, n.Name.Param.Ntype) } } @@ -1553,17 +1581,17 @@ func nodedump(n *Node, flag FmtFlag) string { } if n.List.Len() != 0 { indent(&buf) - fmt.Fprintf(&buf, "%v-list%v", Oconv(n.Op, 0), n.List) + fmt.Fprintf(&buf, "%v-list%v", n.Op, n.List) } if n.Rlist.Len() != 0 { indent(&buf) - fmt.Fprintf(&buf, "%v-rlist%v", Oconv(n.Op, 0), n.Rlist) + fmt.Fprintf(&buf, "%v-rlist%v", n.Op, n.Rlist) } - if len(n.Nbody.Slice()) != 0 { + if n.Nbody.Len() != 0 { indent(&buf) - fmt.Fprintf(&buf, "%v-body%v", Oconv(n.Op, 0), n.Nbody) + fmt.Fprintf(&buf, "%v-body%v", n.Op, n.Nbody) } } @@ -1672,8 +1700,8 @@ func Fldconv(f *Field, flag FmtFlag) string { // (The escape analysis tags do not apply to func vars.) // But it must not suppress struct field tags. // See golang.org/issue/13777 and golang.org/issue/14331. - if flag&FmtShort == 0 && (!fmtbody || !f.Funarg) && f.Note != nil { - str += " " + strconv.Quote(*f.Note) + if flag&FmtShort == 0 && (!fmtbody || !f.Funarg) && f.Note != "" { + str += " " + strconv.Quote(f.Note) } if fmtmode == FTypeId && (sf&FmtUnsigned != 0) { diff --git a/src/cmd/compile/internal/gc/gen.go b/src/cmd/compile/internal/gc/gen.go index 4a98f41bcb..275e6a7507 100644 --- a/src/cmd/compile/internal/gc/gen.go +++ b/src/cmd/compile/internal/gc/gen.go @@ -8,6 +8,7 @@ package gc import ( "cmd/internal/obj" + "cmd/internal/sys" "fmt" ) @@ -217,7 +218,7 @@ func Genlist(l Nodes) { func cgen_proc(n *Node, proc int) { switch n.Left.Op { default: - Fatalf("cgen_proc: unknown call %v", Oconv(n.Left.Op, 0)) + Fatalf("cgen_proc: unknown call %v", n.Left.Op) case OCALLMETH: cgen_callmeth(n.Left, proc) @@ -245,7 +246,7 @@ func cgen_dcl(n *Node) { if n.Class&PHEAP == 0 { return } - if compiling_runtime != 0 { + if compiling_runtime { Yyerror("%v escapes to heap, not allowed in runtime.", n) } if prealloc[n] == nil { @@ -1030,7 +1031,7 @@ func componentgen_wb(nr, nl *Node, wb bool) bool { // Emit vardef if needed. if nl.Op == ONAME { switch nl.Type.Etype { - case TARRAY, TSTRING, TINTER, TSTRUCT: + case TARRAY, TSLICE, TSTRING, TINTER, TSTRUCT: Gvardef(nl) } } @@ -1174,7 +1175,7 @@ func visitComponents(t *Type, startOffset int64, f func(elem *Type, elemOffset i } // NOTE: Assuming little endian (signed top half at offset 4). // We don't have any 32-bit big-endian systems. - if Thearch.Thechar != '5' && Thearch.Thechar != '8' { + if !Thearch.LinkArch.InFamily(sys.ARM, sys.I386) { Fatalf("unknown 32-bit architecture") } return f(Types[TUINT32], startOffset) && @@ -1203,13 +1204,12 @@ func visitComponents(t *Type, startOffset int64, f func(elem *Type, elemOffset i return f(Ptrto(Types[TUINT8]), startOffset) && f(Types[Simtype[TUINT]], startOffset+int64(Widthptr)) - case TARRAY: - if t.IsSlice() { - return f(Ptrto(t.Elem()), startOffset+int64(Array_array)) && - f(Types[Simtype[TUINT]], startOffset+int64(Array_nel)) && - f(Types[Simtype[TUINT]], startOffset+int64(Array_cap)) - } + case TSLICE: + return f(Ptrto(t.Elem()), startOffset+int64(Array_array)) && + f(Types[Simtype[TUINT]], startOffset+int64(Array_nel)) && + f(Types[Simtype[TUINT]], startOffset+int64(Array_cap)) + case TARRAY: // Short-circuit [1e6]struct{}. if t.Elem().Width == 0 { return true diff --git a/src/cmd/compile/internal/gc/go.go b/src/cmd/compile/internal/gc/go.go index fdea1f2fba..f9a372dcce 100644 --- a/src/cmd/compile/internal/gc/go.go +++ b/src/cmd/compile/internal/gc/go.go @@ -5,8 +5,9 @@ package gc import ( - "bytes" + "bufio" "cmd/compile/internal/ssa" + "cmd/internal/bio" "cmd/internal/obj" ) @@ -16,48 +17,10 @@ const ( MaxStackVarSize = 10 * 1024 * 1024 ) -type Val struct { - // U contains one of: - // bool bool when n.ValCtype() == CTBOOL - // *Mpint int when n.ValCtype() == CTINT, rune when n.ValCtype() == CTRUNE - // *Mpflt float when n.ValCtype() == CTFLT - // *Mpcplx pair of floats when n.ValCtype() == CTCPLX - // string string when n.ValCtype() == CTSTR - // *Nilval when n.ValCtype() == CTNIL - U interface{} -} - -type NilVal struct{} - -func (v Val) Ctype() Ctype { - switch x := v.U.(type) { - default: - Fatalf("unexpected Ctype for %T", v.U) - panic("not reached") - case nil: - return 0 - case *NilVal: - return CTNIL - case bool: - return CTBOOL - case *Mpint: - if x.Rune { - return CTRUNE - } - return CTINT - case *Mpflt: - return CTFLT - case *Mpcplx: - return CTCPLX - case string: - return CTSTR - } -} - type Pkg struct { Name string // package name, e.g. "sys" Path string // string literal used in import statement, e.g. "runtime/internal/sys" - Pathsym *Sym + Pathsym *obj.LSym Prefix string // escaped path for use in symbol table Imported bool // export data of this package was parsed Exported bool // import line written in export data @@ -66,6 +29,14 @@ type Pkg struct { Syms map[string]*Sym } +// Sym represents an object name. Most commonly, this is a Go identifier naming +// an object declared within a package, but Syms are also used to name internal +// synthesized objects. +// +// As a special exception, field and method names that are exported use the Sym +// associated with localpkg instead of the package that declared them. This +// allows using Sym pointer equality to test for Go identifier uniqueness when +// handling selector expressions. type Sym struct { Flags SymFlags Link *Sym @@ -111,37 +82,6 @@ const ( SymAlgGen ) -var dclstack *Sym - -// Ctype describes the constant kind of an "ideal" (untyped) constant. -type Ctype int8 - -const ( - CTxxx Ctype = iota - - CTINT - CTRUNE - CTFLT - CTCPLX - CTSTR - CTBOOL - CTNIL -) - -// ChanDir is whether a channel can send, receive, or both. -type ChanDir uint8 - -func (c ChanDir) CanRecv() bool { return c&Crecv != 0 } -func (c ChanDir) CanSend() bool { return c&Csend != 0 } - -const ( - // types of channel - // must match ../../../../reflect/type.go:/ChanDir - Crecv ChanDir = 1 << 0 - Csend ChanDir = 1 << 1 - Cboth ChanDir = Crecv | Csend -) - // The Class of a variable/function describes the "storage class" // of a variable or function. During parsing, storage classes are // called declaration contexts. @@ -161,30 +101,6 @@ const ( PHEAP = 1 << 7 // an extra bit to identify an escaped variable ) -const ( - Etop = 1 << 1 // evaluated at statement level - Erv = 1 << 2 // evaluated in value context - Etype = 1 << 3 - Ecall = 1 << 4 // call-only expressions are ok - Efnstruct = 1 << 5 // multivalue function returns are ok - Eiota = 1 << 6 // iota is ok - Easgn = 1 << 7 // assigning to expression - Eindir = 1 << 8 // indirecting through expression - Eaddr = 1 << 9 // taking address of expression - Eproc = 1 << 10 // inside a go statement - Ecomplit = 1 << 11 // type in composite literal -) - -type Sig struct { - name string - pkg *Pkg - isym *Sym - tsym *Sym - type_ *Type - mtype *Type - offset int32 -} - // note this is the runtime representation // of the compilers arrays. // @@ -212,20 +128,13 @@ var sizeof_Array int // runtime sizeof(Array) // } String; var sizeof_String int // runtime sizeof(String) -// lexlineno is the line number _after_ the most recently read rune. -// In particular, it's advanced (or rewound) as newlines are read (or unread). -var lexlineno int32 - -// lineno is the line number at the start of the most recently lexed token. -var lineno int32 - var pragcgobuf string var infile string var outfile string -var bout *obj.Biobuf +var bout *bio.Writer var nerrors int @@ -235,13 +144,9 @@ var nsyntaxerrors int var decldepth int32 -var safemode int - -var nolocalimports int +var safemode bool -var lexbuf bytes.Buffer -var strbuf bytes.Buffer -var litbuf string // LLITERAL value for use in syntax error messages +var nolocalimports bool var Debug [256]int @@ -266,12 +171,13 @@ var msanpkg *Pkg // package runtime/msan var typepkg *Pkg // fake package for runtime type info (headers) -var typelinkpkg *Pkg // fake package for runtime type info (data) - var unsafepkg *Pkg // package unsafe var trackpkg *Pkg // fake package for field tracking +var mappkg *Pkg // fake package for map zero value +var zerosize int64 + var Tptr EType // either TPTR32 or TPTR64 var myimportpath string @@ -318,8 +224,6 @@ var maxfltval [NTYPE]*Mpflt var xtop []*Node -var externdcl []*Node - var exportlist []*Node var importlist []*Node // imported functions and methods with inlinable bodies @@ -344,10 +248,6 @@ var Stksize int64 // stack size for current frame var stkptrsize int64 // prefix of stack containing pointers -var blockgen int32 // max block number - -var block int32 // current block number - var hasdefer bool // flag that curfn has defer statement var Curfn *Node @@ -364,21 +264,21 @@ var Funcdepth int32 var typecheckok bool -var compiling_runtime int +var compiling_runtime bool var compiling_wrappers int -var use_writebarrier int +var use_writebarrier bool -var pure_go int +var pure_go bool var flag_installsuffix string -var flag_race int +var flag_race bool -var flag_msan int +var flag_msan bool -var flag_largemodel int +var flag_largemodel bool // Whether we are adding any sort of code instrumentation, such as // when the race detector is enabled. @@ -388,9 +288,9 @@ var debuglive int var Ctxt *obj.Link -var writearchive int +var writearchive bool -var bstdout obj.Biobuf +var bstdout *bufio.Writer var Nacl bool @@ -404,34 +304,6 @@ var nodfp *Node var Disable_checknil int -type Flow struct { - Prog *obj.Prog // actual instruction - P1 *Flow // predecessors of this instruction: p1, - P2 *Flow // and then p2 linked though p2link. - P2link *Flow - S1 *Flow // successors of this instruction (at most two: s1 and s2). - S2 *Flow - Link *Flow // next instruction in function code - - Active int32 // usable by client - - Id int32 // sequence number in flow graph - Rpo int32 // reverse post ordering - Loop uint16 // x5 for every loop - Refset bool // diagnostic generated - - Data interface{} // for use by client -} - -type Graph struct { - Start *Flow - Num int - - // After calling flowrpo, rpo lists the flow nodes in reverse postorder, - // and each non-dead Flow node f has g->rpo[f->rpo] == f. - Rpo []*Flow -} - // interface to back end const ( @@ -491,9 +363,8 @@ const ( ) type Arch struct { - Thechar int - Thestring string - Thelinkarch *obj.LinkArch + LinkArch *obj.LinkArch + REGSP int REGCTXT int REGCALLX int // BX @@ -507,23 +378,25 @@ type Arch struct { MAXWIDTH int64 ReservedRegs []int - AddIndex func(*Node, int64, *Node) bool // optional - Betypeinit func() - Bgen_float func(*Node, bool, int, *obj.Prog) // optional - Cgen64 func(*Node, *Node) // only on 32-bit systems - Cgenindex func(*Node, *Node, bool) *obj.Prog - Cgen_bmul func(Op, *Node, *Node, *Node) bool - Cgen_float func(*Node, *Node) // optional - Cgen_hmul func(*Node, *Node, *Node) - Cgen_shift func(Op, bool, *Node, *Node, *Node) - Clearfat func(*Node) - Cmp64 func(*Node, *Node, Op, int, *obj.Prog) // only on 32-bit systems - Defframe func(*obj.Prog) - Dodiv func(Op, *Node, *Node, *Node) - Excise func(*Flow) - Expandchecks func(*obj.Prog) - Getg func(*Node) - Gins func(obj.As, *Node, *Node) *obj.Prog + AddIndex func(*Node, int64, *Node) bool // optional + Betypeinit func() + Bgen_float func(*Node, bool, int, *obj.Prog) // optional + Cgen64 func(*Node, *Node) // only on 32-bit systems + Cgenindex func(*Node, *Node, bool) *obj.Prog + Cgen_bmul func(Op, *Node, *Node, *Node) bool + Cgen_float func(*Node, *Node) // optional + Cgen_hmul func(*Node, *Node, *Node) + RightShiftWithCarry func(*Node, uint, *Node) // only on systems without RROTC instruction + AddSetCarry func(*Node, *Node, *Node) // only on systems when ADD does not update carry flag + Cgen_shift func(Op, bool, *Node, *Node, *Node) + Clearfat func(*Node) + Cmp64 func(*Node, *Node, Op, int, *obj.Prog) // only on 32-bit systems + Defframe func(*obj.Prog) + Dodiv func(Op, *Node, *Node, *Node) + Excise func(*Flow) + Expandchecks func(*obj.Prog) + Getg func(*Node) + Gins func(obj.As, *Node, *Node) *obj.Prog // Ginscmp generates code comparing n1 to n2 and jumping away if op is satisfied. // The returned prog should be Patch'ed with the jump target. diff --git a/src/cmd/compile/internal/gc/gsubr.go b/src/cmd/compile/internal/gc/gsubr.go index 353d90f593..7e64194957 100644 --- a/src/cmd/compile/internal/gc/gsubr.go +++ b/src/cmd/compile/internal/gc/gsubr.go @@ -32,6 +32,7 @@ package gc import ( "cmd/internal/obj" + "cmd/internal/sys" "fmt" "runtime" "strings" @@ -57,7 +58,9 @@ func Ismem(n *Node) bool { return true case OADDR: - return Thearch.Thechar == '6' || Thearch.Thechar == '9' // because 6g uses PC-relative addressing; TODO(rsc): not sure why 9g too + // amd64 and s390x use PC relative addressing. + // TODO(rsc): not sure why ppc64 needs this too. + return Thearch.LinkArch.InFamily(sys.AMD64, sys.PPC64, sys.S390X) } return false @@ -83,7 +86,7 @@ func Gbranch(as obj.As, t *Type, likely int) *obj.Prog { p := Prog(as) p.To.Type = obj.TYPE_BRANCH p.To.Val = nil - if as != obj.AJMP && likely != 0 && Thearch.Thechar != '9' && Thearch.Thechar != '7' && Thearch.Thechar != '0' { + if as != obj.AJMP && likely != 0 && !Thearch.LinkArch.InFamily(sys.PPC64, sys.ARM64, sys.MIPS64, sys.S390X) { p.From.Type = obj.TYPE_CONST if likely > 0 { p.From.Offset = 1 @@ -274,7 +277,7 @@ func gused(n *Node) { func Isfat(t *Type) bool { if t != nil { switch t.Etype { - case TSTRUCT, TARRAY, TSTRING, + case TSTRUCT, TARRAY, TSLICE, TSTRING, TINTER: // maybe remove later return true } @@ -324,13 +327,13 @@ func Naddr(a *obj.Addr, n *Node) { a := a // copy to let escape into Ctxt.Dconv Debug['h'] = 1 Dump("naddr", n) - Fatalf("naddr: bad %v %v", Oconv(n.Op, 0), Ctxt.Dconv(a)) + Fatalf("naddr: bad %v %v", n.Op, Ctxt.Dconv(a)) case OREGISTER: a.Type = obj.TYPE_REG a.Reg = n.Reg a.Sym = nil - if Thearch.Thechar == '8' { // TODO(rsc): Never clear a->width. + if Thearch.LinkArch.Family == sys.I386 { // TODO(rsc): Never clear a->width. a.Width = 0 } @@ -342,7 +345,7 @@ func Naddr(a *obj.Addr, n *Node) { if a.Offset != int64(int32(a.Offset)) { Yyerror("offset %d too large for OINDREG", a.Offset) } - if Thearch.Thechar == '8' { // TODO(rsc): Never clear a->width. + if Thearch.LinkArch.Family == sys.I386 { // TODO(rsc): Never clear a->width. a.Width = 0 } @@ -419,36 +422,36 @@ func Naddr(a *obj.Addr, n *Node) { if !n.Left.Type.IsStruct() || n.Left.Type.Field(0).Sym != n.Sym { Debug['h'] = 1 Dump("naddr", n) - Fatalf("naddr: bad %v %v", Oconv(n.Op, 0), Ctxt.Dconv(a)) + Fatalf("naddr: bad %v %v", n.Op, Ctxt.Dconv(a)) } Naddr(a, n.Left) case OLITERAL: - if Thearch.Thechar == '8' { + if Thearch.LinkArch.Family == sys.I386 { a.Width = 0 } - switch n.Val().Ctype() { + switch u := n.Val().U.(type) { default: Fatalf("naddr: const %v", Tconv(n.Type, FmtLong)) - case CTFLT: + case *Mpflt: a.Type = obj.TYPE_FCONST - a.Val = n.Val().U.(*Mpflt).Float64() + a.Val = u.Float64() - case CTINT, CTRUNE: + case *Mpint: a.Sym = nil a.Type = obj.TYPE_CONST - a.Offset = n.Int64() + a.Offset = u.Int64() - case CTSTR: - datagostring(n.Val().U.(string), a) + case string: + datagostring(u, a) - case CTBOOL: + case bool: a.Sym = nil a.Type = obj.TYPE_CONST - a.Offset = int64(obj.Bool2int(n.Val().U.(bool))) + a.Offset = int64(obj.Bool2int(u)) - case CTNIL: + case *NilVal: a.Sym = nil a.Type = obj.TYPE_CONST a.Offset = 0 @@ -457,12 +460,12 @@ func Naddr(a *obj.Addr, n *Node) { case OADDR: Naddr(a, n.Left) a.Etype = uint8(Tptr) - if Thearch.Thechar != '0' && Thearch.Thechar != '5' && Thearch.Thechar != '7' && Thearch.Thechar != '9' { // TODO(rsc): Do this even for arm, ppc64. + if !Thearch.LinkArch.InFamily(sys.MIPS64, sys.ARM, sys.ARM64, sys.PPC64, sys.S390X) { // TODO(rsc): Do this even for these architectures. a.Width = int64(Widthptr) } if a.Type != obj.TYPE_MEM { a := a // copy to let escape into Ctxt.Dconv - Fatalf("naddr: OADDR %v (from %v)", Ctxt.Dconv(a), Oconv(n.Left.Op, 0)) + Fatalf("naddr: OADDR %v (from %v)", Ctxt.Dconv(a), n.Left.Op) } a.Type = obj.TYPE_ADDR @@ -496,7 +499,7 @@ func Naddr(a *obj.Addr, n *Node) { } a.Etype = uint8(Simtype[TUINT]) a.Offset += int64(Array_nel) - if Thearch.Thechar != '5' { // TODO(rsc): Do this even on arm. + if Thearch.LinkArch.Family != sys.ARM { // TODO(rsc): Do this even on arm. a.Width = int64(Widthint) } @@ -509,7 +512,7 @@ func Naddr(a *obj.Addr, n *Node) { } a.Etype = uint8(Simtype[TUINT]) a.Offset += int64(Array_cap) - if Thearch.Thechar != '5' { // TODO(rsc): Do this even on arm. + if Thearch.LinkArch.Family != sys.ARM { // TODO(rsc): Do this even on arm. a.Width = int64(Widthint) } } @@ -541,7 +544,7 @@ func nodarg(t interface{}, fp int) *Node { switch t := t.(type) { case *Type: // entire argument struct, not just one arg - if !t.IsStruct() || !t.Funarg { + if !t.IsFuncArgStruct() { Fatalf("nodarg: bad type %v", t) } n = Nod(ONAME, nil, nil) @@ -695,7 +698,7 @@ func Regalloc(n *Node, t *Type, o *Node) { Fatalf("regalloc: t nil") } et := Simtype[t.Etype] - if Ctxt.Arch.Regsize == 4 && (et == TINT64 || et == TUINT64) { + if Ctxt.Arch.RegSize == 4 && (et == TINT64 || et == TUINT64) { Fatalf("regalloc 64bit") } diff --git a/src/cmd/compile/internal/gc/init.go b/src/cmd/compile/internal/gc/init.go index d355a46557..6c9223b57a 100644 --- a/src/cmd/compile/internal/gc/init.go +++ b/src/cmd/compile/internal/gc/init.go @@ -58,8 +58,6 @@ func anyinit(n []*Node) bool { break } fallthrough - - // fall through default: return true } diff --git a/src/cmd/compile/internal/gc/inl.go b/src/cmd/compile/internal/gc/inl.go index ea2394e7f9..10b61377ca 100644 --- a/src/cmd/compile/internal/gc/inl.go +++ b/src/cmd/compile/internal/gc/inl.go @@ -71,7 +71,7 @@ func typecheckinl(fn *Node) { } save_safemode := safemode - safemode = 0 + safemode = false savefn := Curfn Curfn = fn @@ -100,7 +100,7 @@ func caninl(fn *Node) { } // If fn has no body (is defined outside of Go), cannot inline it. - if len(fn.Nbody.Slice()) == 0 { + if fn.Nbody.Len() == 0 { return } @@ -110,8 +110,9 @@ func caninl(fn *Node) { // can't handle ... args yet if Debug['l'] < 3 { - for _, t := range fn.Type.Params().Fields().Slice() { - if t.Isddd { + f := fn.Type.Params().Fields() + if len := f.Len(); len > 0 { + if t := f.Index(len - 1); t.Isddd { return } } @@ -128,7 +129,7 @@ func caninl(fn *Node) { } const maxBudget = 80 - budget := maxBudget // allowed hairyness + budget := int32(maxBudget) // allowed hairyness if ishairylist(fn.Nbody, &budget) || budget < 0 { return } @@ -136,27 +137,29 @@ func caninl(fn *Node) { savefn := Curfn Curfn = fn - fn.Func.Nname.Func.Inl.Set(fn.Nbody.Slice()) - fn.Nbody.Set(inlcopylist(fn.Func.Nname.Func.Inl.Slice())) - inldcl := inlcopylist(fn.Func.Nname.Name.Defn.Func.Dcl) - fn.Func.Nname.Func.Inldcl.Set(inldcl) - fn.Func.Nname.Func.InlCost = int32(maxBudget - budget) + n := fn.Func.Nname + + n.Func.Inl.Set(fn.Nbody.Slice()) + fn.Nbody.Set(inlcopylist(n.Func.Inl.Slice())) + inldcl := inlcopylist(n.Name.Defn.Func.Dcl) + n.Func.Inldcl.Set(inldcl) + n.Func.InlCost = maxBudget - budget // hack, TODO, check for better way to link method nodes back to the thing with the ->inl // this is so export can find the body of a method - fn.Type.SetNname(fn.Func.Nname) + fn.Type.SetNname(n) if Debug['m'] > 1 { - fmt.Printf("%v: can inline %v as: %v { %v }\n", fn.Line(), Nconv(fn.Func.Nname, FmtSharp), Tconv(fn.Type, FmtSharp), Hconv(fn.Func.Nname.Func.Inl, FmtSharp)) + fmt.Printf("%v: can inline %v as: %v { %v }\n", fn.Line(), Nconv(n, FmtSharp), Tconv(fn.Type, FmtSharp), Hconv(n.Func.Inl, FmtSharp)) } else if Debug['m'] != 0 { - fmt.Printf("%v: can inline %v\n", fn.Line(), fn.Func.Nname) + fmt.Printf("%v: can inline %v\n", fn.Line(), n) } Curfn = savefn } // Look for anything we want to punt on. -func ishairylist(ll Nodes, budget *int) bool { +func ishairylist(ll Nodes, budget *int32) bool { for _, n := range ll.Slice() { if ishairy(n, budget) { return true @@ -165,7 +168,7 @@ func ishairylist(ll Nodes, budget *int) bool { return false } -func ishairy(n *Node, budget *int) bool { +func ishairy(n *Node, budget *int32) bool { if n == nil { return false } @@ -173,13 +176,13 @@ func ishairy(n *Node, budget *int) bool { switch n.Op { // Call is okay if inlinable and we have the budget for the body. case OCALLFUNC: - if n.Left.Func != nil && len(n.Left.Func.Inl.Slice()) != 0 { - *budget -= int(n.Left.Func.InlCost) + if fn := n.Left.Func; fn != nil && fn.Inl.Len() != 0 { + *budget -= fn.InlCost break } if n.Left.Op == ONAME && n.Left.Left != nil && n.Left.Left.Op == OTYPE && n.Left.Right != nil && n.Left.Right.Op == ONAME { // methods called as functions - if n.Left.Sym.Def != nil && len(n.Left.Sym.Def.Func.Inl.Slice()) != 0 { - *budget -= int(n.Left.Sym.Def.Func.InlCost) + if d := n.Left.Sym.Def; d != nil && d.Func.Inl.Len() != 0 { + *budget -= d.Func.InlCost break } } @@ -189,14 +192,15 @@ func ishairy(n *Node, budget *int) bool { // Call is okay if inlinable and we have the budget for the body. case OCALLMETH: - if n.Left.Type == nil { + t := n.Left.Type + if t == nil { Fatalf("no function type for [%p] %v\n", n.Left, Nconv(n.Left, FmtSign)) } - if n.Left.Type.Nname() == nil { - Fatalf("no function definition for [%p] %v\n", n.Left.Type, Tconv(n.Left.Type, FmtSign)) + if t.Nname() == nil { + Fatalf("no function definition for [%p] %v\n", t, Tconv(t, FmtSign)) } - if len(n.Left.Type.Nname().Func.Inl.Slice()) != 0 { - *budget -= int(n.Left.Type.Nname().Func.InlCost) + if inlfn := t.Nname().Func; inlfn.Inl.Len() != 0 { + *budget -= inlfn.InlCost break } if Debug['l'] < 4 { @@ -453,7 +457,7 @@ func inlnode(n *Node) *Node { if Debug['m'] > 3 { fmt.Printf("%v:call to func %v\n", n.Line(), Nconv(n.Left, FmtSign)) } - if n.Left.Func != nil && len(n.Left.Func.Inl.Slice()) != 0 && !isIntrinsicCall1(n) { // normal case + if n.Left.Func != nil && n.Left.Func.Inl.Len() != 0 && !isIntrinsicCall1(n) { // normal case n = mkinlcall(n, n.Left, n.Isddd) } else if n.Left.Op == ONAME && n.Left.Left != nil && n.Left.Left.Op == OTYPE && n.Left.Right != nil && n.Left.Right.Op == ONAME { // methods called as functions if n.Left.Sym.Def != nil { @@ -492,7 +496,7 @@ func mkinlcall(n *Node, fn *Node, isddd bool) *Node { pkg := fnpkg(fn) if pkg != localpkg && pkg != nil { - safemode = 0 + safemode = false } n = mkinlcall1(n, fn, isddd) safemode = save_safemode @@ -520,7 +524,7 @@ var inlgen int // n.Left = mkinlcall1(n.Left, fn, isddd) func mkinlcall1(n *Node, fn *Node, isddd bool) *Node { // For variadic fn. - if len(fn.Func.Inl.Slice()) == 0 { + if fn.Func.Inl.Len() == 0 { return n } @@ -750,7 +754,7 @@ func mkinlcall1(n *Node, fn *Node, isddd bool) *Node { vararrtype := typArray(varargtype.Elem(), int64(varargcount)) as.Right = Nod(OCOMPLIT, nil, typenod(vararrtype)) as.Right.List.Set(varargs) - as.Right = Nod(OSLICE, as.Right, Nod(OKEY, nil, nil)) + as.Right = Nod(OSLICE, as.Right, nil) } as = typecheck(as, Etop) diff --git a/src/cmd/compile/internal/gc/lex.go b/src/cmd/compile/internal/gc/lex.go index 6f1331ca89..8608a6229c 100644 --- a/src/cmd/compile/internal/gc/lex.go +++ b/src/cmd/compile/internal/gc/lex.go @@ -6,6 +6,7 @@ package gc import ( "bufio" + "bytes" "cmd/internal/obj" "fmt" "io" @@ -20,6 +21,17 @@ const ( BOM = 0xFEFF ) +// lexlineno is the line number _after_ the most recently read rune. +// In particular, it's advanced (or rewound) as newlines are read (or unread). +var lexlineno int32 + +// lineno is the line number at the start of the most recently lexed token. +var lineno int32 + +var lexbuf bytes.Buffer +var strbuf bytes.Buffer +var litbuf string // LLITERAL value for use in syntax error messages + func isSpace(c rune) bool { return c == ' ' || c == '\t' || c == '\n' || c == '\r' } @@ -32,6 +44,10 @@ func isDigit(c rune) bool { return '0' <= c && c <= '9' } +func isQuoted(s string) bool { + return len(s) >= 2 && s[0] == '"' && s[len(s)-1] == '"' +} + func plan9quote(s string) string { if s == "" { return "''" @@ -739,7 +755,7 @@ func (l *lexer) number(c rune) { } done: - litbuf = "literal " + str + litbuf = "" // lazily initialized in (*parser).syntax_error l.nlsemi = true l.tok = LLITERAL } @@ -841,15 +857,6 @@ func internString(b []byte) string { return s } -func more(pp *string) bool { - p := *pp - for p != "" && isSpace(rune(p[0])) { - p = p[1:] - } - *pp = p - return p != "" -} - // read and interpret syntax that looks like // //line parse.y:15 // as a discontinuity in sequential line numbers. @@ -875,7 +882,7 @@ func (l *lexer) getlinepragma() rune { text := strings.TrimSuffix(lexbuf.String(), "\r") if strings.HasPrefix(text, "go:cgo_") { - pragcgo(text) + pragcgobuf += pragcgo(text) } verb := text @@ -907,17 +914,17 @@ func (l *lexer) getlinepragma() rune { case "go:noinline": l.pragma |= Noinline case "go:systemstack": - if compiling_runtime == 0 { + if !compiling_runtime { Yyerror("//go:systemstack only allowed in runtime") } l.pragma |= Systemstack case "go:nowritebarrier": - if compiling_runtime == 0 { + if !compiling_runtime { Yyerror("//go:nowritebarrier only allowed in runtime") } l.pragma |= Nowritebarrier case "go:nowritebarrierrec": - if compiling_runtime == 0 { + if !compiling_runtime { Yyerror("//go:nowritebarrierrec only allowed in runtime") } l.pragma |= Nowritebarrierrec | Nowritebarrier // implies Nowritebarrier @@ -979,139 +986,114 @@ func (l *lexer) getlinepragma() rune { return c } -func getimpsym(pp *string) string { - more(pp) // skip spaces - p := *pp - if p == "" || p[0] == '"' { - return "" - } - i := 0 - for i < len(p) && !isSpace(rune(p[i])) && p[i] != '"' { - i++ - } - sym := p[:i] - *pp = p[i:] - return sym -} +func pragcgo(text string) string { + f := pragmaFields(text) -func getquoted(pp *string) (string, bool) { - more(pp) // skip spaces - p := *pp - if p == "" || p[0] != '"' { - return "", false - } - p = p[1:] - i := strings.Index(p, `"`) - if i < 0 { - return "", false - } - *pp = p[i+1:] - return p[:i], true -} + verb := f[0][3:] // skip "go:" + switch verb { + case "cgo_export_static", "cgo_export_dynamic": + switch { + case len(f) == 2 && !isQuoted(f[1]): + local := plan9quote(f[1]) + return fmt.Sprintln(verb, local) -// Copied nearly verbatim from the C compiler's #pragma parser. -// TODO: Rewrite more cleanly once the compiler is written in Go. -func pragcgo(text string) { - var q string + case len(f) == 3 && !isQuoted(f[1]) && !isQuoted(f[2]): + local := plan9quote(f[1]) + remote := plan9quote(f[2]) + return fmt.Sprintln(verb, local, remote) - if i := strings.Index(text, " "); i >= 0 { - text, q = text[:i], text[i:] - } - - verb := text[3:] // skip "go:" - - if verb == "cgo_dynamic_linker" || verb == "dynlinker" { - p, ok := getquoted(&q) - if !ok { - Yyerror("usage: //go:cgo_dynamic_linker \"path\"") - return + default: + Yyerror(`usage: //go:%s local [remote]`, verb) } - pragcgobuf += fmt.Sprintf("cgo_dynamic_linker %v\n", plan9quote(p)) - return + case "cgo_import_dynamic": + switch { + case len(f) == 2 && !isQuoted(f[1]): + local := plan9quote(f[1]) + return fmt.Sprintln(verb, local) - } + case len(f) == 3 && !isQuoted(f[1]) && !isQuoted(f[2]): + local := plan9quote(f[1]) + remote := plan9quote(f[2]) + return fmt.Sprintln(verb, local, remote) - if verb == "dynexport" { - verb = "cgo_export_dynamic" - } - if verb == "cgo_export_static" || verb == "cgo_export_dynamic" { - local := getimpsym(&q) - var remote string - if local == "" { - goto err2 - } - if !more(&q) { - pragcgobuf += fmt.Sprintf("%s %v\n", verb, plan9quote(local)) - return - } + case len(f) == 4 && !isQuoted(f[1]) && !isQuoted(f[2]) && isQuoted(f[3]): + local := plan9quote(f[1]) + remote := plan9quote(f[2]) + library := plan9quote(strings.Trim(f[3], `"`)) + return fmt.Sprintln(verb, local, remote, library) - remote = getimpsym(&q) - if remote == "" { - goto err2 + default: + Yyerror(`usage: //go:cgo_import_dynamic local [remote ["library"]]`) } - pragcgobuf += fmt.Sprintf("%s %v %v\n", verb, plan9quote(local), plan9quote(remote)) - return - - err2: - Yyerror("usage: //go:%s local [remote]", verb) - return - } + case "cgo_import_static": + switch { + case len(f) == 2 && !isQuoted(f[1]): + local := plan9quote(f[1]) + return fmt.Sprintln(verb, local) - if verb == "cgo_import_dynamic" || verb == "dynimport" { - var ok bool - local := getimpsym(&q) - var p string - var remote string - if local == "" { - goto err3 - } - if !more(&q) { - pragcgobuf += fmt.Sprintf("cgo_import_dynamic %v\n", plan9quote(local)) - return + default: + Yyerror(`usage: //go:cgo_import_static local`) } + case "cgo_dynamic_linker": + switch { + case len(f) == 2 && isQuoted(f[1]): + path := plan9quote(strings.Trim(f[1], `"`)) + return fmt.Sprintln(verb, path) - remote = getimpsym(&q) - if remote == "" { - goto err3 - } - if !more(&q) { - pragcgobuf += fmt.Sprintf("cgo_import_dynamic %v %v\n", plan9quote(local), plan9quote(remote)) - return + default: + Yyerror(`usage: //go:cgo_dynamic_linker "path"`) } + case "cgo_ldflag": + switch { + case len(f) == 2 && isQuoted(f[1]): + arg := plan9quote(strings.Trim(f[1], `"`)) + return fmt.Sprintln(verb, arg) - p, ok = getquoted(&q) - if !ok { - goto err3 + default: + Yyerror(`usage: //go:cgo_ldflag "arg"`) } - pragcgobuf += fmt.Sprintf("cgo_import_dynamic %v %v %v\n", plan9quote(local), plan9quote(remote), plan9quote(p)) - return - - err3: - Yyerror("usage: //go:cgo_import_dynamic local [remote [\"library\"]]") - return } + return "" +} - if verb == "cgo_import_static" { - local := getimpsym(&q) - if local == "" || more(&q) { - Yyerror("usage: //go:cgo_import_static local") - return +// pragmaFields is similar to strings.FieldsFunc(s, isSpace) +// but does not split when inside double quoted regions and always +// splits before the start and after the end of a double quoted region. +// pragmaFields does not recognize escaped quotes. If a quote in s is not +// closed the part after the opening quote will not be returned as a field. +func pragmaFields(s string) []string { + var a []string + inQuote := false + fieldStart := -1 // Set to -1 when looking for start of field. + for i, c := range s { + switch { + case c == '"': + if inQuote { + inQuote = false + a = append(a, s[fieldStart:i+1]) + fieldStart = -1 + } else { + inQuote = true + if fieldStart >= 0 { + a = append(a, s[fieldStart:i]) + } + fieldStart = i + } + case !inQuote && isSpace(c): + if fieldStart >= 0 { + a = append(a, s[fieldStart:i]) + fieldStart = -1 + } + default: + if fieldStart == -1 { + fieldStart = i + } } - pragcgobuf += fmt.Sprintf("cgo_import_static %v\n", plan9quote(local)) - return - } - - if verb == "cgo_ldflag" { - p, ok := getquoted(&q) - if !ok { - Yyerror("usage: //go:cgo_ldflag \"arg\"") - return - } - pragcgobuf += fmt.Sprintf("cgo_ldflag %v\n", plan9quote(p)) - return - + if !inQuote && fieldStart >= 0 { // Last field might end at the end of the string. + a = append(a, s[fieldStart:]) } + return a } func (l *lexer) getr() rune { diff --git a/src/cmd/compile/internal/gc/lex_test.go b/src/cmd/compile/internal/gc/lex_test.go new file mode 100644 index 0000000000..9230b30dad --- /dev/null +++ b/src/cmd/compile/internal/gc/lex_test.go @@ -0,0 +1,79 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package gc + +import "testing" + +func eq(a, b []string) bool { + if len(a) != len(b) { + return false + } + for i := 0; i < len(a); i++ { + if a[i] != b[i] { + return false + } + } + return true +} + +func TestPragmaFields(t *testing.T) { + + var tests = []struct { + in string + want []string + }{ + {"", []string{}}, + {" \t ", []string{}}, + {`""""`, []string{`""`, `""`}}, + {" a'b'c ", []string{"a'b'c"}}, + {"1 2 3 4", []string{"1", "2", "3", "4"}}, + {"\n☺\t☹\n", []string{"☺", "☹"}}, + {`"1 2 " 3 " 4 5"`, []string{`"1 2 "`, `3`, `" 4 5"`}}, + {`"1""2 3""4"`, []string{`"1"`, `"2 3"`, `"4"`}}, + {`12"34"`, []string{`12`, `"34"`}}, + {`12"34 `, []string{`12`}}, + } + + for _, tt := range tests { + got := pragmaFields(tt.in) + if !eq(got, tt.want) { + t.Errorf("pragmaFields(%q) = %v; want %v", tt.in, got, tt.want) + continue + } + } +} + +func TestPragcgo(t *testing.T) { + + var tests = []struct { + in string + want string + }{ + {`go:cgo_export_dynamic local`, "cgo_export_dynamic local\n"}, + {`go:cgo_export_dynamic local remote`, "cgo_export_dynamic local remote\n"}, + {`go:cgo_export_dynamic local' remote'`, "cgo_export_dynamic 'local''' 'remote'''\n"}, + {`go:cgo_export_static local`, "cgo_export_static local\n"}, + {`go:cgo_export_static local remote`, "cgo_export_static local remote\n"}, + {`go:cgo_export_static local' remote'`, "cgo_export_static 'local''' 'remote'''\n"}, + {`go:cgo_import_dynamic local`, "cgo_import_dynamic local\n"}, + {`go:cgo_import_dynamic local remote`, "cgo_import_dynamic local remote\n"}, + {`go:cgo_import_dynamic local remote "library"`, "cgo_import_dynamic local remote library\n"}, + {`go:cgo_import_dynamic local' remote' "lib rary"`, "cgo_import_dynamic 'local''' 'remote''' 'lib rary'\n"}, + {`go:cgo_import_static local`, "cgo_import_static local\n"}, + {`go:cgo_import_static local'`, "cgo_import_static 'local'''\n"}, + {`go:cgo_dynamic_linker "/path/"`, "cgo_dynamic_linker /path/\n"}, + {`go:cgo_dynamic_linker "/p ath/"`, "cgo_dynamic_linker '/p ath/'\n"}, + {`go:cgo_ldflag "arg"`, "cgo_ldflag arg\n"}, + {`go:cgo_ldflag "a rg"`, "cgo_ldflag 'a rg'\n"}, + } + + for _, tt := range tests { + got := pragcgo(tt.in) + if got != tt.want { + t.Errorf("pragcgo(%q) = %q; want %q", tt.in, got, tt.want) + continue + } + } +} diff --git a/src/cmd/compile/internal/gc/main.go b/src/cmd/compile/internal/gc/main.go index 73ecb09fa5..54211e4892 100644 --- a/src/cmd/compile/internal/gc/main.go +++ b/src/cmd/compile/internal/gc/main.go @@ -10,6 +10,7 @@ import ( "bufio" "cmd/compile/internal/ssa" "cmd/internal/obj" + "cmd/internal/sys" "flag" "fmt" "io" @@ -89,22 +90,21 @@ func doversion() { os.Exit(0) } +// supportsDynlink reports whether or not the code generator for the given +// architecture supports the -shared and -dynlink flags. +func supportsDynlink(arch *sys.Arch) bool { + return arch.InFamily(sys.AMD64, sys.ARM, sys.ARM64, sys.I386, sys.PPC64, sys.S390X) +} + func Main() { defer hidePanic() - // Allow GOARCH=thearch.thestring or GOARCH=thearch.thestringsuffix, - // but not other values. - p := obj.Getgoarch() - - if !strings.HasPrefix(p, Thearch.Thestring) { - log.Fatalf("cannot use %cg with GOARCH=%s", Thearch.Thechar, p) - } - goarch = p + goarch = obj.Getgoarch() - Ctxt = obj.Linknew(Thearch.Thelinkarch) + Ctxt = obj.Linknew(Thearch.LinkArch) Ctxt.DiagFunc = Yyerror - Ctxt.Bso = &bstdout - bstdout = *obj.Binitw(os.Stdout) + bstdout = bufio.NewWriter(os.Stdout) + Ctxt.Bso = bstdout localpkg = mkpkg("") localpkg.Prefix = "\"\"" @@ -126,10 +126,6 @@ func Main() { itabpkg.Name = "go.itab" itabpkg.Prefix = "go.itab" // not go%2eitab - typelinkpkg = mkpkg("go.typelink") - typelinkpkg.Name = "go.typelink" - typelinkpkg.Prefix = "go.typelink" // not go%2etypelink - itablinkpkg = mkpkg("go.itablink") itablinkpkg.Name = "go.itablink" itablinkpkg.Prefix = "go.itablink" // not go%2eitablink @@ -141,24 +137,27 @@ func Main() { typepkg = mkpkg("type") typepkg.Name = "type" + // pseudo-package used for map zero values + mappkg = mkpkg("go.map") + mappkg.Name = "go.map" + mappkg.Prefix = "go.map" + goroot = obj.Getgoroot() goos = obj.Getgoos() Nacl = goos == "nacl" if Nacl { - flag_largemodel = 1 + flag_largemodel = true } - outfile = "" - obj.Flagcount("+", "compiling runtime", &compiling_runtime) + flag.BoolVar(&compiling_runtime, "+", false, "compiling runtime") obj.Flagcount("%", "debug non-static initializers", &Debug['%']) obj.Flagcount("A", "for bootstrapping, allow 'any' type", &Debug['A']) obj.Flagcount("B", "disable bounds checking", &Debug['B']) - obj.Flagstr("D", "set relative `path` for local imports", &localimport) + flag.StringVar(&localimport, "D", "", "set relative `path` for local imports") obj.Flagcount("E", "debug symbol export", &Debug['E']) obj.Flagfn1("I", "add `directory` to import search path", addidir) obj.Flagcount("K", "debug missing line numbers", &Debug['K']) - obj.Flagcount("L", "use full (long) path in error messages", &Debug['L']) obj.Flagcount("M", "debug move generation", &Debug['M']) obj.Flagcount("N", "disable optimizations", &Debug['N']) obj.Flagcount("P", "debug peephole optimizer", &Debug['P']) @@ -166,61 +165,52 @@ func Main() { obj.Flagcount("S", "print assembly listing", &Debug['S']) obj.Flagfn0("V", "print compiler version", doversion) obj.Flagcount("W", "debug parse tree after type checking", &Debug['W']) - obj.Flagstr("asmhdr", "write assembly header to `file`", &asmhdr) - obj.Flagstr("buildid", "record `id` as the build id in the export metadata", &buildid) - obj.Flagcount("complete", "compiling complete package (no C or assembly)", &pure_go) - obj.Flagstr("d", "print debug information about items in `list`", &debugstr) + flag.StringVar(&asmhdr, "asmhdr", "", "write assembly header to `file`") + flag.StringVar(&buildid, "buildid", "", "record `id` as the build id in the export metadata") + flag.BoolVar(&pure_go, "complete", false, "compiling complete package (no C or assembly)") + flag.StringVar(&debugstr, "d", "", "print debug information about items in `list`") obj.Flagcount("e", "no limit on number of errors reported", &Debug['e']) obj.Flagcount("f", "debug stack frames", &Debug['f']) obj.Flagcount("g", "debug code generation", &Debug['g']) obj.Flagcount("h", "halt on error", &Debug['h']) obj.Flagcount("i", "debug line number stack", &Debug['i']) obj.Flagfn1("importmap", "add `definition` of the form source=actual to import map", addImportMap) - obj.Flagstr("installsuffix", "set pkg directory `suffix`", &flag_installsuffix) + flag.StringVar(&flag_installsuffix, "installsuffix", "", "set pkg directory `suffix`") obj.Flagcount("j", "debug runtime-initialized variables", &Debug['j']) obj.Flagcount("l", "disable inlining", &Debug['l']) obj.Flagcount("live", "debug liveness analysis", &debuglive) obj.Flagcount("m", "print optimization decisions", &Debug['m']) - obj.Flagcount("msan", "build code compatible with C/C++ memory sanitizer", &flag_msan) - obj.Flagcount("newexport", "use new export format", &newexport) // TODO(gri) remove eventually (issue 13241) - obj.Flagcount("nolocalimports", "reject local (relative) imports", &nolocalimports) - obj.Flagstr("o", "write output to `file`", &outfile) - obj.Flagstr("p", "set expected package import `path`", &myimportpath) - obj.Flagcount("pack", "write package file instead of object file", &writearchive) + flag.BoolVar(&flag_msan, "msan", false, "build code compatible with C/C++ memory sanitizer") + flag.BoolVar(&newexport, "newexport", true, "use new export format") // TODO(gri) remove eventually (issue 15323) + flag.BoolVar(&nolocalimports, "nolocalimports", false, "reject local (relative) imports") + flag.StringVar(&outfile, "o", "", "write output to `file`") + flag.StringVar(&myimportpath, "p", "", "set expected package import `path`") + flag.BoolVar(&writearchive, "pack", false, "write package file instead of object file") obj.Flagcount("r", "debug generated wrappers", &Debug['r']) - obj.Flagcount("race", "enable race detector", &flag_race) + flag.BoolVar(&flag_race, "race", false, "enable race detector") obj.Flagcount("s", "warn about composite literals that can be simplified", &Debug['s']) - obj.Flagstr("trimpath", "remove `prefix` from recorded source file paths", &Ctxt.LineHist.TrimPathPrefix) - obj.Flagcount("u", "reject unsafe code", &safemode) + flag.StringVar(&Ctxt.LineHist.TrimPathPrefix, "trimpath", "", "remove `prefix` from recorded source file paths") + flag.BoolVar(&safemode, "u", false, "reject unsafe code") obj.Flagcount("v", "increase debug verbosity", &Debug['v']) obj.Flagcount("w", "debug type checking", &Debug['w']) - use_writebarrier = 1 - obj.Flagcount("wb", "enable write barrier", &use_writebarrier) + flag.BoolVar(&use_writebarrier, "wb", true, "enable write barrier") obj.Flagcount("x", "debug lexer", &Debug['x']) - obj.Flagcount("y", "debug declarations in canned imports (with -d)", &Debug['y']) - var flag_shared int + var flag_shared bool var flag_dynlink bool - switch Thearch.Thechar { - case '5', '6', '7', '8', '9': - obj.Flagcount("shared", "generate code that can be linked into a shared library", &flag_shared) - } - if Thearch.Thechar == '6' { - obj.Flagcount("largemodel", "generate code that assumes a large memory model", &flag_largemodel) - } - switch Thearch.Thechar { - case '5', '6', '7', '8', '9': + if supportsDynlink(Thearch.LinkArch.Arch) { + flag.BoolVar(&flag_shared, "shared", false, "generate code that can be linked into a shared library") flag.BoolVar(&flag_dynlink, "dynlink", false, "support references to Go symbols defined in other shared libraries") } - obj.Flagstr("cpuprofile", "write cpu profile to `file`", &cpuprofile) - obj.Flagstr("memprofile", "write memory profile to `file`", &memprofile) - obj.Flagint64("memprofilerate", "set runtime.MemProfileRate to `rate`", &memprofilerate) + if Thearch.LinkArch.Family == sys.AMD64 { + flag.BoolVar(&flag_largemodel, "largemodel", false, "generate code that assumes a large memory model") + } + flag.StringVar(&cpuprofile, "cpuprofile", "", "write cpu profile to `file`") + flag.StringVar(&memprofile, "memprofile", "", "write memory profile to `file`") + flag.Int64Var(&memprofilerate, "memprofilerate", 0, "set runtime.MemProfileRate to `rate`") flag.BoolVar(&ssaEnabled, "ssa", true, "use SSA backend to generate code") obj.Flagparse(usage) - if flag_dynlink { - flag_shared = 1 - } - Ctxt.Flag_shared = int32(flag_shared) + Ctxt.Flag_shared = flag_dynlink || flag_shared Ctxt.Flag_dynlink = flag_dynlink Ctxt.Flag_optimize = Debug['N'] == 0 @@ -233,17 +223,17 @@ func Main() { startProfile() - if flag_race != 0 { + if flag_race { racepkg = mkpkg("runtime/race") racepkg.Name = "race" } - if flag_msan != 0 { + if flag_msan { msanpkg = mkpkg("runtime/msan") msanpkg.Name = "msan" } - if flag_race != 0 && flag_msan != 0 { + if flag_race && flag_msan { log.Fatal("cannot use both -race and -msan") - } else if flag_race != 0 || flag_msan != 0 { + } else if flag_race || flag_msan { instrumenting = true } @@ -301,9 +291,9 @@ func Main() { } Thearch.Betypeinit() - if Widthptr == 0 { - Fatalf("betypeinit failed") - } + Widthint = Thearch.LinkArch.IntSize + Widthptr = Thearch.LinkArch.PtrSize + Widthreg = Thearch.LinkArch.RegSize initUniverse() @@ -422,7 +412,7 @@ func Main() { // Typecheck imported function bodies if debug['l'] > 1, // otherwise lazily when used or re-exported. for _, n := range importlist { - if len(n.Func.Inl.Slice()) != 0 { + if n.Func.Inl.Len() != 0 { saveerrors() typecheckinl(n) } @@ -479,7 +469,7 @@ func Main() { fninit(xtop) } - if compiling_runtime != 0 { + if compiling_runtime { checknowritebarrierrec() } @@ -577,7 +567,7 @@ func islocalname(name string) bool { func findpkg(name string) (file string, ok bool) { if islocalname(name) { - if safemode != 0 || nolocalimports != 0 { + if safemode || nolocalimports { return "", false } @@ -620,10 +610,10 @@ func findpkg(name string) (file string, ok bool) { if flag_installsuffix != "" { suffixsep = "_" suffix = flag_installsuffix - } else if flag_race != 0 { + } else if flag_race { suffixsep = "_" suffix = "race" - } else if flag_msan != 0 { + } else if flag_msan { suffixsep = "_" suffix = "msan" } @@ -653,11 +643,24 @@ func loadsys() { iota_ = -1000000 incannedimport = 1 - importpkg = Runtimepkg - parse_import(bufio.NewReader(strings.NewReader(runtimeimport)), nil) - - importpkg = unsafepkg - parse_import(bufio.NewReader(strings.NewReader(unsafeimport)), nil) + // The first byte in the binary export format is a 'c' or 'd' + // specifying the encoding format. We could just check that + // byte, but this is a perhaps more robust. Also, it is not + // speed-critical. + // TODO(gri) simplify once textual export format has gone + if strings.HasPrefix(runtimeimport, "package") { + // textual export format + importpkg = Runtimepkg + parse_import(bufio.NewReader(strings.NewReader(runtimeimport)), nil) + importpkg = unsafepkg + parse_import(bufio.NewReader(strings.NewReader(unsafeimport)), nil) + } else { + // binary export format + importpkg = Runtimepkg + Import(bufio.NewReader(strings.NewReader(runtimeimport))) + importpkg = unsafepkg + Import(bufio.NewReader(strings.NewReader(unsafeimport))) + } importpkg = nil incannedimport = 0 @@ -702,7 +705,7 @@ func importfile(f *Val, indent []byte) { } if path_ == "unsafe" { - if safemode != 0 { + if safemode { Yyerror("cannot import package unsafe") errorexit() } @@ -826,7 +829,7 @@ func importfile(f *Val, indent []byte) { errorexit() } - if safemode != 0 && !importpkg.Safe { + if safemode && !importpkg.Safe { Yyerror("cannot import unsafe package %q", importpkg.Path) } } @@ -904,7 +907,7 @@ func mkpackage(pkgname string) { p = p[:i] } suffix := ".o" - if writearchive > 0 { + if writearchive { suffix = ".a" } outfile = p + suffix diff --git a/src/cmd/compile/internal/gc/obj.go b/src/cmd/compile/internal/gc/obj.go index 99eb73bd94..c1132b6aac 100644 --- a/src/cmd/compile/internal/gc/obj.go +++ b/src/cmd/compile/internal/gc/obj.go @@ -5,6 +5,7 @@ package gc import ( + "cmd/internal/bio" "cmd/internal/obj" "crypto/sha256" "fmt" @@ -23,7 +24,7 @@ func formathdr(arhdr []byte, name string, size int64) { func dumpobj() { var err error - bout, err = obj.Bopenw(outfile) + bout, err = bio.Create(outfile) if err != nil { Flusherrors() fmt.Printf("can't create %s: %v\n", outfile, err) @@ -32,36 +33,36 @@ func dumpobj() { startobj := int64(0) var arhdr [ArhdrSize]byte - if writearchive != 0 { - obj.Bwritestring(bout, "!<arch>\n") + if writearchive { + bout.WriteString("!<arch>\n") arhdr = [ArhdrSize]byte{} bout.Write(arhdr[:]) - startobj = obj.Boffset(bout) + startobj = bout.Offset() } fmt.Fprintf(bout, "go object %s %s %s %s\n", obj.Getgoos(), obj.Getgoarch(), obj.Getgoversion(), obj.Expstring()) dumpexport() - if writearchive != 0 { + if writearchive { bout.Flush() - size := obj.Boffset(bout) - startobj + size := bout.Offset() - startobj if size&1 != 0 { - obj.Bputc(bout, 0) + bout.WriteByte(0) } - obj.Bseek(bout, startobj-ArhdrSize, 0) + bout.Seek(startobj-ArhdrSize, 0) formathdr(arhdr[:], "__.PKGDEF", size) bout.Write(arhdr[:]) bout.Flush() - obj.Bseek(bout, startobj+size+(size&1), 0) + bout.Seek(startobj+size+(size&1), 0) arhdr = [ArhdrSize]byte{} bout.Write(arhdr[:]) - startobj = obj.Boffset(bout) + startobj = bout.Offset() fmt.Fprintf(bout, "go object %s %s %s %s\n", obj.Getgoos(), obj.Getgoarch(), obj.Getgoversion(), obj.Expstring()) } if pragcgobuf != "" { - if writearchive != 0 { + if writearchive { // write empty export section; must be before cgo section fmt.Fprintf(bout, "\n$$\n\n$$\n\n") } @@ -86,21 +87,26 @@ func dumpobj() { dumpglobls() externdcl = tmp + if zerosize > 0 { + zero := Pkglookup("zero", mappkg) + ggloblsym(zero, int32(zerosize), obj.DUPOK|obj.RODATA) + } + dumpdata() - obj.Writeobjdirect(Ctxt, bout) + obj.Writeobjdirect(Ctxt, bout.Writer) - if writearchive != 0 { + if writearchive { bout.Flush() - size := obj.Boffset(bout) - startobj + size := bout.Offset() - startobj if size&1 != 0 { - obj.Bputc(bout, 0) + bout.WriteByte(0) } - obj.Bseek(bout, startobj-ArhdrSize, 0) + bout.Seek(startobj-ArhdrSize, 0) formathdr(arhdr[:], "_go_.o", size) bout.Write(arhdr[:]) } - obj.Bterm(bout) + bout.Close() } func dumpglobls() { @@ -132,9 +138,9 @@ func dumpglobls() { funcsyms = nil } -func Bputname(b *obj.Biobuf, s *obj.LSym) { - obj.Bwritestring(b, s.Name) - obj.Bputc(b, 0) +func Bputname(b *bio.Writer, s *obj.LSym) { + b.WriteString(s.Name) + b.WriteByte(0) } func Linksym(s *Sym) *obj.LSym { @@ -320,9 +326,15 @@ func dsymptrLSym(s *obj.LSym, off int, x *obj.LSym, xoff int) int { return off } +func dsymptrOffLSym(s *obj.LSym, off int, x *obj.LSym, xoff int) int { + s.WriteOff(Ctxt, int64(off), x, int64(xoff)) + off += 4 + return off +} + func gdata(nam *Node, nr *Node, wid int) { if nam.Op != ONAME { - Fatalf("gdata nam op %v", opnames[nam.Op]) + Fatalf("gdata nam op %v", nam.Op) } if nam.Sym == nil { Fatalf("gdata nil nam sym") @@ -330,20 +342,23 @@ func gdata(nam *Node, nr *Node, wid int) { switch nr.Op { case OLITERAL: - switch nr.Val().Ctype() { - case CTCPLX: - gdatacomplex(nam, nr.Val().U.(*Mpcplx)) + switch u := nr.Val().U.(type) { + case *Mpcplx: + gdatacomplex(nam, u) - case CTSTR: - gdatastring(nam, nr.Val().U.(string)) + case string: + gdatastring(nam, u) - case CTINT, CTRUNE, CTBOOL: - i, _ := nr.IntLiteral() + case bool: + i := int64(obj.Bool2int(u)) Linksym(nam.Sym).WriteInt(Ctxt, nam.Xoffset, wid, i) - case CTFLT: + case *Mpint: + Linksym(nam.Sym).WriteInt(Ctxt, nam.Xoffset, wid, u.Int64()) + + case *Mpflt: s := Linksym(nam.Sym) - f := nr.Val().U.(*Mpflt).Float64() + f := u.Float64() switch nam.Type.Etype { case TFLOAT32: s.WriteFloat32(Ctxt, nam.Xoffset, float32(f)) @@ -357,7 +372,7 @@ func gdata(nam *Node, nr *Node, wid int) { case OADDR: if nr.Left.Op != ONAME { - Fatalf("gdata ADDR left op %s", opnames[nr.Left.Op]) + Fatalf("gdata ADDR left op %s", nr.Left.Op) } to := nr.Left Linksym(nam.Sym).WriteAddr(Ctxt, nam.Xoffset, wid, Linksym(to.Sym), to.Xoffset) @@ -369,7 +384,7 @@ func gdata(nam *Node, nr *Node, wid int) { Linksym(nam.Sym).WriteAddr(Ctxt, nam.Xoffset, wid, Linksym(funcsym(nr.Sym)), nr.Xoffset) default: - Fatalf("gdata unhandled op %v %v\n", nr, opnames[nr.Op]) + Fatalf("gdata unhandled op %v %v\n", nr, nr.Op) } } diff --git a/src/cmd/compile/internal/gc/opnames.go b/src/cmd/compile/internal/gc/opnames.go index df0d8cb7fb..015baa2376 100644 --- a/src/cmd/compile/internal/gc/opnames.go +++ b/src/cmd/compile/internal/gc/opnames.go @@ -160,9 +160,9 @@ var opnames = []string{ OLROT: "LROT", ORROTC: "RROTC", ORETJMP: "RETJMP", - OPS: "OPS", - OPC: "OPC", - OSQRT: "OSQRT", - OGETG: "OGETG", + OPS: "PS", + OPC: "PC", + OSQRT: "SQRT", + OGETG: "GETG", OEND: "END", } diff --git a/src/cmd/compile/internal/gc/order.go b/src/cmd/compile/internal/gc/order.go index 8410a236cd..7026ad79ef 100644 --- a/src/cmd/compile/internal/gc/order.go +++ b/src/cmd/compile/internal/gc/order.go @@ -165,7 +165,7 @@ func ordersafeexpr(n *Node, order *Order) *Node { a.Right = r return typecheck(&a, Erv) default: - Fatalf("ordersafeexpr %v", Oconv(n.Op, 0)) + Fatalf("ordersafeexpr %v", n.Op) return nil // not reached } } @@ -324,7 +324,7 @@ func ismulticall(l Nodes) bool { // Copyret emits t1, t2, ... = n, where n is a function call, // and then returns the list t1, t2, .... func copyret(n *Node, order *Order) []*Node { - if !n.Type.IsStruct() || !n.Type.Funarg { + if !n.Type.IsFuncArgStruct() { Fatalf("copyret %v %d", n.Type, n.Left.Type.Results().NumFields()) } @@ -373,7 +373,7 @@ func ordercall(n *Node, order *Order) { if t == nil { break } - if t.Note != nil && *t.Note == unsafeUintptrTag { + if t.Note == unsafeUintptrTag { xp := n.List.Addr(i) for (*xp).Op == OCONVNOP && !(*xp).Type.IsPtr() { xp = &(*xp).Left @@ -416,7 +416,7 @@ func ordercall(n *Node, order *Order) { func ordermapassign(n *Node, order *Order) { switch n.Op { default: - Fatalf("ordermapassign %v", Oconv(n.Op, 0)) + Fatalf("ordermapassign %v", n.Op) case OAS: order.out = append(order.out, n) @@ -478,7 +478,7 @@ func orderstmt(n *Node, order *Order) { switch n.Op { default: - Fatalf("orderstmt %v", Oconv(n.Op, 0)) + Fatalf("orderstmt %v", n.Op) case OVARKILL, OVARLIVE: order.out = append(order.out, n) @@ -731,7 +731,7 @@ func orderstmt(n *Node, order *Order) { default: Fatalf("orderstmt range %v", n.Type) - case TARRAY: + case TARRAY, TSLICE: if n.List.Len() < 2 || isblank(n.List.Second()) { // for i := range x will only use x once, to compute len(x). // No need to copy it. @@ -790,7 +790,7 @@ func orderstmt(n *Node, order *Order) { var r *Node for _, n2 := range n.List.Slice() { if n2.Op != OXCASE { - Fatalf("order select case %v", Oconv(n2.Op, 0)) + Fatalf("order select case %v", n2.Op) } r = n2.Left setlineno(n2) @@ -803,7 +803,7 @@ func orderstmt(n *Node, order *Order) { if r != nil { switch r.Op { default: - Yyerror("unknown op in select %v", Oconv(r.Op, 0)) + Yyerror("unknown op in select %v", r.Op) Dump("select case", r) // If this is case x := <-ch or case x, y := <-ch, the case has @@ -943,7 +943,7 @@ func orderstmt(n *Node, order *Order) { n.Left = orderexpr(n.Left, order, nil) for _, n4 := range n.List.Slice() { if n4.Op != OXCASE { - Fatalf("order switch case %v", Oconv(n4.Op, 0)) + Fatalf("order switch case %v", n4.Op) } orderexprlistinplace(n4.List, order) orderblockNodes(&n4.Nbody) @@ -1123,30 +1123,22 @@ func orderexpr(n *Node, order *Order, lhs *Node) *Node { n = ordercopyexpr(n, n.Type, order, 0) } - case OSLICE, OSLICEARR, OSLICESTR: + case OSLICE, OSLICEARR, OSLICESTR, OSLICE3, OSLICE3ARR: n.Left = orderexpr(n.Left, order, nil) - n.Right.Left = orderexpr(n.Right.Left, order, nil) - n.Right.Left = ordercheapexpr(n.Right.Left, order) - n.Right.Right = orderexpr(n.Right.Right, order, nil) - n.Right.Right = ordercheapexpr(n.Right.Right, order) - if lhs == nil || lhs.Op != ONAME && !samesafeexpr(lhs, n.Left) { - n = ordercopyexpr(n, n.Type, order, 0) - } - - case OSLICE3, OSLICE3ARR: - n.Left = orderexpr(n.Left, order, nil) - n.Right.Left = orderexpr(n.Right.Left, order, nil) - n.Right.Left = ordercheapexpr(n.Right.Left, order) - n.Right.Right.Left = orderexpr(n.Right.Right.Left, order, nil) - n.Right.Right.Left = ordercheapexpr(n.Right.Right.Left, order) - n.Right.Right.Right = orderexpr(n.Right.Right.Right, order, nil) - n.Right.Right.Right = ordercheapexpr(n.Right.Right.Right, order) + low, high, max := n.SliceBounds() + low = orderexpr(low, order, nil) + low = ordercheapexpr(low, order) + high = orderexpr(high, order, nil) + high = ordercheapexpr(high, order) + max = orderexpr(max, order, nil) + max = ordercheapexpr(max, order) + n.SetSliceBounds(low, high, max) if lhs == nil || lhs.Op != ONAME && !samesafeexpr(lhs, n.Left) { n = ordercopyexpr(n, n.Type, order, 0) } case OCLOSURE: - if n.Noescape && len(n.Func.Cvars.Slice()) > 0 { + if n.Noescape && n.Func.Cvars.Len() > 0 { prealloc[n] = ordertemp(Types[TUINT8], order, false) // walk will fill in correct type } diff --git a/src/cmd/compile/internal/gc/parser.go b/src/cmd/compile/internal/gc/parser.go index 6538877e68..55f352590b 100644 --- a/src/cmd/compile/internal/gc/parser.go +++ b/src/cmd/compile/internal/gc/parser.go @@ -102,6 +102,9 @@ func (p *parser) syntax_error(msg string) { tok = "name" } case LLITERAL: + if litbuf == "" { + litbuf = "literal " + lexbuf.String() + } tok = litbuf case LOPER: tok = goopnames[p.op] @@ -1408,20 +1411,17 @@ loop: } x = Nod(OINDEX, x, i) case 1: - i := index[0] - j := index[1] - x = Nod(OSLICE, x, Nod(OKEY, i, j)) + x = Nod(OSLICE, x, nil) + x.SetSliceBounds(index[0], index[1], nil) case 2: - i := index[0] - j := index[1] - k := index[2] - if j == nil { + if index[1] == nil { Yyerror("middle index required in 3-index slice") } - if k == nil { + if index[2] == nil { Yyerror("final index required in 3-index slice") } - x = Nod(OSLICE3, x, Nod(OKEY, i, Nod(OKEY, j, k))) + x = Nod(OSLICE3, x, nil) + x.SetSliceBounds(index[0], index[1], index[2]) default: panic("unreachable") @@ -2906,7 +2906,7 @@ func (p *parser) hidden_import() { if Debug['E'] > 0 { fmt.Printf("import [%q] func %v \n", importpkg.Path, s2) - if Debug['m'] > 2 && len(s2.Func.Inl.Slice()) != 0 { + if Debug['m'] > 2 && s2.Func.Inl.Len() != 0 { fmt.Printf("inl body:%v\n", s2.Func.Inl) } } @@ -3246,17 +3246,14 @@ func (p *parser) hidden_literal() *Node { if p.tok == LLITERAL { ss := nodlit(p.val) p.next() - switch ss.Val().Ctype() { - case CTINT, CTRUNE: - ss.Val().U.(*Mpint).Neg() - break - case CTFLT: - ss.Val().U.(*Mpflt).Neg() - break - case CTCPLX: - ss.Val().U.(*Mpcplx).Real.Neg() - ss.Val().U.(*Mpcplx).Imag.Neg() - break + switch u := ss.Val().U.(type) { + case *Mpint: + u.Neg() + case *Mpflt: + u.Neg() + case *Mpcplx: + u.Real.Neg() + u.Imag.Neg() default: Yyerror("bad negated constant") } diff --git a/src/cmd/compile/internal/gc/pgen.go b/src/cmd/compile/internal/gc/pgen.go index efe10a419c..984d468bc6 100644 --- a/src/cmd/compile/internal/gc/pgen.go +++ b/src/cmd/compile/internal/gc/pgen.go @@ -7,6 +7,7 @@ package gc import ( "cmd/compile/internal/ssa" "cmd/internal/obj" + "cmd/internal/sys" "crypto/md5" "fmt" "sort" @@ -90,7 +91,7 @@ func gvardefx(n *Node, as obj.As) { Fatalf("gvardef nil") } if n.Op != ONAME { - Yyerror("gvardef %v; %v", Oconv(n.Op, FmtSharp), n) + Yyerror("gvardef %v; %v", oconv(n.Op, FmtSharp), n) return } @@ -286,7 +287,7 @@ func allocauto(ptxt *obj.Prog) { if haspointers(n.Type) { stkptrsize = Stksize } - if Thearch.Thechar == '0' || Thearch.Thechar == '5' || Thearch.Thechar == '7' || Thearch.Thechar == '9' { + if Thearch.LinkArch.InFamily(sys.MIPS64, sys.ARM, sys.ARM64, sys.PPC64, sys.S390X) { Stksize = Rnd(Stksize, int64(Widthptr)) } if Stksize >= 1<<31 { @@ -323,7 +324,12 @@ func Cgen_checknil(n *Node) { Fatalf("bad checknil") } - if ((Thearch.Thechar == '0' || Thearch.Thechar == '5' || Thearch.Thechar == '7' || Thearch.Thechar == '9') && n.Op != OREGISTER) || !n.Addable || n.Op == OLITERAL { + // Most architectures require that the address to be checked is + // in a register (it could be in memory). + needsReg := !Thearch.LinkArch.InFamily(sys.AMD64, sys.I386) + + // Move the address to be checked into a register if necessary. + if (needsReg && n.Op != OREGISTER) || !n.Addable || n.Op == OLITERAL { var reg Node Regalloc(®, Types[Tptr], n) Cgen(n, ®) @@ -357,8 +363,8 @@ func compile(fn *Node) { Curfn = fn dowidth(Curfn.Type) - if len(fn.Nbody.Slice()) == 0 { - if pure_go != 0 || strings.HasPrefix(fn.Func.Nname.Sym.Name, "init.") { + if fn.Nbody.Len() == 0 { + if pure_go || strings.HasPrefix(fn.Func.Nname.Sym.Name, "init.") { Yyerror("missing function body for %q", fn.Func.Nname.Sym.Name) return } @@ -375,7 +381,7 @@ func compile(fn *Node) { // set up domain for labels clearlabels() - if Curfn.Type.Outnamed { + if Curfn.Type.FuncType().Outnamed { // add clearing of the output parameters for _, t := range Curfn.Type.Results().Fields().Slice() { if t.Nname != nil { diff --git a/src/cmd/compile/internal/gc/pgen_test.go b/src/cmd/compile/internal/gc/pgen_test.go index fcb8bfa0c2..44dc1db12e 100644 --- a/src/cmd/compile/internal/gc/pgen_test.go +++ b/src/cmd/compile/internal/gc/pgen_test.go @@ -10,6 +10,14 @@ import ( "testing" ) +func typeWithoutPointers() *Type { + return &Type{Etype: TSTRUCT, Extra: &StructType{Haspointers: 1}} // haspointers -> false +} + +func typeWithPointers() *Type { + return &Type{Etype: TSTRUCT, Extra: &StructType{Haspointers: 2}} // haspointers -> true +} + // Test all code paths for cmpstackvarlt. func TestCmpstackvar(t *testing.T) { testdata := []struct { @@ -62,13 +70,13 @@ func TestCmpstackvar(t *testing.T) { false, }, { - Node{Class: PAUTO, Type: &Type{Haspointers: 1}}, // haspointers -> false - Node{Class: PAUTO, Type: &Type{Haspointers: 2}}, // haspointers -> true + Node{Class: PAUTO, Type: typeWithoutPointers()}, + Node{Class: PAUTO, Type: typeWithPointers()}, false, }, { - Node{Class: PAUTO, Type: &Type{Haspointers: 2}}, // haspointers -> true - Node{Class: PAUTO, Type: &Type{Haspointers: 1}}, // haspointers -> false + Node{Class: PAUTO, Type: typeWithPointers()}, + Node{Class: PAUTO, Type: typeWithoutPointers()}, true, }, { @@ -127,7 +135,7 @@ func TestStackvarSort(t *testing.T) { {Class: PFUNC, Xoffset: 10, Type: &Type{}, Name: &Name{}, Sym: &Sym{}}, {Class: PFUNC, Xoffset: 20, Type: &Type{}, Name: &Name{}, Sym: &Sym{}}, {Class: PAUTO, Used: true, Type: &Type{}, Name: &Name{}, Sym: &Sym{}}, - {Class: PAUTO, Type: &Type{Haspointers: 1}, Name: &Name{}, Sym: &Sym{}}, // haspointers -> false + {Class: PAUTO, Type: typeWithoutPointers(), Name: &Name{}, Sym: &Sym{}}, {Class: PAUTO, Type: &Type{}, Name: &Name{}, Sym: &Sym{}}, {Class: PAUTO, Type: &Type{}, Name: &Name{Needzero: true}, Sym: &Sym{}}, {Class: PAUTO, Type: &Type{Width: 1}, Name: &Name{}, Sym: &Sym{}}, @@ -148,7 +156,7 @@ func TestStackvarSort(t *testing.T) { {Class: PAUTO, Type: &Type{}, Name: &Name{}, Sym: &Sym{}}, {Class: PAUTO, Type: &Type{}, Name: &Name{}, Sym: &Sym{Name: "abc"}}, {Class: PAUTO, Type: &Type{}, Name: &Name{}, Sym: &Sym{Name: "xyz"}}, - {Class: PAUTO, Type: &Type{Haspointers: 1}, Name: &Name{}, Sym: &Sym{}}, // haspointers -> false + {Class: PAUTO, Type: typeWithoutPointers(), Name: &Name{}, Sym: &Sym{}}, } // haspointers updates Type.Haspointers as a side effect, so // exercise this function on all inputs so that reflect.DeepEqual diff --git a/src/cmd/compile/internal/gc/plive.go b/src/cmd/compile/internal/gc/plive.go index 43f594e2ea..e04c8563b1 100644 --- a/src/cmd/compile/internal/gc/plive.go +++ b/src/cmd/compile/internal/gc/plive.go @@ -17,6 +17,7 @@ package gc import ( "cmd/internal/obj" + "cmd/internal/sys" "fmt" "sort" "strings" @@ -917,18 +918,17 @@ func onebitwalktype1(t *Type, xoffset *int64, bv Bvec) { bvset(bv, int32(*xoffset/int64(Widthptr)+1)) // pointer in second slot *xoffset += t.Width + case TSLICE: + // struct { byte *array; uintgo len; uintgo cap; } + if *xoffset&int64(Widthptr-1) != 0 { + Fatalf("onebitwalktype1: invalid TARRAY alignment, %v", t) + } + bvset(bv, int32(*xoffset/int64(Widthptr))) // pointer in first slot (BitsPointer) + *xoffset += t.Width + case TARRAY: - if t.IsSlice() { - // struct { byte *array; uintgo len; uintgo cap; } - if *xoffset&int64(Widthptr-1) != 0 { - Fatalf("onebitwalktype1: invalid TARRAY alignment, %v", t) - } - bvset(bv, int32(*xoffset/int64(Widthptr))) // pointer in first slot (BitsPointer) - *xoffset += t.Width - } else { - for i := int64(0); i < t.NumElem(); i++ { - onebitwalktype1(t.Elem(), xoffset, bv) - } + for i := int64(0); i < t.NumElem(); i++ { + onebitwalktype1(t.Elem(), xoffset, bv) } case TSTRUCT: @@ -1396,7 +1396,7 @@ func livenessepilogue(lv *Liveness) { // The instruction before a call to deferreturn is always a // no-op, to keep PC-specific data unambiguous. prev := p.Opt.(*obj.Prog) - if Ctxt.Arch.Thechar == '9' { + if Ctxt.Arch.Family == sys.PPC64 { // On ppc64 there is an additional instruction // (another no-op or reload of toc pointer) before // the call. diff --git a/src/cmd/compile/internal/gc/popt.go b/src/cmd/compile/internal/gc/popt.go index 41f8ba9fcc..001a715f7b 100644 --- a/src/cmd/compile/internal/gc/popt.go +++ b/src/cmd/compile/internal/gc/popt.go @@ -235,6 +235,34 @@ func fixjmp(firstp *obj.Prog) { // for every f.Data field, for use by the client. // If newData is nil, f.Data will be nil. +type Graph struct { + Start *Flow + Num int + + // After calling flowrpo, rpo lists the flow nodes in reverse postorder, + // and each non-dead Flow node f has g->rpo[f->rpo] == f. + Rpo []*Flow +} + +type Flow struct { + Prog *obj.Prog // actual instruction + P1 *Flow // predecessors of this instruction: p1, + P2 *Flow // and then p2 linked though p2link. + P2link *Flow + S1 *Flow // successors of this instruction (at most two: s1 and s2). + S2 *Flow + Link *Flow // next instruction in function code + + Active int32 // usable by client + + Id int32 // sequence number in flow graph + Rpo int32 // reverse post ordering + Loop uint16 // x5 for every loop + Refset bool // diagnostic generated + + Data interface{} // for use by client +} + var flowmark int // MaxFlowProg is the maximum size program (counted in instructions) diff --git a/src/cmd/compile/internal/gc/racewalk.go b/src/cmd/compile/internal/gc/racewalk.go index 09889a40f3..5bcaf89d50 100644 --- a/src/cmd/compile/internal/gc/racewalk.go +++ b/src/cmd/compile/internal/gc/racewalk.go @@ -54,14 +54,14 @@ func instrument(fn *Node) { return } - if flag_race == 0 || !ispkgin(norace_inst_pkgs) { + if !flag_race || !ispkgin(norace_inst_pkgs) { instrumentlist(fn.Nbody, nil) // nothing interesting for race detector in fn->enter instrumentlist(fn.Func.Exit, nil) } - if flag_race != 0 { + if flag_race { // nodpc is the PC of the caller as extracted by // getcallerpc. We use -widthptr(FP) for x86. // BUG: this will not work on arm. @@ -132,7 +132,7 @@ func instrumentnode(np **Node, init *Nodes, wr int, skip int) { switch n.Op { default: - Fatalf("instrument: unknown node type %v", Oconv(n.Op, 0)) + Fatalf("instrument: unknown node type %v", n.Op) case OAS, OASWB, OAS2FUNC: instrumentnode(&n.Left, init, 1, 0) @@ -164,7 +164,13 @@ func instrumentnode(np **Node, init *Nodes, wr int, skip int) { var outn Nodes outn.Set(out) instrumentnode(&ls[i], &outn, 0, 0) - out = append(outn.Slice(), ls[i]) + if ls[i].Op != OAS || ls[i].Ninit.Len() == 0 { + out = append(outn.Slice(), ls[i]) + } else { + // Splice outn onto end of ls[i].Ninit + ls[i].Ninit.AppendNodes(&outn) + out = append(out, ls[i]) + } } } n.List.Set(out) @@ -301,7 +307,11 @@ func instrumentnode(np **Node, init *Nodes, wr int, skip int) { case OSLICE, OSLICEARR, OSLICE3, OSLICE3ARR, OSLICESTR: instrumentnode(&n.Left, init, 0, 0) - instrumentnode(&n.Right, init, 0, 0) + low, high, max := n.SliceBounds() + instrumentnode(&low, init, 0, 0) + instrumentnode(&high, init, 0, 0) + instrumentnode(&max, init, 0, 0) + n.SetSliceBounds(low, high, max) goto ret case OKEY: @@ -364,13 +374,13 @@ func instrumentnode(np **Node, init *Nodes, wr int, skip int) { OAS2RECV, OAS2MAPR, OASOP: - Yyerror("instrument: %v must be lowered by now", Oconv(n.Op, 0)) + Yyerror("instrument: %v must be lowered by now", n.Op) goto ret // impossible nodes: only appear in backend. case ORROTC, OEXTEND: - Yyerror("instrument: %v cannot exist now", Oconv(n.Op, 0)) + Yyerror("instrument: %v cannot exist now", n.Op) goto ret case OGETG: @@ -497,7 +507,7 @@ func callinstr(np **Node, init *Nodes, wr int, skip int) bool { n = treecopy(n, 0) makeaddable(n) var f *Node - if flag_msan != 0 { + if flag_msan { name := "msanread" if wr != 0 { name = "msanwrite" @@ -509,7 +519,7 @@ func callinstr(np **Node, init *Nodes, wr int, skip int) bool { Fatalf("instrument: %v badwidth", t) } f = mkcall(name, nil, init, uintptraddr(n), Nodintconst(w)) - } else if flag_race != 0 && (t.IsStruct() || t.IsArray()) { + } else if flag_race && (t.IsStruct() || t.IsArray()) { name := "racereadrange" if wr != 0 { name = "racewriterange" @@ -521,7 +531,7 @@ func callinstr(np **Node, init *Nodes, wr int, skip int) bool { Fatalf("instrument: %v badwidth", t) } f = mkcall(name, nil, init, uintptraddr(n), Nodintconst(w)) - } else if flag_race != 0 { + } else if flag_race { name := "raceread" if wr != 0 { name = "racewrite" diff --git a/src/cmd/compile/internal/gc/range.go b/src/cmd/compile/internal/gc/range.go index 6adf8e0d6d..9d3f79cdce 100644 --- a/src/cmd/compile/internal/gc/range.go +++ b/src/cmd/compile/internal/gc/range.go @@ -49,7 +49,7 @@ func typecheckrange(n *Node) { Yyerror("cannot range over %v", Nconv(n.Right, FmtLong)) goto out - case TARRAY: + case TARRAY, TSLICE: t1 = Types[TINT] t2 = t.Elem() @@ -154,7 +154,7 @@ func walkrange(n *Node) { v2 = n.List.Second() } - // n->list has no meaning anymore, clear it + // n.List has no meaning anymore, clear it // to avoid erroneous processing by racewalk. n.List.Set(nil) @@ -164,7 +164,7 @@ func walkrange(n *Node) { default: Fatalf("walkrange") - case TARRAY: + case TARRAY, TSLICE: if memclrrange(n, v1, v2, a) { lineno = lno return @@ -217,9 +217,9 @@ func walkrange(n *Node) { n.Right.Ninit.Set1(a) } - // orderstmt allocated the iterator for us. - // we only use a once, so no copy needed. case TMAP: + // orderstmt allocated the iterator for us. + // we only use a once, so no copy needed. ha := a th := hiter(t) @@ -254,8 +254,8 @@ func walkrange(n *Node) { body = []*Node{a} } - // orderstmt arranged for a copy of the channel variable. case TCHAN: + // orderstmt arranged for a copy of the channel variable. ha := a n.Left = nil @@ -278,9 +278,13 @@ func walkrange(n *Node) { } else { body = []*Node{Nod(OAS, v1, hv1)} } + // Zero hv1. This prevents hv1 from being the sole, inaccessible + // reference to an otherwise GC-able value during the next channel receive. + // See issue 15281. + body = append(body, Nod(OAS, hv1, nil)) - // orderstmt arranged for a copy of the string variable. case TSTRING: + // orderstmt arranged for a copy of the string variable. ha := a ohv1 := temp(Types[TINT]) diff --git a/src/cmd/compile/internal/gc/reflect.go b/src/cmd/compile/internal/gc/reflect.go index 11bcd4cdc6..ceed55a2a5 100644 --- a/src/cmd/compile/internal/gc/reflect.go +++ b/src/cmd/compile/internal/gc/reflect.go @@ -22,6 +22,16 @@ type itabEntry struct { var signatlist []*Node var itabs []itabEntry +type Sig struct { + name string + pkg *Pkg + isym *Sym + tsym *Sym + type_ *Type + mtype *Type + offset int32 +} + // byMethodNameAndPackagePath sorts method signatures by name, then package path. type byMethodNameAndPackagePath []*Sig @@ -60,12 +70,12 @@ const ( ) func structfieldSize() int { return 3 * Widthptr } // Sizeof(runtime.structfield{}) -func imethodSize() int { return 2 * Widthptr } // Sizeof(runtime.imethod{}) +func imethodSize() int { return 4 + 4 } // Sizeof(runtime.imethod{}) func uncommonSize(t *Type) int { // Sizeof(runtime.uncommontype{}) if t.Sym == nil && len(methods(t)) == 0 { return 0 } - return 2*Widthptr + 2*Widthint + return 4 + 2 + 2 } func makefield(name string, t *Type) *Field { @@ -76,8 +86,8 @@ func makefield(name string, t *Type) *Field { } func mapbucket(t *Type) *Type { - if t.Bucket != nil { - return t.Bucket + if t.MapType().Bucket != nil { + return t.MapType().Bucket } bucket := typ(TSTRUCT) @@ -92,13 +102,18 @@ func mapbucket(t *Type) *Type { valtype = Ptrto(valtype) } + field := make([]*Field, 0, 5) + // The first field is: uint8 topbits[BUCKETSIZE]. arr := typArray(Types[TUINT8], BUCKETSIZE) - field := make([]*Field, 0, 5) field = append(field, makefield("topbits", arr)) + arr = typArray(keytype, BUCKETSIZE) + arr.Noalg = true field = append(field, makefield("keys", arr)) + arr = typArray(valtype, BUCKETSIZE) + arr.Noalg = true field = append(field, makefield("values", arr)) // Make sure the overflow pointer is the last memory in the struct, @@ -147,17 +162,17 @@ func mapbucket(t *Type) *Type { Yyerror("bad math in mapbucket for %v", t) } - t.Bucket = bucket + t.MapType().Bucket = bucket - bucket.Map = t + bucket.StructType().Map = t return bucket } // Builds a type representing a Hmap structure for the given map type. // Make sure this stays in sync with ../../../../runtime/hashmap.go! func hmap(t *Type) *Type { - if t.Hmap != nil { - return t.Hmap + if t.MapType().Hmap != nil { + return t.MapType().Hmap } bucket := mapbucket(t) @@ -176,14 +191,14 @@ func hmap(t *Type) *Type { h.Local = t.Local h.SetFields(field[:]) dowidth(h) - t.Hmap = h - h.Map = t + t.MapType().Hmap = h + h.StructType().Map = t return h } func hiter(t *Type) *Type { - if t.Hiter != nil { - return t.Hiter + if t.MapType().Hiter != nil { + return t.MapType().Hiter } // build a struct: @@ -224,8 +239,8 @@ func hiter(t *Type) *Type { if i.Width != int64(12*Widthptr) { Yyerror("hash_iter size not correct %d %d", i.Width, 12*Widthptr) } - t.Hiter = i - i.Map = t + t.MapType().Hiter = i + i.StructType().Map = t return i } @@ -402,8 +417,6 @@ func imethods(t *Type) []*Sig { return methods } -var dimportpath_gopkg *Pkg - func dimportpath(p *Pkg) { if p.Pathsym != nil { return @@ -416,27 +429,18 @@ func dimportpath(p *Pkg) { return } - if dimportpath_gopkg == nil { - dimportpath_gopkg = mkpkg("go") - dimportpath_gopkg.Name = "go" - } - - nam := "importpath." + p.Prefix + "." - - n := Nod(ONAME, nil, nil) - n.Sym = Pkglookup(nam, dimportpath_gopkg) - - n.Class = PEXTERN - n.Xoffset = 0 - p.Pathsym = n.Sym - + var str string if p == localpkg { // Note: myimportpath != "", or else dgopkgpath won't call dimportpath. - gdatastring(n, myimportpath) + str = myimportpath } else { - gdatastring(n, p.Path) + str = p.Path } - ggloblsym(n.Sym, int32(Types[TSTRING].Width), obj.DUPOK|obj.RODATA) + + s := obj.Linklookup(Ctxt, "type..importpath."+p.Prefix+".", 0) + ot := dnameData(s, 0, str, "", nil, false) + ggloblLSym(s, int32(ot), obj.DUPOK|obj.RODATA) + p.Pathsym = s } func dgopkgpath(s *Sym, ot int, pkg *Pkg) int { @@ -451,15 +455,34 @@ func dgopkgpathLSym(s *obj.LSym, ot int, pkg *Pkg) int { if pkg == localpkg && myimportpath == "" { // If we don't know the full import path of the package being compiled // (i.e. -p was not passed on the compiler command line), emit a reference to - // go.importpath.""., which the linker will rewrite using the correct import path. + // type..importpath.""., which the linker will rewrite using the correct import path. // Every package that imports this one directly defines the symbol. // See also https://groups.google.com/forum/#!topic/golang-dev/myb9s53HxGQ. - ns := obj.Linklookup(Ctxt, `go.importpath."".`, 0) + ns := obj.Linklookup(Ctxt, `type..importpath."".`, 0) return dsymptrLSym(s, ot, ns, 0) } dimportpath(pkg) - return dsymptrLSym(s, ot, Linksym(pkg.Pathsym), 0) + return dsymptrLSym(s, ot, pkg.Pathsym, 0) +} + +// dgopkgpathOffLSym writes an offset relocation in s at offset ot to the pkg path symbol. +func dgopkgpathOffLSym(s *obj.LSym, ot int, pkg *Pkg) int { + if pkg == nil { + return duintxxLSym(s, ot, 0, 4) + } + if pkg == localpkg && myimportpath == "" { + // If we don't know the full import path of the package being compiled + // (i.e. -p was not passed on the compiler command line), emit a reference to + // type..importpath.""., which the linker will rewrite using the correct import path. + // Every package that imports this one directly defines the symbol. + // See also https://groups.google.com/forum/#!topic/golang-dev/myb9s53HxGQ. + ns := obj.Linklookup(Ctxt, `type..importpath."".`, 0) + return dsymptrOffLSym(s, ot, ns, 0) + } + + dimportpath(pkg) + return dsymptrOffLSym(s, ot, pkg.Pathsym, 0) } // isExportedField reports whether a struct field is exported. @@ -478,20 +501,16 @@ func isExportedField(ft *Field) bool { // dnameField dumps a reflect.name for a struct field. func dnameField(s *Sym, ot int, ft *Field) int { - var name, tag string + var name string if ft.Sym != nil && ft.Embedded == 0 { name = ft.Sym.Name } - if ft.Note != nil { - tag = *ft.Note - } - return dname(s, ot, name, tag, nil, isExportedField(ft)) + nsym := dname(name, ft.Note, nil, isExportedField(ft)) + return dsymptrLSym(Linksym(s), ot, nsym, 0) } -var dnameCount int - -// dname dumps a reflect.name for a struct field or method. -func dname(s *Sym, ot int, name, tag string, pkg *Pkg, exported bool) int { +// dnameData writes the contents of a reflect.name into s at offset ot. +func dnameData(s *obj.LSym, ot int, name, tag string, pkg *Pkg, exported bool) int { if len(name) > 1<<16-1 { Fatalf("name too long: %s", name) } @@ -524,31 +543,46 @@ func dname(s *Sym, ot int, name, tag string, pkg *Pkg, exported bool) int { copy(tb[2:], tag) } - // Very few names require a pkgPath *string (only those - // defined in a different package than their type). So if - // there is no pkgPath, we treat the name contents as string - // data that duplicates across packages. - var bsym *obj.LSym + ot = int(s.WriteBytes(Ctxt, int64(ot), b)) + + if pkg != nil { + ot = dgopkgpathOffLSym(s, ot, pkg) + } + + return ot +} + +var dnameCount int + +// dname creates a reflect.name for a struct field or method. +func dname(name, tag string, pkg *Pkg, exported bool) *obj.LSym { + // Write out data as "type.." to signal two things to the + // linker, first that when dynamically linking, the symbol + // should be moved to a relro section, and second that the + // contents should not be decoded as a type. + sname := "type..namedata." if pkg == nil { - _, bsym = stringsym(string(b)) + // In the common case, share data with other packages. + if name == "" { + if exported { + sname += "-noname-exported." + tag + } else { + sname += "-noname-unexported." + tag + } + } else { + sname += name + "." + tag + } } else { - // Write out data as "type.." to signal two things to the - // linker, first that when dynamically linking, the symbol - // should be moved to a relro section, and second that the - // contents should not be decoded as a type. - bsymname := fmt.Sprintf(`type..methodname."".%d`, dnameCount) + sname = fmt.Sprintf(`%s"".%d`, sname, dnameCount) dnameCount++ - bsym = obj.Linklookup(Ctxt, bsymname, 0) - bsym.P = b - boff := len(b) - boff = int(Rnd(int64(boff), int64(Widthptr))) - boff = dgopkgpathLSym(bsym, boff, pkg) - ggloblLSym(bsym, int32(boff), obj.RODATA|obj.LOCAL) } - - ot = dsymptrLSym(Linksym(s), ot, bsym, 0) - - return ot + s := obj.Linklookup(Ctxt, sname, 0) + if len(s.P) > 0 { + return s + } + ot := dnameData(s, 0, name, tag, pkg, exported) + ggloblLSym(s, int32(ot), obj.DUPOK|obj.RODATA) + return s } // dextratype dumps the fields of a runtime.uncommontype. @@ -568,15 +602,19 @@ func dextratype(s *Sym, ot int, t *Type, dataAdd int) int { dtypesym(a.type_) } - ot = dgopkgpath(s, ot, typePkg(t)) - - // slice header - ot = dsymptr(s, ot, s, ot+Widthptr+2*Widthint+dataAdd) + ot = dgopkgpathOffLSym(Linksym(s), ot, typePkg(t)) - n := len(m) - ot = duintxx(s, ot, uint64(n), Widthint) - ot = duintxx(s, ot, uint64(n), Widthint) + dataAdd += 4 + 2 + 2 + mcount := len(m) + if mcount != int(uint16(mcount)) { + Fatalf("too many methods on %s: %d", t, mcount) + } + if dataAdd != int(uint16(dataAdd)) { + Fatalf("methods are too far away on %s: %d", t, dataAdd) + } + ot = duint16(s, ot, uint16(mcount)) + ot = duint16(s, ot, uint16(dataAdd)) return ot } @@ -584,7 +622,7 @@ func typePkg(t *Type) *Pkg { tsym := t.Sym if tsym == nil { switch t.Etype { - case TARRAY, TPTR32, TPTR64, TCHAN: + case TARRAY, TSLICE, TPTR32, TPTR64, TCHAN: if t.Elem() != nil { tsym = t.Elem().Sym } @@ -599,6 +637,7 @@ func typePkg(t *Type) *Pkg { // dextratypeData dumps the backing array for the []method field of // runtime.uncommontype. func dextratypeData(s *Sym, ot int, t *Type) int { + lsym := Linksym(s) for _, a := range methods(t) { // ../../../../runtime/type.go:/method exported := exportname(a.name) @@ -606,22 +645,24 @@ func dextratypeData(s *Sym, ot int, t *Type) int { if !exported && a.pkg != typePkg(t) { pkg = a.pkg } - ot = dname(s, ot, a.name, "", pkg, exported) - ot = dmethodptr(s, ot, dtypesym(a.mtype)) - ot = dmethodptr(s, ot, a.isym) - ot = dmethodptr(s, ot, a.tsym) + nsym := dname(a.name, "", pkg, exported) + + ot = dsymptrOffLSym(lsym, ot, nsym, 0) + ot = dmethodptrOffLSym(lsym, ot, Linksym(dtypesym(a.mtype))) + ot = dmethodptrOffLSym(lsym, ot, Linksym(a.isym)) + ot = dmethodptrOffLSym(lsym, ot, Linksym(a.tsym)) } return ot } -func dmethodptr(s *Sym, off int, x *Sym) int { - duintptr(s, off, 0) - r := obj.Addrel(Linksym(s)) - r.Off = int32(off) - r.Siz = uint8(Widthptr) - r.Sym = Linksym(x) - r.Type = obj.R_METHOD - return off + Widthptr +func dmethodptrOffLSym(s *obj.LSym, ot int, x *obj.LSym) int { + duintxxLSym(s, ot, 0, 4) + r := obj.Addrel(s) + r.Off = int32(ot) + r.Siz = 4 + r.Sym = x + r.Type = obj.R_METHODOFF + return ot + 4 } var kinds = []int{ @@ -647,6 +688,7 @@ var kinds = []int{ TCHAN: obj.KindChan, TMAP: obj.KindMap, TARRAY: obj.KindArray, + TSLICE: obj.KindSlice, TFUNC: obj.KindFunc, TCOMPLEX64: obj.KindComplex64, TCOMPLEX128: obj.KindComplex128, @@ -654,67 +696,46 @@ var kinds = []int{ } func haspointers(t *Type) bool { - if t.Haspointers != 0 { - return t.Haspointers-1 != 0 - } - - var ret bool switch t.Etype { - case TINT, - TUINT, - TINT8, - TUINT8, - TINT16, - TUINT16, - TINT32, - TUINT32, - TINT64, - TUINT64, - TUINTPTR, - TFLOAT32, - TFLOAT64, - TCOMPLEX64, - TCOMPLEX128, - TBOOL: - ret = false + case TINT, TUINT, TINT8, TUINT8, TINT16, TUINT16, TINT32, TUINT32, TINT64, + TUINT64, TUINTPTR, TFLOAT32, TFLOAT64, TCOMPLEX64, TCOMPLEX128, TBOOL: + return false + + case TSLICE: + return true case TARRAY: - if t.IsSlice() { - ret = true - break + at := t.Extra.(*ArrayType) + if at.Haspointers != 0 { + return at.Haspointers-1 != 0 } - if t.NumElem() == 0 { // empty array - ret = false - break + ret := false + if t.NumElem() != 0 { // non-empty array + ret = haspointers(t.Elem()) } - ret = haspointers(t.Elem()) + at.Haspointers = 1 + uint8(obj.Bool2int(ret)) + return ret case TSTRUCT: - ret = false + st := t.StructType() + if st.Haspointers != 0 { + return st.Haspointers-1 != 0 + } + + ret := false for _, t1 := range t.Fields().Slice() { if haspointers(t1.Type) { ret = true break } } - - case TSTRING, - TPTR32, - TPTR64, - TUNSAFEPTR, - TINTER, - TCHAN, - TMAP, - TFUNC: - fallthrough - default: - ret = true + st.Haspointers = 1 + uint8(obj.Bool2int(ret)) + return ret } - t.Haspointers = 1 + uint8(obj.Bool2int(ret)) - return ret + return true } // typeptrdata returns the length in bytes of the prefix of t @@ -742,11 +763,11 @@ func typeptrdata(t *Type) int64 { // struct { Type *type; void *data; } return 2 * int64(Widthptr) + case TSLICE: + // struct { byte *array; uintgo len; uintgo cap; } + return int64(Widthptr) + case TARRAY: - if t.IsSlice() { - // struct { byte *array; uintgo len; uintgo cap; } - return int64(Widthptr) - } // haspointers already eliminated t.NumElem() == 0. return (t.NumElem()-1)*t.Elem().Width + typeptrdata(t.Elem()) @@ -766,14 +787,21 @@ func typeptrdata(t *Type) int64 { } } -// tflag is documented in ../../../../reflect/type.go. -const tflagUncommon = 1 - -// commonType -// ../../../../runtime/type.go:/commonType +// tflag is documented in reflect/type.go. +// +// tflag values must be kept in sync with copies in: +// cmd/compile/internal/gc/reflect.go +// cmd/link/internal/ld/decodesym.go +// reflect/type.go +// runtime/type.go +const ( + tflagUncommon = 1 << 0 + tflagExtraStar = 1 << 1 +) var dcommontype_algarray *Sym +// dcommontype dumps the contents of a reflect.rtype (runtime._type). func dcommontype(s *Sym, ot int, t *Type) int { if ot != 0 { Fatalf("dcommontype %d", ot) @@ -814,7 +842,8 @@ func dcommontype(s *Sym, ot int, t *Type) int { // kind uint8 // alg *typeAlg // gcdata *byte - // string *string + // str nameOff + // _ int32 // } ot = duintptr(s, ot, uint64(t.Width)) ot = duintptr(s, ot, uint64(ptrdata)) @@ -825,6 +854,26 @@ func dcommontype(s *Sym, ot int, t *Type) int { if uncommonSize(t) != 0 { tflag |= tflagUncommon } + + exported := false + p := Tconv(t, FmtLeft|FmtUnsigned) + // If we're writing out type T, + // we are very likely to write out type *T as well. + // Use the string "*T"[1:] for "T", so that the two + // share storage. This is a cheap way to reduce the + // amount of space taken up by reflect strings. + if !strings.HasPrefix(p, "*") { + p = "*" + p + tflag |= tflagExtraStar + if t.Sym != nil { + exported = exportname(t.Sym.Name) + } + } else { + if t.Elem() != nil && t.Elem().Sym != nil { + exported = exportname(t.Elem().Sym.Name) + } + } + ot = duint8(s, ot, tflag) // runtime (and common sense) expects alignment to be a power of two. @@ -840,9 +889,6 @@ func dcommontype(s *Sym, ot int, t *Type) int { ot = duint8(s, ot, t.Align) // fieldAlign i = kinds[t.Etype] - if t.IsSlice() { - i = obj.KindSlice - } if !haspointers(t) { i |= obj.KindNoPointers } @@ -860,21 +906,9 @@ func dcommontype(s *Sym, ot int, t *Type) int { } ot = dsymptr(s, ot, gcsym, 0) // gcdata - p := Tconv(t, FmtLeft|FmtUnsigned) - - // If we're writing out type T, - // we are very likely to write out type *T as well. - // Use the string "*T"[1:] for "T", so that the two - // share storage. This is a cheap way to reduce the - // amount of space taken up by reflect strings. - prefix := 0 - if !strings.HasPrefix(p, "*") { - p = "*" + p - prefix = 1 - } - _, symdata := stringsym(p) // string - ot = dsymptrLSym(Linksym(s), ot, symdata, prefix) - ot = duintxx(s, ot, uint64(len(p)-prefix), Widthint) + nsym := dname(p, "", nil, exported) + ot = dsymptrOffLSym(Linksym(s), ot, nsym, 0) + ot = duint32(s, ot, 0) return ot } @@ -889,23 +923,9 @@ func tracksym(t *Type, f *Field) *Sym { return Pkglookup(Tconv(t, FmtLeft)+"."+f.Sym.Name, trackpkg) } -func typelinksym(t *Type) *Sym { - // %-uT is what the generated Type's string field says. - // It uses (ambiguous) package names instead of import paths. - // %-T is the complete, unambiguous type name. - // We want the types to end up sorted by string field, - // so use that first in the name, and then add :%-T to - // disambiguate. We use a tab character as the separator to - // ensure the types appear sorted by their string field. The - // names are a little long but they are discarded by the linker - // and do not end up in the symbol table of the final binary. - p := Tconv(t, FmtLeft|FmtUnsigned) + "\t" + Tconv(t, FmtLeft) - - s := Pkglookup(p, typelinkpkg) - - //print("typelinksym: %s -> %+S\n", p, s); - - return s +func typelinkLSym(t *Type) *obj.LSym { + name := "go.typelink." + Tconv(t, FmtLeft) // complete, unambiguous type name + return obj.Linklookup(Ctxt, name, 0) } func typesymprefix(prefix string, t *Type) *Sym { @@ -999,9 +1019,6 @@ func isreflexive(t *Type) bool { return false case TARRAY: - if t.IsSlice() { - Fatalf("slice can't be a map key: %v", t) - } return isreflexive(t.Elem()) case TSTRUCT: @@ -1049,9 +1066,6 @@ func needkeyupdate(t *Type) bool { return true case TARRAY: - if t.IsSlice() { - Fatalf("slice can't be a map key: %v", t) - } return needkeyupdate(t.Elem()) case TSTRUCT: @@ -1119,28 +1133,26 @@ ok: ot = dextratype(s, ot, t, 0) case TARRAY: - if t.IsArray() { - // ../../../../runtime/type.go:/arrayType - s1 := dtypesym(t.Elem()) - t2 := typSlice(t.Elem()) - s2 := dtypesym(t2) - ot = dcommontype(s, ot, t) - ot = dsymptr(s, ot, s1, 0) - ot = dsymptr(s, ot, s2, 0) - ot = duintptr(s, ot, uint64(t.NumElem())) - } else { - // ../../../../runtime/type.go:/sliceType - s1 := dtypesym(t.Elem()) + // ../../../../runtime/type.go:/arrayType + s1 := dtypesym(t.Elem()) + t2 := typSlice(t.Elem()) + s2 := dtypesym(t2) + ot = dcommontype(s, ot, t) + ot = dsymptr(s, ot, s1, 0) + ot = dsymptr(s, ot, s2, 0) + ot = duintptr(s, ot, uint64(t.NumElem())) + ot = dextratype(s, ot, t, 0) - ot = dcommontype(s, ot, t) - ot = dsymptr(s, ot, s1, 0) - } + case TSLICE: + // ../../../../runtime/type.go:/sliceType + s1 := dtypesym(t.Elem()) + ot = dcommontype(s, ot, t) + ot = dsymptr(s, ot, s1, 0) ot = dextratype(s, ot, t, 0) - // ../../../../runtime/type.go:/chanType case TCHAN: + // ../../../../runtime/type.go:/chanType s1 := dtypesym(t.Elem()) - ot = dcommontype(s, ot, t) ot = dsymptr(s, ot, s1, 0) ot = duintptr(s, ot, uint64(t.ChanDir())) @@ -1207,6 +1219,7 @@ ok: dataAdd := imethodSize() * n ot = dextratype(s, ot, t, dataAdd) + lsym := Linksym(s) for _, a := range m { // ../../../../runtime/type.go:/imethod exported := exportname(a.name) @@ -1214,8 +1227,10 @@ ok: if !exported && a.pkg != tpkg { pkg = a.pkg } - ot = dname(s, ot, a.name, "", pkg, exported) - ot = dsymptr(s, ot, dtypesym(a.type_), 0) + nsym := dname(a.name, "", pkg, exported) + + ot = dsymptrOffLSym(lsym, ot, nsym, 0) + ot = dsymptrOffLSym(lsym, ot, Linksym(dtypesym(a.type_)), 0) } // ../../../../runtime/type.go:/mapType @@ -1301,18 +1316,29 @@ ok: ggloblsym(s, int32(ot), int16(dupok|obj.RODATA)) // generate typelink.foo pointing at s = type.foo. + // // The linker will leave a table of all the typelinks for - // types in the binary, so reflect can find them. - // We only need the link for unnamed composites that - // we want be able to find. - if t.Sym == nil { + // types in the binary, so the runtime can find them. + // + // When buildmode=shared, all types are in typelinks so the + // runtime can deduplicate type pointers. + keep := Ctxt.Flag_dynlink + if !keep && t.Sym == nil { + // For an unnamed type, we only need the link if the type can + // be created at run time by reflect.PtrTo and similar + // functions. If the type exists in the program, those + // functions must return the existing type structure rather + // than creating a new one. switch t.Etype { - case TPTR32, TPTR64, TARRAY, TCHAN, TFUNC, TMAP, TSTRUCT: - slink := typelinksym(t) - dsymptr(slink, 0, s, 0) - ggloblsym(slink, int32(Widthptr), int16(dupok|obj.RODATA)) + case TPTR32, TPTR64, TARRAY, TCHAN, TFUNC, TMAP, TSLICE, TSTRUCT: + keep = true } } + if keep { + slink := typelinkLSym(t) + dsymptrOffLSym(slink, 0, Linksym(s), 0) + ggloblLSym(slink, 4, int16(dupok|obj.RODATA)) + } return s } @@ -1365,6 +1391,11 @@ func dumptypestructs() { } // generate import strings for imported packages + if forceObjFileStability { + // Sorting the packages is not necessary but to compare binaries created + // using textual and binary format we sort by path to reduce differences. + sort.Sort(pkgByPath(pkgs)) + } for _, p := range pkgs { if p.Direct { dimportpath(p) @@ -1393,16 +1424,22 @@ func dumptypestructs() { // add paths for runtime and main, which 6l imports implicitly. dimportpath(Runtimepkg) - if flag_race != 0 { + if flag_race { dimportpath(racepkg) } - if flag_msan != 0 { + if flag_msan { dimportpath(msanpkg) } dimportpath(mkpkg("main")) } } +type pkgByPath []*Pkg + +func (a pkgByPath) Len() int { return len(a) } +func (a pkgByPath) Less(i, j int) bool { return a[i].Path < a[j].Path } +func (a pkgByPath) Swap(i, j int) { a[i], a[j] = a[j], a[i] } + func dalgsym(t *Type) *Sym { var s *Sym var hashfunc *Sym @@ -1632,11 +1669,10 @@ func (p *GCProg) emit(t *Type, offset int64) { p.w.Ptr(offset / int64(Widthptr)) p.w.Ptr(offset/int64(Widthptr) + 1) + case TSLICE: + p.w.Ptr(offset / int64(Widthptr)) + case TARRAY: - if t.IsSlice() { - p.w.Ptr(offset / int64(Widthptr)) - return - } if t.NumElem() == 0 { // should have been handled by haspointers check above Fatalf("GCProg.emit: empty array") @@ -1667,3 +1703,27 @@ func (p *GCProg) emit(t *Type, offset int64) { } } } + +// zeroaddr returns the address of a symbol with at least +// size bytes of zeros. +func zeroaddr(size int64) *Node { + if size >= 1<<31 { + Fatalf("map value too big %d", size) + } + if zerosize < size { + zerosize = size + } + s := Pkglookup("zero", mappkg) + if s.Def == nil { + x := newname(s) + x.Type = Types[TUINT8] + x.Class = PEXTERN + x.Typecheck = 1 + s.Def = x + } + z := Nod(OADDR, s.Def, nil) + z.Type = Ptrto(Types[TUINT8]) + z.Addable = true + z.Typecheck = 1 + return z +} diff --git a/src/cmd/compile/internal/gc/reg.go b/src/cmd/compile/internal/gc/reg.go index 26746a5bcf..5763f79de1 100644 --- a/src/cmd/compile/internal/gc/reg.go +++ b/src/cmd/compile/internal/gc/reg.go @@ -33,6 +33,7 @@ package gc import ( "bytes" "cmd/internal/obj" + "cmd/internal/sys" "fmt" "sort" "strings" @@ -249,7 +250,7 @@ func addmove(r *Flow, bn int, rn int, f int) { p1.As = Thearch.Optoas(OAS, Types[uint8(v.etype)]) // TODO(rsc): Remove special case here. - if (Thearch.Thechar == '0' || Thearch.Thechar == '5' || Thearch.Thechar == '7' || Thearch.Thechar == '9') && v.etype == TBOOL { + if Thearch.LinkArch.InFamily(sys.MIPS64, sys.ARM, sys.ARM64, sys.PPC64) && v.etype == TBOOL { p1.As = Thearch.Optoas(OAS, Types[TUINT8]) } p1.From.Type = obj.TYPE_REG @@ -302,7 +303,7 @@ func mkvar(f *Flow, a *obj.Addr) Bits { // TODO(rsc): Remove special case here. case obj.TYPE_ADDR: var bit Bits - if Thearch.Thechar == '0' || Thearch.Thechar == '5' || Thearch.Thechar == '7' || Thearch.Thechar == '9' { + if Thearch.LinkArch.InFamily(sys.MIPS64, sys.ARM, sys.ARM64, sys.PPC64) { goto memcase } a.Type = obj.TYPE_MEM @@ -368,7 +369,7 @@ func mkvar(f *Flow, a *obj.Addr) Bits { if v.etype == et { if int64(v.width) == w { // TODO(rsc): Remove special case for arm here. - if flag == 0 || Thearch.Thechar != '5' { + if flag == 0 || Thearch.LinkArch.Family != sys.ARM { return blsh(uint(i)) } } @@ -487,7 +488,7 @@ func mkvar(f *Flow, a *obj.Addr) Bits { } if Debug['R'] != 0 { - fmt.Printf("bit=%2d et=%v w=%d+%d %v %v flag=%d\n", i, Econv(et), o, w, Nconv(node, FmtSharp), Ctxt.Dconv(a), v.addr) + fmt.Printf("bit=%2d et=%v w=%d+%d %v %v flag=%d\n", i, et, o, w, Nconv(node, FmtSharp), Ctxt.Dconv(a), v.addr) } Ostats.Nvar++ @@ -651,7 +652,7 @@ func allreg(b uint64, r *Rgn) uint64 { r.regno = 0 switch v.etype { default: - Fatalf("unknown etype %d/%v", Bitno(b), Econv(v.etype)) + Fatalf("unknown etype %d/%v", Bitno(b), v.etype) case TINT8, TUINT8, @@ -1114,7 +1115,7 @@ func regopt(firstp *obj.Prog) { // Currently we never generate three register forms. // If we do, this will need to change. - if p.From3Type() != obj.TYPE_NONE { + if p.From3Type() != obj.TYPE_NONE && p.From3Type() != obj.TYPE_CONST { Fatalf("regopt not implemented for from3") } @@ -1146,7 +1147,7 @@ func regopt(firstp *obj.Prog) { } if Debug['R'] != 0 && Debug['v'] != 0 { - fmt.Printf("bit=%2d addr=%d et=%v w=%-2d s=%v + %d\n", i, v.addr, Econv(v.etype), v.width, v.node, v.offset) + fmt.Printf("bit=%2d addr=%d et=%v w=%-2d s=%v + %d\n", i, v.addr, v.etype, v.width, v.node, v.offset) } } @@ -1357,7 +1358,7 @@ loop2: if rgp.regno != 0 { if Debug['R'] != 0 && Debug['v'] != 0 { v := &vars[rgp.varno] - fmt.Printf("registerize %v+%d (bit=%2d et=%v) in %v usedreg=%#x vreg=%#x\n", v.node, v.offset, rgp.varno, Econv(v.etype), obj.Rconv(int(rgp.regno)), usedreg, vreg) + fmt.Printf("registerize %v+%d (bit=%2d et=%v) in %v usedreg=%#x vreg=%#x\n", v.node, v.offset, rgp.varno, v.etype, obj.Rconv(int(rgp.regno)), usedreg, vreg) } paint3(rgp.enter, int(rgp.varno), vreg, int(rgp.regno)) diff --git a/src/cmd/compile/internal/gc/select.go b/src/cmd/compile/internal/gc/select.go index 22c716f9ce..120a9b8cf1 100644 --- a/src/cmd/compile/internal/gc/select.go +++ b/src/cmd/compile/internal/gc/select.go @@ -18,7 +18,7 @@ func typecheckselect(sel *Node) { ncase = n1 setlineno(ncase) if ncase.Op != OXCASE { - Fatalf("typecheckselect %v", Oconv(ncase.Op, 0)) + Fatalf("typecheckselect %v", ncase.Op) } if ncase.List.Len() == 0 { @@ -120,7 +120,7 @@ func walkselect(sel *Node) { var ch *Node switch n.Op { default: - Fatalf("select %v", Oconv(n.Op, 0)) + Fatalf("select %v", n.Op) // ok already case OSEND: @@ -218,7 +218,7 @@ func walkselect(sel *Node) { r.Ninit.Set(cas.Ninit.Slice()) switch n.Op { default: - Fatalf("select %v", Oconv(n.Op, 0)) + Fatalf("select %v", n.Op) // if selectnbsend(c, v) { body } else { default body } case OSEND: @@ -282,7 +282,7 @@ func walkselect(sel *Node) { } else { switch n.Op { default: - Fatalf("select %v", Oconv(n.Op, 0)) + Fatalf("select %v", n.Op) // selectsend(sel *byte, hchan *chan any, elem *any) (selected bool); case OSEND: diff --git a/src/cmd/compile/internal/gc/sinit.go b/src/cmd/compile/internal/gc/sinit.go index 85ef78b973..c6f2acffbf 100644 --- a/src/cmd/compile/internal/gc/sinit.go +++ b/src/cmd/compile/internal/gc/sinit.go @@ -342,8 +342,6 @@ func staticcopy(l *Node, r *Node, out *[]*Node) bool { return true } fallthrough - - // fall through case OSTRUCTLIT: p := initplans[r] @@ -563,6 +561,35 @@ func getdyn(n *Node, top int) initGenType { return mode } +// isStaticCompositeLiteral reports whether n is a compile-time constant. +func isStaticCompositeLiteral(n *Node) bool { + switch n.Op { + case OARRAYLIT: + if n.Type.IsSlice() { + return false + } + case OSTRUCTLIT: + case OLITERAL: + return true + default: + return false + } + for _, r := range n.List.Slice() { + if r.Op != OKEY { + Fatalf("isStaticCompositeLiteral: rhs not OKEY: %v", r) + } + index := r.Left + if n.Op == OARRAYLIT && index.Op != OLITERAL { + return false + } + value := r.Right + if !isStaticCompositeLiteral(value) { + return false + } + } + return true +} + func structlit(ctxt int, pass int, n *Node, var_ *Node, init *Nodes) { for _, r := range n.List.Slice() { if r.Op != OKEY { @@ -700,7 +727,7 @@ func slicelit(ctxt int, n *Node, var_ *Node, init *Nodes) { arraylit(ctxt, 2, n, vstat, init) // copy static to slice - a := Nod(OSLICE, vstat, Nod(OKEY, nil, nil)) + a := Nod(OSLICE, vstat, nil) a = Nod(OAS, var_, a) a = typecheck(a, Etop) @@ -718,15 +745,15 @@ func slicelit(ctxt int, n *Node, var_ *Node, init *Nodes) { // var vauto *[...]t = new([...]t) // 4. copy the static array to the auto array // *vauto = vstat - // 5. assign slice of allocated heap to var - // var = [0:]*auto - // 6. for each dynamic part assign to the slice - // var[i] = dynamic part + // 5. for each dynamic part assign to the array + // vauto[i] = dynamic part + // 6. assign slice of allocated heap to var + // var = vauto[:] // // an optimization is done if there is no constant part // 3. var vauto *[...]t = new([...]t) - // 5. var = [0:]*auto - // 6. var[i] = dynamic part + // 5. vauto[i] = dynamic part + // 6. var = vauto[:] // if the literal contains constants, // make static initialized array (1),(2) @@ -784,21 +811,14 @@ func slicelit(ctxt int, n *Node, var_ *Node, init *Nodes) { init.Append(a) } - // make slice out of heap (5) - a = Nod(OAS, var_, Nod(OSLICE, vauto, Nod(OKEY, nil, nil))) - - a = typecheck(a, Etop) - a = orderstmtinplace(a) - a = walkstmt(a) - init.Append(a) - // put dynamics into slice (6) + // put dynamics into array (5) for _, r := range n.List.Slice() { if r.Op != OKEY { Fatalf("slicelit: rhs not OKEY: %v", r) } index := r.Left value := r.Right - a := Nod(OINDEX, var_, index) + a := Nod(OINDEX, vauto, index) a.Bounded = true // TODO need to check bounds? @@ -820,7 +840,7 @@ func slicelit(ctxt int, n *Node, var_ *Node, init *Nodes) { continue } - // build list of var[c] = expr + // build list of vauto[c] = expr setlineno(value) a = Nod(OAS, a, value) @@ -829,6 +849,14 @@ func slicelit(ctxt int, n *Node, var_ *Node, init *Nodes) { a = walkstmt(a) init.Append(a) } + + // make slice out of heap (6) + a = Nod(OAS, var_, Nod(OSLICE, vauto, nil)) + + a = typecheck(a, Etop) + a = orderstmtinplace(a) + a = walkstmt(a) + init.Append(a) } func maplit(ctxt int, n *Node, var_ *Node, init *Nodes) { @@ -1005,7 +1033,7 @@ func anylit(ctxt int, n *Node, var_ *Node, init *Nodes) { t := n.Type switch n.Op { default: - Fatalf("anylit: not lit") + Fatalf("anylit: not lit, op=%v node=%v", n.Op, n) case OPTRLIT: if !t.IsPtr() { @@ -1074,13 +1102,13 @@ func anylit(ctxt int, n *Node, var_ *Node, init *Nodes) { structlit(ctxt, 3, n, var_, init) case OARRAYLIT: - if t.Etype != TARRAY { - Fatalf("anylit: not array") - } if t.IsSlice() { slicelit(ctxt, n, var_, init) break } + if !t.IsArray() { + Fatalf("anylit: not array") + } if var_.isSimpleName() && n.List.Len() > 4 { if ctxt == 0 { @@ -1280,28 +1308,22 @@ func addvalue(p *InitPlan, xoffset int64, n *Node) { func iszero(n *Node) bool { switch n.Op { case OLITERAL: - switch n.Val().Ctype() { + switch u := n.Val().U.(type) { default: Dump("unexpected literal", n) Fatalf("iszero") - - case CTNIL: + case *NilVal: return true - - case CTSTR: - return n.Val().U.(string) == "" - - case CTBOOL: - return !n.Val().U.(bool) - - case CTINT, CTRUNE: - return n.Val().U.(*Mpint).CmpInt64(0) == 0 - - case CTFLT: - return n.Val().U.(*Mpflt).CmpFloat64(0) == 0 - - case CTCPLX: - return n.Val().U.(*Mpcplx).Real.CmpFloat64(0) == 0 && n.Val().U.(*Mpcplx).Imag.CmpFloat64(0) == 0 + case string: + return u == "" + case bool: + return !u + case *Mpint: + return u.CmpInt64(0) == 0 + case *Mpflt: + return u.CmpFloat64(0) == 0 + case *Mpcplx: + return u.Real.CmpFloat64(0) == 0 && u.Imag.CmpFloat64(0) == 0 } case OARRAYLIT: @@ -1309,8 +1331,6 @@ func iszero(n *Node) bool { break } fallthrough - - // fall through case OSTRUCTLIT: for _, n1 := range n.List.Slice() { if !iszero(n1.Right) { @@ -1371,7 +1391,8 @@ func genAsInitNoCheck(n *Node, reportOnly bool) bool { fallthrough case OSLICEARR: - if nr.Right.Op != OKEY || nr.Right.Left != nil || nr.Right.Right != nil { + low, high, _ := nr.SliceBounds() + if low != nil || high != nil { return false } nr = nr.Left @@ -1385,7 +1406,7 @@ func genAsInitNoCheck(n *Node, reportOnly bool) bool { } // nr is the array being converted to a slice - if nr.Type == nil || nr.Type.Etype != TARRAY || nr.Type.IsSlice() { + if nr.Type == nil || !nr.Type.IsArray() { return false } diff --git a/src/cmd/compile/internal/gc/sizeof_test.go b/src/cmd/compile/internal/gc/sizeof_test.go index 11c0f419da..a01da13883 100644 --- a/src/cmd/compile/internal/gc/sizeof_test.go +++ b/src/cmd/compile/internal/gc/sizeof_test.go @@ -27,7 +27,20 @@ func TestSizeof(t *testing.T) { {Name{}, 52, 80}, {Node{}, 92, 144}, {Sym{}, 60, 112}, - {Type{}, 116, 184}, + {Type{}, 52, 80}, + {MapType{}, 20, 40}, + {ForwardType{}, 16, 32}, + {FuncType{}, 28, 48}, + {StructType{}, 12, 24}, + {InterType{}, 4, 8}, + {ChanType{}, 8, 16}, + {ArrayType{}, 16, 24}, + {InterMethType{}, 4, 8}, + {DDDFieldType{}, 4, 8}, + {FuncArgsType{}, 4, 8}, + {ChanArgsType{}, 4, 8}, + {PtrType{}, 4, 8}, + {SliceType{}, 4, 8}, } for _, tt := range tests { diff --git a/src/cmd/compile/internal/gc/ssa.go b/src/cmd/compile/internal/gc/ssa.go index 359f4b22a2..b31cd878cd 100644 --- a/src/cmd/compile/internal/gc/ssa.go +++ b/src/cmd/compile/internal/gc/ssa.go @@ -13,6 +13,7 @@ import ( "cmd/compile/internal/ssa" "cmd/internal/obj" + "cmd/internal/sys" ) var ssaEnabled = true @@ -24,13 +25,13 @@ func initssa() *ssa.Config { ssaExp.unimplemented = false ssaExp.mustImplement = true if ssaConfig == nil { - ssaConfig = ssa.NewConfig(Thearch.Thestring, &ssaExp, Ctxt, Debug['N'] == 0) + ssaConfig = ssa.NewConfig(Thearch.LinkArch.Name, &ssaExp, Ctxt, Debug['N'] == 0) } return ssaConfig } func shouldssa(fn *Node) bool { - switch Thearch.Thestring { + switch Thearch.LinkArch.Name { default: // Only available for testing. if os.Getenv("SSATEST") == "" { @@ -336,12 +337,14 @@ var ( memVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "mem"}} // dummy nodes for temporary variables - ptrVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "ptr"}} - capVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "cap"}} - typVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "typ"}} - idataVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "idata"}} - okVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "ok"}} - deltaVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "delta"}} + ptrVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "ptr"}} + lenVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "len"}} + newlenVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "newlen"}} + capVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "cap"}} + typVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "typ"}} + idataVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "idata"}} + okVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "ok"}} + deltaVar = Node{Op: ONAME, Class: Pxxx, Sym: &Sym{Name: "delta"}} ) // startBlock sets the current block we're generating code in to b. @@ -552,7 +555,7 @@ func (s *state) stmt(n *Node) { case OCALLFUNC, OCALLMETH, OCALLINTER: s.call(n, callNormal) if n.Op == OCALLFUNC && n.Left.Op == ONAME && n.Left.Class == PFUNC && - (compiling_runtime != 0 && n.Left.Sym.Name == "throw" || + (compiling_runtime && n.Left.Sym.Name == "throw" || n.Left.Sym.Pkg == Runtimepkg && (n.Left.Sym.Name == "gopanic" || n.Left.Sym.Name == "selectgo" || n.Left.Sym.Name == "block")) { m := s.mem() b := s.endBlock() @@ -577,7 +580,7 @@ func (s *state) stmt(n *Node) { if n.Left.Class&PHEAP == 0 { return } - if compiling_runtime != 0 { + if compiling_runtime { Fatalf("%v escapes to heap, not allowed in runtime.", n) } @@ -661,6 +664,17 @@ func (s *state) stmt(n *Node) { return } + if n.Left == n.Right && n.Left.Op == ONAME { + // An x=x assignment. No point in doing anything + // here. In addition, skipping this assignment + // prevents generating: + // VARDEF x + // COPY x -> x + // which is bad because x is incorrectly considered + // dead before the vardef. See issue #14904. + return + } + var t *Type if n.Right != nil { t = n.Right.Type @@ -670,14 +684,27 @@ func (s *state) stmt(n *Node) { // Evaluate RHS. rhs := n.Right - if rhs != nil && (rhs.Op == OSTRUCTLIT || rhs.Op == OARRAYLIT) { - // All literals with nonzero fields have already been - // rewritten during walk. Any that remain are just T{} - // or equivalents. Use the zero value. - if !iszero(rhs) { - Fatalf("literal with nonzero value in SSA: %v", rhs) + if rhs != nil { + switch rhs.Op { + case OSTRUCTLIT, OARRAYLIT: + // All literals with nonzero fields have already been + // rewritten during walk. Any that remain are just T{} + // or equivalents. Use the zero value. + if !iszero(rhs) { + Fatalf("literal with nonzero value in SSA: %v", rhs) + } + rhs = nil + case OAPPEND: + // If we're writing the result of an append back to the same slice, + // handle it specially to avoid write barriers on the fast (non-growth) path. + // If the slice can be SSA'd, it'll be on the stack, + // so there will be no write barriers, + // so there's no need to attempt to prevent them. + if samesafeexpr(n.Left, rhs.List.First()) && !s.canSSA(n.Left) { + s.append(rhs, true) + return + } } - rhs = nil } var r *ssa.Value needwb := n.Op == OASWB && rhs != nil @@ -696,11 +723,11 @@ func (s *state) stmt(n *Node) { } } if rhs != nil && rhs.Op == OAPPEND { - // Yuck! The frontend gets rid of the write barrier, but we need it! - // At least, we need it in the case where growslice is called. - // TODO: Do the write barrier on just the growslice branch. + // The frontend gets rid of the write barrier to enable the special OAPPEND + // handling above, but since this is not a special case, we need it. // TODO: just add a ptr graying to the end of growslice? - // TODO: check whether we need to do this for ODOTTYPE and ORECV also. + // TODO: check whether we need to provide special handling and a write barrier + // for ODOTTYPE and ORECV also. // They get similar wb-removal treatment in walk.go:OAS. needwb = true } @@ -709,14 +736,7 @@ func (s *state) stmt(n *Node) { if rhs != nil && (rhs.Op == OSLICE || rhs.Op == OSLICE3 || rhs.Op == OSLICESTR) && samesafeexpr(rhs.Left, n.Left) { // We're assigning a slicing operation back to its source. // Don't write back fields we aren't changing. See issue #14855. - i := rhs.Right.Left - var j, k *Node - if rhs.Op == OSLICE3 { - j = rhs.Right.Right.Left - k = rhs.Right.Right.Right - } else { - j = rhs.Right.Right - } + i, j, k := rhs.SliceBounds() if i != nil && (i.Op == OLITERAL && i.Val().Ctype() == CTINT && i.Int64() == 0) { // [0:...] is the same as [:...] i = nil @@ -942,7 +962,7 @@ func (s *state) stmt(n *Node) { s.nilCheck(p) default: - s.Unimplementedf("unhandled stmt %s", opnames[n.Op]) + s.Unimplementedf("unhandled stmt %s", n.Op) } } @@ -1101,7 +1121,7 @@ var opToSSA = map[opAndType]ssa.Op{ opAndType{OXOR, TINT64}: ssa.OpXor64, opAndType{OXOR, TUINT64}: ssa.OpXor64, - opAndType{OEQ, TBOOL}: ssa.OpEq8, + opAndType{OEQ, TBOOL}: ssa.OpEqB, opAndType{OEQ, TINT8}: ssa.OpEq8, opAndType{OEQ, TUINT8}: ssa.OpEq8, opAndType{OEQ, TINT16}: ssa.OpEq16, @@ -1111,7 +1131,7 @@ var opToSSA = map[opAndType]ssa.Op{ opAndType{OEQ, TINT64}: ssa.OpEq64, opAndType{OEQ, TUINT64}: ssa.OpEq64, opAndType{OEQ, TINTER}: ssa.OpEqInter, - opAndType{OEQ, TARRAY}: ssa.OpEqSlice, + opAndType{OEQ, TSLICE}: ssa.OpEqSlice, opAndType{OEQ, TFUNC}: ssa.OpEqPtr, opAndType{OEQ, TMAP}: ssa.OpEqPtr, opAndType{OEQ, TCHAN}: ssa.OpEqPtr, @@ -1121,7 +1141,7 @@ var opToSSA = map[opAndType]ssa.Op{ opAndType{OEQ, TFLOAT64}: ssa.OpEq64F, opAndType{OEQ, TFLOAT32}: ssa.OpEq32F, - opAndType{ONE, TBOOL}: ssa.OpNeq8, + opAndType{ONE, TBOOL}: ssa.OpNeqB, opAndType{ONE, TINT8}: ssa.OpNeq8, opAndType{ONE, TUINT8}: ssa.OpNeq8, opAndType{ONE, TINT16}: ssa.OpNeq16, @@ -1131,7 +1151,7 @@ var opToSSA = map[opAndType]ssa.Op{ opAndType{ONE, TINT64}: ssa.OpNeq64, opAndType{ONE, TUINT64}: ssa.OpNeq64, opAndType{ONE, TINTER}: ssa.OpNeqInter, - opAndType{ONE, TARRAY}: ssa.OpNeqSlice, + opAndType{ONE, TSLICE}: ssa.OpNeqSlice, opAndType{ONE, TFUNC}: ssa.OpNeqPtr, opAndType{ONE, TMAP}: ssa.OpNeqPtr, opAndType{ONE, TCHAN}: ssa.OpNeqPtr, @@ -1220,7 +1240,7 @@ func (s *state) ssaOp(op Op, t *Type) ssa.Op { etype := s.concreteEtype(t) x, ok := opToSSA[opAndType{op, etype}] if !ok { - s.Unimplementedf("unhandled binary op %s %s", opnames[op], Econv(etype)) + s.Unimplementedf("unhandled binary op %s %s", op, etype) } return x } @@ -1378,7 +1398,7 @@ func (s *state) ssaShiftOp(op Op, t *Type, u *Type) ssa.Op { etype2 := s.concreteEtype(u) x, ok := shiftOpToSSA[opAndTwoTypes{op, etype1, etype2}] if !ok { - s.Unimplementedf("unhandled shift op %s etype=%s/%s", opnames[op], Econv(etype1), Econv(etype2)) + s.Unimplementedf("unhandled shift op %s etype=%s/%s", op, etype1, etype2) } return x } @@ -1387,15 +1407,19 @@ func (s *state) ssaRotateOp(op Op, t *Type) ssa.Op { etype1 := s.concreteEtype(t) x, ok := opToSSA[opAndType{op, etype1}] if !ok { - s.Unimplementedf("unhandled rotate op %s etype=%s", opnames[op], Econv(etype1)) + s.Unimplementedf("unhandled rotate op %s etype=%s", op, etype1) } return x } // expr converts the expression n to ssa, adds it to s and returns the ssa result. func (s *state) expr(n *Node) *ssa.Value { - s.pushLine(n.Lineno) - defer s.popLine() + if !(n.Op == ONAME || n.Op == OLITERAL && n.Sym != nil) { + // ONAMEs and named OLITERALs have the line number + // of the decl, not the use. See issue 14742. + s.pushLine(n.Lineno) + defer s.popLine() + } s.stmtList(n.Ninit) switch n.Op { @@ -1421,9 +1445,9 @@ func (s *state) expr(n *Node) *ssa.Value { addr := s.addr(n, false) return s.newValue2(ssa.OpLoad, n.Type, addr, s.mem()) case OLITERAL: - switch n.Val().Ctype() { - case CTINT: - i := n.Int64() + switch u := n.Val().U.(type) { + case *Mpint: + i := u.Int64() switch n.Type.Size() { case 1: return s.constInt8(n.Type, int8(i)) @@ -1437,21 +1461,14 @@ func (s *state) expr(n *Node) *ssa.Value { s.Fatalf("bad integer size %d", n.Type.Size()) return nil } - case CTSTR: - if n.Val().U == "" { + case string: + if u == "" { return s.constEmptyString(n.Type) } - return s.entryNewValue0A(ssa.OpConstString, n.Type, n.Val().U) - case CTBOOL: - v := s.constBool(n.Val().U.(bool)) - // For some reason the frontend gets the line numbers of - // CTBOOL literals totally wrong. Fix it here by grabbing - // the line number of the enclosing AST node. - if len(s.line) >= 2 { - v.Line = s.line[len(s.line)-2] - } - return v - case CTNIL: + return s.entryNewValue0A(ssa.OpConstString, n.Type, u) + case bool: + return s.constBool(u) + case *NilVal: t := n.Type switch { case t.IsSlice(): @@ -1461,36 +1478,30 @@ func (s *state) expr(n *Node) *ssa.Value { default: return s.constNil(t) } - case CTFLT: - f := n.Val().U.(*Mpflt) + case *Mpflt: switch n.Type.Size() { case 4: - return s.constFloat32(n.Type, f.Float32()) + return s.constFloat32(n.Type, u.Float32()) case 8: - return s.constFloat64(n.Type, f.Float64()) + return s.constFloat64(n.Type, u.Float64()) default: s.Fatalf("bad float size %d", n.Type.Size()) return nil } - case CTCPLX: - c := n.Val().U.(*Mpcplx) - r := &c.Real - i := &c.Imag + case *Mpcplx: + r := &u.Real + i := &u.Imag switch n.Type.Size() { case 8: - { - pt := Types[TFLOAT32] - return s.newValue2(ssa.OpComplexMake, n.Type, - s.constFloat32(pt, r.Float32()), - s.constFloat32(pt, i.Float32())) - } + pt := Types[TFLOAT32] + return s.newValue2(ssa.OpComplexMake, n.Type, + s.constFloat32(pt, r.Float32()), + s.constFloat32(pt, i.Float32())) case 16: - { - pt := Types[TFLOAT64] - return s.newValue2(ssa.OpComplexMake, n.Type, - s.constFloat64(pt, r.Float64()), - s.constFloat64(pt, i.Float64())) - } + pt := Types[TFLOAT64] + return s.newValue2(ssa.OpComplexMake, n.Type, + s.constFloat64(pt, r.Float64()), + s.constFloat64(pt, i.Float64())) default: s.Fatalf("bad float size %d", n.Type.Size()) return nil @@ -1540,7 +1551,7 @@ func (s *state) expr(n *Node) *ssa.Value { return nil } if etypesign(from.Etype) != etypesign(to.Etype) { - s.Fatalf("CONVNOP sign mismatch %v (%s) -> %v (%s)\n", from, Econv(from.Etype), to, Econv(to.Etype)) + s.Fatalf("CONVNOP sign mismatch %v (%s) -> %v (%s)\n", from, from.Etype, to, to.Etype) return nil } @@ -1685,7 +1696,7 @@ func (s *state) expr(n *Node) *ssa.Value { s.newValue1(op, ttp, s.newValue1(ssa.OpComplexImag, ftp, x))) } - s.Unimplementedf("unhandled OCONV %s -> %s", Econv(n.Left.Type.Etype), Econv(n.Type.Etype)) + s.Unimplementedf("unhandled OCONV %s -> %s", n.Left.Type.Etype, n.Type.Etype) return nil case ODOTTYPE: @@ -1708,7 +1719,7 @@ func (s *state) expr(n *Node) *ssa.Value { case ONE: return s.newValue1(ssa.OpNot, Types[TBOOL], c) default: - s.Fatalf("ordered complex compare %s", opnames[n.Op]) + s.Fatalf("ordered complex compare %s", n.Op) } } return s.newValue2(s.ssaOp(n.Op, n.Left.Type), Types[TBOOL], a, b) @@ -1911,8 +1922,7 @@ func (s *state) expr(n *Node) *ssa.Value { return s.newValue2(ssa.OpLoad, n.Type, addr, s.mem()) case OIND: - p := s.expr(n.Left) - s.nilCheck(p) + p := s.exprPtr(n.Left, false, n.Lineno) return s.newValue2(ssa.OpLoad, n.Type, p, s.mem()) case ODOT: @@ -1925,8 +1935,7 @@ func (s *state) expr(n *Node) *ssa.Value { return s.newValue2(ssa.OpLoad, n.Type, p, s.mem()) case ODOTPTR: - p := s.expr(n.Left) - s.nilCheck(p) + p := s.exprPtr(n.Left, false, n.Lineno) p = s.newValue1I(ssa.OpOffPtr, p.Type, n.Xoffset, p) return s.newValue2(ssa.OpLoad, n.Type, p, s.mem()) @@ -2019,38 +2028,34 @@ func (s *state) expr(n *Node) *ssa.Value { } return s.newValue2(ssa.OpIMake, n.Type, tab, data) - case OSLICE, OSLICEARR: + case OSLICE, OSLICEARR, OSLICE3, OSLICE3ARR: v := s.expr(n.Left) - var i, j *ssa.Value - if n.Right.Left != nil { - i = s.extendIndex(s.expr(n.Right.Left)) + var i, j, k *ssa.Value + low, high, max := n.SliceBounds() + if low != nil { + i = s.extendIndex(s.expr(low)) + } + if high != nil { + j = s.extendIndex(s.expr(high)) } - if n.Right.Right != nil { - j = s.extendIndex(s.expr(n.Right.Right)) + if max != nil { + k = s.extendIndex(s.expr(max)) } - p, l, c := s.slice(n.Left.Type, v, i, j, nil) + p, l, c := s.slice(n.Left.Type, v, i, j, k) return s.newValue3(ssa.OpSliceMake, n.Type, p, l, c) + case OSLICESTR: v := s.expr(n.Left) var i, j *ssa.Value - if n.Right.Left != nil { - i = s.extendIndex(s.expr(n.Right.Left)) + low, high, _ := n.SliceBounds() + if low != nil { + i = s.extendIndex(s.expr(low)) } - if n.Right.Right != nil { - j = s.extendIndex(s.expr(n.Right.Right)) + if high != nil { + j = s.extendIndex(s.expr(high)) } p, l, _ := s.slice(n.Left.Type, v, i, j, nil) return s.newValue2(ssa.OpStringMake, n.Type, p, l) - case OSLICE3, OSLICE3ARR: - v := s.expr(n.Left) - var i *ssa.Value - if n.Right.Left != nil { - i = s.extendIndex(s.expr(n.Right.Left)) - } - j := s.extendIndex(s.expr(n.Right.Right.Left)) - k := s.extendIndex(s.expr(n.Right.Right.Right)) - p, l, c := s.slice(n.Left.Type, v, i, j, k) - return s.newValue3(ssa.OpSliceMake, n.Type, p, l, c) case OCALLFUNC: if isIntrinsicCall1(n) { @@ -2066,32 +2071,67 @@ func (s *state) expr(n *Node) *ssa.Value { return s.newValue1(ssa.OpGetG, n.Type, s.mem()) case OAPPEND: - return s.exprAppend(n) + return s.append(n, false) default: - s.Unimplementedf("unhandled expr %s", opnames[n.Op]) + s.Unimplementedf("unhandled expr %s", n.Op) return nil } } -// exprAppend converts an OAPPEND node n to an ssa.Value, adds it to s, and returns the Value. -func (s *state) exprAppend(n *Node) *ssa.Value { - // append(s, e1, e2, e3). Compile like: - // ptr,len,cap := s +// append converts an OAPPEND node to SSA. +// If inplace is false, it converts the OAPPEND expression n to an ssa.Value, +// adds it to s, and returns the Value. +// If inplace is true, it writes the result of the OAPPEND expression n +// back to the slice being appended to, and returns nil. +// inplace MUST be set to false if the slice can be SSA'd. +func (s *state) append(n *Node, inplace bool) *ssa.Value { + // If inplace is false, process as expression "append(s, e1, e2, e3)": + // + // ptr, len, cap := s // newlen := len + 3 - // if newlen > s.cap { - // ptr,_,cap = growslice(s, newlen) + // if newlen > cap { + // ptr, len, cap = growslice(s, newlen) + // newlen = len + 3 // recalculate to avoid a spill // } + // // with write barriers, if needed: + // *(ptr+len) = e1 + // *(ptr+len+1) = e2 + // *(ptr+len+2) = e3 + // return makeslice(ptr, newlen, cap) + // + // + // If inplace is true, process as statement "s = append(s, e1, e2, e3)": + // + // a := &s + // ptr, len, cap := s + // newlen := len + 3 + // if newlen > cap { + // newptr, len, newcap = growslice(ptr, len, cap, newlen) + // vardef(a) // if necessary, advise liveness we are writing a new a + // *a.cap = newcap // write before ptr to avoid a spill + // *a.ptr = newptr // with write barrier + // } + // newlen = len + 3 // recalculate to avoid a spill + // *a.len = newlen + // // with write barriers, if needed: // *(ptr+len) = e1 // *(ptr+len+1) = e2 // *(ptr+len+2) = e3 - // makeslice(ptr,newlen,cap) et := n.Type.Elem() pt := Ptrto(et) // Evaluate slice - slice := s.expr(n.List.First()) + sn := n.List.First() // the slice node is the first in the list + + var slice, addr *ssa.Value + if inplace { + addr = s.addr(sn, false) + slice = s.newValue2(ssa.OpLoad, n.Type, addr, s.mem()) + } else { + slice = s.expr(sn) + } // Allocate new blocks grow := s.f.NewBlock(ssa.BlockPlain) @@ -2103,9 +2143,17 @@ func (s *state) exprAppend(n *Node) *ssa.Value { l := s.newValue1(ssa.OpSliceLen, Types[TINT], slice) c := s.newValue1(ssa.OpSliceCap, Types[TINT], slice) nl := s.newValue2(s.ssaOp(OADD, Types[TINT]), Types[TINT], l, s.constInt(Types[TINT], nargs)) + cmp := s.newValue2(s.ssaOp(OGT, Types[TINT]), Types[TBOOL], nl, c) s.vars[&ptrVar] = p - s.vars[&capVar] = c + + if !inplace { + s.vars[&newlenVar] = nl + s.vars[&capVar] = c + } else { + s.vars[&lenVar] = l + } + b := s.endBlock() b.Kind = ssa.BlockIf b.Likely = ssa.BranchUnlikely @@ -2115,20 +2163,40 @@ func (s *state) exprAppend(n *Node) *ssa.Value { // Call growslice s.startBlock(grow) - taddr := s.newValue1A(ssa.OpAddr, Types[TUINTPTR], &ssa.ExternSymbol{Types[TUINTPTR], typenamesym(n.Type)}, s.sb) + taddr := s.newValue1A(ssa.OpAddr, Types[TUINTPTR], &ssa.ExternSymbol{Types[TUINTPTR], typenamesym(n.Type.Elem())}, s.sb) r := s.rtcall(growslice, true, []*Type{pt, Types[TINT], Types[TINT]}, taddr, p, l, c, nl) - s.vars[&ptrVar] = r[0] - // Note: we don't need to read r[1], the result's length. It will be nl. - // (or maybe we should, we just have to spill/restore nl otherwise?) - s.vars[&capVar] = r[2] + if inplace { + if sn.Op == ONAME { + // Tell liveness we're about to build a new slice + s.vars[&memVar] = s.newValue1A(ssa.OpVarDef, ssa.TypeMem, sn, s.mem()) + } + capaddr := s.newValue1I(ssa.OpOffPtr, pt, int64(Array_cap), addr) + s.vars[&memVar] = s.newValue3I(ssa.OpStore, ssa.TypeMem, s.config.IntSize, capaddr, r[2], s.mem()) + s.insertWBstore(pt, addr, r[0], n.Lineno, 0) + // load the value we just stored to avoid having to spill it + s.vars[&ptrVar] = s.newValue2(ssa.OpLoad, pt, addr, s.mem()) + s.vars[&lenVar] = r[1] // avoid a spill in the fast path + } else { + s.vars[&ptrVar] = r[0] + s.vars[&newlenVar] = s.newValue2(s.ssaOp(OADD, Types[TINT]), Types[TINT], r[1], s.constInt(Types[TINT], nargs)) + s.vars[&capVar] = r[2] + } + b = s.endBlock() b.AddEdgeTo(assign) // assign new elements to slots s.startBlock(assign) + if inplace { + l = s.variable(&lenVar, Types[TINT]) // generates phi for len + nl = s.newValue2(s.ssaOp(OADD, Types[TINT]), Types[TINT], l, s.constInt(Types[TINT], nargs)) + lenaddr := s.newValue1I(ssa.OpOffPtr, pt, int64(Array_nel), addr) + s.vars[&memVar] = s.newValue3I(ssa.OpStore, ssa.TypeMem, s.config.IntSize, lenaddr, nl, s.mem()) + } + // Evaluate args args := make([]*ssa.Value, 0, nargs) store := make([]bool, 0, nargs) @@ -2142,8 +2210,11 @@ func (s *state) exprAppend(n *Node) *ssa.Value { } } - p = s.variable(&ptrVar, pt) // generates phi for ptr - c = s.variable(&capVar, Types[TINT]) // generates phi for cap + p = s.variable(&ptrVar, pt) // generates phi for ptr + if !inplace { + nl = s.variable(&newlenVar, Types[TINT]) // generates phi for nl + c = s.variable(&capVar, Types[TINT]) // generates phi for cap + } p2 := s.newValue2(ssa.OpPtrIndex, pt, p, l) // TODO: just one write barrier call for all of these writes? // TODO: maybe just one writeBarrier.enabled check? @@ -2164,9 +2235,14 @@ func (s *state) exprAppend(n *Node) *ssa.Value { } } - // make result delete(s.vars, &ptrVar) + if inplace { + delete(s.vars, &lenVar) + return nil + } + delete(s.vars, &newlenVar) delete(s.vars, &capVar) + // make result return s.newValue3(ssa.OpSliceMake, n.Type, p, nl, c) } @@ -2398,7 +2474,7 @@ func isSSAIntrinsic1(s *Sym) bool { // so far has only been noticed for Bswap32 and the 16-bit count // leading/trailing instructions, but heuristics might change // in the future or on different architectures). - if !ssaEnabled || ssa.IntrinsicsDisable || Thearch.Thechar != '6' { + if !ssaEnabled || ssa.IntrinsicsDisable || Thearch.LinkArch.Family != sys.AMD64 { return false } if s != nil && s.Pkg != nil && s.Pkg.Path == "runtime/internal/sys" { @@ -2484,7 +2560,7 @@ func (s *state) call(n *Node, k callKind) *ssa.Value { // want to set it here. case OCALLINTER: if fn.Op != ODOTINTER { - Fatalf("OCALLINTER: n.Left not an ODOTINTER: %v", Oconv(fn.Op, 0)) + Fatalf("OCALLINTER: n.Left not an ODOTINTER: %v", fn.Op) } i := s.expr(fn.Left) itab := s.newValue1(ssa.OpITab, Types[TUINTPTR], i) @@ -2542,7 +2618,7 @@ func (s *state) call(n *Node, k callKind) *ssa.Value { case sym != nil: call = s.newValue1A(ssa.OpStaticCall, ssa.TypeMem, sym, s.mem()) default: - Fatalf("bad call type %s %v", opnames[n.Op], n) + Fatalf("bad call type %s %v", n.Op, n) } call.AuxInt = stksize // Call operations carry the argsize of the callee along with them @@ -2570,7 +2646,7 @@ func (s *state) call(n *Node, k callKind) *ssa.Value { return nil } fp := res.Field(0) - return s.entryNewValue1I(ssa.OpOffPtr, Ptrto(fp.Type), fp.Offset, s.sp) + return s.entryNewValue1I(ssa.OpOffPtr, Ptrto(fp.Type), fp.Offset+Ctxt.FixedFrameSize(), s.sp) } // etypesign returns the signed-ness of e, for integer/pointer etypes. @@ -2680,19 +2756,12 @@ func (s *state) addr(n *Node, bounded bool) *ssa.Value { return s.newValue2(ssa.OpPtrIndex, Ptrto(n.Left.Type.Elem()), a, i) } case OIND: - p := s.expr(n.Left) - if !bounded { - s.nilCheck(p) - } - return p + return s.exprPtr(n.Left, bounded, n.Lineno) case ODOT: p := s.addr(n.Left, bounded) return s.newValue1I(ssa.OpOffPtr, t, n.Xoffset, p) case ODOTPTR: - p := s.expr(n.Left) - if !bounded { - s.nilCheck(p) - } + p := s.exprPtr(n.Left, bounded, n.Lineno) return s.newValue1I(ssa.OpOffPtr, t, n.Xoffset, p) case OCLOSUREVAR: return s.newValue1I(ssa.OpOffPtr, t, n.Xoffset, @@ -2715,7 +2784,7 @@ func (s *state) addr(n *Node, bounded bool) *ssa.Value { return s.call(n, callNormal) default: - s.Unimplementedf("unhandled addr %v", Oconv(n.Op, 0)) + s.Unimplementedf("unhandled addr %v", n.Op) return nil } } @@ -2773,9 +2842,6 @@ func canSSAType(t *Type) bool { } switch t.Etype { case TARRAY: - if t.IsSlice() { - return true - } // We can't do arrays because dynamic indexing is // not supported on SSA variables. // TODO: maybe allow if length is <=1? All indexes @@ -2797,6 +2863,19 @@ func canSSAType(t *Type) bool { } } +// exprPtr evaluates n to a pointer and nil-checks it. +func (s *state) exprPtr(n *Node, bounded bool, lineno int32) *ssa.Value { + p := s.expr(n) + if bounded || n.NonNil { + if s.f.Config.Debug_checknil() && lineno > 1 { + s.f.Config.Warnl(lineno, "removed nil check") + } + return p + } + s.nilCheck(p) + return p +} + // nilCheck generates nil pointer checking code. // Starts a new block on return, unless nil checks are disabled. // Used only for automatically inserted nil checks, @@ -3687,6 +3766,10 @@ func (s *state) resolveFwdRef(v *ssa.Value) { if b == s.f.Entry { // Live variable at start of function. if s.canSSA(name) { + if strings.HasPrefix(name.Sym.Name, "autotmp_") { + // It's likely that this is an uninitialized variable in the entry block. + s.Fatalf("Treating auto as if it were arg, func %s, node %v, value %v", b.Func.Name, name, v) + } v.Op = ssa.OpArg v.Aux = name return @@ -4207,7 +4290,7 @@ func (e *ssaExport) SplitInterface(name ssa.LocalSlot) (ssa.LocalSlot, ssa.Local func (e *ssaExport) SplitSlice(name ssa.LocalSlot) (ssa.LocalSlot, ssa.LocalSlot, ssa.LocalSlot) { n := name.N.(*Node) - ptrType := Ptrto(n.Type.Type) + ptrType := Ptrto(name.Type.ElemType().(*Type)) lenType := Types[TINT] if n.Class == PAUTO && !n.Addrtaken { // Split this slice up into three separate variables. @@ -4241,6 +4324,20 @@ func (e *ssaExport) SplitComplex(name ssa.LocalSlot) (ssa.LocalSlot, ssa.LocalSl return ssa.LocalSlot{n, t, name.Off}, ssa.LocalSlot{n, t, name.Off + s} } +func (e *ssaExport) SplitStruct(name ssa.LocalSlot, i int) ssa.LocalSlot { + n := name.N.(*Node) + st := name.Type + ft := st.FieldType(i) + if n.Class == PAUTO && !n.Addrtaken { + // Note: the _ field may appear several times. But + // have no fear, identically-named but distinct Autos are + // ok, albeit maybe confusing for a debugger. + x := e.namedAuto(n.Sym.Name+"."+st.FieldName(i), ft) + return ssa.LocalSlot{x, ft, 0} + } + return ssa.LocalSlot{n, ft, name.Off + st.FieldOff(i)} +} + // namedAuto returns a new AUTO variable with the given name and type. func (e *ssaExport) namedAuto(name string, typ ssa.Type) ssa.GCNode { t := typ.(*Type) diff --git a/src/cmd/compile/internal/gc/ssa_test.go b/src/cmd/compile/internal/gc/ssa_test.go index 59a240237b..46e1b0a7d3 100644 --- a/src/cmd/compile/internal/gc/ssa_test.go +++ b/src/cmd/compile/internal/gc/ssa_test.go @@ -99,3 +99,7 @@ func TestUnsafe(t *testing.T) { runTest(t, "unsafe_ssa.go") } func TestPhi(t *testing.T) { runTest(t, "phi_ssa.go") } func TestSlice(t *testing.T) { runTest(t, "slice.go") } + +func TestNamedReturn(t *testing.T) { runTest(t, "namedReturn.go") } + +func TestDuplicateLoad(t *testing.T) { runTest(t, "dupLoad.go") } diff --git a/src/cmd/compile/internal/gc/subr.go b/src/cmd/compile/internal/gc/subr.go index a61b8bcd27..6f2ed6a839 100644 --- a/src/cmd/compile/internal/gc/subr.go +++ b/src/cmd/compile/internal/gc/subr.go @@ -372,30 +372,6 @@ func saveorignode(n *Node) { n.Orig = norig } -// checkMapKeyType checks that Type key is valid for use as a map key. -func checkMapKeyType(key *Type) { - alg, bad := algtype1(key) - if alg != ANOEQ { - return - } - switch bad.Etype { - default: - Yyerror("invalid map key type %v", key) - case TANY: - // Will be resolved later. - case TFORW: - // map[key] used during definition of key. - // postpone check until key is fully defined. - // if there are multiple uses of map[key] - // before key is fully defined, the error - // will only be printed for the first one. - // good enough. - if key.Maplineno == 0 { - key.Maplineno = lineno - } - } -} - // methcmp sorts by symbol, then by package path for unexported symbols. type methcmp []*Field @@ -540,8 +516,15 @@ func treecopy(n *Node, lineno int32) *Node { } return n + case OPACK: + // OPACK nodes are never valid in const value declarations, + // but allow them like any other declared symbol to avoid + // crashing (golang.org/issue/11361). + fallthrough + case ONAME, OLITERAL, OTYPE: return n + } } @@ -611,6 +594,7 @@ func methtype(t *Type, mustname int) *Type { case TSTRUCT, TARRAY, + TSLICE, TMAP, TCHAN, TSTRING, @@ -631,14 +615,10 @@ func cplxsubtype(et EType) EType { return TFLOAT64 } - Fatalf("cplxsubtype: %v\n", Econv(et)) + Fatalf("cplxsubtype: %v\n", et) return 0 } -func eqnote(a, b *string) bool { - return a == b || a != nil && b != nil && *a == *b -} - // Eqtype reports whether t1 and t2 are identical, following the spec rules. // // Any cyclic type must go through a named type, and if one is @@ -658,7 +638,7 @@ func eqtype1(t1, t2 *Type, assumedEqual map[typePair]struct{}) bool { if t1 == t2 { return true } - if t1 == nil || t2 == nil || t1.Etype != t2.Etype { + if t1 == nil || t2 == nil || t1.Etype != t2.Etype || t1.Broke || t2.Broke { return false } if t1.Sym != nil || t2.Sym != nil { @@ -686,7 +666,7 @@ func eqtype1(t1, t2 *Type, assumedEqual map[typePair]struct{}) bool { t1, i1 := IterFields(t1) t2, i2 := IterFields(t2) for ; t1 != nil && t2 != nil; t1, t2 = i1.Next(), i2.Next() { - if t1.Sym != t2.Sym || t1.Embedded != t2.Embedded || !eqtype1(t1.Type, t2.Type, assumedEqual) || !eqnote(t1.Note, t2.Note) { + if t1.Sym != t2.Sym || t1.Embedded != t2.Embedded || !eqtype1(t1.Type, t2.Type, assumedEqual) || t1.Note != t2.Note { return false } } @@ -767,7 +747,7 @@ func assignop(src *Type, dst *Type, why *string) Op { // TODO(rsc,lvd): This behaves poorly in the presence of inlining. // https://golang.org/issue/2795 - if safemode != 0 && importpkg == nil && src != nil && src.Etype == TUNSAFEPTR { + if safemode && importpkg == nil && src != nil && src.Etype == TUNSAFEPTR { Yyerror("cannot use unsafe.Pointer") errorexit() } @@ -853,18 +833,13 @@ func assignop(src *Type, dst *Type, why *string) Op { // 5. src is the predeclared identifier nil and dst is a nillable type. if src.Etype == TNIL { switch dst.Etype { - case TARRAY: - if !dst.IsSlice() { - break - } - fallthrough - case TPTR32, TPTR64, TFUNC, TMAP, TCHAN, - TINTER: + TINTER, + TSLICE: return OCONVNOP } } @@ -1045,6 +1020,68 @@ func Is64(t *Type) bool { return false } +// SliceBounds returns n's slice bounds: low, high, and max in expr[low:high:max]. +// n must be a slice expression. max is nil if n is a simple slice expression. +func (n *Node) SliceBounds() (low, high, max *Node) { + switch n.Op { + case OSLICE, OSLICEARR, OSLICESTR: + if n.Right == nil { + return nil, nil, nil + } + if n.Right.Op != OKEY { + Fatalf("SliceBounds right %s", opnames[n.Right.Op]) + } + return n.Right.Left, n.Right.Right, nil + case OSLICE3, OSLICE3ARR: + if n.Right.Op != OKEY || n.Right.Right.Op != OKEY { + Fatalf("SliceBounds right %s %s", opnames[n.Right.Op], opnames[n.Right.Right.Op]) + } + return n.Right.Left, n.Right.Right.Left, n.Right.Right.Right + } + Fatalf("SliceBounds op %s: %v", n.Op, n) + return nil, nil, nil +} + +// SetSliceBounds sets n's slice bounds, where n is a slice expression. +// n must be a slice expression. If max is non-nil, n must be a full slice expression. +func (n *Node) SetSliceBounds(low, high, max *Node) { + switch n.Op { + case OSLICE, OSLICEARR, OSLICESTR: + if max != nil { + Fatalf("SetSliceBounds %s given three bounds", n.Op) + } + if n.Right == nil { + n.Right = Nod(OKEY, low, high) + return + } + n.Right.Left = low + n.Right.Right = high + return + case OSLICE3, OSLICE3ARR: + if n.Right == nil { + n.Right = Nod(OKEY, low, Nod(OKEY, high, max)) + } + n.Right.Left = low + n.Right.Right.Left = high + n.Right.Right.Right = max + return + } + Fatalf("SetSliceBounds op %s: %v", n.Op, n) +} + +// IsSlice3 reports whether o is a slice3 op (OSLICE3, OSLICE3ARR). +// o must be a slicing op. +func (o Op) IsSlice3() bool { + switch o { + case OSLICE, OSLICEARR, OSLICESTR: + return false + case OSLICE3, OSLICE3ARR: + return true + } + Fatalf("IsSlice3 op %v", o) + return false +} + // Is a conversion between t1 and t2 a no-op? func Noconv(t1 *Type, t2 *Type) bool { e1 := Simtype[t1.Etype] @@ -1081,6 +1118,10 @@ func syslook(name string) *Node { return s.Def } +func (s *Sym) IsRuntimeCall(name string) bool { + return s.Pkg == Runtimepkg && s.Name == name +} + // typehash computes a hash value for type t to use in type switch // statements. func typehash(t *Type) uint32 { @@ -1162,9 +1203,9 @@ func printframenode(n *Node) { } switch n.Op { case ONAME: - fmt.Printf("%v %v G%d %v width=%d\n", Oconv(n.Op, 0), n.Sym, n.Name.Vargen, n.Type, w) + fmt.Printf("%v %v G%d %v width=%d\n", n.Op, n.Sym, n.Name.Vargen, n.Type, w) case OTYPE: - fmt.Printf("%v %v width=%d\n", Oconv(n.Op, 0), n.Type, w) + fmt.Printf("%v %v width=%d\n", n.Op, n.Type, w) } } @@ -1245,7 +1286,7 @@ func badtype(op Op, tl *Type, tr *Type) { } s := fmt_ - Yyerror("illegal types for operand: %v%s", Oconv(op, 0), s) + Yyerror("illegal types for operand: %v%s", op, s) } // Brcom returns !(op). @@ -1265,7 +1306,7 @@ func Brcom(op Op) Op { case OGE: return OLT } - Fatalf("brcom: no com for %v\n", Oconv(op, 0)) + Fatalf("brcom: no com for %v\n", op) return op } @@ -1286,7 +1327,7 @@ func Brrev(op Op) Op { case OGE: return OLE } - Fatalf("brrev: no rev for %v\n", Oconv(op, 0)) + Fatalf("brrev: no rev for %v\n", op) return op } @@ -1341,6 +1382,11 @@ func safeexpr(n *Node, init *Nodes) *Node { a.Right = r a = walkexpr(a, init) return a + + case OSTRUCTLIT, OARRAYLIT: + if isStaticCompositeLiteral(n) { + return n + } } // make a copy; must not be used as an lvalue diff --git a/src/cmd/compile/internal/gc/swt.go b/src/cmd/compile/internal/gc/swt.go index 3b08b13508..aac92fd311 100644 --- a/src/cmd/compile/internal/gc/swt.go +++ b/src/cmd/compile/internal/gc/swt.go @@ -350,7 +350,7 @@ func casebody(sw *Node, typeswvar *Node) { for i, n := range sw.List.Slice() { setlineno(n) if n.Op != OXCASE { - Fatalf("casebody %v", Oconv(n.Op, 0)) + Fatalf("casebody %v", n.Op) } n.Op = OCASE needvar := n.List.Len() != 1 || n.List.First().Op == OLITERAL diff --git a/src/cmd/compile/internal/gc/syntax.go b/src/cmd/compile/internal/gc/syntax.go index 2f3b98a8ef..8a675ac157 100644 --- a/src/cmd/compile/internal/gc/syntax.go +++ b/src/cmd/compile/internal/gc/syntax.go @@ -54,6 +54,7 @@ type Node struct { Addable bool // addressable Etype EType // op for OASOP, etype for OTYPE, exclam for export, 6g saved reg, ChanDir for OTCHAN Bounded bool // bounds check unnecessary + NonNil bool // guaranteed to be non-nil Class Class // PPARAM, PAUTO, PEXTERN, etc Embedded uint8 // ODCLFIELD embedded type Colas bool // OAS resulting from := diff --git a/src/cmd/compile/internal/gc/testdata/dupLoad.go b/src/cmd/compile/internal/gc/testdata/dupLoad.go new file mode 100644 index 0000000000..d18dc733e1 --- /dev/null +++ b/src/cmd/compile/internal/gc/testdata/dupLoad.go @@ -0,0 +1,83 @@ +// run + +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This test makes sure that we don't split a single +// load up into two separate loads. + +package main + +import "fmt" + +//go:noinline +func read1(b []byte) (uint16, uint16) { + // There is only a single read of b[0]. The two + // returned values must have the same low byte. + v := b[0] + return uint16(v), uint16(v) | uint16(b[1])<<8 +} + +const N = 100000 + +func main1() { + done := make(chan struct{}) + b := make([]byte, 2) + go func() { + for i := 0; i < N; i++ { + b[0] = byte(i) + b[1] = byte(i) + } + done <- struct{}{} + }() + go func() { + for i := 0; i < N; i++ { + x, y := read1(b) + if byte(x) != byte(y) { + fmt.Printf("x=%x y=%x\n", x, y) + panic("bad") + } + } + done <- struct{}{} + }() + <-done + <-done +} + +//go:noinline +func read2(b []byte) (uint16, uint16) { + // There is only a single read of b[1]. The two + // returned values must have the same high byte. + v := uint16(b[1]) << 8 + return v, uint16(b[0]) | v +} + +func main2() { + done := make(chan struct{}) + b := make([]byte, 2) + go func() { + for i := 0; i < N; i++ { + b[0] = byte(i) + b[1] = byte(i) + } + done <- struct{}{} + }() + go func() { + for i := 0; i < N; i++ { + x, y := read2(b) + if x&0xff00 != y&0xff00 { + fmt.Printf("x=%x y=%x\n", x, y) + panic("bad") + } + } + done <- struct{}{} + }() + <-done + <-done +} + +func main() { + main1() + main2() +} diff --git a/src/cmd/compile/internal/gc/testdata/namedReturn.go b/src/cmd/compile/internal/gc/testdata/namedReturn.go new file mode 100644 index 0000000000..19ef8a7e43 --- /dev/null +++ b/src/cmd/compile/internal/gc/testdata/namedReturn.go @@ -0,0 +1,105 @@ +// run + +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +// This test makes sure that naming named +// return variables in a return statement works. +// See issue #14904. + +package main + +import ( + "fmt" + "runtime" +) + +// Our heap-allocated object that will be GC'd incorrectly. +// Note that we always check the second word because that's +// where 0xdeaddeaddeaddead is written. +type B [4]int + +// small (SSAable) array +type T1 [3]*B + +//go:noinline +func f1() (t T1) { + t[0] = &B{91, 92, 93, 94} + runtime.GC() + return t +} + +// large (non-SSAable) array +type T2 [8]*B + +//go:noinline +func f2() (t T2) { + t[0] = &B{91, 92, 93, 94} + runtime.GC() + return t +} + +// small (SSAable) struct +type T3 struct { + a, b, c *B +} + +//go:noinline +func f3() (t T3) { + t.a = &B{91, 92, 93, 94} + runtime.GC() + return t +} + +// large (non-SSAable) struct +type T4 struct { + a, b, c, d, e, f *B +} + +//go:noinline +func f4() (t T4) { + t.a = &B{91, 92, 93, 94} + runtime.GC() + return t +} + +var sink *B + +func f5() int { + b := &B{91, 92, 93, 94} + t := T4{b, nil, nil, nil, nil, nil} + sink = b // make sure b is heap allocated ... + sink = nil // ... but not live + runtime.GC() + t = t + return t.a[1] +} + +func main() { + failed := false + + if v := f1()[0][1]; v != 92 { + fmt.Printf("f1()[0][1]=%d, want 92\n", v) + failed = true + } + if v := f2()[0][1]; v != 92 { + fmt.Printf("f2()[0][1]=%d, want 92\n", v) + failed = true + } + if v := f3().a[1]; v != 92 { + fmt.Printf("f3().a[1]=%d, want 92\n", v) + failed = true + } + if v := f4().a[1]; v != 92 { + fmt.Printf("f4().a[1]=%d, want 92\n", v) + failed = true + } + if v := f5(); v != 92 { + fmt.Printf("f5()=%d, want 92\n", v) + failed = true + } + if failed { + panic("bad") + } +} diff --git a/src/cmd/compile/internal/gc/type.go b/src/cmd/compile/internal/gc/type.go index b89c5dbf22..9f049babc2 100644 --- a/src/cmd/compile/internal/gc/type.go +++ b/src/cmd/compile/internal/gc/type.go @@ -44,6 +44,7 @@ const ( TPTR64 TFUNC + TSLICE TARRAY TSTRUCT TCHAN @@ -70,9 +71,18 @@ const ( NTYPE ) +// ChanDir is whether a channel can send, receive, or both. +type ChanDir uint8 + +func (c ChanDir) CanRecv() bool { return c&Crecv != 0 } +func (c ChanDir) CanSend() bool { return c&Csend != 0 } + const ( - sliceBound = -1 // slices have Bound=sliceBound - dddBound = -100 // arrays declared as [...]T start life with Bound=dddBound + // types of channel + // must match ../../../../reflect/type.go:/ChanDir + Crecv ChanDir = 1 << 0 + Csend ChanDir = 1 << 1 + Cboth ChanDir = Crecv | Csend ) // Types stores pointers to predeclared named types. @@ -108,55 +118,168 @@ var ( // A Type represents a Go type. type Type struct { - Etype EType - Noalg bool - Chan ChanDir - Trecur uint8 // to detect loops - Printed bool - Funarg bool // on TSTRUCT and TFIELD - Local bool // created in this file - Deferwidth bool - Broke bool // broken type definition. - Align uint8 - Haspointers uint8 // 0 unknown, 1 no, 2 yes - Outnamed bool // on TFUNC + // Extra contains extra etype-specific fields. + // As an optimization, those etype-specific structs which contain exactly + // one pointer-shaped field are stored as values rather than pointers when possible. + // + // TMAP: *MapType + // TFORW: *ForwardType + // TFUNC: *FuncType + // TINTERMETHOD: InterMethType + // TSTRUCT: *StructType + // TINTER: *InterType + // TDDDFIELD: DDDFieldType + // TFUNCARGS: FuncArgsType + // TCHANARGS: ChanArgsType + // TCHAN: *ChanType + // TPTR32, TPTR64: PtrType + // TARRAY: *ArrayType + // TSLICE: SliceType + Extra interface{} - Nod *Node // canonical OTYPE node - Orig *Type // original type (type literal or predefined type) + // Width is the width of this Type in bytes. + Width int64 methods Fields allMethods Fields - Sym *Sym + Nod *Node // canonical OTYPE node + Orig *Type // original type (type literal or predefined type) + + Sym *Sym // symbol containing name, for named types Vargen int32 // unique name for OTYPE/ONAME - Lineno int32 + Lineno int32 // line at which this type was declared, implicitly or explicitly + + Etype EType // kind of type + Noalg bool // suppress hash and eq algorithm generation + Trecur uint8 // to detect loops + Printed bool // prevent duplicate export printing + Local bool // created in this file + Deferwidth bool + Broke bool // broken type definition. + Align uint8 // the required alignment of this type, in bytes +} + +// MapType contains Type fields specific to maps. +type MapType struct { + Key *Type // Key type + Val *Type // Val (elem) type + + Bucket *Type // internal struct type representing a hash bucket + Hmap *Type // internal struct type representing the Hmap (map header object) + Hiter *Type // internal struct type representing hash iterator state +} + +// MapType returns t's extra map-specific fields. +func (t *Type) MapType() *MapType { + t.wantEtype(TMAP) + return t.Extra.(*MapType) +} - nname *Node +// ForwardType contains Type fields specific to forward types. +type ForwardType struct { + Copyto []*Node // where to copy the eventual value to + Embedlineno int32 // first use of this type as an embedded type +} + +// ForwardType returns t's extra forward-type-specific fields. +func (t *Type) ForwardType() *ForwardType { + t.wantEtype(TFORW) + return t.Extra.(*ForwardType) +} + +// FuncType contains Type fields specific to func types. +type FuncType struct { + Receiver *Type // function receiver + Results *Type // function results + Params *Type // function params + + Nname *Node + + // Argwid is the total width of the function receiver, params, and results. + // It gets calculated via a temporary TFUNCARGS type. + // Note that TFUNC's Width is Widthptr. Argwid int64 - // most nodes - Type *Type // element type for TARRAY, TCHAN, TMAP, TPTRxx - Width int64 + Outnamed bool +} - // TSTRUCT +// FuncType returns t's extra func-specific fields. +func (t *Type) FuncType() *FuncType { + t.wantEtype(TFUNC) + return t.Extra.(*FuncType) +} + +// InterMethType contains Type fields specific to interface method psuedo-types. +type InterMethType struct { + Nname *Node +} + +// StructType contains Type fields specific to struct types. +type StructType struct { fields Fields - Down *Type // key type in TMAP; next struct in Funarg TSTRUCT + // Maps have three associated internal structs (see struct MapType). + // Map links such structs back to their map type. + Map *Type - // TARRAY - Bound int64 // negative is slice + Funarg bool // whether this struct represents function parameters + Haspointers uint8 // 0 unknown, 1 no, 2 yes +} - // TMAP - Bucket *Type // internal type representing a hash bucket - Hmap *Type // internal type representing a Hmap (map header object) - Hiter *Type // internal type representing hash iterator state - Map *Type // link from the above 3 internal types back to the map type. +// StructType returns t's extra struct-specific fields. +func (t *Type) StructType() *StructType { + t.wantEtype(TSTRUCT) + return t.Extra.(*StructType) +} - Maplineno int32 // first use of TFORW as map key - Embedlineno int32 // first use of TFORW as embedded type +// InterType contains Type fields specific to interface types. +type InterType struct { + fields Fields +} + +// PtrType contains Type fields specific to pointer types. +type PtrType struct { + Elem *Type // element type +} + +// DDDFieldType contains Type fields specific to TDDDFIELD types. +type DDDFieldType struct { + T *Type // reference to a slice type for ... args +} + +// ChanArgsType contains Type fields specific to TCHANARGS types. +type ChanArgsType struct { + T *Type // reference to a chan type whose elements need a width check +} - // for TFORW, where to copy the eventual value to - Copyto []*Node +// // FuncArgsType contains Type fields specific to TFUNCARGS types. +type FuncArgsType struct { + T *Type // reference to a func type whose elements need a width check +} + +// ChanType contains Type fields specific to channel types. +type ChanType struct { + Elem *Type // element type + Dir ChanDir // channel direction +} + +// ChanType returns t's extra channel-specific fields. +func (t *Type) ChanType() *ChanType { + t.wantEtype(TCHAN) + return t.Extra.(*ChanType) +} + +// ArrayType contains Type fields specific to array types. +type ArrayType struct { + Elem *Type // element type + Bound int64 // number of elements; <0 if unknown yet + Haspointers uint8 // 0 unknown, 1 no, 2 yes +} + +// SliceType contains Type fields specific to slice types. +type SliceType struct { + Elem *Type // element type } // A Field represents a field in a struct or a method in an interface or @@ -177,7 +300,7 @@ type Field struct { // or interface Type. Offset int64 - Note *string // literal string annotation + Note string // literal string annotation } // End returns the offset of the first byte immediately after this field. @@ -209,6 +332,12 @@ func (f *Fields) Slice() []*Field { return *f.s } +// Index returns the i'th element of Fields. +// It panics if f does not have at least i+1 elements. +func (f *Fields) Index(i int) *Field { + return (*f.s)[i] +} + // Set sets f to a slice. // This takes ownership of the slice. func (f *Fields) Set(s []*Field) { @@ -238,71 +367,103 @@ func typ(et EType) *Type { Lineno: lineno, } t.Orig = t + // TODO(josharian): lazily initialize some of these? + switch t.Etype { + case TMAP: + t.Extra = new(MapType) + case TFORW: + t.Extra = new(ForwardType) + case TFUNC: + t.Extra = new(FuncType) + case TINTERMETH: + t.Extra = InterMethType{} + case TSTRUCT: + t.Extra = new(StructType) + case TINTER: + t.Extra = new(InterType) + case TPTR32, TPTR64: + t.Extra = PtrType{} + case TCHANARGS: + t.Extra = ChanArgsType{} + case TFUNCARGS: + t.Extra = FuncArgsType{} + case TDDDFIELD: + t.Extra = DDDFieldType{} + case TCHAN: + t.Extra = new(ChanType) + } return t } // typArray returns a new fixed-length array Type. func typArray(elem *Type, bound int64) *Type { + if bound < 0 { + Fatalf("typArray: invalid bound %v", bound) + } t := typ(TARRAY) - t.Type = elem - t.Bound = bound + t.Extra = &ArrayType{Elem: elem, Bound: bound} return t } // typSlice returns a new slice Type. func typSlice(elem *Type) *Type { - t := typ(TARRAY) - t.Type = elem - t.Bound = sliceBound + t := typ(TSLICE) + t.Extra = SliceType{Elem: elem} return t } // typDDDArray returns a new [...]T array Type. func typDDDArray(elem *Type) *Type { t := typ(TARRAY) - t.Type = elem - t.Bound = dddBound + t.Extra = &ArrayType{Elem: elem, Bound: -1} return t } // typChan returns a new chan Type with direction dir. func typChan(elem *Type, dir ChanDir) *Type { t := typ(TCHAN) - t.Type = elem - t.Chan = dir + ct := t.ChanType() + ct.Elem = elem + ct.Dir = dir return t } // typMap returns a new map Type with key type k and element (aka value) type v. func typMap(k, v *Type) *Type { - if k != nil { - checkMapKeyType(k) - } - t := typ(TMAP) - t.Down = k - t.Type = v + mt := t.MapType() + mt.Key = k + mt.Val = v return t } // typPtr returns a new pointer type pointing to t. func typPtr(elem *Type) *Type { t := typ(Tptr) - t.Type = elem + t.Extra = PtrType{Elem: elem} t.Width = int64(Widthptr) t.Align = uint8(Widthptr) return t } -// typWrapper returns a new wrapper psuedo-type. -func typWrapper(et EType, wrapped *Type) *Type { - switch et { - case TCHANARGS, TFUNCARGS, TDDDFIELD: - default: - Fatalf("typWrapper bad etype %s", et) - } - t := typ(et) - t.Type = wrapped +// typDDDField returns a new TDDDFIELD type for slice type s. +func typDDDField(s *Type) *Type { + t := typ(TDDDFIELD) + t.Extra = DDDFieldType{T: s} + return t +} + +// typChanArgs returns a new TCHANARGS type for channel type c. +func typChanArgs(c *Type) *Type { + t := typ(TCHANARGS) + t.Extra = ChanArgsType{T: c} + return t +} + +// typFuncArgs returns a new TFUNCARGS type for func type f. +func typFuncArgs(f *Type) *Type { + t := typ(TFUNCARGS) + t.Extra = FuncArgsType{T: f} return t } @@ -348,20 +509,41 @@ func substAny(t *Type, types *[]*Type) *Type { t = (*types)[0] *types = (*types)[1:] - case TPTR32, TPTR64, TCHAN, TARRAY: - elem := substAny(t.Type, types) - if elem != t.Type { + case TPTR32, TPTR64: + elem := substAny(t.Elem(), types) + if elem != t.Elem() { t = t.Copy() - t.Type = elem + t.Extra = PtrType{Elem: elem} + } + + case TARRAY: + elem := substAny(t.Elem(), types) + if elem != t.Elem() { + t = t.Copy() + t.Extra.(*ArrayType).Elem = elem + } + + case TSLICE: + elem := substAny(t.Elem(), types) + if elem != t.Elem() { + t = t.Copy() + t.Extra = SliceType{Elem: elem} + } + + case TCHAN: + elem := substAny(t.Elem(), types) + if elem != t.Elem() { + t = t.Copy() + t.Extra.(*ChanType).Elem = elem } case TMAP: - key := substAny(t.Down, types) - val := substAny(t.Type, types) - if key != t.Down || val != t.Type { + key := substAny(t.Key(), types) + val := substAny(t.Val(), types) + if key != t.Key() || val != t.Val() { t = t.Copy() - t.Down = key - t.Type = val + t.Extra.(*MapType).Key = key + t.Extra.(*MapType).Val = val } case TFUNC: @@ -412,6 +594,30 @@ func (t *Type) Copy() *Type { return nil } nt := *t + // copy any *T Extra fields, to avoid aliasing + switch t.Etype { + case TMAP: + x := *t.Extra.(*MapType) + nt.Extra = &x + case TFORW: + x := *t.Extra.(*ForwardType) + nt.Extra = &x + case TFUNC: + x := *t.Extra.(*FuncType) + nt.Extra = &x + case TSTRUCT: + x := *t.Extra.(*StructType) + nt.Extra = &x + case TINTER: + x := *t.Extra.(*InterType) + nt.Extra = &x + case TCHAN: + x := *t.Extra.(*ChanType) + nt.Extra = &x + case TARRAY: + x := *t.Extra.(*ArrayType) + nt.Extra = &x + } // TODO(mdempsky): Find out why this is necessary and explain. if t.Orig == t { nt.Orig = &nt @@ -469,17 +675,17 @@ func (t *Type) wantEtype2(et1, et2 EType) { func (t *Type) RecvsP() **Type { t.wantEtype(TFUNC) - return &t.Type + return &t.Extra.(*FuncType).Receiver } func (t *Type) ParamsP() **Type { t.wantEtype(TFUNC) - return &t.Type.Down.Down + return &t.Extra.(*FuncType).Params } func (t *Type) ResultsP() **Type { t.wantEtype(TFUNC) - return &t.Type.Down + return &t.Extra.(*FuncType).Results } func (t *Type) Recvs() *Type { return *t.RecvsP() } @@ -510,46 +716,77 @@ var paramsResults = [2]func(*Type) *Type{ // Key returns the key type of map type t. func (t *Type) Key() *Type { t.wantEtype(TMAP) - return t.Down + return t.Extra.(*MapType).Key } // Val returns the value type of map type t. func (t *Type) Val() *Type { t.wantEtype(TMAP) - return t.Type + return t.Extra.(*MapType).Val } // Elem returns the type of elements of t. // Usable with pointers, channels, arrays, and slices. func (t *Type) Elem() *Type { switch t.Etype { - case TPTR32, TPTR64, TCHAN, TARRAY: - default: - Fatalf("Type.Elem %s", t.Etype) + case TPTR32, TPTR64: + return t.Extra.(PtrType).Elem + case TARRAY: + return t.Extra.(*ArrayType).Elem + case TSLICE: + return t.Extra.(SliceType).Elem + case TCHAN: + return t.Extra.(*ChanType).Elem } - return t.Type + Fatalf("Type.Elem %s", t.Etype) + return nil } -// Wrapped returns the type that pseudo-type t wraps. -func (t *Type) Wrapped() *Type { - switch t.Etype { - case TCHANARGS, TFUNCARGS, TDDDFIELD: - default: - Fatalf("Type.Wrapped %s", t.Etype) - } - return t.Type +// DDDField returns the slice ... type for TDDDFIELD type t. +func (t *Type) DDDField() *Type { + t.wantEtype(TDDDFIELD) + return t.Extra.(DDDFieldType).T +} + +// ChanArgs returns the channel type for TCHANARGS type t. +func (t *Type) ChanArgs() *Type { + t.wantEtype(TCHANARGS) + return t.Extra.(ChanArgsType).T +} + +// FuncArgs returns the channel type for TFUNCARGS type t. +func (t *Type) FuncArgs() *Type { + t.wantEtype(TFUNCARGS) + return t.Extra.(FuncArgsType).T } // Nname returns the associated function's nname. func (t *Type) Nname() *Node { - t.wantEtype2(TFUNC, TINTERMETH) - return t.nname + switch t.Etype { + case TFUNC: + return t.Extra.(*FuncType).Nname + case TINTERMETH: + return t.Extra.(InterMethType).Nname + } + Fatalf("Type.Nname %v %v", t.Etype, t) + return nil } // Nname sets the associated function's nname. func (t *Type) SetNname(n *Node) { - t.wantEtype2(TFUNC, TINTERMETH) - t.nname = n + switch t.Etype { + case TFUNC: + t.Extra.(*FuncType).Nname = n + case TINTERMETH: + t.Extra = InterMethType{Nname: n} + default: + Fatalf("Type.SetNname %v %v", t.Etype, t) + } +} + +// IsFuncArgStruct reports whether t is a struct representing function parameters. +func (t *Type) IsFuncArgStruct() bool { + return t.Etype == TSTRUCT && t.Extra.(*StructType).Funarg } func (t *Type) Methods() *Fields { @@ -563,10 +800,14 @@ func (t *Type) AllMethods() *Fields { } func (t *Type) Fields() *Fields { - if t.Etype != TSTRUCT && t.Etype != TINTER { - Fatalf("Fields: type %v does not have fields", t) + switch t.Etype { + case TSTRUCT: + return &t.Extra.(*StructType).fields + case TINTER: + return &t.Extra.(*InterType).fields } - return &t.fields + Fatalf("Fields: type %v does not have fields", t) + return nil } // Field returns the i'th field/method of struct/interface type t. @@ -589,15 +830,14 @@ func (t *Type) isDDDArray() bool { if t.Etype != TARRAY { return false } - t.checkBound() - return t.Bound == dddBound + return t.Extra.(*ArrayType).Bound < 0 } // ArgWidth returns the total aligned argument size for a function. // It includes the receiver, parameters, and results. func (t *Type) ArgWidth() int64 { t.wantEtype(TFUNC) - return t.Argwid + return t.Extra.(*FuncType).Argwid } func (t *Type) Size() int64 { @@ -611,22 +851,15 @@ func (t *Type) Alignment() int64 { } func (t *Type) SimpleString() string { - return Econv(t.Etype) -} - -func (t *Type) Equal(u ssa.Type) bool { - x, ok := u.(*Type) - return ok && Eqtype(t, x) + return t.Etype.String() } // Compare compares types for purposes of the SSA back // end, returning an ssa.Cmp (one of CMPlt, CMPeq, CMPgt). // The answers are correct for an optimizer -// or code generator, but not for Go source. -// For example, "type gcDrainFlags int" results in -// two Go-different types that Compare equal. -// The order chosen is also arbitrary, only division into -// equivalence classes (Types that compare CMPeq) matters. +// or code generator, but not necessarily typechecking. +// The order chosen is arbitrary, only consistency and division +// into equivalence classes (Types that compare CMPeq) matters. func (t *Type) Compare(u ssa.Type) ssa.Cmp { x, ok := u.(*Type) // ssa.CompilerType is smaller than gc.Type @@ -740,25 +973,25 @@ func (t *Type) cmp(x *Type) ssa.Cmp { } return t.Val().cmp(x.Val()) - case TPTR32, TPTR64: - // No special cases for these two, they are handled + case TPTR32, TPTR64, TSLICE: + // No special cases for these, they are handled // by the general code after the switch. case TSTRUCT: - if t.Map == nil { - if x.Map != nil { + if t.StructType().Map == nil { + if x.StructType().Map != nil { return ssa.CMPlt // nil < non-nil } // to the fallthrough - } else if x.Map == nil { + } else if x.StructType().Map == nil { return ssa.CMPgt // nil > non-nil - } else if t.Map.Bucket == t { + } else if t.StructType().Map.MapType().Bucket == t { // Both have non-nil Map // Special case for Maps which include a recursive type where the recursion is not broken with a named type - if x.Map.Bucket != x { + if x.StructType().Map.MapType().Bucket != x { return ssa.CMPlt // bucket maps are least } - return t.Map.cmp(x.Map) + return t.StructType().Map.cmp(x.StructType().Map) } // If t != t.Map.Bucket, fall through to general case fallthrough @@ -770,15 +1003,7 @@ func (t *Type) cmp(x *Type) ssa.Cmp { return cmpForNe(t1.Embedded < x1.Embedded) } if t1.Note != x1.Note { - if t1.Note == nil { - return ssa.CMPlt - } - if x1.Note == nil { - return ssa.CMPgt - } - if *t1.Note != *x1.Note { - return cmpForNe(*t1.Note < *x1.Note) - } + return cmpForNe(t1.Note < x1.Note) } if c := t1.Sym.cmpsym(x1.Sym); c != ssa.CMPeq { return c @@ -826,7 +1051,7 @@ func (t *Type) cmp(x *Type) ssa.Cmp { panic(e) } - // Common element type comparison for TARRAY, TCHAN, TPTR32, and TPTR64. + // Common element type comparison for TARRAY, TCHAN, TPTR32, TPTR64, and TSLICE. return t.Elem().cmp(x.Elem()) } @@ -869,6 +1094,11 @@ func (t *Type) IsPtr() bool { return t.Etype == TPTR32 || t.Etype == TPTR64 } +// IsUnsafePtr reports whether t is an unsafe pointer. +func (t *Type) IsUnsafePtr() bool { + return t.Etype == TUNSAFEPTR +} + // IsPtrShaped reports whether t is represented by a single machine pointer. // In addition to regular Go pointer types, this includes map, channel, and // function types and unsafe.Pointer. It does not include array or struct types @@ -891,21 +1121,12 @@ func (t *Type) IsChan() bool { return t.Etype == TCHAN } -// checkBound enforces that Bound has an acceptable value. -func (t *Type) checkBound() { - if t.Bound != sliceBound && t.Bound < 0 && t.Bound != dddBound { - Fatalf("bad TARRAY bounds %d %s", t.Bound, t) - } -} - func (t *Type) IsSlice() bool { - t.checkBound() - return t.Etype == TARRAY && t.Bound == sliceBound + return t.Etype == TSLICE } func (t *Type) IsArray() bool { - t.checkBound() - return t.Etype == TARRAY && t.Bound >= 0 + return t.Etype == TARRAY } func (t *Type) IsStruct() bool { @@ -939,27 +1160,36 @@ func (t *Type) FieldType(i int) ssa.Type { func (t *Type) FieldOff(i int) int64 { return t.Field(i).Offset } +func (t *Type) FieldName(i int) string { + return t.Field(i).Sym.Name +} func (t *Type) NumElem() int64 { t.wantEtype(TARRAY) - t.checkBound() - return t.Bound + at := t.Extra.(*ArrayType) + if at.Bound < 0 { + Fatalf("NumElem array %v does not have bound yet", t) + } + return at.Bound } // SetNumElem sets the number of elements in an array type. -// It should not be used if at all possible. -// Create a new array/slice/dddArray with typX instead. -// TODO(josharian): figure out how to get rid of this. +// The only allowed use is on array types created with typDDDArray. +// For other uses, create a new array with typArray instead. func (t *Type) SetNumElem(n int64) { t.wantEtype(TARRAY) - t.Bound = n + at := t.Extra.(*ArrayType) + if at.Bound >= 0 { + Fatalf("SetNumElem array %v already has bound %d", t, at.Bound) + } + at.Bound = n } // ChanDir returns the direction of a channel type t. // The direction will be one of Crecv, Csend, or Cboth. func (t *Type) ChanDir() ChanDir { t.wantEtype(TCHAN) - return t.Chan + return t.Extra.(*ChanType).Dir } func (t *Type) IsMemory() bool { return false } diff --git a/src/cmd/compile/internal/gc/typecheck.go b/src/cmd/compile/internal/gc/typecheck.go index 688936e926..cf44ac8678 100644 --- a/src/cmd/compile/internal/gc/typecheck.go +++ b/src/cmd/compile/internal/gc/typecheck.go @@ -11,6 +11,16 @@ import ( "strings" ) +const ( + Etop = 1 << iota // evaluated at statement level + Erv // evaluated in value context + Etype // evaluated in type context + Ecall // call-only expressions are ok + Efnstruct // multivalue function returns are ok + Easgn // assigning to expression + Ecomplit // type in composite literal +) + // type check the whole tree of an expression. // calculates expression types. // evaluates compile time constants. @@ -66,6 +76,7 @@ var _typekind = []string{ TCHAN: "chan", TMAP: "map", TARRAY: "array", + TSLICE: "slice", TFUNC: "func", TNIL: "nil", TIDEAL: "untyped number", @@ -267,7 +278,7 @@ OpSwitch: default: Dump("typecheck", n) - Fatalf("typecheck %v", Oconv(n.Op, 0)) + Fatalf("typecheck %v", n.Op) // names case OLITERAL: @@ -324,7 +335,6 @@ OpSwitch: ok |= Etype if n.Type == nil { - n.Type = nil return n } @@ -403,6 +413,18 @@ OpSwitch: } n.Op = OTYPE n.Type = typMap(l.Type, r.Type) + + // map key validation + alg, bad := algtype1(l.Type) + if alg == ANOEQ { + if bad.Etype == TFORW { + // queue check for map until all the types are done settling. + mapqueue = append(mapqueue, mapqueueval{l, n.Lineno}) + } else if bad.Etype != TANY { + // no need to queue, key is already bad + Yyerror("invalid map key type %v", l.Type) + } + } n.Left = nil n.Right = nil @@ -435,7 +457,6 @@ OpSwitch: n.Op = OTYPE n.Type = tointerface(n.List.Slice()) if n.Type == nil { - n.Type = nil return n } @@ -444,7 +465,6 @@ OpSwitch: n.Op = OTYPE n.Type = functype(n.Left, n.List.Slice(), n.Rlist.Slice()) if n.Type == nil { - n.Type = nil return n } n.Left = nil @@ -453,13 +473,7 @@ OpSwitch: // type or expr case OIND: - ntop := Erv | Etype - - if top&Eaddr == 0 { // The *x in &*x is not an indirect. - ntop |= Eindir - } - ntop |= top & Ecomplit - n.Left = typecheck(n.Left, ntop) + n.Left = typecheck(n.Left, Erv|Etype|top&Ecomplit) l := n.Left t := l.Type if t == nil { @@ -533,8 +547,8 @@ OpSwitch: op = Op(n.Etype) } else { ok |= Erv - n.Left = typecheck(n.Left, Erv|top&Eiota) - n.Right = typecheck(n.Right, Erv|top&Eiota) + n.Left = typecheck(n.Left, Erv) + n.Right = typecheck(n.Right, Erv) l = n.Left r = n.Right if l.Type == nil || r.Type == nil { @@ -597,7 +611,7 @@ OpSwitch: aop = assignop(l.Type, r.Type, nil) if aop != 0 { if r.Type.IsInterface() && !l.Type.IsInterface() && !l.Type.IsComparable() { - Yyerror("invalid operation: %v (operator %v not defined on %s)", n, Oconv(op, 0), typekind(l.Type)) + Yyerror("invalid operation: %v (operator %v not defined on %s)", n, op, typekind(l.Type)) n.Type = nil return n } @@ -619,7 +633,7 @@ OpSwitch: aop = assignop(r.Type, l.Type, nil) if aop != 0 { if l.Type.IsInterface() && !r.Type.IsInterface() && !r.Type.IsComparable() { - Yyerror("invalid operation: %v (operator %v not defined on %s)", n, Oconv(op, 0), typekind(r.Type)) + Yyerror("invalid operation: %v (operator %v not defined on %s)", n, op, typekind(r.Type)) n.Type = nil return n } @@ -650,7 +664,7 @@ OpSwitch: } if !okfor[op][et] { - Yyerror("invalid operation: %v (operator %v not defined on %s)", n, Oconv(op, 0), typekind(t)) + Yyerror("invalid operation: %v (operator %v not defined on %s)", n, op, typekind(t)) n.Type = nil return n } @@ -752,7 +766,7 @@ OpSwitch: case OCOM, OMINUS, ONOT, OPLUS: ok |= Erv - n.Left = typecheck(n.Left, Erv|top&Eiota) + n.Left = typecheck(n.Left, Erv) l := n.Left t := l.Type if t == nil { @@ -760,7 +774,7 @@ OpSwitch: return n } if !okfor[n.Op][t.Etype] { - Yyerror("invalid operation: %v %v", Oconv(n.Op, 0), t) + Yyerror("invalid operation: %v %v", n.Op, t) n.Type = nil return n } @@ -772,7 +786,7 @@ OpSwitch: case OADDR: ok |= Erv - n.Left = typecheck(n.Left, Erv|Eaddr) + n.Left = typecheck(n.Left, Erv) if n.Left.Type == nil { n.Type = nil return n @@ -808,7 +822,6 @@ OpSwitch: ok |= Erv n = typecheckcomplit(n) if n.Type == nil { - n.Type = nil return n } break OpSwitch @@ -850,7 +863,6 @@ OpSwitch: if n.Type.Etype != TFUNC || n.Type.Recv() == nil { Yyerror("type %v has no method %v", n.Left.Type, Sconv(n.Right.Sym, FmtShort)) n.Type = nil - n.Type = nil return n } @@ -986,7 +998,7 @@ OpSwitch: n.Type = nil return n - case TSTRING, TARRAY: + case TSTRING, TARRAY, TSLICE: n.Right = indexlit(n.Right) if t.IsString() { n.Type = bytetype @@ -994,12 +1006,10 @@ OpSwitch: n.Type = t.Elem() } why := "string" - if t.Etype == TARRAY { - if t.IsArray() { - why = "array" - } else { - why = "slice" - } + if t.IsArray() { + why = "array" + } else if t.IsSlice() { + why = "slice" } if n.Right.Type != nil && !n.Right.Type.IsInteger() { @@ -1095,14 +1105,19 @@ OpSwitch: n.Type = nil break OpSwitch - case OSLICE: + case OSLICE, OSLICE3: ok |= Erv n.Left = typecheck(n.Left, top) - n.Right.Left = typecheck(n.Right.Left, Erv) - n.Right.Right = typecheck(n.Right.Right, Erv) + low, high, max := n.SliceBounds() + hasmax := n.Op.IsSlice3() + low = typecheck(low, Erv) + high = typecheck(high, Erv) + max = typecheck(max, Erv) n.Left = defaultlit(n.Left, nil) - n.Right.Left = indexlit(n.Right.Left) - n.Right.Right = indexlit(n.Right.Right) + low = indexlit(low) + high = indexlit(high) + max = indexlit(max) + n.SetSliceBounds(low, high, max) l := n.Left if l.Type.IsArray() { if !islvalue(n.Left) { @@ -1124,78 +1139,22 @@ OpSwitch: } var tp *Type if t.IsString() { + if hasmax { + Yyerror("invalid operation %v (3-index slice of string)", n) + n.Type = nil + return n + } n.Type = t n.Op = OSLICESTR } else if t.IsPtr() && t.Elem().IsArray() { tp = t.Elem() n.Type = typSlice(tp.Elem()) dowidth(n.Type) - n.Op = OSLICEARR - } else if t.IsSlice() { - n.Type = t - } else { - Yyerror("cannot slice %v (type %v)", l, t) - n.Type = nil - return n - } - - lo := n.Right.Left - if lo != nil && !checksliceindex(l, lo, tp) { - n.Type = nil - return n - } - hi := n.Right.Right - if hi != nil && !checksliceindex(l, hi, tp) { - n.Type = nil - return n - } - if !checksliceconst(lo, hi) { - n.Type = nil - return n - } - break OpSwitch - - case OSLICE3: - ok |= Erv - n.Left = typecheck(n.Left, top) - n.Right.Left = typecheck(n.Right.Left, Erv) - n.Right.Right.Left = typecheck(n.Right.Right.Left, Erv) - n.Right.Right.Right = typecheck(n.Right.Right.Right, Erv) - n.Left = defaultlit(n.Left, nil) - n.Right.Left = indexlit(n.Right.Left) - n.Right.Right.Left = indexlit(n.Right.Right.Left) - n.Right.Right.Right = indexlit(n.Right.Right.Right) - l := n.Left - if l.Type.IsArray() { - if !islvalue(n.Left) { - Yyerror("invalid operation %v (slice of unaddressable value)", n) - n.Type = nil - return n + if hasmax { + n.Op = OSLICE3ARR + } else { + n.Op = OSLICEARR } - - n.Left = Nod(OADDR, n.Left, nil) - n.Left.Implicit = true - n.Left = typecheck(n.Left, Erv) - l = n.Left - } - - t := l.Type - if t == nil { - n.Type = nil - return n - } - if t.IsString() { - Yyerror("invalid operation %v (3-index slice of string)", n) - n.Type = nil - return n - } - - var tp *Type - if t.IsPtr() && t.Elem().IsArray() { - tp = t.Elem() - n.Type = typSlice(tp.Elem()) - dowidth(n.Type) - n.Op = OSLICE3ARR } else if t.IsSlice() { n.Type = t } else { @@ -1204,22 +1163,19 @@ OpSwitch: return n } - lo := n.Right.Left - if lo != nil && !checksliceindex(l, lo, tp) { + if low != nil && !checksliceindex(l, low, tp) { n.Type = nil return n } - mid := n.Right.Right.Left - if mid != nil && !checksliceindex(l, mid, tp) { + if high != nil && !checksliceindex(l, high, tp) { n.Type = nil return n } - hi := n.Right.Right.Right - if hi != nil && !checksliceindex(l, hi, tp) { + if max != nil && !checksliceindex(l, max, tp) { n.Type = nil return n } - if !checksliceconst(lo, hi) || !checksliceconst(lo, mid) || !checksliceconst(mid, hi) { + if !checksliceconst(low, high) || !checksliceconst(low, max) || !checksliceconst(high, max) { n.Type = nil return n } @@ -1241,7 +1197,7 @@ OpSwitch: } } - n.Left = typecheck(n.Left, Erv|Etype|Ecall|top&Eproc) + n.Left = typecheck(n.Left, Erv|Etype|Ecall) n.Diag |= n.Left.Diag l = n.Left if l.Op == ONAME && l.Etype != 0 { @@ -1333,7 +1289,7 @@ OpSwitch: if t.Results().NumFields() == 1 { n.Type = l.Type.Results().Field(0).Type - if n.Op == OCALLFUNC && n.Left.Op == ONAME && (compiling_runtime != 0 || n.Left.Sym.Pkg == Runtimepkg) && n.Left.Sym.Name == "getg" { + if n.Op == OCALLFUNC && n.Left.Op == ONAME && (compiling_runtime || n.Left.Sym.Pkg == Runtimepkg) && n.Left.Sym.Name == "getg" { // Emit code for runtime.getg() directly instead of calling function. // Most such rewrites (for example the similar one for math.Sqrt) should be done in walk, // so that the ordering pass can make sure to preserve the semantics of the original code @@ -1358,7 +1314,7 @@ OpSwitch: case OCAP, OLEN, OREAL, OIMAG: ok |= Erv - if !onearg(n, "%v", Oconv(n.Op, 0)) { + if !onearg(n, "%v", n.Op) { n.Type = nil return n } @@ -1411,9 +1367,6 @@ OpSwitch: } case TARRAY: - if t.IsSlice() { - break - } if callrecv(l) { // has call or receive break } @@ -1427,7 +1380,7 @@ OpSwitch: break OpSwitch badcall1: - Yyerror("invalid argument %v for %v", Nconv(n.Left, FmtLong), Oconv(n.Op, 0)) + Yyerror("invalid argument %v for %v", Nconv(n.Left, FmtLong), n.Op) n.Type = nil return n @@ -1458,8 +1411,8 @@ OpSwitch: n.Type = nil return n } - n.Left = typecheck(n.Left, Erv|top&Eiota) - n.Right = typecheck(n.Right, Erv|top&Eiota) + n.Left = typecheck(n.Left, Erv) + n.Right = typecheck(n.Right, Erv) l = n.Left r = n.Right if l.Type == nil || r.Type == nil { @@ -1510,7 +1463,7 @@ OpSwitch: break OpSwitch case OCLOSE: - if !onearg(n, "%v", Oconv(n.Op, 0)) { + if !onearg(n, "%v", n.Op) { n.Type = nil return n } @@ -1593,7 +1546,7 @@ OpSwitch: // Unpack multiple-return result before type-checking. var funarg *Type - if t.IsStruct() && t.Funarg { + if t.IsFuncArgStruct() { funarg = t t = t.Field(0).Type } @@ -1717,7 +1670,7 @@ OpSwitch: case OCONV: ok |= Erv saveorignode(n) - n.Left = typecheck(n.Left, Erv|top&(Eindir|Eiota)) + n.Left = typecheck(n.Left, Erv) n.Left = convlit1(n.Left, n.Type, true, noReuse) t := n.Left.Type if t == nil || n.Type == nil { @@ -1784,13 +1737,7 @@ OpSwitch: n.Type = nil return n - case TARRAY: - if !t.IsSlice() { - Yyerror("cannot make type %v", t) - n.Type = nil - return n - } - + case TSLICE: if i >= len(args) { Yyerror("missing len argument to make(%v)", t) n.Type = nil @@ -1905,7 +1852,7 @@ OpSwitch: case OPRINT, OPRINTN: ok |= Etop - typecheckslice(n.List.Slice(), Erv|Eindir) // Eindir: address does not escape + typecheckslice(n.List.Slice(), Erv) ls := n.List.Slice() for i1, n1 := range ls { // Special case for print: int constant is int64, not int. @@ -1947,7 +1894,6 @@ OpSwitch: ok |= Erv typecheckclosure(n, top) if n.Type == nil { - n.Type = nil return n } break OpSwitch @@ -2042,7 +1988,7 @@ OpSwitch: case OPROC: ok |= Etop - n.Left = typecheck(n.Left, Etop|Eproc|Erv) + n.Left = typecheck(n.Left, Etop|Erv) checkdefergo(n) break OpSwitch @@ -2089,7 +2035,7 @@ OpSwitch: return n } - if Curfn.Type.Outnamed && n.List.Len() == 0 { + if Curfn.Type.FuncType().Outnamed && n.List.Len() == 0 { break OpSwitch } typecheckaste(ORETURN, nil, false, Curfn.Type.Results(), n.List, func() string { return "return argument" }) @@ -2145,14 +2091,10 @@ OpSwitch: } t := n.Type - if t != nil && !t.Funarg && n.Op != OTYPE { + if t != nil && !t.IsFuncArgStruct() && n.Op != OTYPE { switch t.Etype { - case TFUNC, // might have TANY; wait until its called - TANY, - TFORW, - TIDEAL, - TNIL, - TBLANK: + case TFUNC, // might have TANY; wait until it's called + TANY, TFORW, TIDEAL, TNIL, TBLANK: break default: @@ -2160,7 +2102,7 @@ OpSwitch: } } - if safemode != 0 && incannedimport == 0 && importpkg == nil && compiling_wrappers == 0 && t != nil && t.Etype == TUNSAFEPTR { + if safemode && incannedimport == 0 && importpkg == nil && compiling_wrappers == 0 && t != nil && t.Etype == TUNSAFEPTR { Yyerror("cannot use unsafe.Pointer") } @@ -2342,19 +2284,19 @@ func twoarg(n *Node) bool { return true } if n.List.Len() == 0 { - Yyerror("missing argument to %v - %v", Oconv(n.Op, 0), n) + Yyerror("missing argument to %v - %v", n.Op, n) return false } n.Left = n.List.First() if n.List.Len() == 1 { - Yyerror("missing argument to %v - %v", Oconv(n.Op, 0), n) + Yyerror("missing argument to %v - %v", n.Op, n) n.List.Set(nil) return false } if n.List.Len() > 2 { - Yyerror("too many arguments to %v - %v", Oconv(n.Op, 0), n) + Yyerror("too many arguments to %v - %v", n.Op, n) n.List.Set(nil) return false } @@ -2597,7 +2539,7 @@ func typecheckaste(op Op, call *Node, isddd bool, tstruct *Type, nl Nodes, desc if nl.Len() == 1 { n = nl.First() if n.Type != nil { - if n.Type.IsStruct() && n.Type.Funarg { + if n.Type.IsFuncArgStruct() { if !hasddd(tstruct) { n1 := tstruct.NumFields() n2 := n.Type.NumFields() @@ -2720,7 +2662,7 @@ func typecheckaste(op Op, call *Node, isddd bool, tstruct *Type, nl Nodes, desc if call != nil { Yyerror("invalid use of ... in call to %v", call) } else { - Yyerror("invalid use of ... in %v", Oconv(op, 0)) + Yyerror("invalid use of ... in %v", op) } } @@ -2740,7 +2682,7 @@ notenough: Yyerror("not enough arguments in call to %v", call) } } else { - Yyerror("not enough arguments to %v", Oconv(op, 0)) + Yyerror("not enough arguments to %v", op) } if n != nil { n.Diag = 1 @@ -2753,7 +2695,7 @@ toomany: if call != nil { Yyerror("too many arguments in call to %v", call) } else { - Yyerror("too many arguments to %v", Oconv(op, 0)) + Yyerror("too many arguments to %v", op) } goto out } @@ -2842,19 +2784,19 @@ func indexdup(n *Node, hash map[int64]*Node) { hash[v] = n } +// iscomptype reports whether type t is a composite literal type +// or a pointer to one. func iscomptype(t *Type) bool { + if t.IsPtr() { + t = t.Elem() + } + switch t.Etype { - case TARRAY, TSTRUCT, TMAP: + case TARRAY, TSLICE, TSTRUCT, TMAP: return true - - case TPTR32, TPTR64: - switch t.Elem().Etype { - case TARRAY, TSTRUCT, TMAP: - return true - } + default: + return false } - - return false } func pushtype(n *Node, t *Type) { @@ -2937,7 +2879,7 @@ func typecheckcomplit(n *Node) *Node { Yyerror("invalid type for composite literal: %v", t) n.Type = nil - case TARRAY: + case TARRAY, TSLICE: // Only allocate hash if there are some key/value pairs. var hash map[int64]*Node for _, n1 := range n.List.Slice() { @@ -2948,6 +2890,7 @@ func typecheckcomplit(n *Node) *Node { } length := int64(0) i := 0 + checkBounds := t.IsArray() && !t.isDDDArray() for i2, n2 := range n.List.Slice() { l := n2 setlineno(l) @@ -2973,11 +2916,10 @@ func typecheckcomplit(n *Node) *Node { i++ if int64(i) > length { length = int64(i) - if t.IsArray() && length > t.NumElem() { + if checkBounds && length > t.NumElem() { setlineno(l) Yyerror("array index %d out of bounds [0:%d]", length-1, t.NumElem()) - // suppress any further errors out of bounds errors for the same type by pretending it is a slice - t.SetNumElem(sliceBound) + checkBounds = false } } @@ -3083,7 +3025,12 @@ func typecheckcomplit(n *Node) *Node { } s := l.Left.Sym - if s == nil { + + // An OXDOT uses the Sym field to hold + // the field to the right of the dot, + // so s will be non-nil, but an OXDOT + // is never a valid struct literal key. + if s == nil || l.Left.Op == OXDOT { Yyerror("invalid field name %v in struct initializer", l.Left) l.Right = typecheck(l.Right, Erv) continue @@ -3152,8 +3099,6 @@ func islvalue(n *Node) bool { return false } fallthrough - - // fall through case OIND, ODOTPTR, OCLOSUREVAR, OPARAM: return true @@ -3345,7 +3290,7 @@ func typecheckas2(n *Node) { } switch r.Op { case OCALLMETH, OCALLINTER, OCALLFUNC: - if !r.Type.IsStruct() || !r.Type.Funarg { + if !r.Type.IsFuncArgStruct() { break } cr = r.Type.NumFields() @@ -3503,18 +3448,23 @@ func domethod(n *Node) { checkwidth(n.Type) } -var mapqueue []*Node +type mapqueueval struct { + n *Node + lno int32 +} + +// tracks the line numbers at which forward types are first used as map keys +var mapqueue []mapqueueval func copytype(n *Node, t *Type) { if t.Etype == TFORW { // This type isn't computed yet; when it is, update n. - t.Copyto = append(t.Copyto, n) + t.ForwardType().Copyto = append(t.ForwardType().Copyto, n) return } - maplineno := n.Type.Maplineno - embedlineno := n.Type.Embedlineno - l := n.Type.Copyto + embedlineno := n.Type.ForwardType().Embedlineno + l := n.Type.ForwardType().Copyto // TODO(mdempsky): Fix Type rekinding. *n.Type = *t @@ -3530,7 +3480,6 @@ func copytype(n *Node, t *Type) { t.Nod = nil t.Printed = false t.Deferwidth = false - t.Copyto = nil // Update nodes waiting on this type. for _, n := range l { @@ -3542,18 +3491,12 @@ func copytype(n *Node, t *Type) { if embedlineno != 0 { lineno = embedlineno - if t.IsPtr() { + if t.IsPtr() || t.IsUnsafePtr() { Yyerror("embedded type cannot be a pointer") } } lineno = lno - - // Queue check for map until all the types are done settling. - if maplineno != 0 { - t.Maplineno = maplineno - mapqueue = append(mapqueue, n) - } } func typecheckdeftype(n *Node) { @@ -3598,12 +3541,13 @@ ret: domethod(n) } } - - for _, n := range mapqueue { - lineno = n.Type.Maplineno - checkMapKeyType(n.Type) + for _, e := range mapqueue { + lineno = e.lno + if !e.n.Type.IsComparable() { + Yyerror("invalid map key type %v", e.n.Type) + } } - + mapqueue = nil lineno = lno } @@ -3662,7 +3606,7 @@ func typecheckdef(n *Node) *Node { switch n.Op { default: - Fatalf("typecheckdef %v", Oconv(n.Op, 0)) + Fatalf("typecheckdef %v", n.Op) // not really syms case OGOTO, OLABEL: @@ -3687,7 +3631,7 @@ func typecheckdef(n *Node) *Node { Yyerror("xxx") } - e = typecheck(e, Erv|Eiota) + e = typecheck(e, Erv) if Isconst(e, CTNIL) { Yyerror("const initializer cannot be nil") goto ret @@ -3858,11 +3802,8 @@ func markbreak(n *Node, implicit *Node) { ORANGE: implicit = n fallthrough - - // fall through default: markbreak(n.Left, implicit) - markbreak(n.Right, implicit) markbreaklist(n.Ninit, implicit) markbreaklist(n.Nbody, implicit) @@ -3958,7 +3899,7 @@ func (n *Node) isterminating() bool { } func checkreturn(fn *Node) { - if fn.Type.Results().NumFields() != 0 && len(fn.Nbody.Slice()) != 0 { + if fn.Type.Results().NumFields() != 0 && fn.Nbody.Len() != 0 { markbreaklist(fn.Nbody, nil) if !fn.Nbody.isterminating() { yyerrorl(fn.Func.Endlineno, "missing return at end of function") diff --git a/src/cmd/compile/internal/gc/universe.go b/src/cmd/compile/internal/gc/universe.go index c2ba9c9a93..84df22502f 100644 --- a/src/cmd/compile/internal/gc/universe.go +++ b/src/cmd/compile/internal/gc/universe.go @@ -228,6 +228,7 @@ func typeinit() { okforcap[TARRAY] = true okforcap[TCHAN] = true + okforcap[TSLICE] = true okforconst[TBOOL] = true okforconst[TSTRING] = true @@ -235,6 +236,7 @@ func typeinit() { okforlen[TARRAY] = true okforlen[TCHAN] = true okforlen[TMAP] = true + okforlen[TSLICE] = true okforlen[TSTRING] = true okforeq[TPTR32] = true @@ -246,8 +248,9 @@ func typeinit() { okforeq[TBOOL] = true okforeq[TMAP] = true // nil only; refined in typecheck okforeq[TFUNC] = true // nil only; refined in typecheck - okforeq[TARRAY] = true // nil slice only; refined in typecheck - okforeq[TSTRUCT] = true // it's complicated; refined in typecheck + okforeq[TSLICE] = true // nil only; refined in typecheck + okforeq[TARRAY] = true // only if element type is comparable; refined in typecheck + okforeq[TSTRUCT] = true // only if all struct fields are comparable; refined in typecheck okforcmp[TSTRING] = true @@ -359,16 +362,16 @@ func lexinit1() { // t = interface { Error() string } rcvr := typ(TSTRUCT) - rcvr.Funarg = true + rcvr.StructType().Funarg = true field := newField() field.Type = Ptrto(typ(TSTRUCT)) rcvr.SetFields([]*Field{field}) in := typ(TSTRUCT) - in.Funarg = true + in.StructType().Funarg = true out := typ(TSTRUCT) - out.Funarg = true + out.StructType().Funarg = true field = newField() field.Type = Types[TSTRING] out.SetFields([]*Field{field}) diff --git a/src/cmd/compile/internal/gc/unsafe.go b/src/cmd/compile/internal/gc/unsafe.go index 338f3c0eae..5935cd98ff 100644 --- a/src/cmd/compile/internal/gc/unsafe.go +++ b/src/cmd/compile/internal/gc/unsafe.go @@ -9,7 +9,7 @@ func unsafenmagic(nn *Node) *Node { fn := nn.Left args := nn.List - if safemode != 0 || fn == nil || fn.Op != ONAME { + if safemode || fn == nil || fn.Op != ONAME { return nil } s := fn.Sym @@ -82,7 +82,7 @@ func unsafenmagic(nn *Node) *Node { v += r1.Xoffset default: Dump("unsafenmagic", r) - Fatalf("impossible %v node after dot insertion", Oconv(r1.Op, FmtSharp)) + Fatalf("impossible %v node after dot insertion", oconv(r1.Op, FmtSharp)) goto bad } } diff --git a/src/cmd/compile/internal/gc/walk.go b/src/cmd/compile/internal/gc/walk.go index b7edae5af4..6ec06453ef 100644 --- a/src/cmd/compile/internal/gc/walk.go +++ b/src/cmd/compile/internal/gc/walk.go @@ -6,6 +6,7 @@ package gc import ( "cmd/internal/obj" + "cmd/internal/sys" "fmt" "strings" ) @@ -69,7 +70,7 @@ func walk(fn *Node) { } heapmoves() - if Debug['W'] != 0 && len(Curfn.Func.Enter.Slice()) > 0 { + if Debug['W'] != 0 && Curfn.Func.Enter.Len() > 0 { s := fmt.Sprintf("enter %v", Curfn.Func.Nname.Sym) dumplist(s, Curfn.Func.Enter) } @@ -158,7 +159,7 @@ func walkstmt(n *Node) *Node { if n.Op == ONAME { Yyerror("%v is not a top level statement", n.Sym) } else { - Yyerror("%v is not a top level statement", Oconv(n.Op, 0)) + Yyerror("%v is not a top level statement", n.Op) } Dump("nottop", n) @@ -287,7 +288,7 @@ func walkstmt(n *Node) *Node { if n.List.Len() == 0 { break } - if (Curfn.Type.Outnamed && n.List.Len() > 1) || paramoutheap(Curfn) { + if (Curfn.Type.FuncType().Outnamed && n.List.Len() > 1) || paramoutheap(Curfn) { // assign to the function out parameters, // so that reorder3 can fix up conflicts var rl []*Node @@ -593,8 +594,7 @@ opswitch: // for a struct containing a reflect.Value, which itself has // an unexported field of type unsafe.Pointer. old_safemode := safemode - - safemode = 0 + safemode = false n = walkcompare(n, init) safemode = old_safemode @@ -672,8 +672,7 @@ opswitch: walkexprlist(n.List.Slice(), init) if n.Left.Op == ONAME && n.Left.Sym.Name == "Sqrt" && n.Left.Sym.Pkg.Path == "math" { - switch Thearch.Thechar { - case '5', '6', '7', '9': + if Thearch.LinkArch.InFamily(sys.AMD64, sys.ARM, sys.ARM64, sys.PPC64, sys.S390X) { n.Op = OSQRT n.Left = n.List.First() n.List.Set(nil) @@ -865,8 +864,14 @@ opswitch: // a = *var a := n.List.First() - fn := mapfn(p, t) - r = mkcall1(fn, fn.Type.Results(), init, typename(t), r.Left, key) + if w := t.Val().Width; w <= 1024 { // 1024 must match ../../../../runtime/hashmap.go:maxZero + fn := mapfn(p, t) + r = mkcall1(fn, fn.Type.Results(), init, typename(t), r.Left, key) + } else { + fn := mapfn("mapaccess2_fat", t) + z := zeroaddr(w) + r = mkcall1(fn, fn.Type.Results(), init, typename(t), r.Left, key, z) + } // mapaccess2* returns a typed bool, but due to spec changes, // the boolean result of i.(T) is now untyped so we make it the @@ -881,6 +886,7 @@ opswitch: if !isblank(a) { var_ := temp(Ptrto(t.Val())) var_.Typecheck = 1 + var_.NonNil = true // mapaccess always returns a non-nil pointer n.List.SetIndex(0, var_) n = walkexpr(n, init) init.Append(n) @@ -890,8 +896,6 @@ opswitch: n = typecheck(n, Etop) n = walkexpr(n, init) - // TODO: ptr is always non-nil, so disable nil check for this OIND op. - case ODELETE: init.AppendNodes(&n.Ninit) map_ := n.List.First() @@ -1056,7 +1060,7 @@ opswitch: n = walkexpr(n, init) case OCONV, OCONVNOP: - if Thearch.Thechar == '5' { + if Thearch.LinkArch.Family == sys.ARM { if n.Left.Type.IsFloat() { if n.Type.Etype == TINT64 { n = mkcall("float64toint64", n.Type, init, conv(n.Left, Types[TFLOAT64])) @@ -1219,11 +1223,17 @@ opswitch: // standard version takes key by reference. // orderexpr made sure key is addressable. key = Nod(OADDR, n.Right, nil) - p = "mapaccess1" } - n = mkcall1(mapfn(p, t), Ptrto(t.Val()), init, typename(t), n.Left, key) + if w := t.Val().Width; w <= 1024 { // 1024 must match ../../../../runtime/hashmap.go:maxZero + n = mkcall1(mapfn(p, t), Ptrto(t.Val()), init, typename(t), n.Left, key) + } else { + p = "mapaccess1_fat" + z := zeroaddr(w) + n = mkcall1(mapfn(p, t), Ptrto(t.Val()), init, typename(t), n.Left, key, z) + } + n.NonNil = true // mapaccess always returns a non-nil pointer n = Nod(OIND, n, nil) n.Type = t.Val() n.Typecheck = 1 @@ -1231,35 +1241,28 @@ opswitch: case ORECV: Fatalf("walkexpr ORECV") // should see inside OAS only - case OSLICE, OSLICEARR, OSLICESTR: - n.Left = walkexpr(n.Left, init) - n.Right.Left = walkexpr(n.Right.Left, init) - if n.Right.Left != nil && iszero(n.Right.Left) { - // Reduce x[0:j] to x[:j]. - n.Right.Left = nil - } - n.Right.Right = walkexpr(n.Right.Right, init) - n = reduceSlice(n) - - case OSLICE3, OSLICE3ARR: + case OSLICE, OSLICEARR, OSLICESTR, OSLICE3, OSLICE3ARR: n.Left = walkexpr(n.Left, init) - n.Right.Left = walkexpr(n.Right.Left, init) - if n.Right.Left != nil && iszero(n.Right.Left) { - // Reduce x[0:j:k] to x[:j:k]. - n.Right.Left = nil + low, high, max := n.SliceBounds() + low = walkexpr(low, init) + if low != nil && iszero(low) { + // Reduce x[0:j] to x[:j] and x[0:j:k] to x[:j:k]. + low = nil } - n.Right.Right.Left = walkexpr(n.Right.Right.Left, init) - n.Right.Right.Right = walkexpr(n.Right.Right.Right, init) - - r := n.Right.Right.Right - if r != nil && r.Op == OCAP && samesafeexpr(n.Left, r.Left) { - // Reduce x[i:j:cap(x)] to x[i:j]. - n.Right.Right = n.Right.Right.Left - if n.Op == OSLICE3 { - n.Op = OSLICE - } else { - n.Op = OSLICEARR + high = walkexpr(high, init) + max = walkexpr(max, init) + n.SetSliceBounds(low, high, max) + if n.Op.IsSlice3() { + if max != nil && max.Op == OCAP && samesafeexpr(n.Left, max.Left) { + // Reduce x[i:j:cap(x)] to x[i:j]. + if n.Op == OSLICE3 { + n.Op = OSLICE + } else { + n.Op = OSLICEARR + } + n = reduceSlice(n) } + } else { n = reduceSlice(n) } @@ -1415,17 +1418,18 @@ opswitch: a := Nod(OAS, var_, nil) // zero temp a = typecheck(a, Etop) init.Append(a) - r := Nod(OSLICE, var_, Nod(OKEY, nil, l)) // arr[:l] - r = conv(r, n.Type) // in case n.Type is named. + r := Nod(OSLICE, var_, nil) // arr[:l] + r.SetSliceBounds(nil, l, nil) + r = conv(r, n.Type) // in case n.Type is named. r = typecheck(r, Erv) r = walkexpr(r, init) n = r } else { - // makeslice(t *Type, nel int64, max int64) (ary []any) + // makeslice(et *Type, nel int64, max int64) (ary []any) fn := syslook("makeslice") fn = substArgTypes(fn, t.Elem()) // any-1 - n = mkcall1(fn, n.Type, init, typename(n.Type), conv(l, Types[TINT64]), conv(r, Types[TINT64])) + n = mkcall1(fn, n.Type, init, typename(t.Elem()), conv(l, Types[TINT64]), conv(r, Types[TINT64])) } case ORUNESTR: @@ -1501,7 +1505,7 @@ opswitch: // ifaceeq(i1 any-1, i2 any-2) (ret bool); case OCMPIFACE: if !Eqtype(n.Left.Type, n.Right.Type) { - Fatalf("ifaceeq %v %v %v", Oconv(n.Op, 0), n.Left.Type, n.Right.Type) + Fatalf("ifaceeq %v %v %v", n.Op, n.Left.Type, n.Right.Type) } var fn *Node if n.Left.Type.IsEmptyInterface() { @@ -1532,6 +1536,19 @@ opswitch: n = r case OARRAYLIT, OMAPLIT, OSTRUCTLIT, OPTRLIT: + if isStaticCompositeLiteral(n) { + // n can be directly represented in the read-only data section. + // Make direct reference to the static data. See issue 12841. + vstat := staticname(n.Type, 0) + if n.Op == OSTRUCTLIT { + structlit(0, 1, n, vstat, init) + } else { + arraylit(0, 1, n, vstat, init) + } + n = vstat + n = typecheck(n, Erv) + break + } var_ := temp(n.Type) anylit(0, n, var_, init) n = var_ @@ -1573,13 +1590,15 @@ opswitch: return n } +// TODO(josharian): combine this with its caller and simplify func reduceSlice(n *Node) *Node { - r := n.Right.Right - if r != nil && r.Op == OLEN && samesafeexpr(n.Left, r.Left) { + low, high, max := n.SliceBounds() + if high != nil && high.Op == OLEN && samesafeexpr(n.Left, high.Left) { // Reduce x[i:len(x)] to x[i:]. - n.Right.Right = nil + high = nil } - if (n.Op == OSLICE || n.Op == OSLICESTR) && n.Right.Left == nil && n.Right.Right == nil { + n.SetSliceBounds(low, high, max) + if (n.Op == OSLICE || n.Op == OSLICESTR) && low == nil && high == nil { // Reduce x[:] to x. if Debug_slice > 0 { Warn("slice: omit slice operation") @@ -1632,7 +1651,7 @@ func ascompatee(op Op, nl, nr []*Node, init *Nodes) []*Node { var nln, nrn Nodes nln.Set(nl) nrn.Set(nr) - Yyerror("error in shape across %v %v %v / %d %d [%s]", Hconv(nln, FmtSign), Oconv(op, 0), Hconv(nrn, FmtSign), len(nl), len(nr), Curfn.Func.Nname.Sym.Name) + Yyerror("error in shape across %v %v %v / %d %d [%s]", Hconv(nln, FmtSign), op, Hconv(nrn, FmtSign), len(nl), len(nr), Curfn.Func.Nname.Sym.Name) } return nn } @@ -1716,6 +1735,7 @@ func mkdotargslice(lr0, nn []*Node, l *Field, fp int, init *Nodes, ddd *Node) [] } tslice := typSlice(l.Type.Elem()) + tslice.Noalg = true var n *Node if len(lr0) == 0 { @@ -1783,7 +1803,7 @@ func ascompatte(op Op, call *Node, isddd bool, nl *Type, lr []*Node, fp int, ini var nn []*Node // f(g()) where g has multiple return values - if r != nil && len(lr) <= 1 && r.Type.IsStruct() && r.Type.Funarg { + if r != nil && len(lr) <= 1 && r.Type.IsFuncArgStruct() { // optimization - can do block copy if eqtypenoname(r.Type, nl) { arg := nodarg(nl, fp) @@ -1846,9 +1866,9 @@ func ascompatte(op Op, call *Node, isddd bool, nl *Type, lr []*Node, fp int, ini l1 := dumptypes(nl, "expected") l2 := dumpnodetypes(lr0, "given") if l != nil { - Yyerror("not enough arguments to %v\n\t%s\n\t%s", Oconv(op, 0), l1, l2) + Yyerror("not enough arguments to %v\n\t%s\n\t%s", op, l1, l2) } else { - Yyerror("too many arguments to %v\n\t%s\n\t%s", Oconv(op, 0), l1, l2) + Yyerror("too many arguments to %v\n\t%s\n\t%s", op, l1, l2) } } @@ -1938,7 +1958,7 @@ func walkprint(nn *Node, init *Nodes) *Node { on = substArgTypes(on, n.Type) // any-1 } else if Isint[et] { if et == TUINT64 { - if (t.Sym.Pkg == Runtimepkg || compiling_runtime != 0) && t.Sym.Name == "hex" { + if (t.Sym.Pkg == Runtimepkg || compiling_runtime) && t.Sym.Name == "hex" { on = syslook("printhex") } else { on = syslook("printuint") @@ -1991,7 +2011,9 @@ func callnew(t *Type) *Node { dowidth(t) fn := syslook("newobject") fn = substArgTypes(fn, t) - return mkcall1(fn, Ptrto(t), nil, typename(t)) + v := mkcall1(fn, Ptrto(t), nil, typename(t)) + v.NonNil = true + return v } func iscallret(n *Node) bool { @@ -2041,7 +2063,7 @@ func isglobal(n *Node) bool { // Do we need a write barrier for the assignment l = r? func needwritebarrier(l *Node, r *Node) bool { - if use_writebarrier == 0 { + if !use_writebarrier { return false } @@ -2120,7 +2142,7 @@ func applywritebarrier(n *Node) *Node { func convas(n *Node, init *Nodes) *Node { if n.Op != OAS { - Fatalf("convas: not OAS %v", Oconv(n.Op, 0)) + Fatalf("convas: not OAS %v", n.Op) } n.Typecheck = 1 @@ -2263,7 +2285,7 @@ func reorder3(all []*Node) []*Node { switch l.Op { default: - Fatalf("reorder3 unexpected lvalue %v", Oconv(l.Op, FmtSharp)) + Fatalf("reorder3 unexpected lvalue %v", oconv(l.Op, FmtSharp)) case ONAME: break @@ -2550,7 +2572,7 @@ func paramstoheap(params *Type, out bool) []*Node { } // generate allocation & copying code - if compiling_runtime != 0 { + if compiling_runtime { Yyerror("%v escapes to heap, not allowed in runtime.", v) } if prealloc[v] == nil { @@ -2723,8 +2745,7 @@ func addstr(n *Node, init *Nodes) *Node { prealloc[slice] = prealloc[n] } slice.List.Set(args[1:]) // skip buf arg - args = []*Node{buf} - args = append(args, slice) + args = []*Node{buf, slice} slice.Esc = EscNone } @@ -2787,18 +2808,19 @@ func appendslice(n *Node, init *Nodes) *Node { fn = substArgTypes(fn, s.Type.Elem(), s.Type.Elem()) // s = growslice(T, s, n) - nif.Nbody.Set1(Nod(OAS, s, mkcall1(fn, s.Type, &nif.Ninit, typename(s.Type), s, nn))) + nif.Nbody.Set1(Nod(OAS, s, mkcall1(fn, s.Type, &nif.Ninit, typename(s.Type.Elem()), s, nn))) l = append(l, nif) // s = s[:n] - nt := Nod(OSLICE, s, Nod(OKEY, nil, nn)) + nt := Nod(OSLICE, s, nil) + nt.SetSliceBounds(nil, nn, nil) nt.Etype = 1 l = append(l, Nod(OAS, s, nt)) if haspointers(l1.Type.Elem()) { // copy(s[len(l1):], l2) - nptr1 := Nod(OSLICE, s, Nod(OKEY, Nod(OLEN, l1, nil), nil)) - + nptr1 := Nod(OSLICE, s, nil) + nptr1.SetSliceBounds(Nod(OLEN, l1, nil), nil, nil) nptr1.Etype = 1 nptr2 := l2 fn := syslook("typedslicecopy") @@ -2810,8 +2832,8 @@ func appendslice(n *Node, init *Nodes) *Node { } else if instrumenting { // rely on runtime to instrument copy. // copy(s[len(l1):], l2) - nptr1 := Nod(OSLICE, s, Nod(OKEY, Nod(OLEN, l1, nil), nil)) - + nptr1 := Nod(OSLICE, s, nil) + nptr1.SetSliceBounds(Nod(OLEN, l1, nil), nil, nil) nptr1.Etype = 1 nptr2 := l2 var fn *Node @@ -2917,7 +2939,7 @@ func walkappend(n *Node, init *Nodes, dst *Node) *Node { fn = substArgTypes(fn, ns.Type.Elem(), ns.Type.Elem()) nx.Nbody.Set1(Nod(OAS, ns, - mkcall1(fn, ns.Type, &nx.Ninit, typename(ns.Type), ns, + mkcall1(fn, ns.Type, &nx.Ninit, typename(ns.Type.Elem()), ns, Nod(OADD, Nod(OLEN, ns, nil), na)))) l = append(l, nx) @@ -2925,7 +2947,8 @@ func walkappend(n *Node, init *Nodes, dst *Node) *Node { nn := temp(Types[TINT]) l = append(l, Nod(OAS, nn, Nod(OLEN, ns, nil))) // n = len(s) - nx = Nod(OSLICE, ns, Nod(OKEY, nil, Nod(OADD, nn, na))) // ...s[:n+argc] + nx = Nod(OSLICE, ns, nil) // ...s[:n+argc] + nx.SetSliceBounds(nil, Nod(OADD, nn, na), nil) nx.Etype = 1 l = append(l, Nod(OAS, ns, nx)) // s = s[:n+argc] @@ -3101,12 +3124,7 @@ func walkcompare(n *Node, init *Nodes) *Node { default: return n - case TARRAY: - if t.IsSlice() { - return n - } - - case TSTRUCT: + case TARRAY, TSTRUCT: break } @@ -3274,7 +3292,7 @@ func samecheap(a *Node, b *Node) bool { // The result of walkrotate MUST be assigned back to n, e.g. // n.Left = walkrotate(n.Left) func walkrotate(n *Node) *Node { - if Thearch.Thechar == '0' || Thearch.Thechar == '7' || Thearch.Thechar == '9' { + if Thearch.LinkArch.InFamily(sys.MIPS64, sys.ARM64, sys.PPC64) { return n } @@ -3294,6 +3312,11 @@ func walkrotate(n *Node) *Node { // Constants adding to width? w := int(l.Type.Width * 8) + if Thearch.LinkArch.Family == sys.S390X && w != 32 && w != 64 { + // only supports 32-bit and 64-bit rotates + return n + } + if Smallintconst(l.Right) && Smallintconst(r.Right) { sl := int(l.Right.Int64()) if sl >= 0 { @@ -3401,7 +3424,7 @@ func walkdiv(n *Node, init *Nodes) *Node { // if >= 0, nr is 1<<pow // 1 if nr is negative. // TODO(minux) - if Thearch.Thechar == '0' || Thearch.Thechar == '7' || Thearch.Thechar == '9' { + if Thearch.LinkArch.InFamily(sys.MIPS64, sys.PPC64) { return n } @@ -3462,6 +3485,16 @@ func walkdiv(n *Node, init *Nodes) *Node { goto ret } + // TODO(zhongwei) Test shows that TUINT8, TINT8, TUINT16 and TINT16's "quick division" method + // on current arm64 backend is slower than hardware div instruction on ARM64 due to unnecessary + // data movement between registers. It could be enabled when generated code is good enough. + if Thearch.LinkArch.Family == sys.ARM64 { + switch Simtype[nl.Type.Etype] { + case TUINT8, TINT8, TUINT16, TINT16: + return n + } + } + switch Simtype[nl.Type.Etype] { default: return n @@ -3765,7 +3798,7 @@ func usefield(n *Node) { switch n.Op { default: - Fatalf("usefield %v", Oconv(n.Op, 0)) + Fatalf("usefield %v", n.Op) case ODOT, ODOTPTR: break @@ -3784,7 +3817,7 @@ func usefield(n *Node) { if field == nil { Fatalf("usefield %v %v without paramfld", n.Left.Type, n.Sym) } - if field.Note == nil || !strings.Contains(*field.Note, "go:\"track\"") { + if !strings.Contains(field.Note, "go:\"track\"") { return } diff --git a/src/cmd/compile/internal/mips64/galign.go b/src/cmd/compile/internal/mips64/galign.go index 9d582f4b51..22890c891b 100644 --- a/src/cmd/compile/internal/mips64/galign.go +++ b/src/cmd/compile/internal/mips64/galign.go @@ -11,18 +11,12 @@ import ( ) func betypeinit() { - gc.Widthptr = 8 - gc.Widthint = 8 - gc.Widthreg = 8 } func Main() { - gc.Thearch.Thechar = '0' - gc.Thearch.Thestring = "mips64" - gc.Thearch.Thelinkarch = &mips.Linkmips64 + gc.Thearch.LinkArch = &mips.Linkmips64 if obj.Getgoarch() == "mips64le" { - gc.Thearch.Thestring = "mips64le" - gc.Thearch.Thelinkarch = &mips.Linkmips64le + gc.Thearch.LinkArch = &mips.Linkmips64le } gc.Thearch.REGSP = mips.REGSP gc.Thearch.REGCTXT = mips.REGCTXT diff --git a/src/cmd/compile/internal/mips64/gsubr.go b/src/cmd/compile/internal/mips64/gsubr.go index 60805270af..a2bff29ecc 100644 --- a/src/cmd/compile/internal/mips64/gsubr.go +++ b/src/cmd/compile/internal/mips64/gsubr.go @@ -148,7 +148,7 @@ func ginscmp(op gc.Op, t *gc.Type, n1, n2 *gc.Node, likely int) *obj.Prog { case gc.TFLOAT32: switch op { default: - gc.Fatalf("ginscmp: no entry for op=%v type=%v", gc.Oconv(op, 0), t) + gc.Fatalf("ginscmp: no entry for op=%s type=%v", op, t) case gc.OEQ, gc.ONE: @@ -165,7 +165,7 @@ func ginscmp(op gc.Op, t *gc.Type, n1, n2 *gc.Node, likely int) *obj.Prog { case gc.TFLOAT64: switch op { default: - gc.Fatalf("ginscmp: no entry for op=%v type=%v", gc.Oconv(op, 0), t) + gc.Fatalf("ginscmp: no entry for op=%s type=%v", op, t) case gc.OEQ, gc.ONE: @@ -715,7 +715,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry for op=%v type=%v", gc.Oconv(op, 0), t) + gc.Fatalf("optoas: no entry for op=%s type=%v", op, t) case OEQ_ | gc.TBOOL, OEQ_ | gc.TINT8, diff --git a/src/cmd/compile/internal/ppc64/galign.go b/src/cmd/compile/internal/ppc64/galign.go index 91bece6080..a83dff9a8b 100644 --- a/src/cmd/compile/internal/ppc64/galign.go +++ b/src/cmd/compile/internal/ppc64/galign.go @@ -11,23 +11,16 @@ import ( ) func betypeinit() { - gc.Widthptr = 8 - gc.Widthint = 8 - gc.Widthreg = 8 - - if gc.Ctxt.Flag_shared != 0 { + if gc.Ctxt.Flag_shared { gc.Thearch.ReservedRegs = append(gc.Thearch.ReservedRegs, ppc64.REG_R2) gc.Thearch.ReservedRegs = append(gc.Thearch.ReservedRegs, ppc64.REG_R12) } } func Main() { - gc.Thearch.Thechar = '9' - gc.Thearch.Thestring = "ppc64" - gc.Thearch.Thelinkarch = &ppc64.Linkppc64 + gc.Thearch.LinkArch = &ppc64.Linkppc64 if obj.Getgoarch() == "ppc64le" { - gc.Thearch.Thestring = "ppc64le" - gc.Thearch.Thelinkarch = &ppc64.Linkppc64le + gc.Thearch.LinkArch = &ppc64.Linkppc64le } gc.Thearch.REGSP = ppc64.REGSP gc.Thearch.REGCTXT = ppc64.REGCTXT diff --git a/src/cmd/compile/internal/ppc64/gsubr.go b/src/cmd/compile/internal/ppc64/gsubr.go index de6e2fbe05..1137c50678 100644 --- a/src/cmd/compile/internal/ppc64/gsubr.go +++ b/src/cmd/compile/internal/ppc64/gsubr.go @@ -580,7 +580,7 @@ func rawgins(as obj.As, f *gc.Node, t *gc.Node) *obj.Prog { case obj.ACALL: if p.To.Type == obj.TYPE_REG && p.To.Reg != ppc64.REG_CTR { // Allow front end to emit CALL REG, and rewrite into MOV REG, CTR; CALL CTR. - if gc.Ctxt.Flag_shared != 0 { + if gc.Ctxt.Flag_shared { // Make sure function pointer is in R12 as well when // compiling Go into PIC. // TODO(mwhudson): it would obviously be better to @@ -602,7 +602,7 @@ func rawgins(as obj.As, f *gc.Node, t *gc.Node) *obj.Prog { p.To.Type = obj.TYPE_REG p.To.Reg = ppc64.REG_CTR - if gc.Ctxt.Flag_shared != 0 { + if gc.Ctxt.Flag_shared { // When compiling Go into PIC, the function we just // called via pointer might have been implemented in // a separate module and so overwritten the TOC @@ -712,7 +712,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry for op=%v type=%v", gc.Oconv(op, 0), t) + gc.Fatalf("optoas: no entry for op=%v type=%v", op, t) case OEQ_ | gc.TBOOL, OEQ_ | gc.TINT8, diff --git a/src/cmd/compile/internal/ppc64/reg.go b/src/cmd/compile/internal/ppc64/reg.go index 447679e207..558ba4a4f4 100644 --- a/src/cmd/compile/internal/ppc64/reg.go +++ b/src/cmd/compile/internal/ppc64/reg.go @@ -113,7 +113,7 @@ func excludedregs() uint64 { // Exclude registers with fixed functions regbits := 1<<0 | RtoB(ppc64.REGSP) | RtoB(ppc64.REGG) | RtoB(ppc64.REGTLS) | RtoB(ppc64.REGTMP) - if gc.Ctxt.Flag_shared != 0 { + if gc.Ctxt.Flag_shared { // When compiling Go into PIC, R2 is reserved to be the TOC pointer // and R12 so that calls via function pointer can stomp on it. regbits |= RtoB(ppc64.REG_R2) diff --git a/src/cmd/compile/internal/s390x/cgen.go b/src/cmd/compile/internal/s390x/cgen.go new file mode 100644 index 0000000000..28bb34e0ef --- /dev/null +++ b/src/cmd/compile/internal/s390x/cgen.go @@ -0,0 +1,178 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj" + "cmd/internal/obj/s390x" +) + +type direction int + +const ( + _FORWARDS direction = iota + _BACKWARDS +) + +// blockcopy copies w bytes from &n to &res +func blockcopy(n, res *gc.Node, osrc, odst, w int64) { + var dst gc.Node + var src gc.Node + if n.Ullman >= res.Ullman { + gc.Agenr(n, &dst, res) // temporarily use dst + gc.Regalloc(&src, gc.Types[gc.Tptr], nil) + gins(s390x.AMOVD, &dst, &src) + if res.Op == gc.ONAME { + gc.Gvardef(res) + } + gc.Agen(res, &dst) + } else { + if res.Op == gc.ONAME { + gc.Gvardef(res) + } + gc.Agenr(res, &dst, res) + gc.Agenr(n, &src, nil) + } + defer gc.Regfree(&src) + defer gc.Regfree(&dst) + + var tmp gc.Node + gc.Regalloc(&tmp, gc.Types[gc.Tptr], nil) + defer gc.Regfree(&tmp) + + offset := int64(0) + dir := _FORWARDS + if osrc < odst && odst < osrc+w { + // Reverse. Can't use MVC, fall back onto basic moves. + dir = _BACKWARDS + const copiesPerIter = 2 + if w >= 8*copiesPerIter { + cnt := w - (w % (8 * copiesPerIter)) + ginscon(s390x.AADD, w, &src) + ginscon(s390x.AADD, w, &dst) + + var end gc.Node + gc.Regalloc(&end, gc.Types[gc.Tptr], nil) + p := gins(s390x.ASUB, nil, &end) + p.From.Type = obj.TYPE_CONST + p.From.Offset = cnt + p.Reg = src.Reg + + var label *obj.Prog + for i := 0; i < copiesPerIter; i++ { + offset := int64(-8 * (i + 1)) + p := gins(s390x.AMOVD, &src, &tmp) + p.From.Type = obj.TYPE_MEM + p.From.Offset = offset + if i == 0 { + label = p + } + p = gins(s390x.AMOVD, &tmp, &dst) + p.To.Type = obj.TYPE_MEM + p.To.Offset = offset + } + + ginscon(s390x.ASUB, 8*copiesPerIter, &src) + ginscon(s390x.ASUB, 8*copiesPerIter, &dst) + gins(s390x.ACMP, &src, &end) + gc.Patch(gc.Gbranch(s390x.ABNE, nil, 0), label) + gc.Regfree(&end) + + w -= cnt + } else { + offset = w + } + } + + if dir == _FORWARDS && w > 1024 { + // Loop over MVCs + cnt := w - (w % 256) + + var end gc.Node + gc.Regalloc(&end, gc.Types[gc.Tptr], nil) + add := gins(s390x.AADD, nil, &end) + add.From.Type = obj.TYPE_CONST + add.From.Offset = cnt + add.Reg = src.Reg + + mvc := gins(s390x.AMVC, &src, &dst) + mvc.From.Type = obj.TYPE_MEM + mvc.From.Offset = 0 + mvc.To.Type = obj.TYPE_MEM + mvc.To.Offset = 0 + mvc.From3 = new(obj.Addr) + mvc.From3.Type = obj.TYPE_CONST + mvc.From3.Offset = 256 + + ginscon(s390x.AADD, 256, &src) + ginscon(s390x.AADD, 256, &dst) + gins(s390x.ACMP, &src, &end) + gc.Patch(gc.Gbranch(s390x.ABNE, nil, 0), mvc) + gc.Regfree(&end) + + w -= cnt + } + + for w > 0 { + cnt := w + // If in reverse we can only do 8, 4, 2 or 1 bytes at a time. + if dir == _BACKWARDS { + switch { + case cnt >= 8: + cnt = 8 + case cnt >= 4: + cnt = 4 + case cnt >= 2: + cnt = 2 + } + } else if cnt > 256 { + cnt = 256 + } + + switch cnt { + case 8, 4, 2, 1: + op := s390x.AMOVB + switch cnt { + case 8: + op = s390x.AMOVD + case 4: + op = s390x.AMOVW + case 2: + op = s390x.AMOVH + } + load := gins(op, &src, &tmp) + load.From.Type = obj.TYPE_MEM + load.From.Offset = offset + + store := gins(op, &tmp, &dst) + store.To.Type = obj.TYPE_MEM + store.To.Offset = offset + + if dir == _BACKWARDS { + load.From.Offset -= cnt + store.To.Offset -= cnt + } + + default: + p := gins(s390x.AMVC, &src, &dst) + p.From.Type = obj.TYPE_MEM + p.From.Offset = offset + p.To.Type = obj.TYPE_MEM + p.To.Offset = offset + p.From3 = new(obj.Addr) + p.From3.Type = obj.TYPE_CONST + p.From3.Offset = cnt + } + + switch dir { + case _FORWARDS: + offset += cnt + case _BACKWARDS: + offset -= cnt + } + w -= cnt + } +} diff --git a/src/cmd/compile/internal/s390x/galign.go b/src/cmd/compile/internal/s390x/galign.go new file mode 100644 index 0000000000..d0d621e557 --- /dev/null +++ b/src/cmd/compile/internal/s390x/galign.go @@ -0,0 +1,66 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj/s390x" +) + +func betypeinit() { + gc.Widthptr = 8 + gc.Widthint = 8 + gc.Widthreg = 8 +} + +func Main() { + gc.Thearch.LinkArch = &s390x.Links390x + gc.Thearch.REGSP = s390x.REGSP + gc.Thearch.REGCTXT = s390x.REGCTXT + gc.Thearch.REGCALLX = s390x.REG_R3 + gc.Thearch.REGCALLX2 = s390x.REG_R4 + gc.Thearch.REGRETURN = s390x.REG_R3 + gc.Thearch.REGMIN = s390x.REG_R0 + gc.Thearch.REGMAX = s390x.REG_R15 + gc.Thearch.FREGMIN = s390x.REG_F0 + gc.Thearch.FREGMAX = s390x.REG_F15 + gc.Thearch.MAXWIDTH = 1 << 50 + gc.Thearch.ReservedRegs = resvd + + gc.Thearch.Betypeinit = betypeinit + gc.Thearch.Cgen_hmul = cgen_hmul + gc.Thearch.Cgen_shift = cgen_shift + gc.Thearch.Clearfat = clearfat + gc.Thearch.Defframe = defframe + gc.Thearch.Dodiv = dodiv + gc.Thearch.Excise = excise + gc.Thearch.Expandchecks = expandchecks + gc.Thearch.Getg = getg + gc.Thearch.Gins = gins + gc.Thearch.Ginscmp = ginscmp + gc.Thearch.Ginscon = ginscon + gc.Thearch.Ginsnop = ginsnop + gc.Thearch.Gmove = gmove + gc.Thearch.Peep = peep + gc.Thearch.Proginfo = proginfo + gc.Thearch.Regtyp = isReg + gc.Thearch.Sameaddr = sameaddr + gc.Thearch.Smallindir = smallindir + gc.Thearch.Stackaddr = stackaddr + gc.Thearch.Blockcopy = blockcopy + gc.Thearch.Sudoaddable = sudoaddable + gc.Thearch.Sudoclean = sudoclean + gc.Thearch.Excludedregs = excludedregs + gc.Thearch.RtoB = RtoB + gc.Thearch.FtoB = RtoB + gc.Thearch.BtoR = BtoR + gc.Thearch.BtoF = BtoF + gc.Thearch.Optoas = optoas + gc.Thearch.Doregbits = doregbits + gc.Thearch.Regnames = regnames + + gc.Main() + gc.Exit(0) +} diff --git a/src/cmd/compile/internal/s390x/ggen.go b/src/cmd/compile/internal/s390x/ggen.go new file mode 100644 index 0000000000..39885baace --- /dev/null +++ b/src/cmd/compile/internal/s390x/ggen.go @@ -0,0 +1,577 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj" + "cmd/internal/obj/s390x" + "fmt" +) + +// clearLoopCutOff is the (somewhat arbitrary) value above which it is better +// to have a loop of clear instructions (e.g. XCs) rather than just generating +// multiple instructions (i.e. loop unrolling). +// Must be between 256 and 4096. +const clearLoopCutoff = 1024 + +func defframe(ptxt *obj.Prog) { + // fill in argument size, stack size + ptxt.To.Type = obj.TYPE_TEXTSIZE + + ptxt.To.Val = int32(gc.Rnd(gc.Curfn.Type.ArgWidth(), int64(gc.Widthptr))) + frame := uint32(gc.Rnd(gc.Stksize+gc.Maxarg, int64(gc.Widthreg))) + ptxt.To.Offset = int64(frame) + + // insert code to zero ambiguously live variables + // so that the garbage collector only sees initialized values + // when it looks for pointers. + p := ptxt + + hi := int64(0) + lo := hi + + // iterate through declarations - they are sorted in decreasing xoffset order. + for _, n := range gc.Curfn.Func.Dcl { + if !n.Name.Needzero { + continue + } + if n.Class != gc.PAUTO { + gc.Fatalf("needzero class %d", n.Class) + } + if n.Type.Width%int64(gc.Widthptr) != 0 || n.Xoffset%int64(gc.Widthptr) != 0 || n.Type.Width == 0 { + gc.Fatalf("var %v has size %d offset %d", gc.Nconv(n, gc.FmtLong), int(n.Type.Width), int(n.Xoffset)) + } + + if lo != hi && n.Xoffset+n.Type.Width >= lo-int64(2*gc.Widthreg) { + // merge with range we already have + lo = n.Xoffset + + continue + } + + // zero old range + p = zerorange(p, int64(frame), lo, hi) + + // set new range + hi = n.Xoffset + n.Type.Width + + lo = n.Xoffset + } + + // zero final range + zerorange(p, int64(frame), lo, hi) +} + +// zerorange clears the stack in the given range. +func zerorange(p *obj.Prog, frame int64, lo int64, hi int64) *obj.Prog { + cnt := hi - lo + if cnt == 0 { + return p + } + + // Adjust the frame to account for LR. + frame += gc.Ctxt.FixedFrameSize() + offset := frame + lo + reg := int16(s390x.REGSP) + + // If the offset cannot fit in a 12-bit unsigned displacement then we + // need to create a copy of the stack pointer that we can adjust. + // We also need to do this if we are going to loop. + if offset < 0 || offset > 4096-clearLoopCutoff || cnt > clearLoopCutoff { + p = appendpp(p, s390x.AADD, obj.TYPE_CONST, 0, offset, obj.TYPE_REG, s390x.REGRT1, 0) + p.Reg = int16(s390x.REGSP) + reg = s390x.REGRT1 + offset = 0 + } + + // Generate a loop of large clears. + if cnt > clearLoopCutoff { + n := cnt - (cnt % 256) + end := int16(s390x.REGRT2) + p = appendpp(p, s390x.AADD, obj.TYPE_CONST, 0, offset+n, obj.TYPE_REG, end, 0) + p.Reg = reg + p = appendpp(p, s390x.AXC, obj.TYPE_MEM, reg, offset, obj.TYPE_MEM, reg, offset) + p.From3 = new(obj.Addr) + p.From3.Type = obj.TYPE_CONST + p.From3.Offset = 256 + pl := p + p = appendpp(p, s390x.AADD, obj.TYPE_CONST, 0, 256, obj.TYPE_REG, reg, 0) + p = appendpp(p, s390x.ACMP, obj.TYPE_REG, reg, 0, obj.TYPE_REG, end, 0) + p = appendpp(p, s390x.ABNE, obj.TYPE_NONE, 0, 0, obj.TYPE_BRANCH, 0, 0) + gc.Patch(p, pl) + + cnt -= n + } + + // Generate remaining clear instructions without a loop. + for cnt > 0 { + n := cnt + + // Can clear at most 256 bytes per instruction. + if n > 256 { + n = 256 + } + + switch n { + // Handle very small clears with move instructions. + case 8, 4, 2, 1: + ins := s390x.AMOVB + switch n { + case 8: + ins = s390x.AMOVD + case 4: + ins = s390x.AMOVW + case 2: + ins = s390x.AMOVH + } + p = appendpp(p, ins, obj.TYPE_CONST, 0, 0, obj.TYPE_MEM, reg, offset) + + // Handle clears that would require multiple move instructions with XC. + default: + p = appendpp(p, s390x.AXC, obj.TYPE_MEM, reg, offset, obj.TYPE_MEM, reg, offset) + p.From3 = new(obj.Addr) + p.From3.Type = obj.TYPE_CONST + p.From3.Offset = n + } + + cnt -= n + offset += n + } + + return p +} + +func appendpp(p *obj.Prog, as obj.As, ftype obj.AddrType, freg int16, foffset int64, ttype obj.AddrType, treg int16, toffset int64) *obj.Prog { + q := gc.Ctxt.NewProg() + gc.Clearp(q) + q.As = as + q.Lineno = p.Lineno + q.From.Type = ftype + q.From.Reg = freg + q.From.Offset = foffset + q.To.Type = ttype + q.To.Reg = treg + q.To.Offset = toffset + q.Link = p.Link + p.Link = q + return q +} + +func ginsnop() { + var reg gc.Node + gc.Nodreg(®, gc.Types[gc.TINT], s390x.REG_R0) + gins(s390x.AOR, ®, ®) +} + +var panicdiv *gc.Node + +/* + * generate division. + * generates one of: + * res = nl / nr + * res = nl % nr + * according to op. + */ +func dodiv(op gc.Op, nl *gc.Node, nr *gc.Node, res *gc.Node) { + // Have to be careful about handling + // most negative int divided by -1 correctly. + // The hardware will generate undefined result. + // Also need to explicitly trap on division on zero, + // the hardware will silently generate undefined result. + // DIVW will leave unpredicable result in higher 32-bit, + // so always use DIVD/DIVDU. + t := nl.Type + + t0 := t + check := 0 + if t.IsSigned() { + check = 1 + if gc.Isconst(nl, gc.CTINT) && nl.Int64() != -(1<<uint64(t.Width*8-1)) { + check = 0 + } else if gc.Isconst(nr, gc.CTINT) && nr.Int64() != -1 { + check = 0 + } + } + + if t.Width < 8 { + if t.IsSigned() { + t = gc.Types[gc.TINT64] + } else { + t = gc.Types[gc.TUINT64] + } + check = 0 + } + + a := optoas(gc.ODIV, t) + + var tl gc.Node + gc.Regalloc(&tl, t0, nil) + var tr gc.Node + gc.Regalloc(&tr, t0, nil) + if nl.Ullman >= nr.Ullman { + gc.Cgen(nl, &tl) + gc.Cgen(nr, &tr) + } else { + gc.Cgen(nr, &tr) + gc.Cgen(nl, &tl) + } + + if t != t0 { + // Convert + tl2 := tl + + tr2 := tr + tl.Type = t + tr.Type = t + gmove(&tl2, &tl) + gmove(&tr2, &tr) + } + + // Handle divide-by-zero panic. + p1 := gins(optoas(gc.OCMP, t), &tr, nil) + + p1.To.Type = obj.TYPE_REG + p1.To.Reg = s390x.REGZERO + p1 = gc.Gbranch(optoas(gc.ONE, t), nil, +1) + if panicdiv == nil { + panicdiv = gc.Sysfunc("panicdivide") + } + gc.Ginscall(panicdiv, -1) + gc.Patch(p1, gc.Pc) + + var p2 *obj.Prog + if check != 0 { + var nm1 gc.Node + gc.Nodconst(&nm1, t, -1) + gins(optoas(gc.OCMP, t), &tr, &nm1) + p1 := gc.Gbranch(optoas(gc.ONE, t), nil, +1) + if op == gc.ODIV { + // a / (-1) is -a. + gins(optoas(gc.OMINUS, t), nil, &tl) + + gmove(&tl, res) + } else { + // a % (-1) is 0. + var nz gc.Node + gc.Nodconst(&nz, t, 0) + + gmove(&nz, res) + } + + p2 = gc.Gbranch(obj.AJMP, nil, 0) + gc.Patch(p1, gc.Pc) + } + + p1 = gins(a, &tr, &tl) + if op == gc.ODIV { + gc.Regfree(&tr) + gmove(&tl, res) + } else { + // A%B = A-(A/B*B) + var tm gc.Node + gc.Regalloc(&tm, t, nil) + + // patch div to use the 3 register form + // TODO(minux): add gins3? + p1.Reg = p1.To.Reg + + p1.To.Reg = tm.Reg + gins(optoas(gc.OMUL, t), &tr, &tm) + gc.Regfree(&tr) + gins(optoas(gc.OSUB, t), &tm, &tl) + gc.Regfree(&tm) + gmove(&tl, res) + } + + gc.Regfree(&tl) + if check != 0 { + gc.Patch(p2, gc.Pc) + } +} + +/* + * generate high multiply: + * res = (nl*nr) >> width + */ +func cgen_hmul(nl *gc.Node, nr *gc.Node, res *gc.Node) { + // largest ullman on left. + if nl.Ullman < nr.Ullman { + nl, nr = nr, nl + } + + t := nl.Type + w := int(t.Width) * 8 + var n1 gc.Node + gc.Cgenr(nl, &n1, res) + var n2 gc.Node + gc.Cgenr(nr, &n2, nil) + switch gc.Simtype[t.Etype] { + case gc.TINT8, + gc.TINT16, + gc.TINT32: + gins(optoas(gc.OMUL, t), &n2, &n1) + p := gins(s390x.ASRAD, nil, &n1) + p.From.Type = obj.TYPE_CONST + p.From.Offset = int64(w) + + case gc.TUINT8, + gc.TUINT16, + gc.TUINT32: + gins(optoas(gc.OMUL, t), &n2, &n1) + p := gins(s390x.ASRD, nil, &n1) + p.From.Type = obj.TYPE_CONST + p.From.Offset = int64(w) + + case gc.TINT64: + gins(s390x.AMULHD, &n2, &n1) + + case gc.TUINT64: + gins(s390x.AMULHDU, &n2, &n1) + + default: + gc.Fatalf("cgen_hmul %v", t) + } + + gc.Cgen(&n1, res) + gc.Regfree(&n1) + gc.Regfree(&n2) +} + +/* + * generate shift according to op, one of: + * res = nl << nr + * res = nl >> nr + */ +func cgen_shift(op gc.Op, bounded bool, nl *gc.Node, nr *gc.Node, res *gc.Node) { + a := optoas(op, nl.Type) + + if nr.Op == gc.OLITERAL { + var n1 gc.Node + gc.Regalloc(&n1, nl.Type, res) + gc.Cgen(nl, &n1) + sc := uint64(nr.Int64()) + if sc >= uint64(nl.Type.Width*8) { + // large shift gets 2 shifts by width-1 + var n3 gc.Node + gc.Nodconst(&n3, gc.Types[gc.TUINT32], nl.Type.Width*8-1) + + gins(a, &n3, &n1) + gins(a, &n3, &n1) + } else { + gins(a, nr, &n1) + } + gmove(&n1, res) + gc.Regfree(&n1) + return + } + + if nl.Ullman >= gc.UINF { + var n4 gc.Node + gc.Tempname(&n4, nl.Type) + gc.Cgen(nl, &n4) + nl = &n4 + } + + if nr.Ullman >= gc.UINF { + var n5 gc.Node + gc.Tempname(&n5, nr.Type) + gc.Cgen(nr, &n5) + nr = &n5 + } + + // Allow either uint32 or uint64 as shift type, + // to avoid unnecessary conversion from uint32 to uint64 + // just to do the comparison. + tcount := gc.Types[gc.Simtype[nr.Type.Etype]] + + if tcount.Etype < gc.TUINT32 { + tcount = gc.Types[gc.TUINT32] + } + + var n1 gc.Node + gc.Regalloc(&n1, nr.Type, nil) // to hold the shift type in CX + var n3 gc.Node + gc.Regalloc(&n3, tcount, &n1) // to clear high bits of CX + + var n2 gc.Node + gc.Regalloc(&n2, nl.Type, res) + + if nl.Ullman >= nr.Ullman { + gc.Cgen(nl, &n2) + gc.Cgen(nr, &n1) + gmove(&n1, &n3) + } else { + gc.Cgen(nr, &n1) + gmove(&n1, &n3) + gc.Cgen(nl, &n2) + } + + gc.Regfree(&n3) + + // test and fix up large shifts + if !bounded { + gc.Nodconst(&n3, tcount, nl.Type.Width*8) + gins(optoas(gc.OCMP, tcount), &n1, &n3) + p1 := gc.Gbranch(optoas(gc.OLT, tcount), nil, 1) + if op == gc.ORSH && nl.Type.IsSigned() { + gc.Nodconst(&n3, gc.Types[gc.TUINT32], nl.Type.Width*8-1) + gins(a, &n3, &n2) + } else { + gc.Nodconst(&n3, nl.Type, 0) + gmove(&n3, &n2) + } + + gc.Patch(p1, gc.Pc) + } + + gins(a, &n1, &n2) + + gmove(&n2, res) + + gc.Regfree(&n1) + gc.Regfree(&n2) +} + +// clearfat clears (i.e. replaces with zeros) the value pointed to by nl. +func clearfat(nl *gc.Node) { + if gc.Debug['g'] != 0 { + fmt.Printf("clearfat %v (%v, size: %d)\n", nl, nl.Type, nl.Type.Width) + } + + // Avoid taking the address for simple enough types. + if gc.Componentgen(nil, nl) { + return + } + + var dst gc.Node + gc.Regalloc(&dst, gc.Types[gc.Tptr], nil) + gc.Agen(nl, &dst) + + var boff int64 + w := nl.Type.Width + if w > clearLoopCutoff { + // Generate a loop clearing 256 bytes per iteration using XCs. + var end gc.Node + gc.Regalloc(&end, gc.Types[gc.Tptr], nil) + p := gins(s390x.AMOVD, &dst, &end) + p.From.Type = obj.TYPE_ADDR + p.From.Offset = w - (w % 256) + + p = gins(s390x.AXC, &dst, &dst) + p.From.Type = obj.TYPE_MEM + p.From.Offset = 0 + p.To.Type = obj.TYPE_MEM + p.To.Offset = 0 + p.From3 = new(obj.Addr) + p.From3.Offset = 256 + p.From3.Type = obj.TYPE_CONST + pl := p + + ginscon(s390x.AADD, 256, &dst) + gins(s390x.ACMP, &dst, &end) + gc.Patch(gc.Gbranch(s390x.ABNE, nil, 0), pl) + gc.Regfree(&end) + w = w % 256 + } + + // Generate instructions to clear the remaining memory. + for w > 0 { + n := w + + // Can clear at most 256 bytes per instruction. + if n > 256 { + n = 256 + } + + switch n { + // Handle very small clears using moves. + case 8, 4, 2, 1: + ins := s390x.AMOVB + switch n { + case 8: + ins = s390x.AMOVD + case 4: + ins = s390x.AMOVW + case 2: + ins = s390x.AMOVH + } + p := gins(ins, nil, &dst) + p.From.Type = obj.TYPE_CONST + p.From.Offset = 0 + p.To.Type = obj.TYPE_MEM + p.To.Offset = boff + + // Handle clears that would require multiple moves with a XC. + default: + p := gins(s390x.AXC, &dst, &dst) + p.From.Type = obj.TYPE_MEM + p.From.Offset = boff + p.To.Type = obj.TYPE_MEM + p.To.Offset = boff + p.From3 = new(obj.Addr) + p.From3.Offset = n + p.From3.Type = obj.TYPE_CONST + } + + boff += n + w -= n + } + + gc.Regfree(&dst) +} + +// Called after regopt and peep have run. +// Expand CHECKNIL pseudo-op into actual nil pointer check. +func expandchecks(firstp *obj.Prog) { + for p := firstp; p != nil; p = p.Link { + if gc.Debug_checknil != 0 && gc.Ctxt.Debugvlog != 0 { + fmt.Printf("expandchecks: %v\n", p) + } + if p.As != obj.ACHECKNIL { + continue + } + if gc.Debug_checknil != 0 && p.Lineno > 1 { // p->lineno==1 in generated wrappers + gc.Warnl(p.Lineno, "generated nil check") + } + if p.From.Type != obj.TYPE_REG { + gc.Fatalf("invalid nil check %v\n", p) + } + + // check is + // CMPBNE arg, $0, 2(PC) [likely] + // MOVD R0, 0(R0) + p1 := gc.Ctxt.NewProg() + + gc.Clearp(p1) + p1.Link = p.Link + p.Link = p1 + p1.Lineno = p.Lineno + p1.Pc = 9999 + p.As = s390x.ACMPBNE + p.From3 = new(obj.Addr) + p.From3.Type = obj.TYPE_CONST + p.From3.Offset = 0 + + p.To.Type = obj.TYPE_BRANCH + p.To.Val = p1.Link + + // crash by write to memory address 0. + p1.As = s390x.AMOVD + + p1.From.Type = obj.TYPE_REG + p1.From.Reg = s390x.REGZERO + p1.To.Type = obj.TYPE_MEM + p1.To.Reg = s390x.REGZERO + p1.To.Offset = 0 + } +} + +// res = runtime.getg() +func getg(res *gc.Node) { + var n1 gc.Node + gc.Nodreg(&n1, res.Type, s390x.REGG) + gmove(&n1, res) +} diff --git a/src/cmd/compile/internal/s390x/gsubr.go b/src/cmd/compile/internal/s390x/gsubr.go new file mode 100644 index 0000000000..3e8782f5e6 --- /dev/null +++ b/src/cmd/compile/internal/s390x/gsubr.go @@ -0,0 +1,1115 @@ +// Derived from Inferno utils/6c/txt.c +// http://code.google.com/p/inferno-os/source/browse/utils/6c/txt.c +// +// Copyright © 1994-1999 Lucent Technologies Inc. All rights reserved. +// Portions Copyright © 1995-1997 C H Forsyth (forsyth@terzarima.net) +// Portions Copyright © 1997-1999 Vita Nuova Limited +// Portions Copyright © 2000-2007 Vita Nuova Holdings Limited (www.vitanuova.com) +// Portions Copyright © 2004,2006 Bruce Ellis +// Portions Copyright © 2005-2007 C H Forsyth (forsyth@terzarima.net) +// Revisions Copyright © 2000-2007 Lucent Technologies Inc. and others +// Portions Copyright © 2009 The Go Authors. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person obtaining a copy +// of this software and associated documentation files (the "Software"), to deal +// in the Software without restriction, including without limitation the rights +// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the Software is +// furnished to do so, subject to the following conditions: +// +// The above copyright notice and this permission notice shall be included in +// all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +// THE SOFTWARE. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj" + "cmd/internal/obj/s390x" + "fmt" +) + +var resvd = []int{ + s390x.REGZERO, // R0 + s390x.REGTMP, // R10 + s390x.REGTMP2, // R11 + s390x.REGCTXT, // R12 + s390x.REGG, // R13 + s390x.REG_LR, // R14 + s390x.REGSP, // R15 +} + +// generate +// as $c, n +func ginscon(as obj.As, c int64, n2 *gc.Node) { + var n1 gc.Node + + gc.Nodconst(&n1, gc.Types[gc.TINT64], c) + + if as != s390x.AMOVD && (c < -s390x.BIG || c > s390x.BIG) || n2.Op != gc.OREGISTER || as == s390x.AMULLD { + // cannot have more than 16-bit of immediate in ADD, etc. + // instead, MOV into register first. + var ntmp gc.Node + gc.Regalloc(&ntmp, gc.Types[gc.TINT64], nil) + + rawgins(s390x.AMOVD, &n1, &ntmp) + rawgins(as, &ntmp, n2) + gc.Regfree(&ntmp) + return + } + + rawgins(as, &n1, n2) +} + +// generate +// as n, $c (CMP/CMPU) +func ginscon2(as obj.As, n2 *gc.Node, c int64) { + var n1 gc.Node + + gc.Nodconst(&n1, gc.Types[gc.TINT64], c) + + switch as { + default: + gc.Fatalf("ginscon2") + + case s390x.ACMP: + if -s390x.BIG <= c && c <= s390x.BIG { + rawgins(as, n2, &n1) + return + } + + case s390x.ACMPU: + if 0 <= c && c <= 2*s390x.BIG { + rawgins(as, n2, &n1) + return + } + } + + // MOV n1 into register first + var ntmp gc.Node + gc.Regalloc(&ntmp, gc.Types[gc.TINT64], nil) + + rawgins(s390x.AMOVD, &n1, &ntmp) + rawgins(as, n2, &ntmp) + gc.Regfree(&ntmp) +} + +func ginscmp(op gc.Op, t *gc.Type, n1, n2 *gc.Node, likely int) *obj.Prog { + if t.IsInteger() && n1.Op == gc.OLITERAL && n2.Op != gc.OLITERAL { + // Reverse comparison to place constant last. + op = gc.Brrev(op) + n1, n2 = n2, n1 + } + + var r1, r2, g1, g2 gc.Node + gc.Regalloc(&r1, t, n1) + gc.Regalloc(&g1, n1.Type, &r1) + gc.Cgen(n1, &g1) + gmove(&g1, &r1) + if t.IsInteger() && gc.Isconst(n2, gc.CTINT) { + ginscon2(optoas(gc.OCMP, t), &r1, n2.Int64()) + } else { + gc.Regalloc(&r2, t, n2) + gc.Regalloc(&g2, n1.Type, &r2) + gc.Cgen(n2, &g2) + gmove(&g2, &r2) + rawgins(optoas(gc.OCMP, t), &r1, &r2) + gc.Regfree(&g2) + gc.Regfree(&r2) + } + gc.Regfree(&g1) + gc.Regfree(&r1) + return gc.Gbranch(optoas(op, t), nil, likely) +} + +// gmvc tries to move f to t using a mvc instruction. +// If successful it returns true, otherwise it returns false. +func gmvc(f, t *gc.Node) bool { + ft := int(gc.Simsimtype(f.Type)) + tt := int(gc.Simsimtype(t.Type)) + + if ft != tt { + return false + } + + if f.Op != gc.OINDREG || t.Op != gc.OINDREG { + return false + } + + if f.Xoffset < 0 || f.Xoffset >= 4096-8 { + return false + } + + if t.Xoffset < 0 || t.Xoffset >= 4096-8 { + return false + } + + var len int64 + switch ft { + case gc.TUINT8, gc.TINT8, gc.TBOOL: + len = 1 + case gc.TUINT16, gc.TINT16: + len = 2 + case gc.TUINT32, gc.TINT32, gc.TFLOAT32: + len = 4 + case gc.TUINT64, gc.TINT64, gc.TFLOAT64, gc.TPTR64: + len = 8 + case gc.TUNSAFEPTR: + len = int64(gc.Widthptr) + default: + return false + } + + p := gc.Prog(s390x.AMVC) + gc.Naddr(&p.From, f) + gc.Naddr(&p.To, t) + p.From3 = new(obj.Addr) + p.From3.Offset = len + p.From3.Type = obj.TYPE_CONST + return true +} + +// generate move: +// t = f +// hard part is conversions. +func gmove(f *gc.Node, t *gc.Node) { + if gc.Debug['M'] != 0 { + fmt.Printf("gmove %v -> %v\n", gc.Nconv(f, gc.FmtLong), gc.Nconv(t, gc.FmtLong)) + } + + ft := int(gc.Simsimtype(f.Type)) + tt := int(gc.Simsimtype(t.Type)) + cvt := t.Type + + if gc.Iscomplex[ft] || gc.Iscomplex[tt] { + gc.Complexmove(f, t) + return + } + + var a obj.As + + // cannot have two memory operands + if gc.Ismem(f) && gc.Ismem(t) { + if gmvc(f, t) { + return + } + goto hard + } + + // convert constant to desired type + if f.Op == gc.OLITERAL { + var con gc.Node + f.Convconst(&con, t.Type) + f = &con + ft = tt // so big switch will choose a simple mov + + // some constants can't move directly to memory. + if gc.Ismem(t) { + // float constants come from memory. + if t.Type.IsFloat() { + goto hard + } + + // all immediates are 16-bit sign-extended + // unless moving into a register. + if t.Type.IsInteger() { + if i := con.Int64(); int64(int16(i)) != i { + goto hard + } + } + + // immediate moves to memory have a 12-bit unsigned displacement + if t.Xoffset < 0 || t.Xoffset >= 4096-8 { + goto hard + } + } + } + + // a float-to-int or int-to-float conversion requires the source operand in a register + if gc.Ismem(f) && ((f.Type.IsFloat() && t.Type.IsInteger()) || (f.Type.IsInteger() && t.Type.IsFloat())) { + cvt = f.Type + goto hard + } + + // a float32-to-float64 or float64-to-float32 conversion requires the source operand in a register + if gc.Ismem(f) && f.Type.IsFloat() && t.Type.IsFloat() && (ft != tt) { + cvt = f.Type + goto hard + } + + // value -> value copy, only one memory operand. + // figure out the instruction to use. + // break out of switch for one-instruction gins. + // goto rdst for "destination must be register". + // goto hard for "convert to cvt type first". + // otherwise handle and return. + switch uint32(ft)<<16 | uint32(tt) { + default: + gc.Fatalf("gmove %v -> %v", gc.Tconv(f.Type, gc.FmtLong), gc.Tconv(t.Type, gc.FmtLong)) + + // integer copy and truncate + case gc.TINT8<<16 | gc.TINT8, + gc.TUINT8<<16 | gc.TINT8, + gc.TINT16<<16 | gc.TINT8, + gc.TUINT16<<16 | gc.TINT8, + gc.TINT32<<16 | gc.TINT8, + gc.TUINT32<<16 | gc.TINT8, + gc.TINT64<<16 | gc.TINT8, + gc.TUINT64<<16 | gc.TINT8: + a = s390x.AMOVB + + case gc.TINT8<<16 | gc.TUINT8, + gc.TUINT8<<16 | gc.TUINT8, + gc.TINT16<<16 | gc.TUINT8, + gc.TUINT16<<16 | gc.TUINT8, + gc.TINT32<<16 | gc.TUINT8, + gc.TUINT32<<16 | gc.TUINT8, + gc.TINT64<<16 | gc.TUINT8, + gc.TUINT64<<16 | gc.TUINT8: + a = s390x.AMOVBZ + + case gc.TINT16<<16 | gc.TINT16, + gc.TUINT16<<16 | gc.TINT16, + gc.TINT32<<16 | gc.TINT16, + gc.TUINT32<<16 | gc.TINT16, + gc.TINT64<<16 | gc.TINT16, + gc.TUINT64<<16 | gc.TINT16: + a = s390x.AMOVH + + case gc.TINT16<<16 | gc.TUINT16, + gc.TUINT16<<16 | gc.TUINT16, + gc.TINT32<<16 | gc.TUINT16, + gc.TUINT32<<16 | gc.TUINT16, + gc.TINT64<<16 | gc.TUINT16, + gc.TUINT64<<16 | gc.TUINT16: + a = s390x.AMOVHZ + + case gc.TINT32<<16 | gc.TINT32, + gc.TUINT32<<16 | gc.TINT32, + gc.TINT64<<16 | gc.TINT32, + gc.TUINT64<<16 | gc.TINT32: + a = s390x.AMOVW + + case gc.TINT32<<16 | gc.TUINT32, + gc.TUINT32<<16 | gc.TUINT32, + gc.TINT64<<16 | gc.TUINT32, + gc.TUINT64<<16 | gc.TUINT32: + a = s390x.AMOVWZ + + case gc.TINT64<<16 | gc.TINT64, + gc.TINT64<<16 | gc.TUINT64, + gc.TUINT64<<16 | gc.TINT64, + gc.TUINT64<<16 | gc.TUINT64: + a = s390x.AMOVD + + // sign extend int8 + case gc.TINT8<<16 | gc.TINT16, + gc.TINT8<<16 | gc.TUINT16, + gc.TINT8<<16 | gc.TINT32, + gc.TINT8<<16 | gc.TUINT32, + gc.TINT8<<16 | gc.TINT64, + gc.TINT8<<16 | gc.TUINT64: + a = s390x.AMOVB + goto rdst + + // sign extend uint8 + case gc.TUINT8<<16 | gc.TINT16, + gc.TUINT8<<16 | gc.TUINT16, + gc.TUINT8<<16 | gc.TINT32, + gc.TUINT8<<16 | gc.TUINT32, + gc.TUINT8<<16 | gc.TINT64, + gc.TUINT8<<16 | gc.TUINT64: + a = s390x.AMOVBZ + goto rdst + + // sign extend int16 + case gc.TINT16<<16 | gc.TINT32, + gc.TINT16<<16 | gc.TUINT32, + gc.TINT16<<16 | gc.TINT64, + gc.TINT16<<16 | gc.TUINT64: + a = s390x.AMOVH + goto rdst + + // zero extend uint16 + case gc.TUINT16<<16 | gc.TINT32, + gc.TUINT16<<16 | gc.TUINT32, + gc.TUINT16<<16 | gc.TINT64, + gc.TUINT16<<16 | gc.TUINT64: + a = s390x.AMOVHZ + goto rdst + + // sign extend int32 + case gc.TINT32<<16 | gc.TINT64, + gc.TINT32<<16 | gc.TUINT64: + a = s390x.AMOVW + goto rdst + + // zero extend uint32 + case gc.TUINT32<<16 | gc.TINT64, + gc.TUINT32<<16 | gc.TUINT64: + a = s390x.AMOVWZ + goto rdst + + // float to integer + case gc.TFLOAT32<<16 | gc.TUINT8, + gc.TFLOAT32<<16 | gc.TUINT16: + cvt = gc.Types[gc.TUINT32] + goto hard + + case gc.TFLOAT32<<16 | gc.TUINT32: + a = s390x.ACLFEBR + goto rdst + + case gc.TFLOAT32<<16 | gc.TUINT64: + a = s390x.ACLGEBR + goto rdst + + case gc.TFLOAT64<<16 | gc.TUINT8, + gc.TFLOAT64<<16 | gc.TUINT16: + cvt = gc.Types[gc.TUINT32] + goto hard + + case gc.TFLOAT64<<16 | gc.TUINT32: + a = s390x.ACLFDBR + goto rdst + + case gc.TFLOAT64<<16 | gc.TUINT64: + a = s390x.ACLGDBR + goto rdst + + case gc.TFLOAT32<<16 | gc.TINT8, + gc.TFLOAT32<<16 | gc.TINT16: + cvt = gc.Types[gc.TINT32] + goto hard + + case gc.TFLOAT32<<16 | gc.TINT32: + a = s390x.ACFEBRA + goto rdst + + case gc.TFLOAT32<<16 | gc.TINT64: + a = s390x.ACGEBRA + goto rdst + + case gc.TFLOAT64<<16 | gc.TINT8, + gc.TFLOAT64<<16 | gc.TINT16: + cvt = gc.Types[gc.TINT32] + goto hard + + case gc.TFLOAT64<<16 | gc.TINT32: + a = s390x.ACFDBRA + goto rdst + + case gc.TFLOAT64<<16 | gc.TINT64: + a = s390x.ACGDBRA + goto rdst + + // integer to float + case gc.TUINT8<<16 | gc.TFLOAT32, + gc.TUINT16<<16 | gc.TFLOAT32: + cvt = gc.Types[gc.TUINT32] + goto hard + + case gc.TUINT32<<16 | gc.TFLOAT32: + a = s390x.ACELFBR + goto rdst + + case gc.TUINT64<<16 | gc.TFLOAT32: + a = s390x.ACELGBR + goto rdst + + case gc.TUINT8<<16 | gc.TFLOAT64, + gc.TUINT16<<16 | gc.TFLOAT64: + cvt = gc.Types[gc.TUINT32] + goto hard + + case gc.TUINT32<<16 | gc.TFLOAT64: + a = s390x.ACDLFBR + goto rdst + + case gc.TUINT64<<16 | gc.TFLOAT64: + a = s390x.ACDLGBR + goto rdst + + case gc.TINT8<<16 | gc.TFLOAT32, + gc.TINT16<<16 | gc.TFLOAT32: + cvt = gc.Types[gc.TINT32] + goto hard + + case gc.TINT32<<16 | gc.TFLOAT32: + a = s390x.ACEFBRA + goto rdst + + case gc.TINT64<<16 | gc.TFLOAT32: + a = s390x.ACEGBRA + goto rdst + + case gc.TINT8<<16 | gc.TFLOAT64, + gc.TINT16<<16 | gc.TFLOAT64: + cvt = gc.Types[gc.TINT32] + goto hard + + case gc.TINT32<<16 | gc.TFLOAT64: + a = s390x.ACDFBRA + goto rdst + + case gc.TINT64<<16 | gc.TFLOAT64: + a = s390x.ACDGBRA + goto rdst + + // float to float + case gc.TFLOAT32<<16 | gc.TFLOAT32: + a = s390x.AFMOVS + + case gc.TFLOAT64<<16 | gc.TFLOAT64: + a = s390x.AFMOVD + + case gc.TFLOAT32<<16 | gc.TFLOAT64: + a = s390x.ALDEBR + goto rdst + + case gc.TFLOAT64<<16 | gc.TFLOAT32: + a = s390x.ALEDBR + goto rdst + } + + gins(a, f, t) + return + + // requires register destination +rdst: + if t != nil && t.Op == gc.OREGISTER { + gins(a, f, t) + return + } else { + var r1 gc.Node + gc.Regalloc(&r1, t.Type, t) + + gins(a, f, &r1) + gmove(&r1, t) + gc.Regfree(&r1) + return + } + + // requires register intermediate +hard: + var r1 gc.Node + gc.Regalloc(&r1, cvt, t) + + gmove(f, &r1) + gmove(&r1, t) + gc.Regfree(&r1) + return +} + +func intLiteral(n *gc.Node) (x int64, ok bool) { + switch { + case n == nil: + return + case gc.Isconst(n, gc.CTINT): + return n.Int64(), true + case gc.Isconst(n, gc.CTBOOL): + return int64(obj.Bool2int(n.Bool())), true + } + return +} + +// gins is called by the front end. +// It synthesizes some multiple-instruction sequences +// so the front end can stay simpler. +func gins(as obj.As, f, t *gc.Node) *obj.Prog { + if t != nil { + if as >= obj.A_ARCHSPECIFIC { + if x, ok := intLiteral(f); ok { + ginscon(as, x, t) + return nil // caller must not use + } + } + if as == s390x.ACMP || as == s390x.ACMPU { + if x, ok := intLiteral(t); ok { + ginscon2(as, f, x) + return nil // caller must not use + } + } + } + return rawgins(as, f, t) +} + +// generate one instruction: +// as f, t +func rawgins(as obj.As, f *gc.Node, t *gc.Node) *obj.Prog { + // self move check + // TODO(mundaym): use sized math and extend to MOVB, MOVWZ etc. + switch as { + case s390x.AMOVD, s390x.AFMOVS, s390x.AFMOVD: + if f != nil && t != nil && + f.Op == gc.OREGISTER && t.Op == gc.OREGISTER && + f.Reg == t.Reg { + return nil + } + } + + p := gc.Prog(as) + gc.Naddr(&p.From, f) + gc.Naddr(&p.To, t) + + switch as { + // Bad things the front end has done to us. Crash to find call stack. + case s390x.AMULLD: + if p.From.Type == obj.TYPE_CONST { + gc.Debug['h'] = 1 + gc.Fatalf("bad inst: %v", p) + } + case s390x.ACMP, s390x.ACMPU: + if p.From.Type == obj.TYPE_MEM || p.To.Type == obj.TYPE_MEM { + gc.Debug['h'] = 1 + gc.Fatalf("bad inst: %v", p) + } + } + + if gc.Debug['g'] != 0 { + fmt.Printf("%v\n", p) + } + + w := int32(0) + switch as { + case s390x.AMOVB, s390x.AMOVBZ: + w = 1 + + case s390x.AMOVH, s390x.AMOVHZ: + w = 2 + + case s390x.AMOVW, s390x.AMOVWZ: + w = 4 + + case s390x.AMOVD: + if p.From.Type == obj.TYPE_CONST || p.From.Type == obj.TYPE_ADDR { + break + } + w = 8 + } + + if w != 0 && ((f != nil && p.From.Width < int64(w)) || (t != nil && p.To.Type != obj.TYPE_REG && p.To.Width > int64(w))) { + gc.Dump("f", f) + gc.Dump("t", t) + gc.Fatalf("bad width: %v (%d, %d)\n", p, p.From.Width, p.To.Width) + } + + return p +} + +// optoas returns the Axxx equivalent of Oxxx for type t +func optoas(op gc.Op, t *gc.Type) obj.As { + if t == nil { + gc.Fatalf("optoas: t is nil") + } + + // avoid constant conversions in switches below + const ( + OMINUS_ = uint32(gc.OMINUS) << 16 + OLSH_ = uint32(gc.OLSH) << 16 + ORSH_ = uint32(gc.ORSH) << 16 + OADD_ = uint32(gc.OADD) << 16 + OSUB_ = uint32(gc.OSUB) << 16 + OMUL_ = uint32(gc.OMUL) << 16 + ODIV_ = uint32(gc.ODIV) << 16 + OOR_ = uint32(gc.OOR) << 16 + OAND_ = uint32(gc.OAND) << 16 + OXOR_ = uint32(gc.OXOR) << 16 + OEQ_ = uint32(gc.OEQ) << 16 + ONE_ = uint32(gc.ONE) << 16 + OLT_ = uint32(gc.OLT) << 16 + OLE_ = uint32(gc.OLE) << 16 + OGE_ = uint32(gc.OGE) << 16 + OGT_ = uint32(gc.OGT) << 16 + OCMP_ = uint32(gc.OCMP) << 16 + OAS_ = uint32(gc.OAS) << 16 + OHMUL_ = uint32(gc.OHMUL) << 16 + OSQRT_ = uint32(gc.OSQRT) << 16 + OLROT_ = uint32(gc.OLROT) << 16 + ) + + a := obj.AXXX + switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { + default: + gc.Fatalf("optoas: no entry for op=%v type=%v", op, t) + + case OEQ_ | gc.TBOOL, + OEQ_ | gc.TINT8, + OEQ_ | gc.TUINT8, + OEQ_ | gc.TINT16, + OEQ_ | gc.TUINT16, + OEQ_ | gc.TINT32, + OEQ_ | gc.TUINT32, + OEQ_ | gc.TINT64, + OEQ_ | gc.TUINT64, + OEQ_ | gc.TPTR32, + OEQ_ | gc.TPTR64, + OEQ_ | gc.TFLOAT32, + OEQ_ | gc.TFLOAT64: + a = s390x.ABEQ + + case ONE_ | gc.TBOOL, + ONE_ | gc.TINT8, + ONE_ | gc.TUINT8, + ONE_ | gc.TINT16, + ONE_ | gc.TUINT16, + ONE_ | gc.TINT32, + ONE_ | gc.TUINT32, + ONE_ | gc.TINT64, + ONE_ | gc.TUINT64, + ONE_ | gc.TPTR32, + ONE_ | gc.TPTR64, + ONE_ | gc.TFLOAT32, + ONE_ | gc.TFLOAT64: + a = s390x.ABNE + + case OLT_ | gc.TINT8, // ACMP + OLT_ | gc.TINT16, + OLT_ | gc.TINT32, + OLT_ | gc.TINT64, + OLT_ | gc.TUINT8, + // ACMPU + OLT_ | gc.TUINT16, + OLT_ | gc.TUINT32, + OLT_ | gc.TUINT64, + OLT_ | gc.TFLOAT32, + // AFCMPU + OLT_ | gc.TFLOAT64: + a = s390x.ABLT + + case OLE_ | gc.TINT8, // ACMP + OLE_ | gc.TINT16, + OLE_ | gc.TINT32, + OLE_ | gc.TINT64, + OLE_ | gc.TUINT8, + // ACMPU + OLE_ | gc.TUINT16, + OLE_ | gc.TUINT32, + OLE_ | gc.TUINT64, + OLE_ | gc.TFLOAT32, + OLE_ | gc.TFLOAT64: + a = s390x.ABLE + + case OGT_ | gc.TINT8, + OGT_ | gc.TINT16, + OGT_ | gc.TINT32, + OGT_ | gc.TINT64, + OGT_ | gc.TUINT8, + OGT_ | gc.TUINT16, + OGT_ | gc.TUINT32, + OGT_ | gc.TUINT64, + OGT_ | gc.TFLOAT32, + OGT_ | gc.TFLOAT64: + a = s390x.ABGT + + case OGE_ | gc.TINT8, + OGE_ | gc.TINT16, + OGE_ | gc.TINT32, + OGE_ | gc.TINT64, + OGE_ | gc.TUINT8, + OGE_ | gc.TUINT16, + OGE_ | gc.TUINT32, + OGE_ | gc.TUINT64, + OGE_ | gc.TFLOAT32, + OGE_ | gc.TFLOAT64: + a = s390x.ABGE + + case OCMP_ | gc.TBOOL, + OCMP_ | gc.TINT8, + OCMP_ | gc.TINT16, + OCMP_ | gc.TINT32, + OCMP_ | gc.TPTR32, + OCMP_ | gc.TINT64: + a = s390x.ACMP + + case OCMP_ | gc.TUINT8, + OCMP_ | gc.TUINT16, + OCMP_ | gc.TUINT32, + OCMP_ | gc.TUINT64, + OCMP_ | gc.TPTR64: + a = s390x.ACMPU + + case OCMP_ | gc.TFLOAT32: + a = s390x.ACEBR + + case OCMP_ | gc.TFLOAT64: + a = s390x.AFCMPU + + case OAS_ | gc.TBOOL, + OAS_ | gc.TINT8: + a = s390x.AMOVB + + case OAS_ | gc.TUINT8: + a = s390x.AMOVBZ + + case OAS_ | gc.TINT16: + a = s390x.AMOVH + + case OAS_ | gc.TUINT16: + a = s390x.AMOVHZ + + case OAS_ | gc.TINT32: + a = s390x.AMOVW + + case OAS_ | gc.TUINT32, + OAS_ | gc.TPTR32: + a = s390x.AMOVWZ + + case OAS_ | gc.TINT64, + OAS_ | gc.TUINT64, + OAS_ | gc.TPTR64: + a = s390x.AMOVD + + case OAS_ | gc.TFLOAT32: + a = s390x.AFMOVS + + case OAS_ | gc.TFLOAT64: + a = s390x.AFMOVD + + case OADD_ | gc.TINT8, + OADD_ | gc.TUINT8, + OADD_ | gc.TINT16, + OADD_ | gc.TUINT16, + OADD_ | gc.TINT32, + OADD_ | gc.TUINT32, + OADD_ | gc.TPTR32, + OADD_ | gc.TINT64, + OADD_ | gc.TUINT64, + OADD_ | gc.TPTR64: + a = s390x.AADD + + case OADD_ | gc.TFLOAT32: + a = s390x.AFADDS + + case OADD_ | gc.TFLOAT64: + a = s390x.AFADD + + case OSUB_ | gc.TINT8, + OSUB_ | gc.TUINT8, + OSUB_ | gc.TINT16, + OSUB_ | gc.TUINT16, + OSUB_ | gc.TINT32, + OSUB_ | gc.TUINT32, + OSUB_ | gc.TPTR32, + OSUB_ | gc.TINT64, + OSUB_ | gc.TUINT64, + OSUB_ | gc.TPTR64: + a = s390x.ASUB + + case OSUB_ | gc.TFLOAT32: + a = s390x.AFSUBS + + case OSUB_ | gc.TFLOAT64: + a = s390x.AFSUB + + case OMINUS_ | gc.TINT8, + OMINUS_ | gc.TUINT8, + OMINUS_ | gc.TINT16, + OMINUS_ | gc.TUINT16, + OMINUS_ | gc.TINT32, + OMINUS_ | gc.TUINT32, + OMINUS_ | gc.TPTR32, + OMINUS_ | gc.TINT64, + OMINUS_ | gc.TUINT64, + OMINUS_ | gc.TPTR64: + a = s390x.ANEG + + case OAND_ | gc.TINT8, + OAND_ | gc.TUINT8, + OAND_ | gc.TINT16, + OAND_ | gc.TUINT16, + OAND_ | gc.TINT32, + OAND_ | gc.TUINT32, + OAND_ | gc.TPTR32, + OAND_ | gc.TINT64, + OAND_ | gc.TUINT64, + OAND_ | gc.TPTR64: + a = s390x.AAND + + case OOR_ | gc.TINT8, + OOR_ | gc.TUINT8, + OOR_ | gc.TINT16, + OOR_ | gc.TUINT16, + OOR_ | gc.TINT32, + OOR_ | gc.TUINT32, + OOR_ | gc.TPTR32, + OOR_ | gc.TINT64, + OOR_ | gc.TUINT64, + OOR_ | gc.TPTR64: + a = s390x.AOR + + case OXOR_ | gc.TINT8, + OXOR_ | gc.TUINT8, + OXOR_ | gc.TINT16, + OXOR_ | gc.TUINT16, + OXOR_ | gc.TINT32, + OXOR_ | gc.TUINT32, + OXOR_ | gc.TPTR32, + OXOR_ | gc.TINT64, + OXOR_ | gc.TUINT64, + OXOR_ | gc.TPTR64: + a = s390x.AXOR + + case OLSH_ | gc.TINT8, + OLSH_ | gc.TUINT8, + OLSH_ | gc.TINT16, + OLSH_ | gc.TUINT16, + OLSH_ | gc.TINT32, + OLSH_ | gc.TUINT32, + OLSH_ | gc.TPTR32, + OLSH_ | gc.TINT64, + OLSH_ | gc.TUINT64, + OLSH_ | gc.TPTR64: + a = s390x.ASLD + + case ORSH_ | gc.TUINT8, + ORSH_ | gc.TUINT16, + ORSH_ | gc.TUINT32, + ORSH_ | gc.TPTR32, + ORSH_ | gc.TUINT64, + ORSH_ | gc.TPTR64: + a = s390x.ASRD + + case ORSH_ | gc.TINT8, + ORSH_ | gc.TINT16, + ORSH_ | gc.TINT32, + ORSH_ | gc.TINT64: + a = s390x.ASRAD + + case OHMUL_ | gc.TINT64: + a = s390x.AMULHD + + case OHMUL_ | gc.TUINT64, + OHMUL_ | gc.TPTR64: + a = s390x.AMULHDU + + case OMUL_ | gc.TINT8, + OMUL_ | gc.TINT16, + OMUL_ | gc.TINT32, + OMUL_ | gc.TINT64: + a = s390x.AMULLD + + case OMUL_ | gc.TUINT8, + OMUL_ | gc.TUINT16, + OMUL_ | gc.TUINT32, + OMUL_ | gc.TPTR32, + // don't use word multiply, the high 32-bit are undefined. + OMUL_ | gc.TUINT64, + OMUL_ | gc.TPTR64: + // for 64-bit multiplies, signedness doesn't matter. + a = s390x.AMULLD + + case OMUL_ | gc.TFLOAT32: + a = s390x.AFMULS + + case OMUL_ | gc.TFLOAT64: + a = s390x.AFMUL + + case ODIV_ | gc.TINT8, + ODIV_ | gc.TINT16, + ODIV_ | gc.TINT32, + ODIV_ | gc.TINT64: + a = s390x.ADIVD + + case ODIV_ | gc.TUINT8, + ODIV_ | gc.TUINT16, + ODIV_ | gc.TUINT32, + ODIV_ | gc.TPTR32, + ODIV_ | gc.TUINT64, + ODIV_ | gc.TPTR64: + a = s390x.ADIVDU + + case ODIV_ | gc.TFLOAT32: + a = s390x.AFDIVS + + case ODIV_ | gc.TFLOAT64: + a = s390x.AFDIV + + case OSQRT_ | gc.TFLOAT64: + a = s390x.AFSQRT + + case OLROT_ | gc.TUINT32, + OLROT_ | gc.TPTR32, + OLROT_ | gc.TINT32: + a = s390x.ARLL + + case OLROT_ | gc.TUINT64, + OLROT_ | gc.TPTR64, + OLROT_ | gc.TINT64: + a = s390x.ARLLG + } + + return a +} + +const ( + ODynam = 1 << 0 + OAddable = 1 << 1 +) + +var clean [20]gc.Node + +var cleani int = 0 + +func sudoclean() { + if clean[cleani-1].Op != gc.OEMPTY { + gc.Regfree(&clean[cleani-1]) + } + if clean[cleani-2].Op != gc.OEMPTY { + gc.Regfree(&clean[cleani-2]) + } + cleani -= 2 +} + +/* + * generate code to compute address of n, + * a reference to a (perhaps nested) field inside + * an array or struct. + * return 0 on failure, 1 on success. + * on success, leaves usable address in a. + * + * caller is responsible for calling sudoclean + * after successful sudoaddable, + * to release the register used for a. + */ +func sudoaddable(as obj.As, n *gc.Node, a *obj.Addr) bool { + if n.Type == nil { + return false + } + + *a = obj.Addr{} + + switch n.Op { + case gc.OLITERAL: + if !gc.Isconst(n, gc.CTINT) { + return false + } + v := n.Int64() + switch as { + default: + return false + + // operations that can cope with a 32-bit immediate + // TODO(mundaym): logical operations can work on high bits + case s390x.AADD, + s390x.AADDC, + s390x.ASUB, + s390x.AMULLW, + s390x.AAND, + s390x.AOR, + s390x.AXOR, + s390x.ASLD, + s390x.ASLW, + s390x.ASRAW, + s390x.ASRAD, + s390x.ASRW, + s390x.ASRD, + s390x.AMOVB, + s390x.AMOVBZ, + s390x.AMOVH, + s390x.AMOVHZ, + s390x.AMOVW, + s390x.AMOVWZ, + s390x.AMOVD: + if int64(int32(v)) != v { + return false + } + + // for comparisons avoid immediates unless they can + // fit into a int8/uint8 + // this favours combined compare and branch instructions + case s390x.ACMP: + if int64(int8(v)) != v { + return false + } + case s390x.ACMPU: + if int64(uint8(v)) != v { + return false + } + } + + cleani += 2 + reg := &clean[cleani-1] + reg1 := &clean[cleani-2] + reg.Op = gc.OEMPTY + reg1.Op = gc.OEMPTY + gc.Naddr(a, n) + return true + + case gc.ODOT, + gc.ODOTPTR: + cleani += 2 + reg := &clean[cleani-1] + reg1 := &clean[cleani-2] + reg.Op = gc.OEMPTY + reg1.Op = gc.OEMPTY + var nn *gc.Node + var oary [10]int64 + o := gc.Dotoffset(n, oary[:], &nn) + if nn == nil { + sudoclean() + return false + } + + if nn.Addable && o == 1 && oary[0] >= 0 { + // directly addressable set of DOTs + n1 := *nn + + n1.Type = n.Type + n1.Xoffset += oary[0] + // check that the offset fits into a 12-bit displacement + if n1.Xoffset < 0 || n1.Xoffset >= (1<<12)-8 { + sudoclean() + return false + } + gc.Naddr(a, &n1) + return true + } + + gc.Regalloc(reg, gc.Types[gc.Tptr], nil) + n1 := *reg + n1.Op = gc.OINDREG + if oary[0] >= 0 { + gc.Agen(nn, reg) + n1.Xoffset = oary[0] + } else { + gc.Cgen(nn, reg) + gc.Cgen_checknil(reg) + n1.Xoffset = -(oary[0] + 1) + } + + for i := 1; i < o; i++ { + if oary[i] >= 0 { + gc.Fatalf("can't happen") + } + gins(s390x.AMOVD, &n1, reg) + gc.Cgen_checknil(reg) + n1.Xoffset = -(oary[i] + 1) + } + + a.Type = obj.TYPE_NONE + a.Index = 0 + // check that the offset fits into a 12-bit displacement + if n1.Xoffset < 0 || n1.Xoffset >= (1<<12)-8 { + tmp := n1 + tmp.Op = gc.OREGISTER + tmp.Type = gc.Types[gc.Tptr] + tmp.Xoffset = 0 + gc.Cgen_checknil(&tmp) + ginscon(s390x.AADD, n1.Xoffset, &tmp) + n1.Xoffset = 0 + } + gc.Naddr(a, &n1) + return true + } + + return false +} diff --git a/src/cmd/compile/internal/s390x/peep.go b/src/cmd/compile/internal/s390x/peep.go new file mode 100644 index 0000000000..cd6a8c5d8c --- /dev/null +++ b/src/cmd/compile/internal/s390x/peep.go @@ -0,0 +1,1664 @@ +// Derived from Inferno utils/6c/peep.c +// http://code.google.com/p/inferno-os/source/browse/utils/6c/peep.c +// +// Copyright © 1994-1999 Lucent Technologies Inc. All rights reserved. +// Portions Copyright © 1995-1997 C H Forsyth (forsyth@terzarima.net) +// Portions Copyright © 1997-1999 Vita Nuova Limited +// Portions Copyright © 2000-2007 Vita Nuova Holdings Limited (www.vitanuova.com) +// Portions Copyright © 2004,2006 Bruce Ellis +// Portions Copyright © 2005-2007 C H Forsyth (forsyth@terzarima.net) +// Revisions Copyright © 2000-2007 Lucent Technologies Inc. and others +// Portions Copyright © 2009 The Go Authors. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person obtaining a copy +// of this software and associated documentation files (the "Software"), to deal +// in the Software without restriction, including without limitation the rights +// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the Software is +// furnished to do so, subject to the following conditions: +// +// The above copyright notice and this permission notice shall be included in +// all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +// THE SOFTWARE. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj" + "cmd/internal/obj/s390x" + "fmt" +) + +type usage int + +const ( + _None usage = iota // no usage found + _Read // only read from + _ReadWriteSame // both read from and written to in a single operand + _Write // only written to + _ReadWriteDiff // both read from and written to in different operands +) + +var gactive uint32 + +func peep(firstp *obj.Prog) { + g := gc.Flowstart(firstp, nil) + if g == nil { + return + } + gactive = 0 + + run := func(name string, pass func(r *gc.Flow) int) int { + n := pass(g.Start) + if gc.Debug['P'] != 0 { + fmt.Println(name, ":", n) + } + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + gc.Dumpit(name, g.Start, 0) + } + return n + } + + for { + n := 0 + n += run("constant propagation", constantPropagation) + n += run("copy propagation", copyPropagation) + n += run("cast propagation", castPropagation) + n += run("remove load-hit-stores", removeLoadHitStores) + n += run("dead code elimination", deadCodeElimination) + if n == 0 { + break + } + } + run("fuse op moves", fuseOpMoves) + run("fuse clears", fuseClear) + run("load pipelining", loadPipelining) + run("fuse compare branch", fuseCompareBranch) + run("simplify ops", simplifyOps) + run("dead code elimination", deadCodeElimination) + + // TODO(mundaym): load/store multiple aren't currently handled by copyu + // so this pass must be last. + run("fuse multiple", fuseMultiple) + + gc.Flowend(g) +} + +func pushback(r0 *gc.Flow) { + var r *gc.Flow + + var b *gc.Flow + p0 := r0.Prog + for r = gc.Uniqp(r0); r != nil && gc.Uniqs(r) != nil; r = gc.Uniqp(r) { + p := r.Prog + if p.As != obj.ANOP { + if !(isReg(&p.From) || isConst(&p.From)) || !isReg(&p.To) { + break + } + if copyu(p, &p0.To, nil) != _None || copyu(p0, &p.To, nil) != _None { + break + } + } + + if p.As == obj.ACALL { + break + } + b = r + } + + if b == nil { + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("no pushback: %v\n", r0.Prog) + if r != nil { + fmt.Printf("\t%v [%v]\n", r.Prog, gc.Uniqs(r) != nil) + } + } + + return + } + + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("pushback\n") + for r := b; ; r = r.Link { + fmt.Printf("\t%v\n", r.Prog) + if r == r0 { + break + } + } + } + + t := *r0.Prog + for r = gc.Uniqp(r0); ; r = gc.Uniqp(r) { + p0 = r.Link.Prog + p := r.Prog + p0.As = p.As + p0.Lineno = p.Lineno + p0.From = p.From + p0.To = p.To + p0.From3 = p.From3 + p0.Reg = p.Reg + p0.RegTo2 = p.RegTo2 + if r == b { + break + } + } + + p0 = r.Prog + p0.As = t.As + p0.Lineno = t.Lineno + p0.From = t.From + p0.To = t.To + p0.From3 = t.From3 + p0.Reg = t.Reg + p0.RegTo2 = t.RegTo2 + + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("\tafter\n") + for r := b; ; r = r.Link { + fmt.Printf("\t%v\n", r.Prog) + if r == r0 { + break + } + } + } +} + +// excise replaces the given instruction with a NOP and clears +// its operands. +func excise(r *gc.Flow) { + p := r.Prog + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("%v ===delete===\n", p) + } + obj.Nopout(p) + gc.Ostats.Ndelmov++ +} + +// isZero returns true if a is either the constant 0 or the register +// REGZERO. +func isZero(a *obj.Addr) bool { + if a.Type == obj.TYPE_CONST && a.Offset == 0 { + return true + } + if a.Type == obj.TYPE_REG && a.Reg == s390x.REGZERO { + return true + } + return false +} + +// isReg returns true if a is a general purpose or floating point +// register (GPR or FPR). +// +// TODO(mundaym): currently this excludes REGZER0, but not other +// special registers. +func isReg(a *obj.Addr) bool { + return a.Type == obj.TYPE_REG && + s390x.REG_R0 <= a.Reg && + a.Reg <= s390x.REG_F15 && + a.Reg != s390x.REGZERO +} + +// isGPR returns true if a is a general purpose register (GPR). +// REGZERO is treated as a GPR. +func isGPR(a *obj.Addr) bool { + return a.Type == obj.TYPE_REG && + s390x.REG_R0 <= a.Reg && + a.Reg <= s390x.REG_R15 +} + +// isFPR returns true if a is a floating point register (FPR). +func isFPR(a *obj.Addr) bool { + return a.Type == obj.TYPE_REG && + s390x.REG_F0 <= a.Reg && + a.Reg <= s390x.REG_F15 +} + +// isConst returns true if a refers to a constant (integer or +// floating point, not string currently). +func isConst(a *obj.Addr) bool { + return a.Type == obj.TYPE_CONST || a.Type == obj.TYPE_FCONST +} + +// isBDMem returns true if a refers to a memory location addressable by a +// base register (B) and a displacement (D), such as: +// x+8(R1) +// and +// 0(R10) +// It returns false if the address contains an index register (X) such as: +// 16(R1)(R2*1) +// or if a relocation is required. +func isBDMem(a *obj.Addr) bool { + return a.Type == obj.TYPE_MEM && + a.Index == 0 && + (a.Name == obj.NAME_NONE || a.Name == obj.NAME_AUTO || a.Name == obj.NAME_PARAM) +} + +// the idea is to substitute +// one register for another +// from one MOV to another +// MOV a, R1 +// ADD b, R1 / no use of R2 +// MOV R1, R2 +// would be converted to +// MOV a, R2 +// ADD b, R2 +// MOV R2, R1 +// hopefully, then the former or latter MOV +// will be eliminated by copy propagation. +// +// r0 (the argument, not the register) is the MOV at the end of the +// above sequences. subprop returns true if it modified any instructions. +func subprop(r0 *gc.Flow) bool { + p := r0.Prog + v1 := &p.From + if !isReg(v1) { + return false + } + v2 := &p.To + if !isReg(v2) { + return false + } + cast := false + switch p.As { + case s390x.AMOVW, s390x.AMOVWZ, + s390x.AMOVH, s390x.AMOVHZ, + s390x.AMOVB, s390x.AMOVBZ: + cast = true + } + for r := gc.Uniqp(r0); r != nil; r = gc.Uniqp(r) { + if gc.Uniqs(r) == nil { + break + } + p = r.Prog + switch copyu(p, v1, nil) { + case _Write, _ReadWriteDiff: + if p.As == obj.ACALL { + return false + } + if (!cast || p.As == r0.Prog.As) && p.To.Type == v1.Type && p.To.Reg == v1.Reg { + copysub(&p.To, v1, v2) + for r = gc.Uniqs(r); r != r0; r = gc.Uniqs(r) { + p = r.Prog + copysub(&p.From, v1, v2) + copysub1(p, v1, v2) + copysub(&p.To, v1, v2) + } + v1.Reg, v2.Reg = v2.Reg, v1.Reg + return true + } + if cast { + return false + } + case _ReadWriteSame: + if cast { + return false + } + } + if copyu(p, v2, nil) != _None { + return false + } + } + return false +} + +// The idea is to remove redundant copies. +// v1->v2 F=0 +// (use v2 s/v2/v1/)* +// set v1 F=1 +// use v2 return fail (v1->v2 move must remain) +// ----------------- +// v1->v2 F=0 +// (use v2 s/v2/v1/)* +// set v1 F=1 +// set v2 return success (caller can remove v1->v2 move) +func copyprop(r *gc.Flow) bool { + p := r.Prog + + canSub := false + switch p.As { + case s390x.AFMOVS, s390x.AFMOVD, s390x.AMOVD: + canSub = true + default: + for rr := gc.Uniqp(r); rr != nil; rr = gc.Uniqp(rr) { + if gc.Uniqs(rr) == nil { + break + } + switch copyu(rr.Prog, &p.From, nil) { + case _Read, _None: + continue + } + // write + if rr.Prog.As == p.As { + canSub = true + } + break + } + } + if !canSub { + return false + } + if copyas(&p.From, &p.To) { + return true + } + + gactive++ + return copy1(&p.From, &p.To, r.S1, 0) +} + +// copy1 replaces uses of v2 with v1 starting at r and returns true if +// all uses were rewritten. +func copy1(v1 *obj.Addr, v2 *obj.Addr, r *gc.Flow, f int) bool { + if uint32(r.Active) == gactive { + return true + } + r.Active = int32(gactive) + for ; r != nil; r = r.S1 { + p := r.Prog + if f == 0 && gc.Uniqp(r) == nil { + // Multiple predecessors; conservatively + // assume v1 was set on other path + f = 1 + } + t := copyu(p, v2, nil) + switch t { + case _ReadWriteSame: + return false + case _Write: + return true + case _Read, _ReadWriteDiff: + if f != 0 { + return false + } + if copyu(p, v2, v1) != 0 { + return false + } + if t == _ReadWriteDiff { + return true + } + } + if f == 0 { + switch copyu(p, v1, nil) { + case _ReadWriteSame, _ReadWriteDiff, _Write: + f = 1 + } + } + if r.S2 != nil { + if !copy1(v1, v2, r.S2, f) { + return false + } + } + } + return true +} + +// If s==nil, copyu returns the set/use of v in p; otherwise, it +// modifies p to replace reads of v with reads of s and returns 0 for +// success or non-zero for failure. +// +// If s==nil, copy returns one of the following values: +// _Read if v only used +// _ReadWriteSame if v is set and used in one address (read-alter-rewrite; +// can't substitute) +// _Write if v is only set +// _ReadWriteDiff if v is set in one address and used in another (so addresses +// can be rewritten independently) +// _None otherwise (not touched) +func copyu(p *obj.Prog, v *obj.Addr, s *obj.Addr) usage { + if p.From3Type() != obj.TYPE_NONE && p.From3Type() != obj.TYPE_CONST { + // Currently we never generate a From3 with anything other than a constant in it. + fmt.Printf("copyu: From3 (%v) not implemented\n", gc.Ctxt.Dconv(p.From3)) + } + + switch p.As { + default: + fmt.Printf("copyu: can't find %v\n", obj.Aconv(p.As)) + return _ReadWriteSame + + case // read p.From, write p.To + s390x.AMOVH, + s390x.AMOVHZ, + s390x.AMOVB, + s390x.AMOVBZ, + s390x.AMOVW, + s390x.AMOVWZ, + s390x.AMOVD, + s390x.ANEG, + s390x.AADDME, + s390x.AADDZE, + s390x.ASUBME, + s390x.ASUBZE, + s390x.AFMOVS, + s390x.AFMOVD, + s390x.ALEDBR, + s390x.AFNEG, + s390x.ALDEBR, + s390x.ACLFEBR, + s390x.ACLGEBR, + s390x.ACLFDBR, + s390x.ACLGDBR, + s390x.ACFEBRA, + s390x.ACGEBRA, + s390x.ACFDBRA, + s390x.ACGDBRA, + s390x.ACELFBR, + s390x.ACELGBR, + s390x.ACDLFBR, + s390x.ACDLGBR, + s390x.ACEFBRA, + s390x.ACEGBRA, + s390x.ACDFBRA, + s390x.ACDGBRA, + s390x.AFSQRT: + + if s != nil { + copysub(&p.From, v, s) + + // Update only indirect uses of v in p.To + if !copyas(&p.To, v) { + copysub(&p.To, v, s) + } + return _None + } + + if copyas(&p.To, v) { + // Fix up implicit from + if p.From.Type == obj.TYPE_NONE { + p.From = p.To + } + if copyau(&p.From, v) { + return _ReadWriteDiff + } + return _Write + } + + if copyau(&p.From, v) { + return _Read + } + if copyau(&p.To, v) { + // p.To only indirectly uses v + return _Read + } + + return _None + + // read p.From, read p.Reg, write p.To + case s390x.AADD, + s390x.AADDC, + s390x.AADDE, + s390x.ASUB, + s390x.ASLW, + s390x.ASRW, + s390x.ASRAW, + s390x.ASLD, + s390x.ASRD, + s390x.ASRAD, + s390x.ARLL, + s390x.ARLLG, + s390x.AOR, + s390x.AORN, + s390x.AAND, + s390x.AANDN, + s390x.ANAND, + s390x.ANOR, + s390x.AXOR, + s390x.AMULLW, + s390x.AMULLD, + s390x.AMULHD, + s390x.AMULHDU, + s390x.ADIVW, + s390x.ADIVD, + s390x.ADIVWU, + s390x.ADIVDU, + s390x.AFADDS, + s390x.AFADD, + s390x.AFSUBS, + s390x.AFSUB, + s390x.AFMULS, + s390x.AFMUL, + s390x.AFDIVS, + s390x.AFDIV: + if s != nil { + copysub(&p.From, v, s) + copysub1(p, v, s) + + // Update only indirect uses of v in p.To + if !copyas(&p.To, v) { + copysub(&p.To, v, s) + } + } + + if copyas(&p.To, v) { + if p.Reg == 0 { + p.Reg = p.To.Reg + } + if copyau(&p.From, v) || copyau1(p, v) { + return _ReadWriteDiff + } + return _Write + } + + if copyau(&p.From, v) { + return _Read + } + if copyau1(p, v) { + return _Read + } + if copyau(&p.To, v) { + return _Read + } + return _None + + case s390x.ABEQ, + s390x.ABGT, + s390x.ABGE, + s390x.ABLT, + s390x.ABLE, + s390x.ABNE, + s390x.ABVC, + s390x.ABVS: + return _None + + case obj.ACHECKNIL, // read p.From + s390x.ACMP, // read p.From, read p.To + s390x.ACMPU, + s390x.ACMPW, + s390x.ACMPWU, + s390x.AFCMPO, + s390x.AFCMPU, + s390x.ACEBR, + s390x.AMVC, + s390x.ACLC, + s390x.AXC, + s390x.AOC, + s390x.ANC: + if s != nil { + copysub(&p.From, v, s) + copysub(&p.To, v, s) + return _None + } + + if copyau(&p.From, v) { + return _Read + } + if copyau(&p.To, v) { + return _Read + } + return _None + + case s390x.ACMPBNE, s390x.ACMPBEQ, + s390x.ACMPBLT, s390x.ACMPBLE, + s390x.ACMPBGT, s390x.ACMPBGE, + s390x.ACMPUBNE, s390x.ACMPUBEQ, + s390x.ACMPUBLT, s390x.ACMPUBLE, + s390x.ACMPUBGT, s390x.ACMPUBGE: + if s != nil { + copysub(&p.From, v, s) + copysub1(p, v, s) + return _None + } + if copyau(&p.From, v) { + return _Read + } + if copyau1(p, v) { + return _Read + } + return _None + + case s390x.ACLEAR: + if s != nil { + copysub(&p.To, v, s) + return _None + } + if copyau(&p.To, v) { + return _Read + } + return _None + + // go never generates a branch to a GPR + // read p.To + case s390x.ABR: + if s != nil { + copysub(&p.To, v, s) + return _None + } + + if copyau(&p.To, v) { + return _Read + } + return _None + + case obj.ARET, obj.AUNDEF: + if s != nil { + return _None + } + + // All registers die at this point, so claim + // everything is set (and not used). + return _Write + + case s390x.ABL: + if v.Type == obj.TYPE_REG { + if s390x.REGARG != -1 && v.Reg == s390x.REGARG { + return _ReadWriteSame + } + if p.From.Type == obj.TYPE_REG && p.From.Reg == v.Reg { + return _ReadWriteSame + } + if v.Reg == s390x.REGZERO { + // Deliberately inserted nops set R0. + return _ReadWriteSame + } + if v.Reg == s390x.REGCTXT { + // Context register for closures. + // TODO(mundaym): not sure if we need to exclude this. + return _ReadWriteSame + } + } + if s != nil { + copysub(&p.To, v, s) + return _None + } + if copyau(&p.To, v) { + return _ReadWriteDiff + } + return _Write + + case obj.ATEXT: + if v.Type == obj.TYPE_REG { + if v.Reg == s390x.REGARG { + return _Write + } + } + return _None + + case obj.APCDATA, + obj.AFUNCDATA, + obj.AVARDEF, + obj.AVARKILL, + obj.AVARLIVE, + obj.AUSEFIELD, + obj.ANOP: + return _None + } +} + +// copyas returns 1 if a and v address the same register. +// +// If a is the from operand, this means this operation reads the +// register in v. If a is the to operand, this means this operation +// writes the register in v. +func copyas(a *obj.Addr, v *obj.Addr) bool { + if isReg(v) { + if a.Type == v.Type { + if a.Reg == v.Reg { + return true + } + } + } + return false +} + +// copyau returns 1 if a either directly or indirectly addresses the +// same register as v. +// +// If a is the from operand, this means this operation reads the +// register in v. If a is the to operand, this means the operation +// either reads or writes the register in v (if !copyas(a, v), then +// the operation reads the register in v). +func copyau(a *obj.Addr, v *obj.Addr) bool { + if copyas(a, v) { + return true + } + if v.Type == obj.TYPE_REG { + if a.Type == obj.TYPE_MEM || (a.Type == obj.TYPE_ADDR && a.Reg != 0) { + if v.Reg == a.Reg { + return true + } + } + } + return false +} + +// copyau1 returns 1 if p.Reg references the same register as v and v +// is a direct reference. +func copyau1(p *obj.Prog, v *obj.Addr) bool { + if isReg(v) && v.Reg != 0 { + if p.Reg == v.Reg { + return true + } + } + return false +} + +// copysub replaces v.Reg with s.Reg if a.Reg and v.Reg are direct +// references to the same register. +func copysub(a, v, s *obj.Addr) { + if copyau(a, v) { + a.Reg = s.Reg + } +} + +// copysub1 replaces p.Reg with s.Reg if p.Reg and v.Reg are direct +// references to the same register. +func copysub1(p *obj.Prog, v, s *obj.Addr) { + if copyau1(p, v) { + p.Reg = s.Reg + } +} + +func sameaddr(a *obj.Addr, v *obj.Addr) bool { + if a.Type != v.Type { + return false + } + if isReg(v) && a.Reg == v.Reg { + return true + } + if v.Type == obj.NAME_AUTO || v.Type == obj.NAME_PARAM { + // TODO(mundaym): is the offset enough here? Node? + if v.Offset == a.Offset { + return true + } + } + return false +} + +func smallindir(a *obj.Addr, reg *obj.Addr) bool { + return reg.Type == obj.TYPE_REG && + a.Type == obj.TYPE_MEM && + a.Reg == reg.Reg && + 0 <= a.Offset && a.Offset < 4096 +} + +func stackaddr(a *obj.Addr) bool { + // TODO(mundaym): the name implies this should check + // for TYPE_ADDR with a base register REGSP. + return a.Type == obj.TYPE_REG && a.Reg == s390x.REGSP +} + +// isMove returns true if p is a move. Moves may imply +// sign/zero extension. +func isMove(p *obj.Prog) bool { + switch p.As { + case s390x.AMOVD, + s390x.AMOVW, s390x.AMOVWZ, + s390x.AMOVH, s390x.AMOVHZ, + s390x.AMOVB, s390x.AMOVBZ, + s390x.AFMOVD, s390x.AFMOVS: + return true + } + return false +} + +// isLoad returns true if p is a move from memory to a register. +func isLoad(p *obj.Prog) bool { + if !isMove(p) { + return false + } + if !(isGPR(&p.To) || isFPR(&p.To)) { + return false + } + if p.From.Type != obj.TYPE_MEM { + return false + } + return true +} + +// isStore returns true if p is a move from a register to memory. +func isStore(p *obj.Prog) bool { + if !isMove(p) { + return false + } + if !(isGPR(&p.From) || isFPR(&p.From) || isConst(&p.From)) { + return false + } + if p.To.Type != obj.TYPE_MEM { + return false + } + return true +} + +// sameStackMem returns true if a and b are both memory operands +// and address the same location which must reside on the stack. +func sameStackMem(a, b *obj.Addr) bool { + if a.Type != obj.TYPE_MEM || + b.Type != obj.TYPE_MEM || + a.Name != b.Name || + a.Sym != b.Sym || + a.Node != b.Node || + a.Reg != b.Reg || + a.Index != b.Index || + a.Offset != b.Offset { + return false + } + switch a.Name { + case obj.NAME_NONE: + return a.Reg == s390x.REGSP + case obj.NAME_PARAM, obj.NAME_AUTO: + // params and autos are always on the stack + return true + } + return false +} + +// removeLoadHitStores trys to remove loads that take place +// immediately after a store to the same location. Returns +// true if load-hit-stores were removed. +// +// For example: +// MOVD R1, 0(R15) +// MOVD 0(R15), R2 +// Would become: +// MOVD R1, 0(R15) +// MOVD R1, R2 +func removeLoadHitStores(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + if !isStore(p) { + continue + } + for rr := gc.Uniqs(r); rr != nil; rr = gc.Uniqs(rr) { + pp := rr.Prog + if gc.Uniqp(rr) == nil { + break + } + if pp.As == obj.ANOP { + continue + } + if isLoad(pp) && sameStackMem(&p.To, &pp.From) { + if size(p.As) >= size(pp.As) && isGPR(&p.From) == isGPR(&pp.To) { + pp.From = p.From + } + } + if !isMove(pp) || isStore(pp) { + break + } + if copyau(&p.From, &pp.To) { + break + } + } + } + return n +} + +// size returns the width of the given move. +func size(as obj.As) int { + switch as { + case s390x.AMOVD, s390x.AFMOVD: + return 8 + case s390x.AMOVW, s390x.AMOVWZ, s390x.AFMOVS: + return 4 + case s390x.AMOVH, s390x.AMOVHZ: + return 2 + case s390x.AMOVB, s390x.AMOVBZ: + return 1 + } + return -1 +} + +// castPropagation tries to eliminate unecessary casts. +// +// For example: +// MOVHZ R1, R2 // uint16 +// MOVB R2, 0(R15) // int8 +// Can be simplified to: +// MOVB R1, 0(R15) +func castPropagation(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + if !isMove(p) || !isGPR(&p.To) { + continue + } + + // r is a move with a destination register + var move *gc.Flow + for rr := gc.Uniqs(r); rr != nil; rr = gc.Uniqs(rr) { + if gc.Uniqp(rr) == nil { + // branch target: leave alone + break + } + pp := rr.Prog + if isMove(pp) && copyas(&pp.From, &p.To) { + if pp.To.Type == obj.TYPE_MEM { + if p.From.Type == obj.TYPE_MEM || + p.From.Type == obj.TYPE_ADDR { + break + } + if p.From.Type == obj.TYPE_CONST && + int64(int16(p.From.Offset)) != p.From.Offset { + break + } + } + move = rr + break + } + if pp.As == obj.ANOP { + continue + } + break + } + if move == nil { + continue + } + + // we have a move that reads from our destination reg, check if any future + // instructions also read from the reg + mp := move.Prog + if !copyas(&mp.From, &mp.To) { + safe := false + for rr := gc.Uniqs(move); rr != nil; rr = gc.Uniqs(rr) { + if gc.Uniqp(rr) == nil { + break + } + switch copyu(rr.Prog, &p.To, nil) { + case _None: + continue + case _Write: + safe = true + } + break + } + if !safe { + continue + } + } + + // at this point we have something like: + // MOV* const/mem/reg, reg + // MOV* reg, reg/mem + // now check if this is a cast that cannot be forward propagated + execute := false + if p.As == mp.As || isZero(&p.From) || size(p.As) == size(mp.As) { + execute = true + } else if isGPR(&p.From) && size(p.As) >= size(mp.As) { + execute = true + } + + if execute { + mp.From = p.From + excise(r) + n++ + } + } + return n +} + +// fuseClear merges memory clear operations. +// +// Looks for this pattern (sequence of clears): +// MOVD R0, n(R15) +// MOVD R0, n+8(R15) +// MOVD R0, n+16(R15) +// Replaces with: +// CLEAR $24, n(R15) +func fuseClear(r *gc.Flow) int { + n := 0 + var align int64 + var clear *obj.Prog + for ; r != nil; r = r.Link { + // If there is a branch into the instruction stream then + // we can't fuse into previous instructions. + if gc.Uniqp(r) == nil { + clear = nil + } + + p := r.Prog + if p.As == obj.ANOP { + continue + } + if p.As == s390x.AXC { + if p.From.Reg == p.To.Reg && p.From.Offset == p.To.Offset { + // TODO(mundaym): merge clears? + p.As = s390x.ACLEAR + p.From.Offset = p.From3.Offset + p.From3 = nil + p.From.Type = obj.TYPE_CONST + p.From.Reg = 0 + clear = p + } else { + clear = nil + } + continue + } + + // Is our source a constant zero? + if !isZero(&p.From) { + clear = nil + continue + } + + // Are we moving to memory? + if p.To.Type != obj.TYPE_MEM || + p.To.Index != 0 || + p.To.Offset >= 4096 || + !(p.To.Name == obj.NAME_NONE || p.To.Name == obj.NAME_AUTO || p.To.Name == obj.NAME_PARAM) { + clear = nil + continue + } + + size := int64(0) + switch p.As { + default: + clear = nil + continue + case s390x.AMOVB, s390x.AMOVBZ: + size = 1 + case s390x.AMOVH, s390x.AMOVHZ: + size = 2 + case s390x.AMOVW, s390x.AMOVWZ: + size = 4 + case s390x.AMOVD: + size = 8 + } + + // doubleword aligned clears should be kept doubleword + // aligned + if (size == 8 && align != 8) || (size != 8 && align == 8) { + clear = nil + } + + if clear != nil && + clear.To.Reg == p.To.Reg && + clear.To.Name == p.To.Name && + clear.To.Node == p.To.Node && + clear.To.Sym == p.To.Sym { + + min := clear.To.Offset + max := clear.To.Offset + clear.From.Offset + + // previous clear is already clearing this region + if min <= p.To.Offset && max >= p.To.Offset+size { + excise(r) + n++ + continue + } + + // merge forwards + if max == p.To.Offset { + clear.From.Offset += size + excise(r) + n++ + continue + } + + // merge backwards + if min-size == p.To.Offset { + clear.From.Offset += size + clear.To.Offset -= size + excise(r) + n++ + continue + } + } + + // transform into clear + p.From.Type = obj.TYPE_CONST + p.From.Offset = size + p.From.Reg = 0 + p.As = s390x.ACLEAR + clear = p + align = size + } + return n +} + +// fuseMultiple merges memory loads and stores into load multiple and +// store multiple operations. +// +// Looks for this pattern (sequence of loads or stores): +// MOVD R1, 0(R15) +// MOVD R2, 8(R15) +// MOVD R3, 16(R15) +// Replaces with: +// STMG R1, R3, 0(R15) +func fuseMultiple(r *gc.Flow) int { + n := 0 + var fused *obj.Prog + for ; r != nil; r = r.Link { + // If there is a branch into the instruction stream then + // we can't fuse into previous instructions. + if gc.Uniqp(r) == nil { + fused = nil + } + + p := r.Prog + + isStore := isGPR(&p.From) && isBDMem(&p.To) + isLoad := isGPR(&p.To) && isBDMem(&p.From) + + // are we a candidate? + size := int64(0) + switch p.As { + default: + fused = nil + continue + case obj.ANOP: + // skip over nops + continue + case s390x.AMOVW, s390x.AMOVWZ: + size = 4 + // TODO(mundaym): 32-bit load multiple is currently not supported + // as it requires sign/zero extension. + if !isStore { + fused = nil + continue + } + case s390x.AMOVD: + size = 8 + if !isLoad && !isStore { + fused = nil + continue + } + } + + // If we merge two loads/stores with different source/destination Nodes + // then we will lose a reference the second Node which means that the + // compiler might mark the Node as unused and free its slot on the stack. + // TODO(mundaym): allow this by adding a dummy reference to the Node. + if fused == nil || + fused.From.Node != p.From.Node || + fused.From.Type != p.From.Type || + fused.To.Node != p.To.Node || + fused.To.Type != p.To.Type { + fused = p + continue + } + + // check two addresses + ca := func(a, b *obj.Addr, offset int64) bool { + return a.Reg == b.Reg && a.Offset+offset == b.Offset && + a.Sym == b.Sym && a.Name == b.Name + } + + switch fused.As { + default: + fused = p + case s390x.AMOVW, s390x.AMOVWZ: + if size == 4 && fused.From.Reg+1 == p.From.Reg && ca(&fused.To, &p.To, 4) { + fused.As = s390x.ASTMY + fused.Reg = p.From.Reg + excise(r) + n++ + } else { + fused = p + } + case s390x.AMOVD: + if size == 8 && fused.From.Reg+1 == p.From.Reg && ca(&fused.To, &p.To, 8) { + fused.As = s390x.ASTMG + fused.Reg = p.From.Reg + excise(r) + n++ + } else if size == 8 && fused.To.Reg+1 == p.To.Reg && ca(&fused.From, &p.From, 8) { + fused.As = s390x.ALMG + fused.Reg = fused.To.Reg + fused.To.Reg = p.To.Reg + excise(r) + n++ + } else { + fused = p + } + case s390x.ASTMG, s390x.ASTMY: + if (fused.As == s390x.ASTMY && size != 4) || + (fused.As == s390x.ASTMG && size != 8) { + fused = p + continue + } + offset := size * int64(fused.Reg-fused.From.Reg+1) + if fused.Reg+1 == p.From.Reg && ca(&fused.To, &p.To, offset) { + fused.Reg = p.From.Reg + excise(r) + n++ + } else { + fused = p + } + case s390x.ALMG: + offset := 8 * int64(fused.To.Reg-fused.Reg+1) + if size == 8 && fused.To.Reg+1 == p.To.Reg && ca(&fused.From, &p.From, offset) { + fused.To.Reg = p.To.Reg + excise(r) + n++ + } else { + fused = p + } + } + } + return n +} + +// simplifyOps looks for side-effect free ops that can be removed or +// replaced with moves. +// +// For example: +// XOR $0, R1 => NOP +// ADD $0, R1, R2 => MOVD R1, R2 +func simplifyOps(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + + // if the target is R0 then this is a required NOP + if isGPR(&p.To) && p.To.Reg == s390x.REGZERO { + continue + } + + switch p.As { + case s390x.AADD, s390x.ASUB, + s390x.AOR, s390x.AXOR, + s390x.ASLW, s390x.ASRW, s390x.ASRAW, + s390x.ASLD, s390x.ASRD, s390x.ASRAD, + s390x.ARLL, s390x.ARLLG: + if isZero(&p.From) && isGPR(&p.To) { + if p.Reg == 0 || p.Reg == p.To.Reg { + excise(r) + n++ + } else { + p.As = s390x.AMOVD + p.From.Type = obj.TYPE_REG + p.From.Reg = p.Reg + p.Reg = 0 + } + } + case s390x.AMULLW, s390x.AAND: + if isZero(&p.From) && isGPR(&p.To) { + p.As = s390x.AMOVD + p.From.Type = obj.TYPE_REG + p.From.Reg = s390x.REGZERO + p.Reg = 0 + } + } + } + return n +} + +// fuseOpMoves looks for moves following 2-operand operations and trys to merge them into +// a 3-operand operation. +// +// For example: +// ADD R1, R2 +// MOVD R2, R3 +// might become +// ADD R1, R2, R3 +func fuseOpMoves(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + switch p.As { + case s390x.AADD: + case s390x.ASUB: + if isConst(&p.From) && int64(int16(p.From.Offset)) != p.From.Offset { + continue + } + case s390x.ASLW, + s390x.ASRW, + s390x.ASRAW, + s390x.ASLD, + s390x.ASRD, + s390x.ASRAD, + s390x.ARLL, + s390x.ARLLG: + // ok - p.From will be a reg or a constant + case s390x.AOR, + s390x.AORN, + s390x.AAND, + s390x.AANDN, + s390x.ANAND, + s390x.ANOR, + s390x.AXOR, + s390x.AMULLW, + s390x.AMULLD: + if isConst(&p.From) { + // these instructions can either use 3 register form + // or have an immediate but not both + continue + } + default: + continue + } + + if p.Reg != 0 && p.Reg != p.To.Reg { + continue + } + + var move *gc.Flow + rr := gc.Uniqs(r) + for { + if rr == nil || gc.Uniqp(rr) == nil || rr == r { + break + } + pp := rr.Prog + switch copyu(pp, &p.To, nil) { + case _None: + rr = gc.Uniqs(rr) + continue + case _Read: + if move == nil && pp.As == s390x.AMOVD && isGPR(&pp.From) && isGPR(&pp.To) { + move = rr + rr = gc.Uniqs(rr) + continue + } + case _Write: + if move == nil { + // dead code + excise(r) + n++ + } else { + for prev := gc.Uniqp(move); prev != r; prev = gc.Uniqp(prev) { + if copyu(prev.Prog, &move.Prog.To, nil) != 0 { + move = nil + break + } + } + if move == nil { + break + } + p.Reg, p.To.Reg = p.To.Reg, move.Prog.To.Reg + excise(move) + n++ + + // clean up + if p.From.Reg == p.To.Reg && isCommutative(p.As) { + p.From.Reg, p.Reg = p.Reg, 0 + } + if p.To.Reg == p.Reg { + p.Reg = 0 + } + // we could try again if p has become a 2-operand op + // but in testing nothing extra was extracted + } + } + break + } + } + return n +} + +// isCommutative returns true if the order of input operands +// does not affect the result. For example: +// x + y == y + x so ADD is commutative +// x ^ y == y ^ x so XOR is commutative +func isCommutative(as obj.As) bool { + switch as { + case s390x.AADD, + s390x.AOR, + s390x.AAND, + s390x.AXOR, + s390x.AMULLW, + s390x.AMULLD: + return true + } + return false +} + +// applyCast applies the cast implied by the given move +// instruction to v and returns the result. +func applyCast(cast obj.As, v int64) int64 { + switch cast { + case s390x.AMOVWZ: + return int64(uint32(v)) + case s390x.AMOVHZ: + return int64(uint16(v)) + case s390x.AMOVBZ: + return int64(uint8(v)) + case s390x.AMOVW: + return int64(int32(v)) + case s390x.AMOVH: + return int64(int16(v)) + case s390x.AMOVB: + return int64(int8(v)) + } + return v +} + +// constantPropagation removes redundant constant copies. +func constantPropagation(r *gc.Flow) int { + n := 0 + // find MOV $con,R followed by + // another MOV $con,R without + // setting R in the interim + for ; r != nil; r = r.Link { + p := r.Prog + if isMove(p) { + if !isReg(&p.To) { + continue + } + if !isConst(&p.From) { + continue + } + } else { + continue + } + + rr := r + for { + rr = gc.Uniqs(rr) + if rr == nil || rr == r { + break + } + if gc.Uniqp(rr) == nil { + break + } + + pp := rr.Prog + t := copyu(pp, &p.To, nil) + switch t { + case _None: + continue + case _Read: + if !isGPR(&pp.From) || !isMove(pp) { + continue + } + if p.From.Type == obj.TYPE_CONST { + v := applyCast(p.As, p.From.Offset) + if isGPR(&pp.To) { + if int64(int32(v)) == v || ((v>>32)<<32) == v { + pp.From.Reg = 0 + pp.From.Offset = v + pp.From.Type = obj.TYPE_CONST + n++ + } + } else if int64(int16(v)) == v { + pp.From.Reg = 0 + pp.From.Offset = v + pp.From.Type = obj.TYPE_CONST + n++ + } + } + continue + case _Write: + if p.As != pp.As || p.From.Type != pp.From.Type { + break + } + if p.From.Type == obj.TYPE_CONST && p.From.Offset == pp.From.Offset { + excise(rr) + n++ + continue + } else if p.From.Type == obj.TYPE_FCONST { + if p.From.Val.(float64) == pp.From.Val.(float64) { + excise(rr) + n++ + continue + } + } + } + break + } + } + return n +} + +// copyPropagation tries to eliminate register-to-register moves. +func copyPropagation(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + if isMove(p) && isReg(&p.To) { + // Convert uses to $0 to uses of R0 and + // propagate R0 + if isGPR(&p.To) && isZero(&p.From) { + p.From.Type = obj.TYPE_REG + p.From.Reg = s390x.REGZERO + } + + // Try to eliminate reg->reg moves + if isGPR(&p.From) || isFPR(&p.From) { + if copyprop(r) || (subprop(r) && copyprop(r)) { + excise(r) + n++ + } + } + } + } + return n +} + +// loadPipelining pushes any load from memory as early as possible. +func loadPipelining(r *gc.Flow) int { + for ; r != nil; r = r.Link { + p := r.Prog + if isLoad(p) { + pushback(r) + } + } + return 0 +} + +// fuseCompareBranch finds comparisons followed by a branch and converts +// them into a compare-and-branch instruction (which avoid setting the +// condition code). +func fuseCompareBranch(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + r1 := gc.Uniqs(r) + if r1 == nil { + continue + } + p1 := r1.Prog + + var ins obj.As + switch p.As { + case s390x.ACMP: + switch p1.As { + case s390x.ABCL, s390x.ABC: + continue + case s390x.ABEQ: + ins = s390x.ACMPBEQ + case s390x.ABGE: + ins = s390x.ACMPBGE + case s390x.ABGT: + ins = s390x.ACMPBGT + case s390x.ABLE: + ins = s390x.ACMPBLE + case s390x.ABLT: + ins = s390x.ACMPBLT + case s390x.ABNE: + ins = s390x.ACMPBNE + default: + continue + } + + case s390x.ACMPU: + switch p1.As { + case s390x.ABCL, s390x.ABC: + continue + case s390x.ABEQ: + ins = s390x.ACMPUBEQ + case s390x.ABGE: + ins = s390x.ACMPUBGE + case s390x.ABGT: + ins = s390x.ACMPUBGT + case s390x.ABLE: + ins = s390x.ACMPUBLE + case s390x.ABLT: + ins = s390x.ACMPUBLT + case s390x.ABNE: + ins = s390x.ACMPUBNE + default: + continue + } + + case s390x.ACMPW, s390x.ACMPWU: + continue + + default: + continue + } + + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("cnb %v; %v ", p, p1) + } + + if p1.To.Sym != nil { + continue + } + + if p.To.Type == obj.TYPE_REG { + p1.As = ins + p1.From = p.From + p1.Reg = p.To.Reg + p1.From3 = nil + } else if p.To.Type == obj.TYPE_CONST { + switch p.As { + case s390x.ACMP, s390x.ACMPW: + if (p.To.Offset < -(1 << 7)) || (p.To.Offset >= ((1 << 7) - 1)) { + continue + } + case s390x.ACMPU, s390x.ACMPWU: + if p.To.Offset >= (1 << 8) { + continue + } + default: + } + p1.As = ins + p1.From = p.From + p1.Reg = 0 + p1.From3 = new(obj.Addr) + *(p1.From3) = p.To + } else { + continue + } + + if gc.Debug['P'] != 0 && gc.Debug['v'] != 0 { + fmt.Printf("%v\n", p1) + } + excise(r) + n++ + } + return n +} + +// deadCodeElimination removes writes to registers which are written +// to again before they are next read. +func deadCodeElimination(r *gc.Flow) int { + n := 0 + for ; r != nil; r = r.Link { + p := r.Prog + // Currently there are no instructions which write to multiple + // registers in copyu. This check will need to change if there + // ever are. + if !(isGPR(&p.To) || isFPR(&p.To)) || copyu(p, &p.To, nil) != _Write { + continue + } + for rr := gc.Uniqs(r); rr != nil; rr = gc.Uniqs(rr) { + t := copyu(rr.Prog, &p.To, nil) + if t == _None { + continue + } + if t == _Write { + excise(r) + n++ + } + break + } + } + return n +} diff --git a/src/cmd/compile/internal/s390x/prog.go b/src/cmd/compile/internal/s390x/prog.go new file mode 100644 index 0000000000..306adf85c3 --- /dev/null +++ b/src/cmd/compile/internal/s390x/prog.go @@ -0,0 +1,179 @@ +// Copyright 2016 The Go Authors. All rights reserved. +// Use of this source code is governed by a BSD-style +// license that can be found in the LICENSE file. + +package s390x + +import ( + "cmd/compile/internal/gc" + "cmd/internal/obj" + "cmd/internal/obj/s390x" +) + +// This table gives the basic information about instruction +// generated by the compiler and processed in the optimizer. +// See opt.h for bit definitions. +// +// Instructions not generated need not be listed. +// As an exception to that rule, we typically write down all the +// size variants of an operation even if we just use a subset. +var progtable = [s390x.ALAST & obj.AMask]obj.ProgInfo{ + obj.ATYPE & obj.AMask: {Flags: gc.Pseudo | gc.Skip}, + obj.ATEXT & obj.AMask: {Flags: gc.Pseudo}, + obj.AFUNCDATA & obj.AMask: {Flags: gc.Pseudo}, + obj.APCDATA & obj.AMask: {Flags: gc.Pseudo}, + obj.AUNDEF & obj.AMask: {Flags: gc.Break}, + obj.AUSEFIELD & obj.AMask: {Flags: gc.OK}, + obj.ACHECKNIL & obj.AMask: {Flags: gc.LeftRead}, + obj.AVARDEF & obj.AMask: {Flags: gc.Pseudo | gc.RightWrite}, + obj.AVARKILL & obj.AMask: {Flags: gc.Pseudo | gc.RightWrite}, + obj.AVARLIVE & obj.AMask: {Flags: gc.Pseudo | gc.LeftRead}, + + // NOP is an internal no-op that also stands + // for USED and SET annotations. + obj.ANOP & obj.AMask: {Flags: gc.LeftRead | gc.RightWrite}, + + // Integer + s390x.AADD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ASUB & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ANEG & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AAND & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AOR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AXOR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AMULLD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AMULLW & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AMULHD & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AMULHDU & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ADIVD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ADIVDU & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ASLD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ASRD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ASRAD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ARLL & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ARLLG & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.ACMP & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightRead}, + s390x.ACMPU & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightRead}, + + // Floating point. + s390x.AFADD & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFADDS & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFSUB & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFSUBS & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFMUL & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFMULS & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFDIV & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFDIVS & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RegRead | gc.RightWrite}, + s390x.AFCMPU & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightRead}, + s390x.ACEBR & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightRead}, + s390x.ALEDBR & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ALDEBR & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.AFSQRT & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite}, + + // Conversions + s390x.ACEFBRA & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACDFBRA & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACEGBRA & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACDGBRA & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACFEBRA & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACFDBRA & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACGEBRA & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACGDBRA & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACELFBR & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACDLFBR & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACELGBR & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACDLGBR & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACLFEBR & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACLFDBR & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACLGEBR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightWrite | gc.Conv}, + s390x.ACLGDBR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightWrite | gc.Conv}, + + // Moves + s390x.AMOVB & obj.AMask: {Flags: gc.SizeB | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVBZ & obj.AMask: {Flags: gc.SizeB | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVH & obj.AMask: {Flags: gc.SizeW | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVHZ & obj.AMask: {Flags: gc.SizeW | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVW & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVWZ & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AMOVD & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightWrite | gc.Move}, + s390x.AFMOVS & obj.AMask: {Flags: gc.SizeF | gc.LeftRead | gc.RightWrite | gc.Move | gc.Conv}, + s390x.AFMOVD & obj.AMask: {Flags: gc.SizeD | gc.LeftRead | gc.RightWrite | gc.Move}, + + // Storage operations + s390x.AMVC & obj.AMask: {Flags: gc.LeftRead | gc.LeftAddr | gc.RightWrite | gc.RightAddr}, + s390x.ACLC & obj.AMask: {Flags: gc.LeftRead | gc.LeftAddr | gc.RightRead | gc.RightAddr}, + s390x.AXC & obj.AMask: {Flags: gc.LeftRead | gc.LeftAddr | gc.RightWrite | gc.RightAddr}, + s390x.AOC & obj.AMask: {Flags: gc.LeftRead | gc.LeftAddr | gc.RightWrite | gc.RightAddr}, + s390x.ANC & obj.AMask: {Flags: gc.LeftRead | gc.LeftAddr | gc.RightWrite | gc.RightAddr}, + + // Jumps + s390x.ABR & obj.AMask: {Flags: gc.Jump | gc.Break}, + s390x.ABL & obj.AMask: {Flags: gc.Call}, + s390x.ABEQ & obj.AMask: {Flags: gc.Cjmp}, + s390x.ABNE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ABGE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ABLT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ABGT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ABLE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBEQ & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBNE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBGE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBLT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBGT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPBLE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBEQ & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBNE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBGE & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBLT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBGT & obj.AMask: {Flags: gc.Cjmp}, + s390x.ACMPUBLE & obj.AMask: {Flags: gc.Cjmp}, + + // Macros + s390x.ACLEAR & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightAddr | gc.RightWrite}, + + // Load/store multiple + s390x.ASTMG & obj.AMask: {Flags: gc.SizeQ | gc.LeftRead | gc.RightAddr | gc.RightWrite}, + s390x.ASTMY & obj.AMask: {Flags: gc.SizeL | gc.LeftRead | gc.RightAddr | gc.RightWrite}, + s390x.ALMG & obj.AMask: {Flags: gc.SizeQ | gc.LeftAddr | gc.LeftRead | gc.RightWrite}, + s390x.ALMY & obj.AMask: {Flags: gc.SizeL | gc.LeftAddr | gc.LeftRead | gc.RightWrite}, + + obj.ARET & obj.AMask: {Flags: gc.Break}, +} + +func proginfo(p *obj.Prog) { + info := &p.Info + *info = progtable[p.As&obj.AMask] + if info.Flags == 0 { + gc.Fatalf("proginfo: unknown instruction %v", p) + } + + if (info.Flags&gc.RegRead != 0) && p.Reg == 0 { + info.Flags &^= gc.RegRead + info.Flags |= gc.RightRead /*CanRegRead |*/ + } + + if (p.From.Type == obj.TYPE_MEM || p.From.Type == obj.TYPE_ADDR) && p.From.Reg != 0 { + info.Regindex |= RtoB(int(p.From.Reg)) + } + + if (p.To.Type == obj.TYPE_MEM || p.To.Type == obj.TYPE_ADDR) && p.To.Reg != 0 { + info.Regindex |= RtoB(int(p.To.Reg)) + } + + if p.From.Type == obj.TYPE_ADDR && p.From.Sym != nil && (info.Flags&gc.LeftRead != 0) { + info.Flags &^= gc.LeftRead + info.Flags |= gc.LeftAddr + } + + switch p.As { + // load multiple sets a range of registers + case s390x.ALMG, s390x.ALMY: + for r := p.Reg; r <= p.To.Reg; r++ { + info.Regset |= RtoB(int(r)) + } + // store multiple reads a range of registers + case s390x.ASTMG, s390x.ASTMY: + for r := p.From.Reg; r <= p.Reg; r++ { + info.Reguse |= RtoB(int(r)) + } + } +} diff --git a/src/cmd/compile/internal/s390x/reg.go b/src/cmd/compile/internal/s390x/reg.go new file mode 100644 index 0000000000..4cb8a9da05 --- /dev/null +++ b/src/cmd/compile/internal/s390x/reg.go @@ -0,0 +1,130 @@ +// Derived from Inferno utils/6c/reg.c +// http://code.google.com/p/inferno-os/source/browse/utils/6c/reg.c +// +// Copyright © 1994-1999 Lucent Technologies Inc. All rights reserved. +// Portions Copyright © 1995-1997 C H Forsyth (forsyth@terzarima.net) +// Portions Copyright © 1997-1999 Vita Nuova Limited +// Portions Copyright © 2000-2007 Vita Nuova Holdings Limited (www.vitanuova.com) +// Portions Copyright © 2004,2006 Bruce Ellis +// Portions Copyright © 2005-2007 C H Forsyth (forsyth@terzarima.net) +// Revisions Copyright © 2000-2007 Lucent Technologies Inc. and others +// Portions Copyright © 2009 The Go Authors. All rights reserved. +// +// Permission is hereby granted, free of charge, to any person obtaining a copy +// of this software and associated documentation files (the "Software"), to deal +// in the Software without restriction, including without limitation the rights +// to use, copy, modify, merge, publish, distribute, sublicense, and/or sell +// copies of the Software, and to permit persons to whom the Software is +// furnished to do so, subject to the following conditions: +// +// The above copyright notice and this permission notice shall be included in +// all copies or substantial portions of the Software. +// +// THE SOFTWARE IS PROVIDED "AS IS", WITHOUT WARRANTY OF ANY KIND, EXPRESS OR +// IMPLIED, INCLUDING BUT NOT LIMITED TO THE WARRANTIES OF MERCHANTABILITY, +// FITNESS FOR A PARTICULAR PURPOSE AND NONINFRINGEMENT. IN NO EVENT SHALL THE +// AUTHORS OR COPYRIGHT HOLDERS BE LIABLE FOR ANY CLAIM, DAMAGES OR OTHER +// LIABILITY, WHETHER IN AN ACTION OF CONTRACT, TORT OR OTHERWISE, ARISING FROM, +// OUT OF OR IN CONNECTION WITH THE SOFTWARE OR THE USE OR OTHER DEALINGS IN +// THE SOFTWARE. + +package s390x + +import "cmd/internal/obj/s390x" +import "cmd/compile/internal/gc" + +const ( + NREGVAR = 32 /* 16 general + 16 floating */ +) + +var regname = []string{ + ".R0", + ".R1", + ".R2", + ".R3", + ".R4", + ".R5", + ".R6", + ".R7", + ".R8", + ".R9", + ".R10", + ".R11", + ".R12", + ".R13", + ".R14", + ".R15", + ".F0", + ".F1", + ".F2", + ".F3", + ".F4", + ".F5", + ".F6", + ".F7", + ".F8", + ".F9", + ".F10", + ".F11", + ".F12", + ".F13", + ".F14", + ".F15", +} + +func regnames(n *int) []string { + *n = NREGVAR + return regname +} + +func excludedregs() uint64 { + // Exclude registers with fixed functions + return RtoB(s390x.REG_R0) | + RtoB(s390x.REGSP) | + RtoB(s390x.REGG) | + RtoB(s390x.REGTMP) | + RtoB(s390x.REGTMP2) | + RtoB(s390x.REG_LR) +} + +func doregbits(r int) uint64 { + return 0 +} + +/* + * track register variables including external registers: + * bit reg + * 0 R0 + * ... ... + * 15 R15 + * 16+0 F0 + * 16+1 F1 + * ... ... + * 16+15 F15 + */ +func RtoB(r int) uint64 { + if r >= s390x.REG_R0 && r <= s390x.REG_R15 { + return 1 << uint(r-s390x.REG_R0) + } + if r >= s390x.REG_F0 && r <= s390x.REG_F15 { + return 1 << uint(16+r-s390x.REG_F0) + } + return 0 +} + +func BtoR(b uint64) int { + b &= 0xffff + if b == 0 { + return 0 + } + return gc.Bitno(b) + s390x.REG_R0 +} + +func BtoF(b uint64) int { + b >>= 16 + b &= 0xffff + if b == 0 { + return 0 + } + return gc.Bitno(b) + s390x.REG_F0 +} diff --git a/src/cmd/compile/internal/ssa/TODO b/src/cmd/compile/internal/ssa/TODO index e081856bd3..dad4880994 100644 --- a/src/cmd/compile/internal/ssa/TODO +++ b/src/cmd/compile/internal/ssa/TODO @@ -41,8 +41,6 @@ Future/other ------------ - Start another architecture (arm?) - 64-bit ops on 32-bit machines -- Investigate type equality. During SSA generation, should we use n.Type or (say) TypeBool? - Should we get rid of named types in favor of underlying types during SSA generation? -- Should we introduce a new type equality routine that is less strict than the frontend's? - Infrastructure for enabling/disabling/configuring passes - Modify logging for at least pass=1, to be Warnl compatible diff --git a/src/cmd/compile/internal/ssa/check.go b/src/cmd/compile/internal/ssa/check.go index 5a17735304..4a10606d3c 100644 --- a/src/cmd/compile/internal/ssa/check.go +++ b/src/cmd/compile/internal/ssa/check.go @@ -162,7 +162,7 @@ func checkFunc(f *Func) { // variable length args) nArgs := opcodeTable[v.Op].argLen if nArgs != -1 && int32(len(v.Args)) != nArgs { - f.Fatalf("value %v has %d args, expected %d", v.LongString(), + f.Fatalf("value %s has %d args, expected %d", v.LongString(), len(v.Args), nArgs) } @@ -193,6 +193,8 @@ func checkFunc(f *Func) { canHaveAuxInt = true case auxInt64, auxFloat64: canHaveAuxInt = true + case auxInt128: + // AuxInt must be zero, so leave canHaveAuxInt set to false. case auxFloat32: canHaveAuxInt = true if !isExactFloat32(v) { @@ -203,19 +205,25 @@ func checkFunc(f *Func) { case auxSymOff, auxSymValAndOff: canHaveAuxInt = true canHaveAux = true + case auxSymInt32: + if v.AuxInt != int64(int32(v.AuxInt)) { + f.Fatalf("bad int32 AuxInt value for %v", v) + } + canHaveAuxInt = true + canHaveAux = true default: f.Fatalf("unknown aux type for %s", v.Op) } if !canHaveAux && v.Aux != nil { - f.Fatalf("value %v has an Aux value %v but shouldn't", v.LongString(), v.Aux) + f.Fatalf("value %s has an Aux value %v but shouldn't", v.LongString(), v.Aux) } if !canHaveAuxInt && v.AuxInt != 0 { - f.Fatalf("value %v has an AuxInt value %d but shouldn't", v.LongString(), v.AuxInt) + f.Fatalf("value %s has an AuxInt value %d but shouldn't", v.LongString(), v.AuxInt) } for _, arg := range v.Args { if arg == nil { - f.Fatalf("value %v has nil arg", v.LongString()) + f.Fatalf("value %s has nil arg", v.LongString()) } } @@ -271,7 +279,7 @@ func checkFunc(f *Func) { for _, v := range b.Values { for i, a := range v.Args { if !valueMark[a.ID] { - f.Fatalf("%v, arg %d of %v, is missing", a, i, v) + f.Fatalf("%v, arg %d of %s, is missing", a, i, v.LongString()) } } } @@ -338,7 +346,7 @@ func checkFunc(f *Func) { // domCheck reports whether x dominates y (including x==y). func domCheck(f *Func, sdom sparseTree, x, y *Block) bool { - if !sdom.isAncestorEq(y, f.Entry) { + if !sdom.isAncestorEq(f.Entry, y) { // unreachable - ignore return true } diff --git a/src/cmd/compile/internal/ssa/compile.go b/src/cmd/compile/internal/ssa/compile.go index d52ae9c6da..bc9c830ee9 100644 --- a/src/cmd/compile/internal/ssa/compile.go +++ b/src/cmd/compile/internal/ssa/compile.go @@ -230,9 +230,10 @@ var passes = [...]pass{ {name: "early deadcode", fn: deadcode}, // remove generated dead code to avoid doing pointless work during opt {name: "short circuit", fn: shortcircuit}, {name: "decompose user", fn: decomposeUser, required: true}, - {name: "opt", fn: opt, required: true}, // TODO: split required rules and optimizing rules - {name: "zero arg cse", fn: zcse, required: true}, // required to merge OpSB values - {name: "opt deadcode", fn: deadcode}, // remove any blocks orphaned during opt + {name: "opt", fn: opt, required: true}, // TODO: split required rules and optimizing rules + {name: "zero arg cse", fn: zcse, required: true}, // required to merge OpSB values + {name: "opt deadcode", fn: deadcode, required: true}, // remove any blocks orphaned during opt + {name: "generic domtree", fn: domTree}, {name: "generic cse", fn: cse}, {name: "phiopt", fn: phiopt}, {name: "nilcheckelim", fn: nilcheckelim}, @@ -288,6 +289,12 @@ var passOrder = [...]constraint{ {"opt", "nilcheckelim"}, // tighten should happen before lowering to avoid splitting naturally paired instructions such as CMP/SET {"tighten", "lower"}, + // cse, phiopt, nilcheckelim, prove and loopbce share idom. + {"generic domtree", "generic cse"}, + {"generic domtree", "phiopt"}, + {"generic domtree", "nilcheckelim"}, + {"generic domtree", "prove"}, + {"generic domtree", "loopbce"}, // tighten will be most effective when as many values have been removed as possible {"generic deadcode", "tighten"}, {"generic cse", "tighten"}, diff --git a/src/cmd/compile/internal/ssa/config.go b/src/cmd/compile/internal/ssa/config.go index 33357124fc..a60291ea53 100644 --- a/src/cmd/compile/internal/ssa/config.go +++ b/src/cmd/compile/internal/ssa/config.go @@ -103,6 +103,7 @@ type Frontend interface { SplitInterface(LocalSlot) (LocalSlot, LocalSlot) SplitSlice(LocalSlot) (LocalSlot, LocalSlot, LocalSlot) SplitComplex(LocalSlot) (LocalSlot, LocalSlot) + SplitStruct(LocalSlot, int) LocalSlot // Line returns a string describing the given line number. Line(int32) string @@ -115,6 +116,12 @@ type GCNode interface { String() string } +// GCSym is an interface that *gc.Sym implements. +// Using *gc.Sym directly would lead to import cycles. +type GCSym interface { + IsRuntimeCall(name string) bool +} + // NewConfig returns a new configuration object for the given architecture. func NewConfig(arch string, fe Frontend, ctxt *obj.Link, optimize bool) *Config { c := &Config{arch: arch, fe: fe} diff --git a/src/cmd/compile/internal/ssa/cse.go b/src/cmd/compile/internal/ssa/cse.go index 1ec5712be0..d501f75e02 100644 --- a/src/cmd/compile/internal/ssa/cse.go +++ b/src/cmd/compile/internal/ssa/cse.go @@ -108,7 +108,7 @@ func cse(f *Func) { break } } - if !equivalent || !v.Type.Equal(w.Type) { + if !equivalent || v.Type.Compare(w.Type) != CMPeq { // w is not equivalent to v. // move it to the end and shrink e. e[j], e[len(e)-1] = e[len(e)-1], e[j] @@ -131,33 +131,36 @@ func cse(f *Func) { } } - // Compute dominator tree - idom := dominators(f) - sdom := newSparseTree(f, idom) + // Dominator tree (f.sdom) is computed by the generic domtree pass. // Compute substitutions we would like to do. We substitute v for w // if v and w are in the same equivalence class and v dominates w. rewrite := make([]*Value, f.NumValues()) for _, e := range partition { - for len(e) > 1 { - // Find a maximal dominant element in e - v := e[0] - for _, w := range e[1:] { - if sdom.isAncestorEq(w.Block, v.Block) { - v = w - } + sort.Sort(sortbyentry{e, f.sdom}) + for i := 0; i < len(e)-1; i++ { + // e is sorted by entry value so maximal dominant element should be + // found first in the slice + v := e[i] + if v == nil { + continue } + e[i] = nil // Replace all elements of e which v dominates - for i := 0; i < len(e); { - w := e[i] - if w == v { - e, e[i] = e[:len(e)-1], e[len(e)-1] - } else if sdom.isAncestorEq(v.Block, w.Block) { + for j := i + 1; j < len(e); j++ { + w := e[j] + if w == nil { + continue + } + if f.sdom.isAncestorEq(v.Block, w.Block) { rewrite[w.ID] = v - e, e[i] = e[:len(e)-1], e[len(e)-1] + e[j] = nil } else { - i++ + // since the blocks are assorted in ascending order by entry number + // once we know that we don't dominate a block we can't dominate any + // 'later' block + break } } } @@ -255,6 +258,14 @@ func cmpVal(v, w *Value, auxIDs auxmap, depth int) Cmp { return lt2Cmp(v.Block.ID < w.Block.ID) } + switch v.Op { + case OpStaticCall, OpAMD64CALLstatic, OpARMCALLstatic: + sym := v.Aux.(GCSym) + if sym.IsRuntimeCall("newobject") { + return lt2Cmp(v.ID < w.ID) + } + } + if tc := v.Type.Compare(w.Type); tc != CMPeq { return tc } @@ -302,3 +313,16 @@ func (sv sortvalues) Less(i, j int) bool { // Sort by value ID last to keep the sort result deterministic. return v.ID < w.ID } + +type sortbyentry struct { + a []*Value // array of values + sdom sparseTree +} + +func (sv sortbyentry) Len() int { return len(sv.a) } +func (sv sortbyentry) Swap(i, j int) { sv.a[i], sv.a[j] = sv.a[j], sv.a[i] } +func (sv sortbyentry) Less(i, j int) bool { + v := sv.a[i] + w := sv.a[j] + return sv.sdom.maxdomorder(v.Block) < sv.sdom.maxdomorder(w.Block) +} diff --git a/src/cmd/compile/internal/ssa/cse_test.go b/src/cmd/compile/internal/ssa/cse_test.go index 905939fc32..d5be2b52ec 100644 --- a/src/cmd/compile/internal/ssa/cse_test.go +++ b/src/cmd/compile/internal/ssa/cse_test.go @@ -44,6 +44,7 @@ func TestCSEAuxPartitionBug(t *testing.T) { Exit("rstore"))) CheckFunc(fun.f) + domTree(fun.f) cse(fun.f) deadcode(fun.f) CheckFunc(fun.f) diff --git a/src/cmd/compile/internal/ssa/decompose.go b/src/cmd/compile/internal/ssa/decompose.go index eab9974106..53116ba593 100644 --- a/src/cmd/compile/internal/ssa/decompose.go +++ b/src/cmd/compile/internal/ssa/decompose.go @@ -21,6 +21,7 @@ func decomposeBuiltIn(f *Func) { // NOTE: the component values we are making are dead at this point. // We must do the opt pass before any deadcode elimination or we will // lose the name->value correspondence. + var newNames []LocalSlot for _, name := range f.Names { t := name.Type switch { @@ -32,29 +33,31 @@ func decomposeBuiltIn(f *Func) { elemType = f.Config.fe.TypeFloat32() } rName, iName := f.Config.fe.SplitComplex(name) - f.Names = append(f.Names, rName, iName) + newNames = append(newNames, rName, iName) for _, v := range f.NamedValues[name] { r := v.Block.NewValue1(v.Line, OpComplexReal, elemType, v) i := v.Block.NewValue1(v.Line, OpComplexImag, elemType, v) f.NamedValues[rName] = append(f.NamedValues[rName], r) f.NamedValues[iName] = append(f.NamedValues[iName], i) } + delete(f.NamedValues, name) case t.IsString(): ptrType := f.Config.fe.TypeBytePtr() lenType := f.Config.fe.TypeInt() ptrName, lenName := f.Config.fe.SplitString(name) - f.Names = append(f.Names, ptrName, lenName) + newNames = append(newNames, ptrName, lenName) for _, v := range f.NamedValues[name] { ptr := v.Block.NewValue1(v.Line, OpStringPtr, ptrType, v) len := v.Block.NewValue1(v.Line, OpStringLen, lenType, v) f.NamedValues[ptrName] = append(f.NamedValues[ptrName], ptr) f.NamedValues[lenName] = append(f.NamedValues[lenName], len) } + delete(f.NamedValues, name) case t.IsSlice(): ptrType := f.Config.fe.TypeBytePtr() lenType := f.Config.fe.TypeInt() ptrName, lenName, capName := f.Config.fe.SplitSlice(name) - f.Names = append(f.Names, ptrName, lenName, capName) + newNames = append(newNames, ptrName, lenName, capName) for _, v := range f.NamedValues[name] { ptr := v.Block.NewValue1(v.Line, OpSlicePtr, ptrType, v) len := v.Block.NewValue1(v.Line, OpSliceLen, lenType, v) @@ -63,20 +66,25 @@ func decomposeBuiltIn(f *Func) { f.NamedValues[lenName] = append(f.NamedValues[lenName], len) f.NamedValues[capName] = append(f.NamedValues[capName], cap) } + delete(f.NamedValues, name) case t.IsInterface(): ptrType := f.Config.fe.TypeBytePtr() typeName, dataName := f.Config.fe.SplitInterface(name) - f.Names = append(f.Names, typeName, dataName) + newNames = append(newNames, typeName, dataName) for _, v := range f.NamedValues[name] { typ := v.Block.NewValue1(v.Line, OpITab, ptrType, v) data := v.Block.NewValue1(v.Line, OpIData, ptrType, v) f.NamedValues[typeName] = append(f.NamedValues[typeName], typ) f.NamedValues[dataName] = append(f.NamedValues[dataName], data) } + delete(f.NamedValues, name) case t.Size() > f.Config.IntSize: - f.Unimplementedf("undecomposed named type %s", t) + f.Unimplementedf("undecomposed named type %s %s", name, t) + default: + newNames = append(newNames, name) } } + f.Names = newNames } func decomposeBuiltInPhi(v *Value) { @@ -181,25 +189,32 @@ func decomposeUser(f *Func) { // We must do the opt pass before any deadcode elimination or we will // lose the name->value correspondence. i := 0 + var fnames []LocalSlot + var newNames []LocalSlot for _, name := range f.Names { t := name.Type switch { case t.IsStruct(): n := t.NumFields() + fnames = fnames[:0] + for i := 0; i < n; i++ { + fnames = append(fnames, f.Config.fe.SplitStruct(name, i)) + } for _, v := range f.NamedValues[name] { for i := 0; i < n; i++ { - fname := LocalSlot{name.N, t.FieldType(i), name.Off + t.FieldOff(i)} // TODO: use actual field name? x := v.Block.NewValue1I(v.Line, OpStructSelect, t.FieldType(i), int64(i), v) - f.NamedValues[fname] = append(f.NamedValues[fname], x) + f.NamedValues[fnames[i]] = append(f.NamedValues[fnames[i]], x) } } delete(f.NamedValues, name) + newNames = append(newNames, fnames...) default: f.Names[i] = name i++ } } f.Names = f.Names[:i] + f.Names = append(f.Names, newNames...) } func decomposeUserPhi(v *Value) { diff --git a/src/cmd/compile/internal/ssa/dom.go b/src/cmd/compile/internal/ssa/dom.go index 0fffcdc2af..c0a4bb4188 100644 --- a/src/cmd/compile/internal/ssa/dom.go +++ b/src/cmd/compile/internal/ssa/dom.go @@ -5,11 +5,13 @@ package ssa // mark values +type markKind uint8 + const ( - notFound = 0 // block has not been discovered yet - notExplored = 1 // discovered and in queue, outedges not processed yet - explored = 2 // discovered and in queue, outedges processed - done = 3 // all done, in output ordering + notFound markKind = 0 // block has not been discovered yet + notExplored markKind = 1 // discovered and in queue, outedges not processed yet + explored markKind = 2 // discovered and in queue, outedges processed + done markKind = 3 // all done, in output ordering ) // This file contains code to compute the dominator tree @@ -18,7 +20,10 @@ const ( // postorder computes a postorder traversal ordering for the // basic blocks in f. Unreachable blocks will not appear. func postorder(f *Func) []*Block { - mark := make([]byte, f.NumBlocks()) + return postorderWithNumbering(f, []int{}) +} +func postorderWithNumbering(f *Func, ponums []int) []*Block { + mark := make([]markKind, f.NumBlocks()) // result ordering var order []*Block @@ -34,6 +39,9 @@ func postorder(f *Func) []*Block { // Children have all been visited. Pop & output block. s = s[:len(s)-1] mark[b.ID] = done + if len(ponums) > 0 { + ponums[b.ID] = len(order) + } order = append(order, b) case notExplored: // Children have not been visited yet. Mark as explored @@ -54,14 +62,14 @@ func postorder(f *Func) []*Block { type linkedBlocks func(*Block) []*Block -const nscratchslices = 8 +const nscratchslices = 7 // experimentally, functions with 512 or fewer blocks account // for 75% of memory (size) allocation for dominator computation // in make.bash. const minscratchblocks = 512 -func (cfg *Config) scratchBlocksForDom(maxBlockID int) (a, b, c, d, e, f, g, h []ID) { +func (cfg *Config) scratchBlocksForDom(maxBlockID int) (a, b, c, d, e, f, g []ID) { tot := maxBlockID * nscratchslices scratch := cfg.domblockstore if len(scratch) < tot { @@ -88,213 +96,143 @@ func (cfg *Config) scratchBlocksForDom(maxBlockID int) (a, b, c, d, e, f, g, h [ e = scratch[4*maxBlockID : 5*maxBlockID] f = scratch[5*maxBlockID : 6*maxBlockID] g = scratch[6*maxBlockID : 7*maxBlockID] - h = scratch[7*maxBlockID : 8*maxBlockID] return } -// dfs performs a depth first search over the blocks starting at the set of -// blocks in the entries list (in arbitrary order). dfnum contains a mapping -// from block id to an int indicating the order the block was reached or -// notFound if the block was not reached. order contains a mapping from dfnum -// to block. -func (f *Func) dfs(entries []*Block, succFn linkedBlocks, dfnum, order, parent []ID) (fromID []*Block) { - maxBlockID := entries[0].Func.NumBlocks() - - fromID = make([]*Block, maxBlockID) - - for _, entry := range entries[0].Func.Blocks { - eid := entry.ID - if fromID[eid] != nil { - panic("Colliding entry IDs") - } - fromID[eid] = entry - } - - n := ID(0) - s := make([]*Block, 0, 256) - for _, entry := range entries { - if dfnum[entry.ID] != notFound { - continue // already found from a previous entry - } - s = append(s, entry) - parent[entry.ID] = entry.ID - for len(s) > 0 { - node := s[len(s)-1] - s = s[:len(s)-1] - - n++ - for _, w := range succFn(node) { - // if it has a dfnum, we've already visited it - if dfnum[w.ID] == notFound { - s = append(s, w) - parent[w.ID] = node.ID - dfnum[w.ID] = notExplored - } - } - dfnum[node.ID] = n - order[n] = node.ID - } - } - - return -} - -// dominators computes the dominator tree for f. It returns a slice -// which maps block ID to the immediate dominator of that block. -// Unreachable blocks map to nil. The entry block maps to nil. func dominators(f *Func) []*Block { preds := func(b *Block) []*Block { return b.Preds } succs := func(b *Block) []*Block { return b.Succs } //TODO: benchmark and try to find criteria for swapping between // dominatorsSimple and dominatorsLT - return f.dominatorsLT([]*Block{f.Entry}, preds, succs) + return f.dominatorsLTOrig(f.Entry, preds, succs) } -// postDominators computes the post-dominator tree for f. -func postDominators(f *Func) []*Block { - preds := func(b *Block) []*Block { return b.Preds } - succs := func(b *Block) []*Block { return b.Succs } - - if len(f.Blocks) == 0 { - return nil - } - - // find the exit blocks - var exits []*Block - for _, b := range f.Blocks { - switch b.Kind { - case BlockExit, BlockRet, BlockRetJmp, BlockCall, BlockCheck: - exits = append(exits, b) - } - } - - // infinite loop with no exit - if exits == nil { - return make([]*Block, f.NumBlocks()) - } - return f.dominatorsLT(exits, succs, preds) -} - -// dominatorsLt runs Lengauer-Tarjan to compute a dominator tree starting at +// dominatorsLTOrig runs Lengauer-Tarjan to compute a dominator tree starting at // entry and using predFn/succFn to find predecessors/successors to allow // computing both dominator and post-dominator trees. -func (f *Func) dominatorsLT(entries []*Block, predFn linkedBlocks, succFn linkedBlocks) []*Block { - // Based on Lengauer-Tarjan from Modern Compiler Implementation in C - - // Appel with optimizations from Finding Dominators in Practice - - // Georgiadis +func (f *Func) dominatorsLTOrig(entry *Block, predFn linkedBlocks, succFn linkedBlocks) []*Block { + // Adapted directly from the original TOPLAS article's "simple" algorithm - maxBlockID := entries[0].Func.NumBlocks() + maxBlockID := entry.Func.NumBlocks() + semi, vertex, label, parent, ancestor, bucketHead, bucketLink := f.Config.scratchBlocksForDom(maxBlockID) - dfnum, vertex, parent, semi, samedom, ancestor, best, bucket := f.Config.scratchBlocksForDom(maxBlockID) - - // dfnum := make([]ID, maxBlockID) // conceptually int32, but punning for allocation purposes. - // vertex := make([]ID, maxBlockID) - // parent := make([]ID, maxBlockID) - - // semi := make([]ID, maxBlockID) - // samedom := make([]ID, maxBlockID) - // ancestor := make([]ID, maxBlockID) - // best := make([]ID, maxBlockID) - // bucket := make([]ID, maxBlockID) + // This version uses integers for most of the computation, + // to make the work arrays smaller and pointer-free. + // fromID translates from ID to *Block where that is needed. + fromID := make([]*Block, maxBlockID) + for _, v := range f.Blocks { + fromID[v.ID] = v + } + idom := make([]*Block, maxBlockID) // Step 1. Carry out a depth first search of the problem graph. Number // the vertices from 1 to n as they are reached during the search. - fromID := f.dfs(entries, succFn, dfnum, vertex, parent) + n := f.dfsOrig(entry, succFn, semi, vertex, label, parent) - idom := make([]*Block, maxBlockID) - - // Step 2. Compute the semidominators of all vertices by applying - // Theorem 4. Carry out the computation vertex by vertex in decreasing - // order by number. - for i := maxBlockID - 1; i > 0; i-- { + for i := n; i >= 2; i-- { w := vertex[i] - if w == 0 { - continue - } - - if dfnum[w] == notFound { - // skip unreachable node - continue - } - - // Step 3. Implicitly define the immediate dominator of each - // vertex by applying Corollary 1. (reordered) - for v := bucket[w]; v != 0; v = bucket[v] { - u := eval(v, ancestor, semi, dfnum, best) - if semi[u] == semi[v] { - idom[v] = fromID[w] // true dominator - } else { - samedom[v] = u // v has same dominator as u - } - } - - p := parent[w] - s := p // semidominator - var sp ID - // calculate the semidominator of w + // step2 in TOPLAS paper for _, v := range predFn(fromID[w]) { - if dfnum[v.ID] == notFound { + if semi[v.ID] == 0 { // skip unreachable predecessor + // not in original, but we're using existing pred instead of building one. continue } - - if dfnum[v.ID] <= dfnum[w] { - sp = v.ID - } else { - sp = semi[eval(v.ID, ancestor, semi, dfnum, best)] - } - - if dfnum[sp] < dfnum[s] { - s = sp + u := evalOrig(v.ID, ancestor, semi, label) + if semi[u] < semi[w] { + semi[w] = semi[u] } } - // link - ancestor[w] = p - best[w] = w + // add w to bucket[vertex[semi[w]]] + // implement bucket as a linked list implemented + // in a pair of arrays. + vsw := vertex[semi[w]] + bucketLink[w] = bucketHead[vsw] + bucketHead[vsw] = w + + linkOrig(parent[w], w, ancestor) - semi[w] = s - if semi[s] != parent[s] { - bucket[w] = bucket[s] - bucket[s] = w + // step3 in TOPLAS paper + for v := bucketHead[parent[w]]; v != 0; v = bucketLink[v] { + u := evalOrig(v, ancestor, semi, label) + if semi[u] < semi[v] { + idom[v] = fromID[u] + } else { + idom[v] = fromID[parent[w]] + } } } - - // Final pass of step 3 - for v := bucket[0]; v != 0; v = bucket[v] { - idom[v] = fromID[bucket[0]] + // step 4 in toplas paper + for i := ID(2); i <= n; i++ { + w := vertex[i] + if idom[w].ID != vertex[semi[w]] { + idom[w] = idom[idom[w].ID] + } } - // Step 4. Explicitly define the immediate dominator of each vertex, - // carrying out the computation vertex by vertex in increasing order by - // number. - for i := 1; i < maxBlockID-1; i++ { - w := vertex[i] - if w == 0 { - continue + return idom +} + +// dfs performs a depth first search over the blocks starting at entry block +// (in arbitrary order). This is a de-recursed version of dfs from the +// original Tarjan-Lengauer TOPLAS article. It's important to return the +// same values for parent as the original algorithm. +func (f *Func) dfsOrig(entry *Block, succFn linkedBlocks, semi, vertex, label, parent []ID) ID { + n := ID(0) + s := make([]*Block, 0, 256) + s = append(s, entry) + + for len(s) > 0 { + v := s[len(s)-1] + s = s[:len(s)-1] + // recursing on v + + if semi[v.ID] != 0 { + continue // already visited } - // w has the same dominator as samedom[w] - if samedom[w] != 0 { - idom[w] = idom[samedom[w]] + n++ + semi[v.ID] = n + vertex[n] = v.ID + label[v.ID] = v.ID + // ancestor[v] already zero + for _, w := range succFn(v) { + // if it has a dfnum, we've already visited it + if semi[w.ID] == 0 { + // yes, w can be pushed multiple times. + s = append(s, w) + parent[w.ID] = v.ID // keep overwriting this till it is visited. + } } } - return idom + return n } -// eval function from LT paper with path compression -func eval(v ID, ancestor []ID, semi []ID, dfnum []ID, best []ID) ID { - a := ancestor[v] - if ancestor[a] != 0 { - bid := eval(a, ancestor, semi, dfnum, best) - ancestor[v] = ancestor[a] - if dfnum[semi[bid]] < dfnum[semi[best[v]]] { - best[v] = bid +// compressOrig is the "simple" compress function from LT paper +func compressOrig(v ID, ancestor, semi, label []ID) { + if ancestor[ancestor[v]] != 0 { + compressOrig(ancestor[v], ancestor, semi, label) + if semi[label[ancestor[v]]] < semi[label[v]] { + label[v] = label[ancestor[v]] } + ancestor[v] = ancestor[ancestor[v]] + } +} + +// evalOrig is the "simple" eval function from LT paper +func evalOrig(v ID, ancestor, semi, label []ID) ID { + if ancestor[v] == 0 { + return v } - return best[v] + compressOrig(v, ancestor, semi, label) + return label[v] +} + +func linkOrig(v, w ID, ancestor []ID) { + ancestor[w] = v } // dominators computes the dominator tree for f. It returns a slice @@ -364,3 +302,9 @@ func intersect(b, c *Block, postnum []int, idom []*Block) *Block { } return b } + +// build immediate dominators. +func domTree(f *Func) { + f.idom = dominators(f) + f.sdom = newSparseTree(f, f.idom) +} diff --git a/src/cmd/compile/internal/ssa/dom_test.go b/src/cmd/compile/internal/ssa/dom_test.go index 9741edf331..6ecbe923d4 100644 --- a/src/cmd/compile/internal/ssa/dom_test.go +++ b/src/cmd/compile/internal/ssa/dom_test.go @@ -372,32 +372,6 @@ func TestDominatorsMultPred(t *testing.T) { verifyDominators(t, fun, dominatorsSimple, doms) } -func TestPostDominators(t *testing.T) { - c := testConfig(t) - fun := Fun(c, "entry", - Bloc("entry", - Valu("mem", OpInitMem, TypeMem, 0, nil), - Valu("p", OpConstBool, TypeBool, 1, nil), - If("p", "a", "c")), - Bloc("a", - If("p", "b", "c")), - Bloc("b", - Goto("c")), - Bloc("c", - If("p", "b", "exit")), - Bloc("exit", - Exit("mem"))) - - doms := map[string]string{"entry": "c", - "a": "c", - "b": "c", - "c": "exit", - } - - CheckFunc(fun.f) - verifyDominators(t, fun, postDominators, doms) -} - func TestInfiniteLoop(t *testing.T) { c := testConfig(t) // note lack of an exit block @@ -415,8 +389,184 @@ func TestInfiniteLoop(t *testing.T) { doms := map[string]string{"a": "entry", "b": "a"} verifyDominators(t, fun, dominators, doms) +} - // no exit block, so there are no post-dominators - postDoms := map[string]string{} - verifyDominators(t, fun, postDominators, postDoms) +func TestDomTricky(t *testing.T) { + doms := map[string]string{ + "4": "1", + "2": "4", + "5": "4", + "11": "4", + "15": "4", // the incorrect answer is "5" + "10": "15", + "19": "15", + } + + if4 := [2]string{"2", "5"} + if5 := [2]string{"15", "11"} + if15 := [2]string{"19", "10"} + + for i := 0; i < 8; i++ { + a := 1 & i + b := 1 & i >> 1 + c := 1 & i >> 2 + + fun := Fun(testConfig(t), "1", + Bloc("1", + Valu("mem", OpInitMem, TypeMem, 0, nil), + Valu("p", OpConstBool, TypeBool, 1, nil), + Goto("4")), + Bloc("2", + Goto("11")), + Bloc("4", + If("p", if4[a], if4[1-a])), // 2, 5 + Bloc("5", + If("p", if5[b], if5[1-b])), //15, 11 + Bloc("10", + Exit("mem")), + Bloc("11", + Goto("15")), + Bloc("15", + If("p", if15[c], if15[1-c])), //19, 10 + Bloc("19", + Goto("10"))) + CheckFunc(fun.f) + verifyDominators(t, fun, dominators, doms) + verifyDominators(t, fun, dominatorsSimple, doms) + } +} + +// generateDominatorMap uses dominatorsSimple to obtain a +// reference dominator tree for testing faster algorithms. +func generateDominatorMap(fut fun) map[string]string { + blockNames := map[*Block]string{} + for n, b := range fut.blocks { + blockNames[b] = n + } + referenceDom := dominatorsSimple(fut.f) + doms := make(map[string]string) + for _, b := range fut.f.Blocks { + if d := referenceDom[b.ID]; d != nil { + doms[blockNames[b]] = blockNames[d] + } + } + return doms +} + +func TestDominatorsPostTricky(t *testing.T) { + c := testConfig(t) + fun := Fun(c, "b1", + Bloc("b1", + Valu("mem", OpInitMem, TypeMem, 0, nil), + Valu("p", OpConstBool, TypeBool, 1, nil), + If("p", "b3", "b2")), + Bloc("b3", + If("p", "b5", "b6")), + Bloc("b5", + Goto("b7")), + Bloc("b7", + If("p", "b8", "b11")), + Bloc("b8", + Goto("b13")), + Bloc("b13", + If("p", "b14", "b15")), + Bloc("b14", + Goto("b10")), + Bloc("b15", + Goto("b16")), + Bloc("b16", + Goto("b9")), + Bloc("b9", + Goto("b7")), + Bloc("b11", + Goto("b12")), + Bloc("b12", + If("p", "b10", "b8")), + Bloc("b10", + Goto("b6")), + Bloc("b6", + Goto("b17")), + Bloc("b17", + Goto("b18")), + Bloc("b18", + If("p", "b22", "b19")), + Bloc("b22", + Goto("b23")), + Bloc("b23", + If("p", "b21", "b19")), + Bloc("b19", + If("p", "b24", "b25")), + Bloc("b24", + Goto("b26")), + Bloc("b26", + Goto("b25")), + Bloc("b25", + If("p", "b27", "b29")), + Bloc("b27", + Goto("b30")), + Bloc("b30", + Goto("b28")), + Bloc("b29", + Goto("b31")), + Bloc("b31", + Goto("b28")), + Bloc("b28", + If("p", "b32", "b33")), + Bloc("b32", + Goto("b21")), + Bloc("b21", + Goto("b47")), + Bloc("b47", + If("p", "b45", "b46")), + Bloc("b45", + Goto("b48")), + Bloc("b48", + Goto("b49")), + Bloc("b49", + If("p", "b50", "b51")), + Bloc("b50", + Goto("b52")), + Bloc("b52", + Goto("b53")), + Bloc("b53", + Goto("b51")), + Bloc("b51", + Goto("b54")), + Bloc("b54", + Goto("b46")), + Bloc("b46", + Exit("mem")), + Bloc("b33", + Goto("b34")), + Bloc("b34", + Goto("b37")), + Bloc("b37", + If("p", "b35", "b36")), + Bloc("b35", + Goto("b38")), + Bloc("b38", + Goto("b39")), + Bloc("b39", + If("p", "b40", "b41")), + Bloc("b40", + Goto("b42")), + Bloc("b42", + Goto("b43")), + Bloc("b43", + Goto("b41")), + Bloc("b41", + Goto("b44")), + Bloc("b44", + Goto("b36")), + Bloc("b36", + Goto("b20")), + Bloc("b20", + Goto("b18")), + Bloc("b2", + Goto("b4")), + Bloc("b4", + Exit("mem"))) + CheckFunc(fun.f) + doms := generateDominatorMap(fun) + verifyDominators(t, fun, dominators, doms) } diff --git a/src/cmd/compile/internal/ssa/export_test.go b/src/cmd/compile/internal/ssa/export_test.go index ce577ef055..0a67de9f05 100644 --- a/src/cmd/compile/internal/ssa/export_test.go +++ b/src/cmd/compile/internal/ssa/export_test.go @@ -48,6 +48,9 @@ func (d DummyFrontend) SplitComplex(s LocalSlot) (LocalSlot, LocalSlot) { } return LocalSlot{s.N, d.TypeFloat32(), s.Off}, LocalSlot{s.N, d.TypeFloat32(), s.Off + 4} } +func (d DummyFrontend) SplitStruct(s LocalSlot, i int) LocalSlot { + return LocalSlot{s.N, s.Type.FieldType(i), s.Off + s.Type.FieldOff(i)} +} func (DummyFrontend) Line(line int32) string { return "unknown.go:0" } diff --git a/src/cmd/compile/internal/ssa/func.go b/src/cmd/compile/internal/ssa/func.go index 6e47b7f19c..11ff8d3792 100644 --- a/src/cmd/compile/internal/ssa/func.go +++ b/src/cmd/compile/internal/ssa/func.go @@ -36,6 +36,9 @@ type Func struct { freeValues *Value // free Values linked by argstorage[0]. All other fields except ID are 0/nil. freeBlocks *Block // free Blocks linked by succstorage[0]. All other fields except ID are 0/nil. + idom []*Block // precomputed immediate dominators + sdom sparseTree // precomputed dominator tree + constants map[int64][]*Value // constants cache, keyed by constant value; users must check value's Op and Type } @@ -284,7 +287,10 @@ func (b *Block) NewValue2I(line int32, op Op, t Type, auxint int64, arg0, arg1 * func (b *Block) NewValue3(line int32, op Op, t Type, arg0, arg1, arg2 *Value) *Value { v := b.Func.newValue(op, t, b, line) v.AuxInt = 0 - v.Args = []*Value{arg0, arg1, arg2} + v.Args = v.argstorage[:3] + v.argstorage[0] = arg0 + v.argstorage[1] = arg1 + v.argstorage[2] = arg2 arg0.Uses++ arg1.Uses++ arg2.Uses++ @@ -295,7 +301,10 @@ func (b *Block) NewValue3(line int32, op Op, t Type, arg0, arg1, arg2 *Value) *V func (b *Block) NewValue3I(line int32, op Op, t Type, auxint int64, arg0, arg1, arg2 *Value) *Value { v := b.Func.newValue(op, t, b, line) v.AuxInt = auxint - v.Args = []*Value{arg0, arg1, arg2} + v.Args = v.argstorage[:3] + v.argstorage[0] = arg0 + v.argstorage[1] = arg1 + v.argstorage[2] = arg2 arg0.Uses++ arg1.Uses++ arg2.Uses++ @@ -309,7 +318,7 @@ func (f *Func) constVal(line int32, op Op, t Type, c int64, setAux bool) *Value } vv := f.constants[c] for _, v := range vv { - if v.Op == op && v.Type.Equal(t) { + if v.Op == op && v.Type.Compare(t) == CMPeq { if setAux && v.AuxInt != c { panic(fmt.Sprintf("cached const %s should have AuxInt of %d", v.LongString(), c)) } diff --git a/src/cmd/compile/internal/ssa/gen/AMD64.rules b/src/cmd/compile/internal/ssa/gen/AMD64.rules index 4ad0f883b0..86123ac5c5 100644 --- a/src/cmd/compile/internal/ssa/gen/AMD64.rules +++ b/src/cmd/compile/internal/ssa/gen/AMD64.rules @@ -6,23 +6,23 @@ (Add64 x y) -> (ADDQ x y) (AddPtr x y) -> (ADDQ x y) (Add32 x y) -> (ADDL x y) -(Add16 x y) -> (ADDW x y) -(Add8 x y) -> (ADDB x y) +(Add16 x y) -> (ADDL x y) +(Add8 x y) -> (ADDL x y) (Add32F x y) -> (ADDSS x y) (Add64F x y) -> (ADDSD x y) (Sub64 x y) -> (SUBQ x y) (SubPtr x y) -> (SUBQ x y) (Sub32 x y) -> (SUBL x y) -(Sub16 x y) -> (SUBW x y) -(Sub8 x y) -> (SUBB x y) +(Sub16 x y) -> (SUBL x y) +(Sub8 x y) -> (SUBL x y) (Sub32F x y) -> (SUBSS x y) (Sub64F x y) -> (SUBSD x y) (Mul64 x y) -> (MULQ x y) (Mul32 x y) -> (MULL x y) -(Mul16 x y) -> (MULW x y) -(Mul8 x y) -> (MULB x y) +(Mul16 x y) -> (MULL x y) +(Mul8 x y) -> (MULL x y) (Mul32F x y) -> (MULSS x y) (Mul64F x y) -> (MULSD x y) @@ -60,30 +60,30 @@ (And64 x y) -> (ANDQ x y) (And32 x y) -> (ANDL x y) -(And16 x y) -> (ANDW x y) -(And8 x y) -> (ANDB x y) +(And16 x y) -> (ANDL x y) +(And8 x y) -> (ANDL x y) (Or64 x y) -> (ORQ x y) (Or32 x y) -> (ORL x y) -(Or16 x y) -> (ORW x y) -(Or8 x y) -> (ORB x y) +(Or16 x y) -> (ORL x y) +(Or8 x y) -> (ORL x y) (Xor64 x y) -> (XORQ x y) (Xor32 x y) -> (XORL x y) -(Xor16 x y) -> (XORW x y) -(Xor8 x y) -> (XORB x y) +(Xor16 x y) -> (XORL x y) +(Xor8 x y) -> (XORL x y) (Neg64 x) -> (NEGQ x) (Neg32 x) -> (NEGL x) -(Neg16 x) -> (NEGW x) -(Neg8 x) -> (NEGB x) +(Neg16 x) -> (NEGL x) +(Neg8 x) -> (NEGL x) (Neg32F x) -> (PXOR x (MOVSSconst <config.Frontend().TypeFloat32()> [f2i(math.Copysign(0, -1))])) (Neg64F x) -> (PXOR x (MOVSDconst <config.Frontend().TypeFloat64()> [f2i(math.Copysign(0, -1))])) (Com64 x) -> (NOTQ x) (Com32 x) -> (NOTL x) -(Com16 x) -> (NOTW x) -(Com8 x) -> (NOTB x) +(Com16 x) -> (NOTL x) +(Com8 x) -> (NOTL x) // CMPQconst 0 below is redundant because BSF sets Z but how to remove? (Ctz64 <t> x) -> (CMOVQEQconst (BSFQ <t> x) (CMPQconst x [0]) [64]) @@ -169,15 +169,15 @@ (Lsh32x16 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) (Lsh32x8 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) -(Lsh16x64 <t> x y) -> (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) -(Lsh16x32 <t> x y) -> (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) -(Lsh16x16 <t> x y) -> (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) -(Lsh16x8 <t> x y) -> (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) +(Lsh16x64 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPQconst y [32]))) +(Lsh16x32 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPLconst y [32]))) +(Lsh16x16 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) +(Lsh16x8 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) -(Lsh8x64 <t> x y) -> (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) -(Lsh8x32 <t> x y) -> (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) -(Lsh8x16 <t> x y) -> (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) -(Lsh8x8 <t> x y) -> (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) +(Lsh8x64 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPQconst y [32]))) +(Lsh8x32 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPLconst y [32]))) +(Lsh8x16 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) +(Lsh8x8 <t> x y) -> (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) (Lrot64 <t> x [c]) -> (ROLQconst <t> [c&63] x) (Lrot32 <t> x [c]) -> (ROLLconst <t> [c&31] x) @@ -194,38 +194,38 @@ (Rsh32Ux16 <t> x y) -> (ANDL (SHRL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) (Rsh32Ux8 <t> x y) -> (ANDL (SHRL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) -(Rsh16Ux64 <t> x y) -> (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) -(Rsh16Ux32 <t> x y) -> (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) -(Rsh16Ux16 <t> x y) -> (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) -(Rsh16Ux8 <t> x y) -> (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) +(Rsh16Ux64 <t> x y) -> (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) +(Rsh16Ux32 <t> x y) -> (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) +(Rsh16Ux16 <t> x y) -> (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) +(Rsh16Ux8 <t> x y) -> (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) -(Rsh8Ux64 <t> x y) -> (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) -(Rsh8Ux32 <t> x y) -> (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) -(Rsh8Ux16 <t> x y) -> (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) -(Rsh8Ux8 <t> x y) -> (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) +(Rsh8Ux64 <t> x y) -> (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) +(Rsh8Ux32 <t> x y) -> (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) +(Rsh8Ux16 <t> x y) -> (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) +(Rsh8Ux8 <t> x y) -> (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) // Signed right shift needs to return 0/-1 if shift amount is >= width of shifted value. // We implement this by setting the shift value to -1 (all ones) if the shift value is >= width. // Note: for small shift widths we generate 32 bits of mask even when we don't need it all. (Rsh64x64 <t> x y) -> (SARQ <t> x (ORQ <y.Type> y (NOTQ <y.Type> (SBBQcarrymask <y.Type> (CMPQconst y [64]))))) (Rsh64x32 <t> x y) -> (SARQ <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPLconst y [64]))))) -(Rsh64x16 <t> x y) -> (SARQ <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [64]))))) -(Rsh64x8 <t> x y) -> (SARQ <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [64]))))) +(Rsh64x16 <t> x y) -> (SARQ <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [64]))))) +(Rsh64x8 <t> x y) -> (SARQ <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [64]))))) (Rsh32x64 <t> x y) -> (SARL <t> x (ORQ <y.Type> y (NOTQ <y.Type> (SBBQcarrymask <y.Type> (CMPQconst y [32]))))) (Rsh32x32 <t> x y) -> (SARL <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPLconst y [32]))))) -(Rsh32x16 <t> x y) -> (SARL <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [32]))))) -(Rsh32x8 <t> x y) -> (SARL <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [32]))))) +(Rsh32x16 <t> x y) -> (SARL <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [32]))))) +(Rsh32x8 <t> x y) -> (SARL <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [32]))))) (Rsh16x64 <t> x y) -> (SARW <t> x (ORQ <y.Type> y (NOTQ <y.Type> (SBBQcarrymask <y.Type> (CMPQconst y [16]))))) (Rsh16x32 <t> x y) -> (SARW <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPLconst y [16]))))) -(Rsh16x16 <t> x y) -> (SARW <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [16]))))) -(Rsh16x8 <t> x y) -> (SARW <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [16]))))) +(Rsh16x16 <t> x y) -> (SARW <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [16]))))) +(Rsh16x8 <t> x y) -> (SARW <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [16]))))) (Rsh8x64 <t> x y) -> (SARB <t> x (ORQ <y.Type> y (NOTQ <y.Type> (SBBQcarrymask <y.Type> (CMPQconst y [8]))))) (Rsh8x32 <t> x y) -> (SARB <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPLconst y [8]))))) -(Rsh8x16 <t> x y) -> (SARB <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [8]))))) -(Rsh8x8 <t> x y) -> (SARB <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [8]))))) +(Rsh8x16 <t> x y) -> (SARB <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [8]))))) +(Rsh8x8 <t> x y) -> (SARB <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [8]))))) (Less64 x y) -> (SETL (CMPQ x y)) (Less32 x y) -> (SETL (CMPL x y)) @@ -281,6 +281,7 @@ (Eq32 x y) -> (SETEQ (CMPL x y)) (Eq16 x y) -> (SETEQ (CMPW x y)) (Eq8 x y) -> (SETEQ (CMPB x y)) +(EqB x y) -> (SETEQ (CMPB x y)) (EqPtr x y) -> (SETEQ (CMPQ x y)) (Eq64F x y) -> (SETEQF (UCOMISD x y)) (Eq32F x y) -> (SETEQF (UCOMISS x y)) @@ -289,6 +290,7 @@ (Neq32 x y) -> (SETNE (CMPL x y)) (Neq16 x y) -> (SETNE (CMPW x y)) (Neq8 x y) -> (SETNE (CMPB x y)) +(NeqB x y) -> (SETNE (CMPB x y)) (NeqPtr x y) -> (SETNE (CMPQ x y)) (Neq64F x y) -> (SETNEF (UCOMISD x y)) (Neq32F x y) -> (SETNEF (UCOMISS x y)) @@ -366,19 +368,21 @@ (Move [size] dst src mem) && (size > 16*64 || config.noDuffDevice) && size%8 == 0 -> (REPMOVSQ dst src (MOVQconst [size/8]) mem) -(Not x) -> (XORBconst [1] x) +(AndB x y) -> (ANDL x y) +(OrB x y) -> (ORL x y) +(Not x) -> (XORLconst [1] x) (OffPtr [off] ptr) && is32Bit(off) -> (ADDQconst [off] ptr) (OffPtr [off] ptr) -> (ADDQ (MOVQconst [off]) ptr) -(Const8 [val]) -> (MOVBconst [val]) -(Const16 [val]) -> (MOVWconst [val]) +(Const8 [val]) -> (MOVLconst [val]) +(Const16 [val]) -> (MOVLconst [val]) (Const32 [val]) -> (MOVLconst [val]) (Const64 [val]) -> (MOVQconst [val]) (Const32F [val]) -> (MOVSSconst [val]) (Const64F [val]) -> (MOVSDconst [val]) (ConstNil) -> (MOVQconst [0]) -(ConstBool [b]) -> (MOVBconst [b]) +(ConstBool [b]) -> (MOVLconst [b]) (Addr {sym} base) -> (LEAQ {sym} base) @@ -404,22 +408,22 @@ (If cond yes no) -> (NE (TESTB cond cond) yes no) -(NE (TESTB (SETL cmp)) yes no) -> (LT cmp yes no) -(NE (TESTB (SETLE cmp)) yes no) -> (LE cmp yes no) -(NE (TESTB (SETG cmp)) yes no) -> (GT cmp yes no) -(NE (TESTB (SETGE cmp)) yes no) -> (GE cmp yes no) -(NE (TESTB (SETEQ cmp)) yes no) -> (EQ cmp yes no) -(NE (TESTB (SETNE cmp)) yes no) -> (NE cmp yes no) -(NE (TESTB (SETB cmp)) yes no) -> (ULT cmp yes no) -(NE (TESTB (SETBE cmp)) yes no) -> (ULE cmp yes no) -(NE (TESTB (SETA cmp)) yes no) -> (UGT cmp yes no) -(NE (TESTB (SETAE cmp)) yes no) -> (UGE cmp yes no) +(NE (TESTB (SETL cmp) (SETL cmp)) yes no) -> (LT cmp yes no) +(NE (TESTB (SETLE cmp) (SETLE cmp)) yes no) -> (LE cmp yes no) +(NE (TESTB (SETG cmp) (SETG cmp)) yes no) -> (GT cmp yes no) +(NE (TESTB (SETGE cmp) (SETGE cmp)) yes no) -> (GE cmp yes no) +(NE (TESTB (SETEQ cmp) (SETEQ cmp)) yes no) -> (EQ cmp yes no) +(NE (TESTB (SETNE cmp) (SETNE cmp)) yes no) -> (NE cmp yes no) +(NE (TESTB (SETB cmp) (SETB cmp)) yes no) -> (ULT cmp yes no) +(NE (TESTB (SETBE cmp) (SETBE cmp)) yes no) -> (ULE cmp yes no) +(NE (TESTB (SETA cmp) (SETA cmp)) yes no) -> (UGT cmp yes no) +(NE (TESTB (SETAE cmp) (SETAE cmp)) yes no) -> (UGE cmp yes no) // Special case for floating point - LF/LEF not generated -(NE (TESTB (SETGF cmp)) yes no) -> (UGT cmp yes no) -(NE (TESTB (SETGEF cmp)) yes no) -> (UGE cmp yes no) -(NE (TESTB (SETEQF cmp)) yes no) -> (EQF cmp yes no) -(NE (TESTB (SETNEF cmp)) yes no) -> (NEF cmp yes no) +(NE (TESTB (SETGF cmp) (SETGF cmp)) yes no) -> (UGT cmp yes no) +(NE (TESTB (SETGEF cmp) (SETGEF cmp)) yes no) -> (UGE cmp yes no) +(NE (TESTB (SETEQF cmp) (SETEQF cmp)) yes no) -> (EQF cmp yes no) +(NE (TESTB (SETNEF cmp) (SETNEF cmp)) yes no) -> (NEF cmp yes no) // Disabled because it interferes with the pattern match above and makes worse code. // (SETNEF x) -> (ORQ (SETNE <config.Frontend().TypeInt8()> x) (SETNAN <config.Frontend().TypeInt8()> x)) @@ -439,44 +443,22 @@ (ADDQ (MOVQconst [c]) x) && is32Bit(c) -> (ADDQconst [c] x) (ADDL x (MOVLconst [c])) -> (ADDLconst [c] x) (ADDL (MOVLconst [c]) x) -> (ADDLconst [c] x) -(ADDW x (MOVWconst [c])) -> (ADDWconst [c] x) -(ADDW (MOVWconst [c]) x) -> (ADDWconst [c] x) -(ADDB x (MOVBconst [c])) -> (ADDBconst [c] x) -(ADDB (MOVBconst [c]) x) -> (ADDBconst [c] x) (SUBQ x (MOVQconst [c])) && is32Bit(c) -> (SUBQconst x [c]) (SUBQ (MOVQconst [c]) x) && is32Bit(c) -> (NEGQ (SUBQconst <v.Type> x [c])) (SUBL x (MOVLconst [c])) -> (SUBLconst x [c]) (SUBL (MOVLconst [c]) x) -> (NEGL (SUBLconst <v.Type> x [c])) -(SUBW x (MOVWconst [c])) -> (SUBWconst x [c]) -(SUBW (MOVWconst [c]) x) -> (NEGW (SUBWconst <v.Type> x [c])) -(SUBB x (MOVBconst [c])) -> (SUBBconst x [c]) -(SUBB (MOVBconst [c]) x) -> (NEGB (SUBBconst <v.Type> x [c])) (MULQ x (MOVQconst [c])) && is32Bit(c) -> (MULQconst [c] x) (MULQ (MOVQconst [c]) x) && is32Bit(c) -> (MULQconst [c] x) (MULL x (MOVLconst [c])) -> (MULLconst [c] x) (MULL (MOVLconst [c]) x) -> (MULLconst [c] x) -(MULW x (MOVWconst [c])) -> (MULWconst [c] x) -(MULW (MOVWconst [c]) x) -> (MULWconst [c] x) -(MULB x (MOVBconst [c])) -> (MULBconst [c] x) -(MULB (MOVBconst [c]) x) -> (MULBconst [c] x) (ANDQ x (MOVQconst [c])) && is32Bit(c) -> (ANDQconst [c] x) (ANDQ (MOVQconst [c]) x) && is32Bit(c) -> (ANDQconst [c] x) (ANDL x (MOVLconst [c])) -> (ANDLconst [c] x) (ANDL (MOVLconst [c]) x) -> (ANDLconst [c] x) -(ANDW x (MOVLconst [c])) -> (ANDWconst [c] x) -(ANDW (MOVLconst [c]) x) -> (ANDWconst [c] x) -(ANDW x (MOVWconst [c])) -> (ANDWconst [c] x) -(ANDW (MOVWconst [c]) x) -> (ANDWconst [c] x) -(ANDB x (MOVLconst [c])) -> (ANDBconst [c] x) -(ANDB (MOVLconst [c]) x) -> (ANDBconst [c] x) -(ANDB x (MOVBconst [c])) -> (ANDBconst [c] x) -(ANDB (MOVBconst [c]) x) -> (ANDBconst [c] x) -(ANDBconst [c] (ANDBconst [d] x)) -> (ANDBconst [c & d] x) -(ANDWconst [c] (ANDWconst [d] x)) -> (ANDWconst [c & d] x) (ANDLconst [c] (ANDLconst [d] x)) -> (ANDLconst [c & d] x) (ANDQconst [c] (ANDQconst [d] x)) -> (ANDQconst [c & d] x) @@ -484,108 +466,69 @@ (ORQ (MOVQconst [c]) x) && is32Bit(c) -> (ORQconst [c] x) (ORL x (MOVLconst [c])) -> (ORLconst [c] x) (ORL (MOVLconst [c]) x) -> (ORLconst [c] x) -(ORW x (MOVWconst [c])) -> (ORWconst [c] x) -(ORW (MOVWconst [c]) x) -> (ORWconst [c] x) -(ORB x (MOVBconst [c])) -> (ORBconst [c] x) -(ORB (MOVBconst [c]) x) -> (ORBconst [c] x) (XORQ x (MOVQconst [c])) && is32Bit(c) -> (XORQconst [c] x) (XORQ (MOVQconst [c]) x) && is32Bit(c) -> (XORQconst [c] x) (XORL x (MOVLconst [c])) -> (XORLconst [c] x) (XORL (MOVLconst [c]) x) -> (XORLconst [c] x) -(XORW x (MOVWconst [c])) -> (XORWconst [c] x) -(XORW (MOVWconst [c]) x) -> (XORWconst [c] x) -(XORB x (MOVBconst [c])) -> (XORBconst [c] x) -(XORB (MOVBconst [c]) x) -> (XORBconst [c] x) (SHLQ x (MOVQconst [c])) -> (SHLQconst [c&63] x) (SHLQ x (MOVLconst [c])) -> (SHLQconst [c&63] x) -(SHLQ x (MOVWconst [c])) -> (SHLQconst [c&63] x) -(SHLQ x (MOVBconst [c])) -> (SHLQconst [c&63] x) (SHLL x (MOVQconst [c])) -> (SHLLconst [c&31] x) (SHLL x (MOVLconst [c])) -> (SHLLconst [c&31] x) -(SHLL x (MOVWconst [c])) -> (SHLLconst [c&31] x) -(SHLL x (MOVBconst [c])) -> (SHLLconst [c&31] x) - -(SHLW x (MOVQconst [c])) -> (SHLWconst [c&31] x) -(SHLW x (MOVLconst [c])) -> (SHLWconst [c&31] x) -(SHLW x (MOVWconst [c])) -> (SHLWconst [c&31] x) -(SHLW x (MOVBconst [c])) -> (SHLWconst [c&31] x) - -(SHLB x (MOVQconst [c])) -> (SHLBconst [c&31] x) -(SHLB x (MOVLconst [c])) -> (SHLBconst [c&31] x) -(SHLB x (MOVWconst [c])) -> (SHLBconst [c&31] x) -(SHLB x (MOVBconst [c])) -> (SHLBconst [c&31] x) (SHRQ x (MOVQconst [c])) -> (SHRQconst [c&63] x) (SHRQ x (MOVLconst [c])) -> (SHRQconst [c&63] x) -(SHRQ x (MOVWconst [c])) -> (SHRQconst [c&63] x) -(SHRQ x (MOVBconst [c])) -> (SHRQconst [c&63] x) (SHRL x (MOVQconst [c])) -> (SHRLconst [c&31] x) (SHRL x (MOVLconst [c])) -> (SHRLconst [c&31] x) -(SHRL x (MOVWconst [c])) -> (SHRLconst [c&31] x) -(SHRL x (MOVBconst [c])) -> (SHRLconst [c&31] x) (SHRW x (MOVQconst [c])) -> (SHRWconst [c&31] x) (SHRW x (MOVLconst [c])) -> (SHRWconst [c&31] x) -(SHRW x (MOVWconst [c])) -> (SHRWconst [c&31] x) -(SHRW x (MOVBconst [c])) -> (SHRWconst [c&31] x) (SHRB x (MOVQconst [c])) -> (SHRBconst [c&31] x) (SHRB x (MOVLconst [c])) -> (SHRBconst [c&31] x) -(SHRB x (MOVWconst [c])) -> (SHRBconst [c&31] x) -(SHRB x (MOVBconst [c])) -> (SHRBconst [c&31] x) (SARQ x (MOVQconst [c])) -> (SARQconst [c&63] x) (SARQ x (MOVLconst [c])) -> (SARQconst [c&63] x) -(SARQ x (MOVWconst [c])) -> (SARQconst [c&63] x) -(SARQ x (MOVBconst [c])) -> (SARQconst [c&63] x) (SARL x (MOVQconst [c])) -> (SARLconst [c&31] x) (SARL x (MOVLconst [c])) -> (SARLconst [c&31] x) -(SARL x (MOVWconst [c])) -> (SARLconst [c&31] x) -(SARL x (MOVBconst [c])) -> (SARLconst [c&31] x) (SARW x (MOVQconst [c])) -> (SARWconst [c&31] x) (SARW x (MOVLconst [c])) -> (SARWconst [c&31] x) -(SARW x (MOVWconst [c])) -> (SARWconst [c&31] x) -(SARW x (MOVBconst [c])) -> (SARWconst [c&31] x) (SARB x (MOVQconst [c])) -> (SARBconst [c&31] x) (SARB x (MOVLconst [c])) -> (SARBconst [c&31] x) -(SARB x (MOVWconst [c])) -> (SARBconst [c&31] x) -(SARB x (MOVBconst [c])) -> (SARBconst [c&31] x) -(SARB x (ANDBconst [31] y)) -> (SARB x y) -(SARW x (ANDWconst [31] y)) -> (SARW x y) (SARL x (ANDLconst [31] y)) -> (SARL x y) (SARQ x (ANDQconst [63] y)) -> (SARQ x y) -(SHLB x (ANDBconst [31] y)) -> (SHLB x y) -(SHLW x (ANDWconst [31] y)) -> (SHLW x y) (SHLL x (ANDLconst [31] y)) -> (SHLL x y) (SHLQ x (ANDQconst [63] y)) -> (SHLQ x y) -(SHRB x (ANDBconst [31] y)) -> (SHRB x y) -(SHRW x (ANDWconst [31] y)) -> (SHRW x y) (SHRL x (ANDLconst [31] y)) -> (SHRL x y) (SHRQ x (ANDQconst [63] y)) -> (SHRQ x y) // Note: the word and byte shifts keep the low 5 bits (not the low 4 or 3 bits) // because the x86 instructions are defined to use all 5 bits of the shift even // for the small shifts. I don't think we'll ever generate a weird shift (e.g. -// (SHLW x (MOVWconst [24])), but just in case. +// (SHRW x (MOVLconst [24])), but just in case. (CMPQ x (MOVQconst [c])) && is32Bit(c) -> (CMPQconst x [c]) (CMPQ (MOVQconst [c]) x) && is32Bit(c) -> (InvertFlags (CMPQconst x [c])) (CMPL x (MOVLconst [c])) -> (CMPLconst x [c]) (CMPL (MOVLconst [c]) x) -> (InvertFlags (CMPLconst x [c])) -(CMPW x (MOVWconst [c])) -> (CMPWconst x [c]) -(CMPW (MOVWconst [c]) x) -> (InvertFlags (CMPWconst x [c])) -(CMPB x (MOVBconst [c])) -> (CMPBconst x [c]) -(CMPB (MOVBconst [c]) x) -> (InvertFlags (CMPBconst x [c])) +(CMPW x (MOVLconst [c])) -> (CMPWconst x [int64(int16(c))]) +(CMPW (MOVLconst [c]) x) -> (InvertFlags (CMPWconst x [int64(int16(c))])) +(CMPB x (MOVLconst [c])) -> (CMPBconst x [int64(int8(c))]) +(CMPB (MOVLconst [c]) x) -> (InvertFlags (CMPBconst x [int64(int8(c))])) + +// Using MOVBQZX instead of ANDQ is cheaper. +(ANDQconst [0xFF] x) -> (MOVBQZX x) +(ANDQconst [0xFFFF] x) -> (MOVWQZX x) +(ANDQconst [0xFFFFFFFF] x) -> (MOVLQZX x) // strength reduction // Assumes that the following costs from https://gmplib.org/~tege/x86-timing.pdf: @@ -684,18 +627,18 @@ // Make sure we don't combine these ops if the load has another use. // This prevents a single load from being split into multiple loads // which then might return different values. See test/atomicload.go. -(MOVBQSX x:(MOVBload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVBQSXload <v.Type> [off] {sym} ptr mem) -(MOVBQZX x:(MOVBload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVBload <v.Type> [off] {sym} ptr mem) -(MOVWQSX x:(MOVWload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVWQSXload <v.Type> [off] {sym} ptr mem) -(MOVWQZX x:(MOVWload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVWload <v.Type> [off] {sym} ptr mem) -(MOVLQSX x:(MOVLload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVLQSXload <v.Type> [off] {sym} ptr mem) -(MOVLQZX x:(MOVLload [off] {sym} ptr mem)) && x.Uses == 1 -> @x.Block (MOVLload <v.Type> [off] {sym} ptr mem) +(MOVBQSX x:(MOVBload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVBQSXload <v.Type> [off] {sym} ptr mem) +(MOVBQZX x:(MOVBload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVBload <v.Type> [off] {sym} ptr mem) +(MOVWQSX x:(MOVWload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVWQSXload <v.Type> [off] {sym} ptr mem) +(MOVWQZX x:(MOVWload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVWload <v.Type> [off] {sym} ptr mem) +(MOVLQSX x:(MOVLload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVLQSXload <v.Type> [off] {sym} ptr mem) +(MOVLQZX x:(MOVLload [off] {sym} ptr mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVLload <v.Type> [off] {sym} ptr mem) -(MOVBQZX x:(MOVBloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 -> @x.Block (MOVBloadidx1 <v.Type> [off] {sym} ptr idx mem) -(MOVWQZX x:(MOVWloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 -> @x.Block (MOVWloadidx1 <v.Type> [off] {sym} ptr idx mem) -(MOVWQZX x:(MOVWloadidx2 [off] {sym} ptr idx mem)) && x.Uses == 1 -> @x.Block (MOVWloadidx2 <v.Type> [off] {sym} ptr idx mem) -(MOVLQZX x:(MOVLloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 -> @x.Block (MOVLloadidx1 <v.Type> [off] {sym} ptr idx mem) -(MOVLQZX x:(MOVLloadidx4 [off] {sym} ptr idx mem)) && x.Uses == 1 -> @x.Block (MOVLloadidx4 <v.Type> [off] {sym} ptr idx mem) +(MOVBQZX x:(MOVBloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVBloadidx1 <v.Type> [off] {sym} ptr idx mem) +(MOVWQZX x:(MOVWloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVWloadidx1 <v.Type> [off] {sym} ptr idx mem) +(MOVWQZX x:(MOVWloadidx2 [off] {sym} ptr idx mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVWloadidx2 <v.Type> [off] {sym} ptr idx mem) +(MOVLQZX x:(MOVLloadidx1 [off] {sym} ptr idx mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVLloadidx1 <v.Type> [off] {sym} ptr idx mem) +(MOVLQZX x:(MOVLloadidx4 [off] {sym} ptr idx mem)) && x.Uses == 1 && clobber(x) -> @x.Block (MOVLloadidx4 <v.Type> [off] {sym} ptr idx mem) // replace load from same location as preceding store with copy (MOVBload [off] {sym} ptr (MOVBstore [off2] {sym2} ptr2 x _)) && sym == sym2 && off == off2 && isSamePtr(ptr, ptr2) -> x @@ -704,12 +647,12 @@ (MOVQload [off] {sym} ptr (MOVQstore [off2] {sym2} ptr2 x _)) && sym == sym2 && off == off2 && isSamePtr(ptr, ptr2) -> x // Fold extensions and ANDs together. -(MOVBQZX (ANDBconst [c] x)) -> (ANDQconst [c & 0xff] x) -(MOVWQZX (ANDWconst [c] x)) -> (ANDQconst [c & 0xffff] x) -(MOVLQZX (ANDLconst [c] x)) && c & 0x80000000 == 0 -> (ANDQconst [c & 0x7fffffff] x) -(MOVBQSX (ANDBconst [c] x)) && c & 0x80 == 0 -> (ANDQconst [c & 0x7f] x) -(MOVWQSX (ANDWconst [c] x)) && c & 0x8000 == 0 -> (ANDQconst [c & 0x7fff] x) -(MOVLQSX (ANDLconst [c] x)) && c & 0x80000000 == 0 -> (ANDQconst [c & 0x7fffffff] x) +(MOVBQZX (ANDLconst [c] x)) -> (ANDLconst [c & 0xff] x) +(MOVWQZX (ANDLconst [c] x)) -> (ANDLconst [c & 0xffff] x) +(MOVLQZX (ANDLconst [c] x)) -> (ANDLconst [c] x) +(MOVBQSX (ANDLconst [c] x)) && c & 0x80 == 0 -> (ANDLconst [c & 0x7f] x) +(MOVWQSX (ANDLconst [c] x)) && c & 0x8000 == 0 -> (ANDLconst [c & 0x7fff] x) +(MOVLQSX (ANDLconst [c] x)) && c & 0x80000000 == 0 -> (ANDLconst [c & 0x7fffffff] x) // Don't extend before storing (MOVLstore [off] {sym} ptr (MOVLQSX x) mem) -> (MOVLstore [off] {sym} ptr x mem) @@ -745,9 +688,9 @@ (MOVQstoreconst [makeValAndOff(c,off)] {sym} ptr mem) (MOVLstore [off] {sym} ptr (MOVLconst [c]) mem) && validOff(off) -> (MOVLstoreconst [makeValAndOff(int64(int32(c)),off)] {sym} ptr mem) -(MOVWstore [off] {sym} ptr (MOVWconst [c]) mem) && validOff(off) -> +(MOVWstore [off] {sym} ptr (MOVLconst [c]) mem) && validOff(off) -> (MOVWstoreconst [makeValAndOff(int64(int16(c)),off)] {sym} ptr mem) -(MOVBstore [off] {sym} ptr (MOVBconst [c]) mem) && validOff(off) -> +(MOVBstore [off] {sym} ptr (MOVLconst [c]) mem) && validOff(off) -> (MOVBstoreconst [makeValAndOff(int64(int8(c)),off)] {sym} ptr mem) // Fold address offsets into constant stores. @@ -1081,22 +1024,27 @@ (CMPLconst (MOVLconst [x]) [y]) && int32(x)<int32(y) && uint32(x)>uint32(y) -> (FlagLT_UGT) (CMPLconst (MOVLconst [x]) [y]) && int32(x)>int32(y) && uint32(x)<uint32(y) -> (FlagGT_ULT) (CMPLconst (MOVLconst [x]) [y]) && int32(x)>int32(y) && uint32(x)>uint32(y) -> (FlagGT_UGT) -(CMPWconst (MOVWconst [x]) [y]) && int16(x)==int16(y) -> (FlagEQ) -(CMPWconst (MOVWconst [x]) [y]) && int16(x)<int16(y) && uint16(x)<uint16(y) -> (FlagLT_ULT) -(CMPWconst (MOVWconst [x]) [y]) && int16(x)<int16(y) && uint16(x)>uint16(y) -> (FlagLT_UGT) -(CMPWconst (MOVWconst [x]) [y]) && int16(x)>int16(y) && uint16(x)<uint16(y) -> (FlagGT_ULT) -(CMPWconst (MOVWconst [x]) [y]) && int16(x)>int16(y) && uint16(x)>uint16(y) -> (FlagGT_UGT) -(CMPBconst (MOVBconst [x]) [y]) && int8(x)==int8(y) -> (FlagEQ) -(CMPBconst (MOVBconst [x]) [y]) && int8(x)<int8(y) && uint8(x)<uint8(y) -> (FlagLT_ULT) -(CMPBconst (MOVBconst [x]) [y]) && int8(x)<int8(y) && uint8(x)>uint8(y) -> (FlagLT_UGT) -(CMPBconst (MOVBconst [x]) [y]) && int8(x)>int8(y) && uint8(x)<uint8(y) -> (FlagGT_ULT) -(CMPBconst (MOVBconst [x]) [y]) && int8(x)>int8(y) && uint8(x)>uint8(y) -> (FlagGT_UGT) +(CMPWconst (MOVLconst [x]) [y]) && int16(x)==int16(y) -> (FlagEQ) +(CMPWconst (MOVLconst [x]) [y]) && int16(x)<int16(y) && uint16(x)<uint16(y) -> (FlagLT_ULT) +(CMPWconst (MOVLconst [x]) [y]) && int16(x)<int16(y) && uint16(x)>uint16(y) -> (FlagLT_UGT) +(CMPWconst (MOVLconst [x]) [y]) && int16(x)>int16(y) && uint16(x)<uint16(y) -> (FlagGT_ULT) +(CMPWconst (MOVLconst [x]) [y]) && int16(x)>int16(y) && uint16(x)>uint16(y) -> (FlagGT_UGT) +(CMPBconst (MOVLconst [x]) [y]) && int8(x)==int8(y) -> (FlagEQ) +(CMPBconst (MOVLconst [x]) [y]) && int8(x)<int8(y) && uint8(x)<uint8(y) -> (FlagLT_ULT) +(CMPBconst (MOVLconst [x]) [y]) && int8(x)<int8(y) && uint8(x)>uint8(y) -> (FlagLT_UGT) +(CMPBconst (MOVLconst [x]) [y]) && int8(x)>int8(y) && uint8(x)<uint8(y) -> (FlagGT_ULT) +(CMPBconst (MOVLconst [x]) [y]) && int8(x)>int8(y) && uint8(x)>uint8(y) -> (FlagGT_UGT) // Other known comparisons. +(CMPQconst (MOVBQZX _) [c]) && 0xFF < c -> (FlagLT_ULT) +(CMPQconst (MOVWQZX _) [c]) && 0xFFFF < c -> (FlagLT_ULT) +(CMPQconst (MOVLQZX _) [c]) && 0xFFFFFFFF < c -> (FlagLT_ULT) +(CMPLconst (SHRLconst _ [c]) [n]) && 0 <= n && 0 < c && c <= 32 && (1<<uint64(32-c)) <= uint64(n) -> (FlagLT_ULT) +(CMPQconst (SHRQconst _ [c]) [n]) && 0 <= n && 0 < c && c <= 64 && (1<<uint64(64-c)) <= uint64(n) -> (FlagLT_ULT) (CMPQconst (ANDQconst _ [m]) [n]) && 0 <= m && m < n -> (FlagLT_ULT) (CMPLconst (ANDLconst _ [m]) [n]) && 0 <= int32(m) && int32(m) < int32(n) -> (FlagLT_ULT) -(CMPWconst (ANDWconst _ [m]) [n]) && 0 <= int16(m) && int16(m) < int16(n) -> (FlagLT_ULT) -(CMPBconst (ANDBconst _ [m]) [n]) && 0 <= int8(m) && int8(m) < int8(n) -> (FlagLT_ULT) +(CMPWconst (ANDLconst _ [m]) [n]) && 0 <= int16(m) && int16(m) < int16(n) -> (FlagLT_ULT) +(CMPBconst (ANDLconst _ [m]) [n]) && 0 <= int8(m) && int8(m) < int8(n) -> (FlagLT_ULT) // TODO: DIVxU also. // Absorb flag constants into SBB ops. @@ -1173,175 +1121,140 @@ (UGE (FlagGT_UGT) yes no) -> (First nil yes no) // Absorb flag constants into SETxx ops. -(SETEQ (FlagEQ)) -> (MOVBconst [1]) -(SETEQ (FlagLT_ULT)) -> (MOVBconst [0]) -(SETEQ (FlagLT_UGT)) -> (MOVBconst [0]) -(SETEQ (FlagGT_ULT)) -> (MOVBconst [0]) -(SETEQ (FlagGT_UGT)) -> (MOVBconst [0]) +(SETEQ (FlagEQ)) -> (MOVLconst [1]) +(SETEQ (FlagLT_ULT)) -> (MOVLconst [0]) +(SETEQ (FlagLT_UGT)) -> (MOVLconst [0]) +(SETEQ (FlagGT_ULT)) -> (MOVLconst [0]) +(SETEQ (FlagGT_UGT)) -> (MOVLconst [0]) -(SETNE (FlagEQ)) -> (MOVBconst [0]) -(SETNE (FlagLT_ULT)) -> (MOVBconst [1]) -(SETNE (FlagLT_UGT)) -> (MOVBconst [1]) -(SETNE (FlagGT_ULT)) -> (MOVBconst [1]) -(SETNE (FlagGT_UGT)) -> (MOVBconst [1]) +(SETNE (FlagEQ)) -> (MOVLconst [0]) +(SETNE (FlagLT_ULT)) -> (MOVLconst [1]) +(SETNE (FlagLT_UGT)) -> (MOVLconst [1]) +(SETNE (FlagGT_ULT)) -> (MOVLconst [1]) +(SETNE (FlagGT_UGT)) -> (MOVLconst [1]) -(SETL (FlagEQ)) -> (MOVBconst [0]) -(SETL (FlagLT_ULT)) -> (MOVBconst [1]) -(SETL (FlagLT_UGT)) -> (MOVBconst [1]) -(SETL (FlagGT_ULT)) -> (MOVBconst [0]) -(SETL (FlagGT_UGT)) -> (MOVBconst [0]) +(SETL (FlagEQ)) -> (MOVLconst [0]) +(SETL (FlagLT_ULT)) -> (MOVLconst [1]) +(SETL (FlagLT_UGT)) -> (MOVLconst [1]) +(SETL (FlagGT_ULT)) -> (MOVLconst [0]) +(SETL (FlagGT_UGT)) -> (MOVLconst [0]) -(SETLE (FlagEQ)) -> (MOVBconst [1]) -(SETLE (FlagLT_ULT)) -> (MOVBconst [1]) -(SETLE (FlagLT_UGT)) -> (MOVBconst [1]) -(SETLE (FlagGT_ULT)) -> (MOVBconst [0]) -(SETLE (FlagGT_UGT)) -> (MOVBconst [0]) +(SETLE (FlagEQ)) -> (MOVLconst [1]) +(SETLE (FlagLT_ULT)) -> (MOVLconst [1]) +(SETLE (FlagLT_UGT)) -> (MOVLconst [1]) +(SETLE (FlagGT_ULT)) -> (MOVLconst [0]) +(SETLE (FlagGT_UGT)) -> (MOVLconst [0]) -(SETG (FlagEQ)) -> (MOVBconst [0]) -(SETG (FlagLT_ULT)) -> (MOVBconst [0]) -(SETG (FlagLT_UGT)) -> (MOVBconst [0]) -(SETG (FlagGT_ULT)) -> (MOVBconst [1]) -(SETG (FlagGT_UGT)) -> (MOVBconst [1]) +(SETG (FlagEQ)) -> (MOVLconst [0]) +(SETG (FlagLT_ULT)) -> (MOVLconst [0]) +(SETG (FlagLT_UGT)) -> (MOVLconst [0]) +(SETG (FlagGT_ULT)) -> (MOVLconst [1]) +(SETG (FlagGT_UGT)) -> (MOVLconst [1]) -(SETGE (FlagEQ)) -> (MOVBconst [1]) -(SETGE (FlagLT_ULT)) -> (MOVBconst [0]) -(SETGE (FlagLT_UGT)) -> (MOVBconst [0]) -(SETGE (FlagGT_ULT)) -> (MOVBconst [1]) -(SETGE (FlagGT_UGT)) -> (MOVBconst [1]) +(SETGE (FlagEQ)) -> (MOVLconst [1]) +(SETGE (FlagLT_ULT)) -> (MOVLconst [0]) +(SETGE (FlagLT_UGT)) -> (MOVLconst [0]) +(SETGE (FlagGT_ULT)) -> (MOVLconst [1]) +(SETGE (FlagGT_UGT)) -> (MOVLconst [1]) -(SETB (FlagEQ)) -> (MOVBconst [0]) -(SETB (FlagLT_ULT)) -> (MOVBconst [1]) -(SETB (FlagLT_UGT)) -> (MOVBconst [0]) -(SETB (FlagGT_ULT)) -> (MOVBconst [1]) -(SETB (FlagGT_UGT)) -> (MOVBconst [0]) +(SETB (FlagEQ)) -> (MOVLconst [0]) +(SETB (FlagLT_ULT)) -> (MOVLconst [1]) +(SETB (FlagLT_UGT)) -> (MOVLconst [0]) +(SETB (FlagGT_ULT)) -> (MOVLconst [1]) +(SETB (FlagGT_UGT)) -> (MOVLconst [0]) -(SETBE (FlagEQ)) -> (MOVBconst [1]) -(SETBE (FlagLT_ULT)) -> (MOVBconst [1]) -(SETBE (FlagLT_UGT)) -> (MOVBconst [0]) -(SETBE (FlagGT_ULT)) -> (MOVBconst [1]) -(SETBE (FlagGT_UGT)) -> (MOVBconst [0]) +(SETBE (FlagEQ)) -> (MOVLconst [1]) +(SETBE (FlagLT_ULT)) -> (MOVLconst [1]) +(SETBE (FlagLT_UGT)) -> (MOVLconst [0]) +(SETBE (FlagGT_ULT)) -> (MOVLconst [1]) +(SETBE (FlagGT_UGT)) -> (MOVLconst [0]) -(SETA (FlagEQ)) -> (MOVBconst [0]) -(SETA (FlagLT_ULT)) -> (MOVBconst [0]) -(SETA (FlagLT_UGT)) -> (MOVBconst [1]) -(SETA (FlagGT_ULT)) -> (MOVBconst [0]) -(SETA (FlagGT_UGT)) -> (MOVBconst [1]) +(SETA (FlagEQ)) -> (MOVLconst [0]) +(SETA (FlagLT_ULT)) -> (MOVLconst [0]) +(SETA (FlagLT_UGT)) -> (MOVLconst [1]) +(SETA (FlagGT_ULT)) -> (MOVLconst [0]) +(SETA (FlagGT_UGT)) -> (MOVLconst [1]) -(SETAE (FlagEQ)) -> (MOVBconst [1]) -(SETAE (FlagLT_ULT)) -> (MOVBconst [0]) -(SETAE (FlagLT_UGT)) -> (MOVBconst [1]) -(SETAE (FlagGT_ULT)) -> (MOVBconst [0]) -(SETAE (FlagGT_UGT)) -> (MOVBconst [1]) +(SETAE (FlagEQ)) -> (MOVLconst [1]) +(SETAE (FlagLT_ULT)) -> (MOVLconst [0]) +(SETAE (FlagLT_UGT)) -> (MOVLconst [1]) +(SETAE (FlagGT_ULT)) -> (MOVLconst [0]) +(SETAE (FlagGT_UGT)) -> (MOVLconst [1]) // Remove redundant *const ops (ADDQconst [0] x) -> x (ADDLconst [c] x) && int32(c)==0 -> x -(ADDWconst [c] x) && int16(c)==0 -> x -(ADDBconst [c] x) && int8(c)==0 -> x (SUBQconst [0] x) -> x (SUBLconst [c] x) && int32(c) == 0 -> x -(SUBWconst [c] x) && int16(c) == 0 -> x -(SUBBconst [c] x) && int8(c) == 0 -> x (ANDQconst [0] _) -> (MOVQconst [0]) (ANDLconst [c] _) && int32(c)==0 -> (MOVLconst [0]) -(ANDWconst [c] _) && int16(c)==0 -> (MOVWconst [0]) -(ANDBconst [c] _) && int8(c)==0 -> (MOVBconst [0]) (ANDQconst [-1] x) -> x (ANDLconst [c] x) && int32(c)==-1 -> x -(ANDWconst [c] x) && int16(c)==-1 -> x -(ANDBconst [c] x) && int8(c)==-1 -> x (ORQconst [0] x) -> x (ORLconst [c] x) && int32(c)==0 -> x -(ORWconst [c] x) && int16(c)==0 -> x -(ORBconst [c] x) && int8(c)==0 -> x (ORQconst [-1] _) -> (MOVQconst [-1]) (ORLconst [c] _) && int32(c)==-1 -> (MOVLconst [-1]) -(ORWconst [c] _) && int16(c)==-1 -> (MOVWconst [-1]) -(ORBconst [c] _) && int8(c)==-1 -> (MOVBconst [-1]) (XORQconst [0] x) -> x (XORLconst [c] x) && int32(c)==0 -> x -(XORWconst [c] x) && int16(c)==0 -> x -(XORBconst [c] x) && int8(c)==0 -> x +// TODO: since we got rid of the W/B versions, we might miss +// things like (ANDLconst [0x100] x) which were formerly +// (ANDBconst [0] x). Probably doesn't happen very often. +// If we cared, we might do: +// (ANDLconst <t> [c] x) && t.Size()==1 && int8(x)==0 -> (MOVLconst [0]) + +// Convert constant subtracts to constant adds +(SUBQconst [c] x) && c != -(1<<31) -> (ADDQconst [-c] x) +(SUBLconst [c] x) -> (ADDLconst [int64(int32(-c))] x) // generic constant folding // TODO: more of this (ADDQconst [c] (MOVQconst [d])) -> (MOVQconst [c+d]) (ADDLconst [c] (MOVLconst [d])) -> (MOVLconst [int64(int32(c+d))]) -(ADDWconst [c] (MOVWconst [d])) -> (MOVWconst [int64(int16(c+d))]) -(ADDBconst [c] (MOVBconst [d])) -> (MOVBconst [int64(int8(c+d))]) (ADDQconst [c] (ADDQconst [d] x)) && is32Bit(c+d) -> (ADDQconst [c+d] x) (ADDLconst [c] (ADDLconst [d] x)) -> (ADDLconst [int64(int32(c+d))] x) -(ADDWconst [c] (ADDWconst [d] x)) -> (ADDWconst [int64(int16(c+d))] x) -(ADDBconst [c] (ADDBconst [d] x)) -> (ADDBconst [int64(int8(c+d))] x) (SUBQconst (MOVQconst [d]) [c]) -> (MOVQconst [d-c]) (SUBLconst (MOVLconst [d]) [c]) -> (MOVLconst [int64(int32(d-c))]) -(SUBWconst (MOVWconst [d]) [c]) -> (MOVWconst [int64(int16(d-c))]) -(SUBBconst (MOVBconst [d]) [c]) -> (MOVBconst [int64(int8(d-c))]) (SUBQconst (SUBQconst x [d]) [c]) && is32Bit(-c-d) -> (ADDQconst [-c-d] x) (SUBLconst (SUBLconst x [d]) [c]) -> (ADDLconst [int64(int32(-c-d))] x) -(SUBWconst (SUBWconst x [d]) [c]) -> (ADDWconst [int64(int16(-c-d))] x) -(SUBBconst (SUBBconst x [d]) [c]) -> (ADDBconst [int64(int8(-c-d))] x) (SARQconst [c] (MOVQconst [d])) -> (MOVQconst [d>>uint64(c)]) (SARLconst [c] (MOVQconst [d])) -> (MOVQconst [d>>uint64(c)]) (SARWconst [c] (MOVQconst [d])) -> (MOVQconst [d>>uint64(c)]) (SARBconst [c] (MOVQconst [d])) -> (MOVQconst [d>>uint64(c)]) (NEGQ (MOVQconst [c])) -> (MOVQconst [-c]) (NEGL (MOVLconst [c])) -> (MOVLconst [int64(int32(-c))]) -(NEGW (MOVWconst [c])) -> (MOVWconst [int64(int16(-c))]) -(NEGB (MOVBconst [c])) -> (MOVBconst [int64(int8(-c))]) (MULQconst [c] (MOVQconst [d])) -> (MOVQconst [c*d]) (MULLconst [c] (MOVLconst [d])) -> (MOVLconst [int64(int32(c*d))]) -(MULWconst [c] (MOVWconst [d])) -> (MOVWconst [int64(int16(c*d))]) -(MULBconst [c] (MOVBconst [d])) -> (MOVBconst [int64(int8(c*d))]) (ANDQconst [c] (MOVQconst [d])) -> (MOVQconst [c&d]) (ANDLconst [c] (MOVLconst [d])) -> (MOVLconst [c&d]) -(ANDWconst [c] (MOVWconst [d])) -> (MOVWconst [c&d]) -(ANDBconst [c] (MOVBconst [d])) -> (MOVBconst [c&d]) (ORQconst [c] (MOVQconst [d])) -> (MOVQconst [c|d]) (ORLconst [c] (MOVLconst [d])) -> (MOVLconst [c|d]) -(ORWconst [c] (MOVWconst [d])) -> (MOVWconst [c|d]) -(ORBconst [c] (MOVBconst [d])) -> (MOVBconst [c|d]) (XORQconst [c] (MOVQconst [d])) -> (MOVQconst [c^d]) (XORLconst [c] (MOVLconst [d])) -> (MOVLconst [c^d]) -(XORWconst [c] (MOVWconst [d])) -> (MOVWconst [c^d]) -(XORBconst [c] (MOVBconst [d])) -> (MOVBconst [c^d]) (NOTQ (MOVQconst [c])) -> (MOVQconst [^c]) (NOTL (MOVLconst [c])) -> (MOVLconst [^c]) -(NOTW (MOVWconst [c])) -> (MOVWconst [^c]) -(NOTB (MOVBconst [c])) -> (MOVBconst [^c]) // generic simplifications // TODO: more of this (ADDQ x (NEGQ y)) -> (SUBQ x y) (ADDL x (NEGL y)) -> (SUBL x y) -(ADDW x (NEGW y)) -> (SUBW x y) -(ADDB x (NEGB y)) -> (SUBB x y) (SUBQ x x) -> (MOVQconst [0]) (SUBL x x) -> (MOVLconst [0]) -(SUBW x x) -> (MOVWconst [0]) -(SUBB x x) -> (MOVBconst [0]) (ANDQ x x) -> x (ANDL x x) -> x -(ANDW x x) -> x -(ANDB x x) -> x (ORQ x x) -> x (ORL x x) -> x -(ORW x x) -> x -(ORB x x) -> x (XORQ x x) -> (MOVQconst [0]) (XORL x x) -> (MOVLconst [0]) -(XORW x x) -> (MOVWconst [0]) -(XORB x x) -> (MOVBconst [0]) // checking AND against 0. (CMPQconst (ANDQ x y) [0]) -> (TESTQ x y) (CMPLconst (ANDL x y) [0]) -> (TESTL x y) -(CMPWconst (ANDW x y) [0]) -> (TESTW x y) -(CMPBconst (ANDB x y) [0]) -> (TESTB x y) +(CMPWconst (ANDL x y) [0]) -> (TESTW x y) +(CMPBconst (ANDL x y) [0]) -> (TESTB x y) (CMPQconst (ANDQconst [c] x) [0]) -> (TESTQconst [c] x) (CMPLconst (ANDLconst [c] x) [0]) -> (TESTLconst [c] x) -(CMPWconst (ANDWconst [c] x) [0]) -> (TESTWconst [c] x) -(CMPBconst (ANDBconst [c] x) [0]) -> (TESTBconst [c] x) +(CMPWconst (ANDLconst [c] x) [0]) -> (TESTWconst [int64(int16(c))] x) +(CMPBconst (ANDLconst [c] x) [0]) -> (TESTBconst [int64(int8(c))] x) // TEST %reg,%reg is shorter than CMP (CMPQconst x [0]) -> (TESTQ x x) @@ -1352,40 +1265,296 @@ // Combining byte loads into larger (unaligned) loads. // There are many ways these combinations could occur. This is // designed to match the way encoding/binary.LittleEndian does it. -(ORW x0:(MOVBload [i] {s} p mem) - (SHLWconst [8] x1:(MOVBload [i+1] {s} p mem))) && mergePoint(b,x0,x1) != nil -> @mergePoint(b,x0,x1) (MOVWload [i] {s} p mem) +(ORL x0:(MOVBload [i] {s} p mem) + s0:(SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && s0.Uses == 1 + && mergePoint(b,x0,x1) != nil + && clobber(x0) + && clobber(x1) + && clobber(s0) + -> @mergePoint(b,x0,x1) (MOVWload [i] {s} p mem) + +(ORL o0:(ORL o1:(ORL + x0:(MOVBload [i] {s} p mem) + s0:(SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) + s1:(SHLLconst [16] x2:(MOVBload [i+2] {s} p mem))) + s2:(SHLLconst [24] x3:(MOVBload [i+3] {s} p mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && x2.Uses == 1 + && x3.Uses == 1 + && s0.Uses == 1 + && s1.Uses == 1 + && s2.Uses == 1 + && o0.Uses == 1 + && o1.Uses == 1 + && mergePoint(b,x0,x1,x2,x3) != nil + && clobber(x0) + && clobber(x1) + && clobber(x2) + && clobber(x3) + && clobber(s0) + && clobber(s1) + && clobber(s2) + && clobber(o0) + && clobber(o1) + -> @mergePoint(b,x0,x1,x2,x3) (MOVLload [i] {s} p mem) + +(ORQ o0:(ORQ o1:(ORQ o2:(ORQ o3:(ORQ o4:(ORQ o5:(ORQ + x0:(MOVBload [i] {s} p mem) + s0:(SHLQconst [8] x1:(MOVBload [i+1] {s} p mem))) + s1:(SHLQconst [16] x2:(MOVBload [i+2] {s} p mem))) + s2:(SHLQconst [24] x3:(MOVBload [i+3] {s} p mem))) + s3:(SHLQconst [32] x4:(MOVBload [i+4] {s} p mem))) + s4:(SHLQconst [40] x5:(MOVBload [i+5] {s} p mem))) + s5:(SHLQconst [48] x6:(MOVBload [i+6] {s} p mem))) + s6:(SHLQconst [56] x7:(MOVBload [i+7] {s} p mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && x2.Uses == 1 + && x3.Uses == 1 + && x4.Uses == 1 + && x5.Uses == 1 + && x6.Uses == 1 + && x7.Uses == 1 + && s0.Uses == 1 + && s1.Uses == 1 + && s2.Uses == 1 + && s3.Uses == 1 + && s4.Uses == 1 + && s5.Uses == 1 + && s6.Uses == 1 + && o0.Uses == 1 + && o1.Uses == 1 + && o2.Uses == 1 + && o3.Uses == 1 + && o4.Uses == 1 + && o5.Uses == 1 + && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil + && clobber(x0) + && clobber(x1) + && clobber(x2) + && clobber(x3) + && clobber(x4) + && clobber(x5) + && clobber(x6) + && clobber(x7) + && clobber(s0) + && clobber(s1) + && clobber(s2) + && clobber(s3) + && clobber(s4) + && clobber(s5) + && clobber(s6) + && clobber(o0) + && clobber(o1) + && clobber(o2) + && clobber(o3) + && clobber(o4) + && clobber(o5) + -> @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQload [i] {s} p mem) + +(ORL x0:(MOVBloadidx1 [i] {s} p idx mem) + s0:(SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && s0.Uses == 1 + && mergePoint(b,x0,x1) != nil + && clobber(x0) + && clobber(x1) + && clobber(s0) + -> @mergePoint(b,x0,x1) (MOVWloadidx1 <v.Type> [i] {s} p idx mem) + +(ORL o0:(ORL o1:(ORL + x0:(MOVBloadidx1 [i] {s} p idx mem) + s0:(SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) + s1:(SHLLconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) + s2:(SHLLconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && x2.Uses == 1 + && x3.Uses == 1 + && s0.Uses == 1 + && s1.Uses == 1 + && s2.Uses == 1 + && o0.Uses == 1 + && o1.Uses == 1 + && mergePoint(b,x0,x1,x2,x3) != nil + && clobber(x0) + && clobber(x1) + && clobber(x2) + && clobber(x3) + && clobber(s0) + && clobber(s1) + && clobber(s2) + && clobber(o0) + && clobber(o1) + -> @mergePoint(b,x0,x1,x2,x3) (MOVLloadidx1 <v.Type> [i] {s} p idx mem) + +(ORQ o0:(ORQ o1:(ORQ o2:(ORQ o3:(ORQ o4:(ORQ o5:(ORQ + x0:(MOVBloadidx1 [i] {s} p idx mem) + s0:(SHLQconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) + s1:(SHLQconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) + s2:(SHLQconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) + s3:(SHLQconst [32] x4:(MOVBloadidx1 [i+4] {s} p idx mem))) + s4:(SHLQconst [40] x5:(MOVBloadidx1 [i+5] {s} p idx mem))) + s5:(SHLQconst [48] x6:(MOVBloadidx1 [i+6] {s} p idx mem))) + s6:(SHLQconst [56] x7:(MOVBloadidx1 [i+7] {s} p idx mem))) + && x0.Uses == 1 + && x1.Uses == 1 + && x2.Uses == 1 + && x3.Uses == 1 + && x4.Uses == 1 + && x5.Uses == 1 + && x6.Uses == 1 + && x7.Uses == 1 + && s0.Uses == 1 + && s1.Uses == 1 + && s2.Uses == 1 + && s3.Uses == 1 + && s4.Uses == 1 + && s5.Uses == 1 + && s6.Uses == 1 + && o0.Uses == 1 + && o1.Uses == 1 + && o2.Uses == 1 + && o3.Uses == 1 + && o4.Uses == 1 + && o5.Uses == 1 + && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil + && clobber(x0) + && clobber(x1) + && clobber(x2) + && clobber(x3) + && clobber(x4) + && clobber(x5) + && clobber(x6) + && clobber(x7) + && clobber(s0) + && clobber(s1) + && clobber(s2) + && clobber(s3) + && clobber(s4) + && clobber(s5) + && clobber(s6) + && clobber(o0) + && clobber(o1) + && clobber(o2) + && clobber(o3) + && clobber(o4) + && clobber(o5) + -> @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQloadidx1 <v.Type> [i] {s} p idx mem) + +// Combine constant stores into larger (unaligned) stores. +(MOVBstoreconst [c] {s} p x:(MOVBstoreconst [a] {s} p mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 1 == ValAndOff(c).Off() + && clobber(x) + -> (MOVWstoreconst [makeValAndOff(ValAndOff(a).Val()&0xff | ValAndOff(c).Val()<<8, ValAndOff(a).Off())] {s} p mem) +(MOVWstoreconst [c] {s} p x:(MOVWstoreconst [a] {s} p mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() + && clobber(x) + -> (MOVLstoreconst [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p mem) +(MOVLstoreconst [c] {s} p x:(MOVLstoreconst [a] {s} p mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() + && clobber(x) + -> (MOVQstore [ValAndOff(a).Off()] {s} p (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) -(ORL (ORL (ORL - x0:(MOVBload [i] {s} p mem) - (SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) - (SHLLconst [16] x2:(MOVBload [i+2] {s} p mem))) - (SHLLconst [24] x3:(MOVBload [i+3] {s} p mem))) && mergePoint(b,x0,x1,x2,x3) != nil -> @mergePoint(b,x0,x1,x2,x3) (MOVLload [i] {s} p mem) +(MOVBstoreconstidx1 [c] {s} p i x:(MOVBstoreconstidx1 [a] {s} p i mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 1 == ValAndOff(c).Off() + && clobber(x) + -> (MOVWstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xff | ValAndOff(c).Val()<<8, ValAndOff(a).Off())] {s} p i mem) +(MOVWstoreconstidx1 [c] {s} p i x:(MOVWstoreconstidx1 [a] {s} p i mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() + && clobber(x) + -> (MOVLstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p i mem) +(MOVLstoreconstidx1 [c] {s} p i x:(MOVLstoreconstidx1 [a] {s} p i mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() + && clobber(x) + -> (MOVQstoreidx1 [ValAndOff(a).Off()] {s} p i (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) -(ORQ (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ - x0:(MOVBload [i] {s} p mem) - (SHLQconst [8] x1:(MOVBload [i+1] {s} p mem))) - (SHLQconst [16] x2:(MOVBload [i+2] {s} p mem))) - (SHLQconst [24] x3:(MOVBload [i+3] {s} p mem))) - (SHLQconst [32] x4:(MOVBload [i+4] {s} p mem))) - (SHLQconst [40] x5:(MOVBload [i+5] {s} p mem))) - (SHLQconst [48] x6:(MOVBload [i+6] {s} p mem))) - (SHLQconst [56] x7:(MOVBload [i+7] {s} p mem))) && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil -> @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQload [i] {s} p mem) +(MOVWstoreconstidx2 [c] {s} p i x:(MOVWstoreconstidx2 [a] {s} p i mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() + && clobber(x) + -> (MOVLstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p (SHLQconst <i.Type> [1] i) mem) +(MOVLstoreconstidx4 [c] {s} p i x:(MOVLstoreconstidx4 [a] {s} p i mem)) + && x.Uses == 1 + && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() + && clobber(x) + -> (MOVQstoreidx1 [ValAndOff(a).Off()] {s} p (SHLQconst <i.Type> [2] i) (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) -(ORW x0:(MOVBloadidx1 [i] {s} p idx mem) - (SHLWconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) && mergePoint(b,x0,x1) != nil -> @mergePoint(b,x0,x1) (MOVWloadidx1 <v.Type> [i] {s} p idx mem) +// Combine stores into larger (unaligned) stores. +(MOVBstore [i] {s} p (SHRQconst [8] w) x:(MOVBstore [i-1] {s} p w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVWstore [i-1] {s} p w mem) +(MOVBstore [i] {s} p (SHRQconst [j] w) x:(MOVBstore [i-1] {s} p w0:(SHRQconst [j-8] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVWstore [i-1] {s} p w0 mem) +(MOVWstore [i] {s} p (SHRQconst [16] w) x:(MOVWstore [i-2] {s} p w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstore [i-2] {s} p w mem) +(MOVWstore [i] {s} p (SHRQconst [j] w) x:(MOVWstore [i-2] {s} p w0:(SHRQconst [j-16] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstore [i-2] {s} p w0 mem) +(MOVLstore [i] {s} p (SHRQconst [32] w) x:(MOVLstore [i-4] {s} p w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstore [i-4] {s} p w mem) +(MOVLstore [i] {s} p (SHRQconst [j] w) x:(MOVLstore [i-4] {s} p w0:(SHRQconst [j-32] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstore [i-4] {s} p w0 mem) -(ORL (ORL (ORL - x0:(MOVBloadidx1 [i] {s} p idx mem) - (SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) - (SHLLconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) - (SHLLconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) && mergePoint(b,x0,x1,x2,x3) != nil -> @mergePoint(b,x0,x1,x2,x3) (MOVLloadidx1 <v.Type> [i] {s} p idx mem) +(MOVBstoreidx1 [i] {s} p idx (SHRQconst [8] w) x:(MOVBstoreidx1 [i-1] {s} p idx w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVWstoreidx1 [i-1] {s} p idx w mem) +(MOVBstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVBstoreidx1 [i-1] {s} p idx w0:(SHRQconst [j-8] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVWstoreidx1 [i-1] {s} p idx w0 mem) +(MOVWstoreidx1 [i] {s} p idx (SHRQconst [16] w) x:(MOVWstoreidx1 [i-2] {s} p idx w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstoreidx1 [i-2] {s} p idx w mem) +(MOVWstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVWstoreidx1 [i-2] {s} p idx w0:(SHRQconst [j-16] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstoreidx1 [i-2] {s} p idx w0 mem) +(MOVLstoreidx1 [i] {s} p idx (SHRQconst [32] w) x:(MOVLstoreidx1 [i-4] {s} p idx w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstoreidx1 [i-4] {s} p idx w mem) +(MOVLstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVLstoreidx1 [i-4] {s} p idx w0:(SHRQconst [j-32] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstoreidx1 [i-4] {s} p idx w0 mem) -(ORQ (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ - x0:(MOVBloadidx1 [i] {s} p idx mem) - (SHLQconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) - (SHLQconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) - (SHLQconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) - (SHLQconst [32] x4:(MOVBloadidx1 [i+4] {s} p idx mem))) - (SHLQconst [40] x5:(MOVBloadidx1 [i+5] {s} p idx mem))) - (SHLQconst [48] x6:(MOVBloadidx1 [i+6] {s} p idx mem))) - (SHLQconst [56] x7:(MOVBloadidx1 [i+7] {s} p idx mem))) && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil -> @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQloadidx1 <v.Type> [i] {s} p idx mem) +(MOVWstoreidx2 [i] {s} p idx (SHRQconst [16] w) x:(MOVWstoreidx2 [i-2] {s} p idx w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstoreidx1 [i-2] {s} p (SHLQconst <idx.Type> [1] idx) w mem) +(MOVWstoreidx2 [i] {s} p idx (SHRQconst [j] w) x:(MOVWstoreidx2 [i-2] {s} p idx w0:(SHRQconst [j-16] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVLstoreidx1 [i-2] {s} p (SHLQconst <idx.Type> [1] idx) w0 mem) +(MOVLstoreidx4 [i] {s} p idx (SHRQconst [32] w) x:(MOVLstoreidx4 [i-4] {s} p idx w mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstoreidx1 [i-4] {s} p (SHLQconst <idx.Type> [2] idx) w mem) +(MOVLstoreidx4 [i] {s} p idx (SHRQconst [j] w) x:(MOVLstoreidx4 [i-4] {s} p idx w0:(SHRQconst [j-32] w) mem)) + && x.Uses == 1 + && clobber(x) + -> (MOVQstoreidx1 [i-4] {s} p (SHLQconst <idx.Type> [2] idx) w0 mem) diff --git a/src/cmd/compile/internal/ssa/gen/AMD64Ops.go b/src/cmd/compile/internal/ssa/gen/AMD64Ops.go index b1698c0cf1..b684b9ccdf 100644 --- a/src/cmd/compile/internal/ssa/gen/AMD64Ops.go +++ b/src/cmd/compile/internal/ssa/gen/AMD64Ops.go @@ -111,12 +111,14 @@ func init() { // Common regInfo var ( gp01 = regInfo{inputs: []regMask{}, outputs: gponly} - gp11 = regInfo{inputs: []regMask{gpsp}, outputs: gponly, clobbers: flags} + gp11 = regInfo{inputs: []regMask{gp}, outputs: gponly, clobbers: flags} + gp11sp = regInfo{inputs: []regMask{gpsp}, outputs: gponly, clobbers: flags} gp11nf = regInfo{inputs: []regMask{gpsp}, outputs: gponly} // nf: no flags clobbered gp11sb = regInfo{inputs: []regMask{gpspsb}, outputs: gponly} - gp21 = regInfo{inputs: []regMask{gpsp, gpsp}, outputs: gponly, clobbers: flags} + gp21 = regInfo{inputs: []regMask{gp, gp}, outputs: gponly, clobbers: flags} + gp21sp = regInfo{inputs: []regMask{gpsp, gp}, outputs: gponly, clobbers: flags} gp21sb = regInfo{inputs: []regMask{gpspsb, gpsp}, outputs: gponly} - gp21shift = regInfo{inputs: []regMask{gpsp, cx}, outputs: []regMask{gp &^ cx}, clobbers: flags} + gp21shift = regInfo{inputs: []regMask{gp, cx}, outputs: []regMask{gp}, clobbers: flags} gp11div = regInfo{inputs: []regMask{ax, gpsp &^ dx}, outputs: []regMask{ax}, clobbers: dx | flags} gp11hmul = regInfo{inputs: []regMask{ax, gpsp}, outputs: []regMask{dx}, @@ -128,8 +130,8 @@ func init() { gp1flags = regInfo{inputs: []regMask{gpsp}, outputs: flagsonly} flagsgp = regInfo{inputs: flagsonly, outputs: gponly} - // for CMOVconst -- uses AX to hold constant temporary. AX input is moved before temp. - gp1flagsgp = regInfo{inputs: []regMask{gp, flags}, clobbers: ax | flags, outputs: []regMask{gp &^ ax}} + // for CMOVconst -- uses AX to hold constant temporary. + gp1flagsgp = regInfo{inputs: []regMask{gp &^ ax, flags}, clobbers: ax | flags, outputs: []regMask{gp &^ ax}} readflags = regInfo{inputs: flagsonly, outputs: gponly} flagsgpax = regInfo{inputs: flagsonly, clobbers: ax | flags, outputs: []regMask{gp &^ ax}} @@ -186,32 +188,20 @@ func init() { {name: "MOVSDstoreidx8", argLength: 4, reg: fpstoreidx, asm: "MOVSD", aux: "SymOff"}, // fp64 indexed by 8i store // binary ops - {name: "ADDQ", argLength: 2, reg: gp21, asm: "ADDQ", commutative: true, resultInArg0: true}, // arg0 + arg1 - {name: "ADDL", argLength: 2, reg: gp21, asm: "ADDL", commutative: true, resultInArg0: true}, // arg0 + arg1 - {name: "ADDW", argLength: 2, reg: gp21, asm: "ADDL", commutative: true, resultInArg0: true}, // arg0 + arg1 - {name: "ADDB", argLength: 2, reg: gp21, asm: "ADDL", commutative: true, resultInArg0: true}, // arg0 + arg1 - {name: "ADDQconst", argLength: 1, reg: gp11, asm: "ADDQ", aux: "Int64", resultInArg0: true, typ: "UInt64"}, // arg0 + auxint - {name: "ADDLconst", argLength: 1, reg: gp11, asm: "ADDL", aux: "Int32", resultInArg0: true}, // arg0 + auxint - {name: "ADDWconst", argLength: 1, reg: gp11, asm: "ADDL", aux: "Int16", resultInArg0: true}, // arg0 + auxint - {name: "ADDBconst", argLength: 1, reg: gp11, asm: "ADDL", aux: "Int8", resultInArg0: true}, // arg0 + auxint + {name: "ADDQ", argLength: 2, reg: gp21sp, asm: "ADDQ", commutative: true}, // arg0 + arg1 + {name: "ADDL", argLength: 2, reg: gp21sp, asm: "ADDL", commutative: true}, // arg0 + arg1 + {name: "ADDQconst", argLength: 1, reg: gp11sp, asm: "ADDQ", aux: "Int64", typ: "UInt64"}, // arg0 + auxint + {name: "ADDLconst", argLength: 1, reg: gp11sp, asm: "ADDL", aux: "Int32"}, // arg0 + auxint {name: "SUBQ", argLength: 2, reg: gp21, asm: "SUBQ", resultInArg0: true}, // arg0 - arg1 {name: "SUBL", argLength: 2, reg: gp21, asm: "SUBL", resultInArg0: true}, // arg0 - arg1 - {name: "SUBW", argLength: 2, reg: gp21, asm: "SUBL", resultInArg0: true}, // arg0 - arg1 - {name: "SUBB", argLength: 2, reg: gp21, asm: "SUBL", resultInArg0: true}, // arg0 - arg1 {name: "SUBQconst", argLength: 1, reg: gp11, asm: "SUBQ", aux: "Int64", resultInArg0: true}, // arg0 - auxint {name: "SUBLconst", argLength: 1, reg: gp11, asm: "SUBL", aux: "Int32", resultInArg0: true}, // arg0 - auxint - {name: "SUBWconst", argLength: 1, reg: gp11, asm: "SUBL", aux: "Int16", resultInArg0: true}, // arg0 - auxint - {name: "SUBBconst", argLength: 1, reg: gp11, asm: "SUBL", aux: "Int8", resultInArg0: true}, // arg0 - auxint {name: "MULQ", argLength: 2, reg: gp21, asm: "IMULQ", commutative: true, resultInArg0: true}, // arg0 * arg1 {name: "MULL", argLength: 2, reg: gp21, asm: "IMULL", commutative: true, resultInArg0: true}, // arg0 * arg1 - {name: "MULW", argLength: 2, reg: gp21, asm: "IMULW", commutative: true, resultInArg0: true}, // arg0 * arg1 - {name: "MULB", argLength: 2, reg: gp21, asm: "IMULW", commutative: true, resultInArg0: true}, // arg0 * arg1 {name: "MULQconst", argLength: 1, reg: gp11, asm: "IMULQ", aux: "Int64", resultInArg0: true}, // arg0 * auxint {name: "MULLconst", argLength: 1, reg: gp11, asm: "IMULL", aux: "Int32", resultInArg0: true}, // arg0 * auxint - {name: "MULWconst", argLength: 1, reg: gp11, asm: "IMULW", aux: "Int16", resultInArg0: true}, // arg0 * auxint - {name: "MULBconst", argLength: 1, reg: gp11, asm: "IMULW", aux: "Int8", resultInArg0: true}, // arg0 * auxint {name: "HMULQ", argLength: 2, reg: gp11hmul, asm: "IMULQ"}, // (arg0 * arg1) >> width {name: "HMULL", argLength: 2, reg: gp11hmul, asm: "IMULL"}, // (arg0 * arg1) >> width @@ -240,30 +230,18 @@ func init() { {name: "ANDQ", argLength: 2, reg: gp21, asm: "ANDQ", commutative: true, resultInArg0: true}, // arg0 & arg1 {name: "ANDL", argLength: 2, reg: gp21, asm: "ANDL", commutative: true, resultInArg0: true}, // arg0 & arg1 - {name: "ANDW", argLength: 2, reg: gp21, asm: "ANDL", commutative: true, resultInArg0: true}, // arg0 & arg1 - {name: "ANDB", argLength: 2, reg: gp21, asm: "ANDL", commutative: true, resultInArg0: true}, // arg0 & arg1 {name: "ANDQconst", argLength: 1, reg: gp11, asm: "ANDQ", aux: "Int64", resultInArg0: true}, // arg0 & auxint {name: "ANDLconst", argLength: 1, reg: gp11, asm: "ANDL", aux: "Int32", resultInArg0: true}, // arg0 & auxint - {name: "ANDWconst", argLength: 1, reg: gp11, asm: "ANDL", aux: "Int16", resultInArg0: true}, // arg0 & auxint - {name: "ANDBconst", argLength: 1, reg: gp11, asm: "ANDL", aux: "Int8", resultInArg0: true}, // arg0 & auxint {name: "ORQ", argLength: 2, reg: gp21, asm: "ORQ", commutative: true, resultInArg0: true}, // arg0 | arg1 {name: "ORL", argLength: 2, reg: gp21, asm: "ORL", commutative: true, resultInArg0: true}, // arg0 | arg1 - {name: "ORW", argLength: 2, reg: gp21, asm: "ORL", commutative: true, resultInArg0: true}, // arg0 | arg1 - {name: "ORB", argLength: 2, reg: gp21, asm: "ORL", commutative: true, resultInArg0: true}, // arg0 | arg1 {name: "ORQconst", argLength: 1, reg: gp11, asm: "ORQ", aux: "Int64", resultInArg0: true}, // arg0 | auxint {name: "ORLconst", argLength: 1, reg: gp11, asm: "ORL", aux: "Int32", resultInArg0: true}, // arg0 | auxint - {name: "ORWconst", argLength: 1, reg: gp11, asm: "ORL", aux: "Int16", resultInArg0: true}, // arg0 | auxint - {name: "ORBconst", argLength: 1, reg: gp11, asm: "ORL", aux: "Int8", resultInArg0: true}, // arg0 | auxint {name: "XORQ", argLength: 2, reg: gp21, asm: "XORQ", commutative: true, resultInArg0: true}, // arg0 ^ arg1 {name: "XORL", argLength: 2, reg: gp21, asm: "XORL", commutative: true, resultInArg0: true}, // arg0 ^ arg1 - {name: "XORW", argLength: 2, reg: gp21, asm: "XORL", commutative: true, resultInArg0: true}, // arg0 ^ arg1 - {name: "XORB", argLength: 2, reg: gp21, asm: "XORL", commutative: true, resultInArg0: true}, // arg0 ^ arg1 {name: "XORQconst", argLength: 1, reg: gp11, asm: "XORQ", aux: "Int64", resultInArg0: true}, // arg0 ^ auxint {name: "XORLconst", argLength: 1, reg: gp11, asm: "XORL", aux: "Int32", resultInArg0: true}, // arg0 ^ auxint - {name: "XORWconst", argLength: 1, reg: gp11, asm: "XORL", aux: "Int16", resultInArg0: true}, // arg0 ^ auxint - {name: "XORBconst", argLength: 1, reg: gp11, asm: "XORL", aux: "Int8", resultInArg0: true}, // arg0 ^ auxint {name: "CMPQ", argLength: 2, reg: gp2flags, asm: "CMPQ", typ: "Flags"}, // arg0 compare to arg1 {name: "CMPL", argLength: 2, reg: gp2flags, asm: "CMPL", typ: "Flags"}, // arg0 compare to arg1 @@ -288,12 +266,8 @@ func init() { {name: "SHLQ", argLength: 2, reg: gp21shift, asm: "SHLQ", resultInArg0: true}, // arg0 << arg1, shift amount is mod 64 {name: "SHLL", argLength: 2, reg: gp21shift, asm: "SHLL", resultInArg0: true}, // arg0 << arg1, shift amount is mod 32 - {name: "SHLW", argLength: 2, reg: gp21shift, asm: "SHLL", resultInArg0: true}, // arg0 << arg1, shift amount is mod 32 - {name: "SHLB", argLength: 2, reg: gp21shift, asm: "SHLL", resultInArg0: true}, // arg0 << arg1, shift amount is mod 32 {name: "SHLQconst", argLength: 1, reg: gp11, asm: "SHLQ", aux: "Int64", resultInArg0: true}, // arg0 << auxint, shift amount 0-63 {name: "SHLLconst", argLength: 1, reg: gp11, asm: "SHLL", aux: "Int32", resultInArg0: true}, // arg0 << auxint, shift amount 0-31 - {name: "SHLWconst", argLength: 1, reg: gp11, asm: "SHLL", aux: "Int16", resultInArg0: true}, // arg0 << auxint, shift amount 0-31 - {name: "SHLBconst", argLength: 1, reg: gp11, asm: "SHLL", aux: "Int8", resultInArg0: true}, // arg0 << auxint, shift amount 0-31 // Note: x86 is weird, the 16 and 8 byte shifts still use all 5 bits of shift amount! {name: "SHRQ", argLength: 2, reg: gp21shift, asm: "SHRQ", resultInArg0: true}, // unsigned arg0 >> arg1, shift amount is mod 64 @@ -322,13 +296,9 @@ func init() { // unary ops {name: "NEGQ", argLength: 1, reg: gp11, asm: "NEGQ", resultInArg0: true}, // -arg0 {name: "NEGL", argLength: 1, reg: gp11, asm: "NEGL", resultInArg0: true}, // -arg0 - {name: "NEGW", argLength: 1, reg: gp11, asm: "NEGL", resultInArg0: true}, // -arg0 - {name: "NEGB", argLength: 1, reg: gp11, asm: "NEGL", resultInArg0: true}, // -arg0 {name: "NOTQ", argLength: 1, reg: gp11, asm: "NOTQ", resultInArg0: true}, // ^arg0 {name: "NOTL", argLength: 1, reg: gp11, asm: "NOTL", resultInArg0: true}, // ^arg0 - {name: "NOTW", argLength: 1, reg: gp11, asm: "NOTL", resultInArg0: true}, // ^arg0 - {name: "NOTB", argLength: 1, reg: gp11, asm: "NOTL", resultInArg0: true}, // ^arg0 {name: "BSFQ", argLength: 1, reg: gp11, asm: "BSFQ"}, // arg0 # of low-order zeroes ; undef if zero {name: "BSFL", argLength: 1, reg: gp11, asm: "BSFL"}, // arg0 # of low-order zeroes ; undef if zero @@ -383,8 +353,6 @@ func init() { {name: "MOVLQSX", argLength: 1, reg: gp11nf, asm: "MOVLQSX"}, // sign extend arg0 from int32 to int64 {name: "MOVLQZX", argLength: 1, reg: gp11nf, asm: "MOVLQZX"}, // zero extend arg0 from int32 to int64 - {name: "MOVBconst", reg: gp01, asm: "MOVB", typ: "UInt8", aux: "Int8", rematerializeable: true}, // 8 low bits of auxint - {name: "MOVWconst", reg: gp01, asm: "MOVW", typ: "UInt16", aux: "Int16", rematerializeable: true}, // 16 low bits of auxint {name: "MOVLconst", reg: gp01, asm: "MOVL", typ: "UInt32", aux: "Int32", rematerializeable: true}, // 32 low bits of auxint {name: "MOVQconst", reg: gp01, asm: "MOVQ", typ: "UInt64", aux: "Int64", rematerializeable: true}, // auxint @@ -471,7 +439,7 @@ func init() { clobbers: buildReg("DI FLAGS"), }, }, - {name: "MOVOconst", reg: regInfo{nil, 0, []regMask{fp}}, typ: "Int128", rematerializeable: true}, + {name: "MOVOconst", reg: regInfo{nil, 0, []regMask{fp}}, typ: "Int128", aux: "Int128", rematerializeable: true}, // arg0 = address of memory to zero // arg1 = # of 8-byte words to zero diff --git a/src/cmd/compile/internal/ssa/gen/ARMOps.go b/src/cmd/compile/internal/ssa/gen/ARMOps.go index a4f7b17e87..23e8f63471 100644 --- a/src/cmd/compile/internal/ssa/gen/ARMOps.go +++ b/src/cmd/compile/internal/ssa/gen/ARMOps.go @@ -25,13 +25,13 @@ func init() { {name: "CMP", argLength: 2, reg: gp2flags, asm: "CMP", typ: "Flags"}, // arg0 compare to arg1 - {name: "MOVWload", argLength: 2, reg: gpload, asm: "MOVW"}, // load from arg0 + auxInt + aux. arg1=mem. - {name: "MOVWstore", argLength: 3, reg: gpstore, asm: "MOVW"}, // store 4 bytes of arg1 to arg0 + auxInt + aux. arg2=mem. + {name: "MOVWload", argLength: 2, reg: gpload, aux: "SymOff", asm: "MOVW"}, // load from arg0 + auxInt + aux. arg1=mem. + {name: "MOVWstore", argLength: 3, reg: gpstore, aux: "SymOff", asm: "MOVW"}, // store 4 bytes of arg1 to arg0 + auxInt + aux. arg2=mem. {name: "CALLstatic", argLength: 1, reg: regInfo{clobbers: callerSave}, aux: "SymOff"}, // call static function aux.(*gc.Sym). arg0=mem, auxint=argsize, returns mem // pseudo-ops - {name: "LessThan", argLength: 2, reg: flagsgp}, // bool, 1 flags encode x<y 0 otherwise. + {name: "LessThan", argLength: 1, reg: flagsgp}, // bool, 1 flags encode x<y 0 otherwise. } blocks := []blockData{ diff --git a/src/cmd/compile/internal/ssa/gen/generic.rules b/src/cmd/compile/internal/ssa/gen/generic.rules index b56e3f1b2d..b33037f100 100644 --- a/src/cmd/compile/internal/ssa/gen/generic.rules +++ b/src/cmd/compile/internal/ssa/gen/generic.rules @@ -81,13 +81,13 @@ (Rsh64Ux64 (Const64 [c]) (Const64 [d])) -> (Const64 [int64(uint64(c) >> uint64(d))]) (Lsh32x64 (Const32 [c]) (Const64 [d])) -> (Const32 [int64(int32(c) << uint64(d))]) (Rsh32x64 (Const32 [c]) (Const64 [d])) -> (Const32 [int64(int32(c) >> uint64(d))]) -(Rsh32Ux64 (Const32 [c]) (Const64 [d])) -> (Const32 [int64(uint32(c) >> uint64(d))]) +(Rsh32Ux64 (Const32 [c]) (Const64 [d])) -> (Const32 [int64(int32(uint32(c) >> uint64(d)))]) (Lsh16x64 (Const16 [c]) (Const64 [d])) -> (Const16 [int64(int16(c) << uint64(d))]) (Rsh16x64 (Const16 [c]) (Const64 [d])) -> (Const16 [int64(int16(c) >> uint64(d))]) -(Rsh16Ux64 (Const16 [c]) (Const64 [d])) -> (Const16 [int64(uint16(c) >> uint64(d))]) +(Rsh16Ux64 (Const16 [c]) (Const64 [d])) -> (Const16 [int64(int16(uint16(c) >> uint64(d)))]) (Lsh8x64 (Const8 [c]) (Const64 [d])) -> (Const8 [int64(int8(c) << uint64(d))]) (Rsh8x64 (Const8 [c]) (Const64 [d])) -> (Const8 [int64(int8(c) >> uint64(d))]) -(Rsh8Ux64 (Const8 [c]) (Const64 [d])) -> (Const8 [int64(uint8(c) >> uint64(d))]) +(Rsh8Ux64 (Const8 [c]) (Const64 [d])) -> (Const8 [int64(int8(uint8(c) >> uint64(d)))]) (Lsh64x64 (Const64 [0]) _) -> (Const64 [0]) (Rsh64x64 (Const64 [0]) _) -> (Const64 [0]) @@ -114,7 +114,7 @@ (Lsh16x16 (Rsh16Ux16 (Lsh16x16 x (Const16 [c1])) (Const16 [c2])) (Const16 [c3])) && uint16(c1) >= uint16(c2) && uint16(c3) >= uint16(c2) -> (Lsh16x16 x (Const16 <config.fe.TypeUInt16()> [int64(int16(c1-c2+c3))])) (Lsh8x8 (Rsh8Ux8 (Lsh8x8 x (Const8 [c1])) (Const8 [c2])) (Const8 [c3])) && uint8(c1) >= uint8(c2) && uint8(c3) >= uint8(c2) -> (Lsh8x8 x (Const8 <config.fe.TypeUInt8()> [int64(int8(c1-c2+c3))])) -// Fold IsInBounds when the range of the index cannot exceed the limt. +// Fold IsInBounds when the range of the index cannot exceed the limit. (IsInBounds (ZeroExt8to32 _) (Const32 [c])) && (1 << 8) <= c -> (ConstBool [1]) (IsInBounds (ZeroExt8to64 _) (Const64 [c])) && (1 << 8) <= c -> (ConstBool [1]) (IsInBounds (ZeroExt16to32 _) (Const32 [c])) && (1 << 16) <= c -> (ConstBool [1]) @@ -141,17 +141,17 @@ (Eq32 x x) -> (ConstBool [1]) (Eq16 x x) -> (ConstBool [1]) (Eq8 x x) -> (ConstBool [1]) -(Eq8 (ConstBool [c]) (ConstBool [d])) -> (ConstBool [b2i(c == d)]) -(Eq8 (ConstBool [0]) x) -> (Not x) -(Eq8 (ConstBool [1]) x) -> x +(EqB (ConstBool [c]) (ConstBool [d])) -> (ConstBool [b2i(c == d)]) +(EqB (ConstBool [0]) x) -> (Not x) +(EqB (ConstBool [1]) x) -> x (Neq64 x x) -> (ConstBool [0]) (Neq32 x x) -> (ConstBool [0]) (Neq16 x x) -> (ConstBool [0]) (Neq8 x x) -> (ConstBool [0]) -(Neq8 (ConstBool [c]) (ConstBool [d])) -> (ConstBool [b2i(c != d)]) -(Neq8 (ConstBool [0]) x) -> x -(Neq8 (ConstBool [1]) x) -> (Not x) +(NeqB (ConstBool [c]) (ConstBool [d])) -> (ConstBool [b2i(c != d)]) +(NeqB (ConstBool [0]) x) -> x +(NeqB (ConstBool [1]) x) -> (Not x) (Eq64 (Const64 <t> [c]) (Add64 (Const64 <t> [d]) x)) -> (Eq64 (Const64 <t> [c-d]) x) (Eq32 (Const32 <t> [c]) (Add32 (Const32 <t> [d]) x)) -> (Eq32 (Const32 <t> [int64(int32(c-d))]) x) @@ -168,13 +168,11 @@ (Eq32 x (Const32 <t> [c])) && x.Op != OpConst32 -> (Eq32 (Const32 <t> [c]) x) (Eq16 x (Const16 <t> [c])) && x.Op != OpConst16 -> (Eq16 (Const16 <t> [c]) x) (Eq8 x (Const8 <t> [c])) && x.Op != OpConst8 -> (Eq8 (Const8 <t> [c]) x) -(Eq8 x (ConstBool <t> [c])) && x.Op != OpConstBool -> (Eq8 (ConstBool <t> [c]) x) (Neq64 x (Const64 <t> [c])) && x.Op != OpConst64 -> (Neq64 (Const64 <t> [c]) x) (Neq32 x (Const32 <t> [c])) && x.Op != OpConst32 -> (Neq32 (Const32 <t> [c]) x) (Neq16 x (Const16 <t> [c])) && x.Op != OpConst16 -> (Neq16 (Const16 <t> [c]) x) (Neq8 x (Const8 <t> [c])) && x.Op != OpConst8 -> (Neq8 (Const8 <t> [c]) x) -(Neq8 x (ConstBool <t> [c])) && x.Op != OpConstBool -> (Neq8 (ConstBool <t> [c]) x) // AddPtr is not canonicalized because nilcheck ptr checks the first argument to be non-nil. (Add64 x (Const64 <t> [c])) && x.Op != OpConst64 -> (Add64 (Const64 <t> [c]) x) @@ -414,6 +412,55 @@ (Neg32 (Sub32 x y)) -> (Sub32 y x) (Neg64 (Sub64 x y)) -> (Sub64 y x) +(And64 x (And64 x y)) -> (And64 x y) +(And32 x (And32 x y)) -> (And32 x y) +(And16 x (And16 x y)) -> (And16 x y) +(And8 x (And8 x y)) -> (And8 x y) +(And64 x (And64 y x)) -> (And64 x y) +(And32 x (And32 y x)) -> (And32 x y) +(And16 x (And16 y x)) -> (And16 x y) +(And8 x (And8 y x)) -> (And8 x y) +(And64 (And64 x y) x) -> (And64 x y) +(And32 (And32 x y) x) -> (And32 x y) +(And16 (And16 x y) x) -> (And16 x y) +(And8 (And8 x y) x) -> (And8 x y) +(And64 (And64 x y) y) -> (And64 x y) +(And32 (And32 x y) y) -> (And32 x y) +(And16 (And16 x y) y) -> (And16 x y) +(And8 (And8 x y) y) -> (And8 x y) +(Or64 x (Or64 x y)) -> (Or64 x y) +(Or32 x (Or32 x y)) -> (Or32 x y) +(Or16 x (Or16 x y)) -> (Or16 x y) +(Or8 x (Or8 x y)) -> (Or8 x y) +(Or64 x (Or64 y x)) -> (Or64 x y) +(Or32 x (Or32 y x)) -> (Or32 x y) +(Or16 x (Or16 y x)) -> (Or16 x y) +(Or8 x (Or8 y x)) -> (Or8 x y) +(Or64 (Or64 x y) x) -> (Or64 x y) +(Or32 (Or32 x y) x) -> (Or32 x y) +(Or16 (Or16 x y) x) -> (Or16 x y) +(Or8 (Or8 x y) x) -> (Or8 x y) +(Or64 (Or64 x y) y) -> (Or64 x y) +(Or32 (Or32 x y) y) -> (Or32 x y) +(Or16 (Or16 x y) y) -> (Or16 x y) +(Or8 (Or8 x y) y) -> (Or8 x y) +(Xor64 x (Xor64 x y)) -> y +(Xor32 x (Xor32 x y)) -> y +(Xor16 x (Xor16 x y)) -> y +(Xor8 x (Xor8 x y)) -> y +(Xor64 x (Xor64 y x)) -> y +(Xor32 x (Xor32 y x)) -> y +(Xor16 x (Xor16 y x)) -> y +(Xor8 x (Xor8 y x)) -> y +(Xor64 (Xor64 x y) x) -> y +(Xor32 (Xor32 x y) x) -> y +(Xor16 (Xor16 x y) x) -> y +(Xor8 (Xor8 x y) x) -> y +(Xor64 (Xor64 x y) y) -> x +(Xor32 (Xor32 x y) y) -> x +(Xor16 (Xor16 x y) y) -> x +(Xor8 (Xor8 x y) y) -> x + (Trunc64to8 (And64 (Const64 [y]) x)) && y&0xFF == 0xFF -> (Trunc64to8 x) (Trunc64to16 (And64 (Const64 [y]) x)) && y&0xFFFF == 0xFFFF -> (Trunc64to16 x) (Trunc64to32 (And64 (Const64 [y]) x)) && y&0xFFFFFFFF == 0xFFFFFFFF -> (Trunc64to32 x) diff --git a/src/cmd/compile/internal/ssa/gen/genericOps.go b/src/cmd/compile/internal/ssa/gen/genericOps.go index e6a0e8355b..88ae8b189d 100644 --- a/src/cmd/compile/internal/ssa/gen/genericOps.go +++ b/src/cmd/compile/internal/ssa/gen/genericOps.go @@ -237,9 +237,14 @@ var genericOps = []opData{ {name: "Geq32F", argLength: 2}, {name: "Geq64F", argLength: 2}, - // 1-input ops - {name: "Not", argLength: 1}, // !arg0, boolean + // boolean ops + {name: "AndB", argLength: 2}, // arg0 && arg1 (not shortcircuited) + {name: "OrB", argLength: 2}, // arg0 || arg1 (not shortcircuited) + {name: "EqB", argLength: 2}, // arg0 == arg1 + {name: "NeqB", argLength: 2}, // arg0 != arg1 + {name: "Not", argLength: 1}, // !arg0, boolean + // 1-input ops {name: "Neg8", argLength: 1}, // -arg0 {name: "Neg16", argLength: 1}, {name: "Neg32", argLength: 1}, diff --git a/src/cmd/compile/internal/ssa/gen/main.go b/src/cmd/compile/internal/ssa/gen/main.go index db3c43d3a3..2aec4a324b 100644 --- a/src/cmd/compile/internal/ssa/gen/main.go +++ b/src/cmd/compile/internal/ssa/gen/main.go @@ -39,7 +39,7 @@ type opData struct { rematerializeable bool argLength int32 // number of arguments, if -1, then this operation has a variable number of arguments commutative bool // this operation is commutative (e.g. addition) - resultInArg0 bool // prefer v and v.Args[0] to be allocated to the same register + resultInArg0 bool // v and v.Args[0] must be allocated to the same register } type blockData struct { @@ -155,6 +155,12 @@ func genOp() { } if v.resultInArg0 { fmt.Fprintln(w, "resultInArg0: true,") + if v.reg.inputs[0] != v.reg.outputs[0] { + log.Fatalf("input[0] and output registers must be equal for %s", v.name) + } + if v.commutative && v.reg.inputs[1] != v.reg.outputs[0] { + log.Fatalf("input[1] and output registers must be equal for %s", v.name) + } } if a.name == "generic" { fmt.Fprintln(w, "generic:true,") diff --git a/src/cmd/compile/internal/ssa/gen/rulegen.go b/src/cmd/compile/internal/ssa/gen/rulegen.go index b40f480f3e..5f7d1cf984 100644 --- a/src/cmd/compile/internal/ssa/gen/rulegen.go +++ b/src/cmd/compile/internal/ssa/gen/rulegen.go @@ -52,12 +52,12 @@ var ( ) type Rule struct { - rule string - lineno int + rule string + loc string // file name & line number } func (r Rule) String() string { - return fmt.Sprintf("rule %q at line %d", r.rule, r.lineno) + return fmt.Sprintf("rule %q at %s", r.rule, r.loc) } // parse returns the matching part of the rule, additional conditions, and the result. @@ -91,6 +91,7 @@ func genRules(arch arch) { scanner := bufio.NewScanner(text) rule := "" var lineno int + var ruleLineno int // line number of "->" for scanner.Scan() { lineno++ line := scanner.Text() @@ -107,6 +108,9 @@ func genRules(arch arch) { if !strings.Contains(rule, "->") { continue } + if ruleLineno == 0 { + ruleLineno = lineno + } if strings.HasSuffix(rule, "->") { continue } @@ -117,18 +121,20 @@ func genRules(arch arch) { if op[len(op)-1] == ')' { op = op[:len(op)-1] // rule has only opcode, e.g. (ConstNil) -> ... } + loc := fmt.Sprintf("%s.rules:%d", arch.name, ruleLineno) if isBlock(op, arch) { - blockrules[op] = append(blockrules[op], Rule{rule: rule, lineno: lineno}) + blockrules[op] = append(blockrules[op], Rule{rule: rule, loc: loc}) } else { - oprules[op] = append(oprules[op], Rule{rule: rule, lineno: lineno}) + oprules[op] = append(oprules[op], Rule{rule: rule, loc: loc}) } rule = "" + ruleLineno = 0 } if err := scanner.Err(); err != nil { log.Fatalf("scanner failed: %v\n", err) } if unbalanced(rule) { - log.Fatalf("unbalanced rule at line %d: %v\n", lineno, rule) + log.Fatalf("%s.rules:%d: unbalanced rule: %v\n", arch.name, lineno, rule) } // Order all the ops. @@ -174,15 +180,15 @@ func genRules(arch arch) { fmt.Fprintf(w, "// result: %s\n", result) fmt.Fprintf(w, "for {\n") - genMatch(w, arch, match) + genMatch(w, arch, match, rule.loc) if cond != "" { fmt.Fprintf(w, "if !(%s) {\nbreak\n}\n", cond) } - genResult(w, arch, result) + genResult(w, arch, result, rule.loc) if *genLog { - fmt.Fprintf(w, "fmt.Println(\"rewrite %s.rules:%d\")\n", arch.name, rule.lineno) + fmt.Fprintf(w, "fmt.Println(\"rewrite %s\")\n", rule.loc) } fmt.Fprintf(w, "return true\n") @@ -217,7 +223,7 @@ func genRules(arch arch) { if s[1] != "nil" { fmt.Fprintf(w, "v := b.Control\n") if strings.Contains(s[1], "(") { - genMatch0(w, arch, s[1], "v", map[string]struct{}{}, false) + genMatch0(w, arch, s[1], "v", map[string]struct{}{}, false, rule.loc) } else { fmt.Fprintf(w, "%s := b.Control\n", s[1]) } @@ -266,7 +272,7 @@ func genRules(arch arch) { if t[1] == "nil" { fmt.Fprintf(w, "b.SetControl(nil)\n") } else { - fmt.Fprintf(w, "b.SetControl(%s)\n", genResult0(w, arch, t[1], new(int), false, false)) + fmt.Fprintf(w, "b.SetControl(%s)\n", genResult0(w, arch, t[1], new(int), false, false, rule.loc)) } if len(newsuccs) < len(succs) { fmt.Fprintf(w, "b.Succs = b.Succs[:%d]\n", len(newsuccs)) @@ -289,7 +295,7 @@ func genRules(arch arch) { } if *genLog { - fmt.Fprintf(w, "fmt.Println(\"rewrite %s.rules:%d\")\n", arch.name, rule.lineno) + fmt.Fprintf(w, "fmt.Println(\"rewrite %s\")\n", rule.loc) } fmt.Fprintf(w, "return true\n") @@ -315,11 +321,11 @@ func genRules(arch arch) { } } -func genMatch(w io.Writer, arch arch, match string) { - genMatch0(w, arch, match, "v", map[string]struct{}{}, true) +func genMatch(w io.Writer, arch arch, match string, loc string) { + genMatch0(w, arch, match, "v", map[string]struct{}{}, true, loc) } -func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, top bool) { +func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, top bool, loc string) { if match[0] != '(' || match[len(match)-1] != ')' { panic("non-compound expr in genMatch0: " + match) } @@ -328,6 +334,24 @@ func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, t // contained in () or {}. s := split(match[1 : len(match)-1]) // remove parens, then split + // Find op record + var op opData + for _, x := range genericOps { + if x.name == s[0] { + op = x + break + } + } + for _, x := range arch.ops { + if x.name == s[0] { + op = x + break + } + } + if op.name == "" { + log.Fatalf("%s: unknown op %s", loc, s[0]) + } + // check op if !top { fmt.Fprintf(w, "if %s.Op != %s {\nbreak\n}\n", v, opName(s[0], arch)) @@ -354,6 +378,11 @@ func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, t } } else if a[0] == '[' { // auxint restriction + switch op.aux { + case "Bool", "Int8", "Int16", "Int32", "Int64", "Int128", "Float32", "Float64", "SymOff", "SymValAndOff", "SymInt32": + default: + log.Fatalf("%s: op %s %s can't have auxint", loc, op.name, op.aux) + } x := a[1 : len(a)-1] // remove [] if !isVariable(x) { // code @@ -368,7 +397,12 @@ func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, t } } } else if a[0] == '{' { - // auxint restriction + // aux restriction + switch op.aux { + case "String", "Sym", "SymOff", "SymValAndOff", "SymInt32": + default: + log.Fatalf("%s: op %s %s can't have aux", loc, op.name, op.aux) + } x := a[1 : len(a)-1] // remove {} if !isVariable(x) { // code @@ -412,30 +446,18 @@ func genMatch0(w io.Writer, arch arch, match, v string, m map[string]struct{}, t argname = fmt.Sprintf("%s_%d", v, argnum) } fmt.Fprintf(w, "%s := %s.Args[%d]\n", argname, v, argnum) - genMatch0(w, arch, a, argname, m, false) + genMatch0(w, arch, a, argname, m, false, loc) argnum++ } } - - variableLength := false - for _, op := range genericOps { - if op.name == s[0] && op.argLength == -1 { - variableLength = true - break - } - } - for _, op := range arch.ops { - if op.name == s[0] && op.argLength == -1 { - variableLength = true - break - } - } - if variableLength { + if op.argLength == -1 { fmt.Fprintf(w, "if len(%s.Args) != %d {\nbreak\n}\n", v, argnum) + } else if int(op.argLength) != argnum { + log.Fatalf("%s: op %s should have %d args, has %d", loc, op.name, op.argLength, argnum) } } -func genResult(w io.Writer, arch arch, result string) { +func genResult(w io.Writer, arch arch, result string, loc string) { move := false if result[0] == '@' { // parse @block directive @@ -444,9 +466,9 @@ func genResult(w io.Writer, arch arch, result string) { result = s[1] move = true } - genResult0(w, arch, result, new(int), true, move) + genResult0(w, arch, result, new(int), true, move, loc) } -func genResult0(w io.Writer, arch arch, result string, alloc *int, top, move bool) string { +func genResult0(w io.Writer, arch arch, result string, alloc *int, top, move bool, loc string) string { // TODO: when generating a constant result, use f.constVal to avoid // introducing copies just to clean them up again. if result[0] != '(' { @@ -464,6 +486,24 @@ func genResult0(w io.Writer, arch arch, result string, alloc *int, top, move boo s := split(result[1 : len(result)-1]) // remove parens, then split + // Find op record + var op opData + for _, x := range genericOps { + if x.name == s[0] { + op = x + break + } + } + for _, x := range arch.ops { + if x.name == s[0] { + op = x + break + } + } + if op.name == "" { + log.Fatalf("%s: unknown op %s", loc, s[0]) + } + // Find the type of the variable. var opType string var typeOverride bool @@ -512,23 +552,38 @@ func genResult0(w io.Writer, arch arch, result string, alloc *int, top, move boo fmt.Fprintf(w, "v.AddArg(%s)\n", v) } } + argnum := 0 for _, a := range s[1:] { if a[0] == '<' { // type restriction, handled above } else if a[0] == '[' { // auxint restriction + switch op.aux { + case "Bool", "Int8", "Int16", "Int32", "Int64", "Int128", "Float32", "Float64", "SymOff", "SymValAndOff", "SymInt32": + default: + log.Fatalf("%s: op %s %s can't have auxint", loc, op.name, op.aux) + } x := a[1 : len(a)-1] // remove [] fmt.Fprintf(w, "%s.AuxInt = %s\n", v, x) } else if a[0] == '{' { // aux restriction + switch op.aux { + case "String", "Sym", "SymOff", "SymValAndOff", "SymInt32": + default: + log.Fatalf("%s: op %s %s can't have aux", loc, op.name, op.aux) + } x := a[1 : len(a)-1] // remove {} fmt.Fprintf(w, "%s.Aux = %s\n", v, x) } else { // regular argument (sexpr or variable) - x := genResult0(w, arch, a, alloc, false, move) + x := genResult0(w, arch, a, alloc, false, move, loc) fmt.Fprintf(w, "%s.AddArg(%s)\n", v, x) + argnum++ } } + if op.argLength != -1 && int(op.argLength) != argnum { + log.Fatalf("%s: op %s should have %d args, has %d", loc, op.name, op.argLength, argnum) + } return v } diff --git a/src/cmd/compile/internal/ssa/id.go b/src/cmd/compile/internal/ssa/id.go index 367e687abf..725279e9fd 100644 --- a/src/cmd/compile/internal/ssa/id.go +++ b/src/cmd/compile/internal/ssa/id.go @@ -11,7 +11,7 @@ type idAlloc struct { last ID } -// get allocates an ID and returns it. +// get allocates an ID and returns it. IDs are always > 0. func (a *idAlloc) get() ID { x := a.last x++ diff --git a/src/cmd/compile/internal/ssa/likelyadjust.go b/src/cmd/compile/internal/ssa/likelyadjust.go index 76251bdd14..2f52c4c6e6 100644 --- a/src/cmd/compile/internal/ssa/likelyadjust.go +++ b/src/cmd/compile/internal/ssa/likelyadjust.go @@ -11,11 +11,24 @@ import ( type loop struct { header *Block // The header node of this (reducible) loop outer *loop // loop containing this loop - // Next two fields not currently used, but cheap to maintain, - // and aid in computation of inner-ness and list of blocks. - nBlocks int32 // Number of blocks in this loop but not within inner loops - isInner bool // True if never discovered to contain a loop - containsCall bool // if any block in this loop or any loop it contains is a BlockCall or BlockDefer + + // By default, children exits, and depth are not initialized. + children []*loop // loops nested directly within this loop. Initialized by assembleChildren(). + exits []*Block // exits records blocks reached by exits from this loop. Initialized by findExits(). + + // Loops aren't that common, so rather than force regalloc to keep + // a map or slice for its data, just put it here. + spills []*Value + scratch int32 + + // Next three fields used by regalloc and/or + // aid in computation of inner-ness and list of blocks. + nBlocks int32 // Number of blocks in this loop but not within inner loops + depth int16 // Nesting depth of the loop; 1 is outermost. Initialized by calculateDepths(). + isInner bool // True if never discovered to contain a loop + + // register allocation uses this. + containsCall bool // if any block in this loop or any loop it contains is a BlockCall or BlockDefer } // outerinner records that outer contains inner @@ -48,6 +61,9 @@ type loopnest struct { po []*Block sdom sparseTree loops []*loop + + // Record which of the lazily initialized fields have actually been initialized. + initializedChildren, initializedDepth, initializedExits bool } func min8(a, b int8) int8 { @@ -295,6 +311,35 @@ func loopnestfor(f *Func) *loopnest { innermost.nBlocks++ } } + + ln := &loopnest{f: f, b2l: b2l, po: po, sdom: sdom, loops: loops} + + // Curious about the loopiness? "-d=ssa/likelyadjust/stats" + if f.pass.stats > 0 && len(loops) > 0 { + ln.assembleChildren() + ln.calculateDepths() + ln.findExits() + + // Note stats for non-innermost loops are slightly flawed because + // they don't account for inner loop exits that span multiple levels. + + for _, l := range loops { + x := len(l.exits) + cf := 0 + if !l.containsCall { + cf = 1 + } + inner := 0 + if l.isInner { + inner++ + } + + f.logStat("loopstats:", + l.depth, "depth", x, "exits", + inner, "is_inner", cf, "is_callfree", l.nBlocks, "n_blocks") + } + } + if f.pass.debug > 1 && len(loops) > 0 { fmt.Printf("Loops in %s:\n", f.Name) for _, l := range loops { @@ -314,5 +359,90 @@ func loopnestfor(f *Func) *loopnest { } fmt.Print("\n") } - return &loopnest{f, b2l, po, sdom, loops} + return ln +} + +// assembleChildren initializes the children field of each +// loop in the nest. Loop A is a child of loop B if A is +// directly nested within B (based on the reducible-loops +// detection above) +func (ln *loopnest) assembleChildren() { + if ln.initializedChildren { + return + } + for _, l := range ln.loops { + if l.outer != nil { + l.outer.children = append(l.outer.children, l) + } + } + ln.initializedChildren = true +} + +// calculateDepths uses the children field of loops +// to determine the nesting depth (outer=1) of each +// loop. This is helpful for finding exit edges. +func (ln *loopnest) calculateDepths() { + if ln.initializedDepth { + return + } + ln.assembleChildren() + for _, l := range ln.loops { + if l.outer == nil { + l.setDepth(1) + } + } + ln.initializedDepth = true +} + +// findExits uses loop depth information to find the +// exits from a loop. +func (ln *loopnest) findExits() { + if ln.initializedExits { + return + } + ln.calculateDepths() + b2l := ln.b2l + for _, b := range ln.po { + l := b2l[b.ID] + if l != nil && len(b.Succs) == 2 { + sl := b2l[b.Succs[0].ID] + if recordIfExit(l, sl, b.Succs[0]) { + continue + } + sl = b2l[b.Succs[1].ID] + if recordIfExit(l, sl, b.Succs[1]) { + continue + } + } + } + ln.initializedExits = true +} + +// recordIfExit checks sl (the loop containing b) to see if it +// is outside of loop l, and if so, records b as an exit block +// from l and returns true. +func recordIfExit(l, sl *loop, b *Block) bool { + if sl != l { + if sl == nil || sl.depth <= l.depth { + l.exits = append(l.exits, b) + return true + } + // sl is not nil, and is deeper than l + // it's possible for this to be a goto into an irreducible loop made from gotos. + for sl.depth > l.depth { + sl = sl.outer + } + if sl != l { + l.exits = append(l.exits, b) + return true + } + } + return false +} + +func (l *loop) setDepth(d int16) { + l.depth = d + for _, c := range l.children { + c.setDepth(d + 1) + } } diff --git a/src/cmd/compile/internal/ssa/loopbce.go b/src/cmd/compile/internal/ssa/loopbce.go index 17486ac49f..9bd2d3f0de 100644 --- a/src/cmd/compile/internal/ssa/loopbce.go +++ b/src/cmd/compile/internal/ssa/loopbce.go @@ -31,7 +31,7 @@ type indVar struct { // // // TODO: handle 32 bit operations -func findIndVar(f *Func, sdom sparseTree) []indVar { +func findIndVar(f *Func) []indVar { var iv []indVar nextb: @@ -110,7 +110,7 @@ nextb: // Second condition: b.Succs[entry] dominates nxt so that // nxt is computed when inc < max, meaning nxt <= max. - if !sdom.isAncestorEq(b.Succs[entry], nxt.Block) { + if !f.sdom.isAncestorEq(b.Succs[entry], nxt.Block) { // inc+ind can only be reached through the branch that enters the loop. continue } @@ -160,20 +160,18 @@ nextb: // loopbce performs loop based bounds check elimination. func loopbce(f *Func) { - idom := dominators(f) - sdom := newSparseTree(f, idom) - ivList := findIndVar(f, sdom) + ivList := findIndVar(f) m := make(map[*Value]indVar) for _, iv := range ivList { m[iv.ind] = iv } - removeBoundsChecks(f, sdom, m) + removeBoundsChecks(f, m) } // removesBoundsChecks remove IsInBounds and IsSliceInBounds based on the induction variables. -func removeBoundsChecks(f *Func, sdom sparseTree, m map[*Value]indVar) { +func removeBoundsChecks(f *Func, m map[*Value]indVar) { for _, b := range f.Blocks { if b.Kind != BlockIf { continue @@ -202,7 +200,7 @@ func removeBoundsChecks(f *Func, sdom sparseTree, m map[*Value]indVar) { goto skip1 } - if iv, has := m[ind]; has && sdom.isAncestorEq(iv.entry, b) && isNonNegative(iv.min) { + if iv, has := m[ind]; has && f.sdom.isAncestorEq(iv.entry, b) && isNonNegative(iv.min) { if v.Args[1] == iv.max { if f.pass.debug > 0 { f.Config.Warnl(b.Line, "Found redundant %s", v.Op) @@ -229,7 +227,7 @@ func removeBoundsChecks(f *Func, sdom sparseTree, m map[*Value]indVar) { goto skip2 } - if iv, has := m[ind]; has && sdom.isAncestorEq(iv.entry, b) && isNonNegative(iv.min) { + if iv, has := m[ind]; has && f.sdom.isAncestorEq(iv.entry, b) && isNonNegative(iv.min) { if v.Args[1].Op == OpSliceCap && iv.max.Op == OpSliceLen && v.Args[1].Args[0] == iv.max.Args[0] { if f.pass.debug > 0 { f.Config.Warnl(b.Line, "Found redundant %s (len promoted to cap)", v.Op) @@ -240,6 +238,37 @@ func removeBoundsChecks(f *Func, sdom sparseTree, m map[*Value]indVar) { } skip2: + // Simplify + // (IsInBounds (Add64 ind) (Const64 [c])) where 0 <= min <= ind < max <= (Const64 [c]) + // (IsSliceInBounds ind (Const64 [c])) where 0 <= min <= ind < max <= (Const64 [c]) + if v.Op == OpIsInBounds || v.Op == OpIsSliceInBounds { + ind, add := dropAdd64(v.Args[0]) + if ind.Op != OpPhi { + goto skip3 + } + + // ind + add >= 0 <-> min + add >= 0 <-> min >= -add + if iv, has := m[ind]; has && f.sdom.isAncestorEq(iv.entry, b) && isGreaterOrEqualThan(iv.min, -add) { + if !v.Args[1].isGenericIntConst() || !iv.max.isGenericIntConst() { + goto skip3 + } + + limit := v.Args[1].AuxInt + if v.Op == OpIsSliceInBounds { + // If limit++ overflows signed integer then 0 <= max && max <= limit will be false. + limit++ + } + + if max := iv.max.AuxInt + add; 0 <= max && max <= limit { // handle overflow + if f.pass.debug > 0 { + f.Config.Warnl(b.Line, "Found redundant (%s ind %d), ind < %d", v.Op, v.Args[1].AuxInt, iv.max.AuxInt+add) + } + goto simplify + } + } + } + skip3: + continue simplify: @@ -258,3 +287,13 @@ func dropAdd64(v *Value) (*Value, int64) { } return v, 0 } + +func isGreaterOrEqualThan(v *Value, c int64) bool { + if c == 0 { + return isNonNegative(v) + } + if v.isGenericIntConst() && v.AuxInt >= c { + return true + } + return false +} diff --git a/src/cmd/compile/internal/ssa/nilcheck.go b/src/cmd/compile/internal/ssa/nilcheck.go index 881e3b2eff..62eb0c8ea6 100644 --- a/src/cmd/compile/internal/ssa/nilcheck.go +++ b/src/cmd/compile/internal/ssa/nilcheck.go @@ -4,14 +4,12 @@ package ssa -// TODO: return value from newobject/newarray is non-nil. - // nilcheckelim eliminates unnecessary nil checks. func nilcheckelim(f *Func) { // A nil check is redundant if the same nil check was successful in a // dominating block. The efficacy of this pass depends heavily on the // efficacy of the cse pass. - idom := dominators(f) + idom := f.idom domTree := make([][]*Block, f.NumBlocks()) // Create a block ID -> [dominees] mapping diff --git a/src/cmd/compile/internal/ssa/nilcheck_test.go b/src/cmd/compile/internal/ssa/nilcheck_test.go index d1f38b6951..af6cbe864a 100644 --- a/src/cmd/compile/internal/ssa/nilcheck_test.go +++ b/src/cmd/compile/internal/ssa/nilcheck_test.go @@ -49,6 +49,7 @@ func benchmarkNilCheckDeep(b *testing.B, depth int) { b.ReportAllocs() for i := 0; i < b.N; i++ { + domTree(fun.f) nilcheckelim(fun.f) } } @@ -83,6 +84,7 @@ func TestNilcheckSimple(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -120,6 +122,7 @@ func TestNilcheckDomOrder(t *testing.T) { Goto("exit"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -153,6 +156,7 @@ func TestNilcheckAddr(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -187,6 +191,7 @@ func TestNilcheckAddPtr(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -231,6 +236,7 @@ func TestNilcheckPhi(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -272,6 +278,7 @@ func TestNilcheckKeepRemove(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -319,6 +326,7 @@ func TestNilcheckInFalseBranch(t *testing.T) { Exit("mem"))) CheckFunc(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -370,6 +378,7 @@ func TestNilcheckUser(t *testing.T) { CheckFunc(fun.f) // we need the opt here to rewrite the user nilcheck opt(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check @@ -409,11 +418,12 @@ func TestNilcheckBug(t *testing.T) { Goto("exit")), Bloc("exit", Valu("phi", OpPhi, TypeMem, 0, nil, "mem", "store"), - Exit("mem"))) + Exit("phi"))) CheckFunc(fun.f) // we need the opt here to rewrite the user nilcheck opt(fun.f) + domTree(fun.f) nilcheckelim(fun.f) // clean up the removed nil check diff --git a/src/cmd/compile/internal/ssa/op.go b/src/cmd/compile/internal/ssa/op.go index d10ea230ff..cadbc7cd7a 100644 --- a/src/cmd/compile/internal/ssa/op.go +++ b/src/cmd/compile/internal/ssa/op.go @@ -26,7 +26,7 @@ type opInfo struct { generic bool // this is a generic (arch-independent) opcode rematerializeable bool // this op is rematerializeable commutative bool // this operation is commutative (e.g. addition) - resultInArg0 bool // prefer v and v.Args[0] to be allocated to the same register + resultInArg0 bool // v and v.Args[0] must be allocated to the same register } type inputInfo struct { @@ -49,9 +49,10 @@ const ( auxInt16 // auxInt is a 16-bit integer auxInt32 // auxInt is a 32-bit integer auxInt64 // auxInt is a 64-bit integer + auxInt128 // auxInt represents a 128-bit integer. Always 0. auxFloat32 // auxInt is a float32 (encoded with math.Float64bits) auxFloat64 // auxInt is a float64 (encoded with math.Float64bits) - auxString // auxInt is a string + auxString // aux is a string auxSym // aux is a symbol auxSymOff // aux is a symbol, auxInt is an offset auxSymValAndOff // aux is a symbol, auxInt is a ValAndOff diff --git a/src/cmd/compile/internal/ssa/opGen.go b/src/cmd/compile/internal/ssa/opGen.go index 5465d7f5ed..9ab9be769c 100644 --- a/src/cmd/compile/internal/ssa/opGen.go +++ b/src/cmd/compile/internal/ssa/opGen.go @@ -120,28 +120,16 @@ const ( OpAMD64MOVSDstoreidx8 OpAMD64ADDQ OpAMD64ADDL - OpAMD64ADDW - OpAMD64ADDB OpAMD64ADDQconst OpAMD64ADDLconst - OpAMD64ADDWconst - OpAMD64ADDBconst OpAMD64SUBQ OpAMD64SUBL - OpAMD64SUBW - OpAMD64SUBB OpAMD64SUBQconst OpAMD64SUBLconst - OpAMD64SUBWconst - OpAMD64SUBBconst OpAMD64MULQ OpAMD64MULL - OpAMD64MULW - OpAMD64MULB OpAMD64MULQconst OpAMD64MULLconst - OpAMD64MULWconst - OpAMD64MULBconst OpAMD64HMULQ OpAMD64HMULL OpAMD64HMULW @@ -165,28 +153,16 @@ const ( OpAMD64MODWU OpAMD64ANDQ OpAMD64ANDL - OpAMD64ANDW - OpAMD64ANDB OpAMD64ANDQconst OpAMD64ANDLconst - OpAMD64ANDWconst - OpAMD64ANDBconst OpAMD64ORQ OpAMD64ORL - OpAMD64ORW - OpAMD64ORB OpAMD64ORQconst OpAMD64ORLconst - OpAMD64ORWconst - OpAMD64ORBconst OpAMD64XORQ OpAMD64XORL - OpAMD64XORW - OpAMD64XORB OpAMD64XORQconst OpAMD64XORLconst - OpAMD64XORWconst - OpAMD64XORBconst OpAMD64CMPQ OpAMD64CMPL OpAMD64CMPW @@ -207,12 +183,8 @@ const ( OpAMD64TESTBconst OpAMD64SHLQ OpAMD64SHLL - OpAMD64SHLW - OpAMD64SHLB OpAMD64SHLQconst OpAMD64SHLLconst - OpAMD64SHLWconst - OpAMD64SHLBconst OpAMD64SHRQ OpAMD64SHRL OpAMD64SHRW @@ -235,12 +207,8 @@ const ( OpAMD64ROLBconst OpAMD64NEGQ OpAMD64NEGL - OpAMD64NEGW - OpAMD64NEGB OpAMD64NOTQ OpAMD64NOTL - OpAMD64NOTW - OpAMD64NOTB OpAMD64BSFQ OpAMD64BSFL OpAMD64BSFW @@ -280,8 +248,6 @@ const ( OpAMD64MOVWQZX OpAMD64MOVLQSX OpAMD64MOVLQZX - OpAMD64MOVBconst - OpAMD64MOVWconst OpAMD64MOVLconst OpAMD64MOVQconst OpAMD64CVTTSD2SL @@ -537,6 +503,10 @@ const ( OpGeq64U OpGeq32F OpGeq64F + OpAndB + OpOrB + OpEqB + OpNeqB OpNot OpNeg8 OpNeg16 @@ -971,81 +941,13 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "ADDQ", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AADDQ, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ADDL", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AADDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ADDW", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AADDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ADDB", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AADDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ADDQconst", - auxType: auxInt64, - argLen: 1, - resultInArg0: true, - asm: x86.AADDQ, + name: "ADDQ", + argLen: 2, + commutative: true, + asm: x86.AADDQ, reg: regInfo{ inputs: []inputInfo{ + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS @@ -1055,13 +957,13 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "ADDLconst", - auxType: auxInt32, - argLen: 1, - resultInArg0: true, - asm: x86.AADDL, + name: "ADDL", + argLen: 2, + commutative: true, + asm: x86.AADDL, reg: regInfo{ inputs: []inputInfo{ + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS @@ -1071,11 +973,10 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "ADDWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.AADDL, + name: "ADDQconst", + auxType: auxInt64, + argLen: 1, + asm: x86.AADDQ, reg: regInfo{ inputs: []inputInfo{ {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 @@ -1087,11 +988,10 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "ADDBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.AADDL, + name: "ADDLconst", + auxType: auxInt32, + argLen: 1, + asm: x86.AADDL, reg: regInfo{ inputs: []inputInfo{ {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 @@ -1109,8 +1009,8 @@ var opcodeTable = [...]opInfo{ asm: x86.ASUBQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1125,40 +1025,8 @@ var opcodeTable = [...]opInfo{ asm: x86.ASUBL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SUBW", - argLen: 2, - resultInArg0: true, - asm: x86.ASUBL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SUBB", - argLen: 2, - resultInArg0: true, - asm: x86.ASUBL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1174,7 +1042,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASUBQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1190,39 +1058,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASUBL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SUBWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.ASUBL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SUBBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.ASUBL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1238,8 +1074,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AIMULQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1255,42 +1091,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AIMULL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "MULW", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AIMULW, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "MULB", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AIMULW, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1306,7 +1108,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AIMULQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1322,39 +1124,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AIMULL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "MULWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.AIMULW, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "MULBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.AIMULW, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1489,8 +1259,8 @@ var opcodeTable = [...]opInfo{ resultInArg0: true, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1686,8 +1456,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AANDQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1703,42 +1473,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AANDL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ANDW", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AANDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ANDB", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AANDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1754,7 +1490,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AANDQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1770,39 +1506,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AANDL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ANDWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.AANDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ANDBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.AANDL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1818,8 +1522,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AORQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1835,42 +1539,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AORL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ORW", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ORB", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1886,7 +1556,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AORQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1902,39 +1572,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AORL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ORWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.AORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "ORBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.AORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1950,8 +1588,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AXORQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -1967,42 +1605,8 @@ var opcodeTable = [...]opInfo{ asm: x86.AXORL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "XORW", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AXORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "XORB", - argLen: 2, - commutative: true, - resultInArg0: true, - asm: x86.AXORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - {1, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {1, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2018,7 +1622,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AXORQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2034,39 +1638,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AXORL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "XORWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.AXORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "XORBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.AXORL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2334,11 +1906,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2350,43 +1922,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SHLW", - argLen: 2, - resultInArg0: true, - asm: x86.ASHLL, - reg: regInfo{ - inputs: []inputInfo{ - {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SHLB", - argLen: 2, - resultInArg0: true, - asm: x86.ASHLL, - reg: regInfo{ - inputs: []inputInfo{ - {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2398,7 +1938,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHLQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2414,39 +1954,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHLL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SHLWconst", - auxType: auxInt16, - argLen: 1, - resultInArg0: true, - asm: x86.ASHLL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "SHLBconst", - auxType: auxInt8, - argLen: 1, - resultInArg0: true, - asm: x86.ASHLL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2462,11 +1970,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2478,11 +1986,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2494,11 +2002,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2510,11 +2018,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2526,7 +2034,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHRQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2542,7 +2050,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHRL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2558,7 +2066,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHRW, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2574,7 +2082,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASHRB, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2590,11 +2098,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2606,11 +2114,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2622,11 +2130,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2638,11 +2146,11 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 2}, // CX - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ - 65517, // AX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, }, }, @@ -2654,7 +2162,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASARQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2670,7 +2178,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASARL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2686,7 +2194,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASARW, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2702,7 +2210,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ASARB, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2718,7 +2226,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AROLQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2734,7 +2242,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AROLL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2750,7 +2258,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AROLW, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2766,7 +2274,7 @@ var opcodeTable = [...]opInfo{ asm: x86.AROLB, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2781,7 +2289,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ANEGQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2796,37 +2304,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ANEGL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "NEGW", - argLen: 1, - resultInArg0: true, - asm: x86.ANEGL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "NEGB", - argLen: 1, - resultInArg0: true, - asm: x86.ANEGL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2841,7 +2319,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ANOTQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2856,37 +2334,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ANOTL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "NOTW", - argLen: 1, - resultInArg0: true, - asm: x86.ANOTL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - clobbers: 8589934592, // FLAGS - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "NOTB", - argLen: 1, - resultInArg0: true, - asm: x86.ANOTL, - reg: regInfo{ - inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2900,7 +2348,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSFQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2914,7 +2362,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSFL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2928,7 +2376,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSFW, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2942,7 +2390,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSRQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2956,7 +2404,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSRL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2970,7 +2418,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSRW, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -2987,7 +2435,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3004,7 +2452,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3021,7 +2469,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3038,7 +2486,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3055,7 +2503,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3072,7 +2520,7 @@ var opcodeTable = [...]opInfo{ reg: regInfo{ inputs: []inputInfo{ {1, 8589934592}, // FLAGS - {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65518}, // CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934593, // AX FLAGS outputs: []regMask{ @@ -3087,7 +2535,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSWAPQ, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -3102,7 +2550,7 @@ var opcodeTable = [...]opInfo{ asm: x86.ABSWAPL, reg: regInfo{ inputs: []inputInfo{ - {0, 65535}, // AX CX DX BX SP BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 + {0, 65519}, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 }, clobbers: 8589934592, // FLAGS outputs: []regMask{ @@ -3438,30 +2886,6 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "MOVBconst", - auxType: auxInt8, - argLen: 0, - rematerializeable: true, - asm: x86.AMOVB, - reg: regInfo{ - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { - name: "MOVWconst", - auxType: auxInt16, - argLen: 0, - rematerializeable: true, - asm: x86.AMOVW, - reg: regInfo{ - outputs: []regMask{ - 65519, // AX CX DX BX BP SI DI R8 R9 R10 R11 R12 R13 R14 R15 - }, - }, - }, - { name: "MOVLconst", auxType: auxInt32, argLen: 0, @@ -4211,6 +3635,7 @@ var opcodeTable = [...]opInfo{ }, { name: "MOVOconst", + auxType: auxInt128, argLen: 0, rematerializeable: true, reg: regInfo{ @@ -4430,9 +3855,10 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "MOVWload", - argLen: 2, - asm: arm.AMOVW, + name: "MOVWload", + auxType: auxSymOff, + argLen: 2, + asm: arm.AMOVW, reg: regInfo{ inputs: []inputInfo{ {0, 31}, // R0 R1 R2 R3 SP @@ -4443,9 +3869,10 @@ var opcodeTable = [...]opInfo{ }, }, { - name: "MOVWstore", - argLen: 3, - asm: arm.AMOVW, + name: "MOVWstore", + auxType: auxSymOff, + argLen: 3, + asm: arm.AMOVW, reg: regInfo{ inputs: []inputInfo{ {0, 31}, // R0 R1 R2 R3 SP @@ -4463,7 +3890,7 @@ var opcodeTable = [...]opInfo{ }, { name: "LessThan", - argLen: 2, + argLen: 1, reg: regInfo{ inputs: []inputInfo{ {0, 32}, // FLAGS @@ -5354,6 +4781,26 @@ var opcodeTable = [...]opInfo{ generic: true, }, { + name: "AndB", + argLen: 2, + generic: true, + }, + { + name: "OrB", + argLen: 2, + generic: true, + }, + { + name: "EqB", + argLen: 2, + generic: true, + }, + { + name: "NeqB", + argLen: 2, + generic: true, + }, + { name: "Not", argLen: 1, generic: true, diff --git a/src/cmd/compile/internal/ssa/phielim.go b/src/cmd/compile/internal/ssa/phielim.go index ce3b5a199a..77013c6481 100644 --- a/src/cmd/compile/internal/ssa/phielim.go +++ b/src/cmd/compile/internal/ssa/phielim.go @@ -40,11 +40,7 @@ func phielimValue(v *Value) bool { // are not v itself, then the phi must remain. // Otherwise, we can replace it with a copy. var w *Value - for i, x := range v.Args { - if b := v.Block.Preds[i]; b.Kind == BlockFirst && b.Succs[1] == v.Block { - // This branch is never taken so we can just eliminate it. - continue - } + for _, x := range v.Args { if x == v { continue } diff --git a/src/cmd/compile/internal/ssa/phiopt.go b/src/cmd/compile/internal/ssa/phiopt.go index 2d0a45733a..3b6728ca86 100644 --- a/src/cmd/compile/internal/ssa/phiopt.go +++ b/src/cmd/compile/internal/ssa/phiopt.go @@ -26,6 +26,7 @@ package ssa func phiopt(f *Func) { for _, b := range f.Blocks { if len(b.Preds) != 2 || len(b.Values) == 0 { + // TODO: handle more than 2 predecessors, e.g. a || b || c. continue } @@ -45,44 +46,67 @@ func phiopt(f *Func) { } // b0 is the if block giving the boolean value. - var reverse bool + // reverse is the predecessor from which the truth value comes. + var reverse int if b0.Succs[0] == pb0 && b0.Succs[1] == pb1 { - reverse = false + reverse = 0 } else if b0.Succs[0] == pb1 && b0.Succs[1] == pb0 { - reverse = true + reverse = 1 } else { b.Fatalf("invalid predecessors\n") } for _, v := range b.Values { - if v.Op != OpPhi || !v.Type.IsBoolean() || v.Args[0].Op != OpConstBool || v.Args[1].Op != OpConstBool { + if v.Op != OpPhi || !v.Type.IsBoolean() { continue } - ok, isCopy := false, false - if v.Args[0].AuxInt == 1 && v.Args[1].AuxInt == 0 { - ok, isCopy = true, !reverse - } else if v.Args[0].AuxInt == 0 && v.Args[1].AuxInt == 1 { - ok, isCopy = true, reverse + // Replaces + // if a { x = true } else { x = false } with x = a + // and + // if a { x = false } else { x = true } with x = !a + if v.Args[0].Op == OpConstBool && v.Args[1].Op == OpConstBool { + if v.Args[reverse].AuxInt != v.Args[1-reverse].AuxInt { + ops := [2]Op{OpNot, OpCopy} + v.reset(ops[v.Args[reverse].AuxInt]) + v.AddArg(b0.Control) + if f.pass.debug > 0 { + f.Config.Warnl(b.Line, "converted OpPhi to %v", v.Op) + } + continue + } } - // (Phi (ConstBool [x]) (ConstBool [x])) is already handled by opt / phielim. - - if ok && isCopy { - if f.pass.debug > 0 { - f.Config.Warnl(b.Line, "converted OpPhi to OpCopy") + // Replaces + // if a { x = true } else { x = value } with x = a || value. + // Requires that value dominates x, meaning that regardless of a, + // value is always computed. This guarantees that the side effects + // of value are not seen if a is false. + if v.Args[reverse].Op == OpConstBool && v.Args[reverse].AuxInt == 1 { + if tmp := v.Args[1-reverse]; f.sdom.isAncestorEq(tmp.Block, b) { + v.reset(OpOrB) + v.SetArgs2(b0.Control, tmp) + if f.pass.debug > 0 { + f.Config.Warnl(b.Line, "converted OpPhi to %v", v.Op) + } + continue } - v.reset(OpCopy) - v.AddArg(b0.Control) - continue } - if ok && !isCopy { - if f.pass.debug > 0 { - f.Config.Warnl(b.Line, "converted OpPhi to OpNot") + + // Replaces + // if a { x = value } else { x = false } with x = a && value. + // Requires that value dominates x, meaning that regardless of a, + // value is always computed. This guarantees that the side effects + // of value are not seen if a is false. + if v.Args[1-reverse].Op == OpConstBool && v.Args[1-reverse].AuxInt == 0 { + if tmp := v.Args[reverse]; f.sdom.isAncestorEq(tmp.Block, b) { + v.reset(OpAndB) + v.SetArgs2(b0.Control, tmp) + if f.pass.debug > 0 { + f.Config.Warnl(b.Line, "converted OpPhi to %v", v.Op) + } + continue } - v.reset(OpNot) - v.AddArg(b0.Control) - continue } } } diff --git a/src/cmd/compile/internal/ssa/prove.go b/src/cmd/compile/internal/ssa/prove.go index a12a996263..f4a10b508a 100644 --- a/src/cmd/compile/internal/ssa/prove.go +++ b/src/cmd/compile/internal/ssa/prove.go @@ -445,9 +445,6 @@ var ( // else branch of the first comparison is executed, we already know that i < len(a). // The code for the second panic can be removed. func prove(f *Func) { - idom := dominators(f) - sdom := newSparseTree(f, idom) - // current node state type walkState int const ( @@ -471,8 +468,8 @@ func prove(f *Func) { for len(work) > 0 { node := work[len(work)-1] work = work[:len(work)-1] - parent := idom[node.block.ID] - branch := getBranch(sdom, parent, node.block) + parent := f.idom[node.block.ID] + branch := getBranch(f.sdom, parent, node.block) switch node.state { case descend: @@ -491,7 +488,7 @@ func prove(f *Func) { block: node.block, state: simplify, }) - for s := sdom.Child(node.block); s != nil; s = sdom.Sibling(s) { + for s := f.sdom.Child(node.block); s != nil; s = f.sdom.Sibling(s) { work = append(work, bp{ block: s, state: descend, diff --git a/src/cmd/compile/internal/ssa/regalloc.go b/src/cmd/compile/internal/ssa/regalloc.go index 22b9d12c19..65c25dfc5a 100644 --- a/src/cmd/compile/internal/ssa/regalloc.go +++ b/src/cmd/compile/internal/ssa/regalloc.go @@ -91,6 +91,18 @@ // will have no use (so don't run deadcode after regalloc!). // TODO: maybe we should introduce these extra phis? +// Additional not-quite-SSA output occurs when spills are sunk out +// of loops to the targets of exit edges from the loop. Before sinking, +// there is one spill site (one StoreReg) targeting stack slot X, after +// sinking there may be multiple spill sites targeting stack slot X, +// with no phi functions at any join points reachable by the multiple +// spill sites. In addition, uses of the spill from copies of the original +// will not name the copy in their reference; instead they will name +// the original, though both will have the same spill location. The +// first sunk spill will be the original, but moved, to an exit block, +// thus ensuring that there is a definition somewhere corresponding to +// the original spill's uses. + package ssa import ( @@ -100,7 +112,8 @@ import ( ) const ( - logSpills = iota + moveSpills = iota + logSpills regDebug stackDebug ) @@ -176,10 +189,9 @@ type valState struct { uses *use // list of uses in this block spill *Value // spilled copy of the Value spillUsed bool - needReg bool // cached value of !v.Type.IsMemory() && !v.Type.IsVoid() && !.v.Type.IsFlags() - rematerializeable bool // cached value of v.rematerializeable() - desired register // register we want value to be in, if any - avoid regMask // registers to avoid if we can + spillUsedShuffle bool // true if used in shuffling, after ordinary uses + needReg bool // cached value of !v.Type.IsMemory() && !v.Type.IsVoid() && !.v.Type.IsFlags() + rematerializeable bool // cached value of v.rematerializeable() } type regState struct { @@ -191,10 +203,11 @@ type regState struct { type regAllocState struct { f *Func - registers []Register - numRegs register - SPReg register - SBReg register + registers []Register + numRegs register + SPReg register + SBReg register + allocatable regMask // for each block, its primary predecessor. // A predecessor of b is primary if it is the closest @@ -206,6 +219,11 @@ type regAllocState struct { // which are live at the end of b, together with a count of how many instructions // forward to the next use. live [][]liveInfo + // desired register assignments at the end of each block. + // Note that this is a static map computed before allocation occurs. Dynamic + // register desires (from partially completed allocations) will trump + // this information. + desired []desiredState // current state of each (preregalloc) Value values []valState @@ -243,6 +261,15 @@ type regAllocState struct { loopnest *loopnest } +type spillToSink struct { + spill *Value // Spill instruction to move (a StoreReg) + dests int32 // Bitmask indicating exit blocks from loop in which spill/val is defined. 1<<i set means val is live into loop.exitBlocks[i] +} + +func (sts *spillToSink) spilledValue() *Value { + return sts.spill.Args[0] +} + type endReg struct { r register v *Value // pre-regalloc value held in this register (TODO: can we use ID here?) @@ -310,6 +337,7 @@ func (s *regAllocState) assignReg(r register, v *Value, c *Value) { // If there is no unused register, a Value will be kicked out of // a register to make room. func (s *regAllocState) allocReg(v *Value, mask regMask) register { + mask &= s.allocatable mask &^= s.nospill if mask == 0 { s.f.Fatalf("no register available") @@ -317,20 +345,7 @@ func (s *regAllocState) allocReg(v *Value, mask regMask) register { // Pick an unused register if one is available. if mask&^s.used != 0 { - mask &^= s.used - - // Use desired register if we can. - d := s.values[v.ID].desired - if d != noRegister && mask>>d&1 != 0 { - mask = regMask(1) << d - } - - // Avoid avoidable registers if we can. - if mask&^s.values[v.ID].avoid != 0 { - mask &^= s.values[v.ID].avoid - } - - return pickReg(mask) + return pickReg(mask &^ s.used) } // Pick a value to spill. Spill the value with the @@ -340,10 +355,6 @@ func (s *regAllocState) allocReg(v *Value, mask regMask) register { // TODO: if a single value is in multiple registers, spill one of them // before spilling a value in just a single register. - // SP and SB are allocated specially. No regular value should - // be allocated to them. - mask &^= 1<<s.SPReg | 1<<s.SBReg - // Find a register to spill. We spill the register containing the value // whose next use is as far in the future as possible. // https://en.wikipedia.org/wiki/Page_replacement_algorithm#The_theoretically_optimal_page_replacement_algorithm @@ -389,14 +400,6 @@ func (s *regAllocState) allocValToReg(v *Value, mask regMask, nospill bool, line return s.regs[r].c } - if v.Op != OpSP { - mask &^= 1 << s.SPReg // dont' spill SP - } - if v.Op != OpSB { - mask &^= 1 << s.SBReg // don't spill SB - } - mask &^= s.reserved() - // Allocate a register. r := s.allocReg(v, mask) @@ -417,7 +420,7 @@ func (s *regAllocState) allocValToReg(v *Value, mask regMask, nospill bool, line // Load v from its spill location. case vi.spill != nil: if s.f.pass.debug > logSpills { - s.f.Config.Warnl(vi.spill.Line, "load spill") + s.f.Config.Warnl(vi.spill.Line, "load spill for %v from %v", v, vi.spill) } c = s.curBlock.NewValue1(line, OpLoadReg, v.Type, vi.spill) vi.spillUsed = true @@ -434,6 +437,7 @@ func (s *regAllocState) allocValToReg(v *Value, mask regMask, nospill bool, line } func (s *regAllocState) init(f *Func) { + s.f = f s.registers = f.Config.registers s.numRegs = register(len(s.registers)) if s.numRegs > noRegister || s.numRegs > register(unsafe.Sizeof(regMask(0))*8) { @@ -448,7 +452,17 @@ func (s *regAllocState) init(f *Func) { } } - s.f = f + // Figure out which registers we're allowed to use. + s.allocatable = regMask(1)<<s.numRegs - 1 + s.allocatable &^= 1 << s.SPReg + s.allocatable &^= 1 << s.SBReg + if obj.Framepointer_enabled != 0 { + s.allocatable &^= 1 << 5 // BP + } + if s.f.Config.ctxt.Flag_dynlink { + s.allocatable &^= 1 << 15 // R15 + } + s.regs = make([]regState, s.numRegs) s.values = make([]valState, f.NumValues()) s.orig = make([]*Value, f.NumValues()) @@ -457,7 +471,6 @@ func (s *regAllocState) init(f *Func) { if !v.Type.IsMemory() && !v.Type.IsVoid() && !v.Type.IsFlags() { s.values[v.ID].needReg = true s.values[v.ID].rematerializeable = v.rematerializeable() - s.values[v.ID].desired = noRegister s.orig[v.ID] = v } } @@ -527,6 +540,18 @@ func (s *regAllocState) advanceUses(v *Value) { } } +// liveAfterCurrentInstruction reports whether v is live after +// the current instruction is completed. v must be used by the +// current instruction. +func (s *regAllocState) liveAfterCurrentInstruction(v *Value) bool { + u := s.values[v.ID].uses + d := u.dist + for u != nil && u.dist == d { + u = u.next + } + return u != nil && u.dist > d +} + // Sets the state of the registers to that encoded in regs. func (s *regAllocState) setState(regs []endReg) { s.freeRegs(s.used) @@ -541,9 +566,25 @@ func (s *regAllocState) compatRegs(t Type) regMask { if t.IsFloat() || t == TypeInt128 { m = 0xffff << 16 // X0-X15 } else { - m = 0xffef << 0 // AX-R15, except SP + m = 0xffff << 0 // AX-R15 + } + return m & s.allocatable +} + +// loopForBlock returns the loop containing block b, +// provided that the loop is "interesting" for purposes +// of improving register allocation (= is inner, and does +// not contain a call) +func (s *regAllocState) loopForBlock(b *Block) *loop { + loop := s.loopnest.b2l[b.ID] + + // Minor for-the-time-being optimization: nothing happens + // unless a loop is both inner and call-free, therefore + // don't bother with other loops. + if loop != nil && (loop.containsCall || !loop.isInner) { + loop = nil } - return m &^ s.reserved() + return loop } func (s *regAllocState) regalloc(f *Func) { @@ -554,12 +595,46 @@ func (s *regAllocState) regalloc(f *Func) { var phiRegs []register var args []*Value + // statistics + var nSpills int // # of spills remaining + var nSpillsInner int // # of spills remaining in inner loops + var nSpillsSunk int // # of sunk spills remaining + var nSpillsChanged int // # of sunk spills lost because of register use change + var nSpillsSunkUnused int // # of spills not sunk because they were removed completely + var nSpillsNotSunkLateUse int // # of spills not sunk because of very late use (in shuffle) + + // Data structure used for computing desired registers. + var desired desiredState + + // Desired registers for inputs & outputs for each instruction in the block. + type dentry struct { + out [4]register // desired output registers + in [3][4]register // desired input registers (for inputs 0,1, and 2) + } + var dinfo []dentry + if f.Entry != f.Blocks[0] { f.Fatalf("entry block must be first") } + // Get loop nest so that spills in inner loops can be + // tracked. When the last block of a loop is processed, + // attempt to move spills out of the loop. + s.loopnest.findExits() + + // Spills are moved from one block's slice of values to another's. + // This confuses register allocation if it occurs before it is + // complete, so candidates are recorded, then rechecked and + // moved after all allocation (register and stack) is complete. + // Because movement is only within a stack slot's lifetime, it + // is safe to do this. + var toSink []spillToSink + // Will be used to figure out live inputs to exit blocks of inner loops. + entryCandidates := newSparseMap(f.NumValues()) + for _, b := range f.Blocks { s.curBlock = b + loop := s.loopForBlock(b) // Initialize liveSet and uses fields for this block. // Walk backwards through the block doing liveness analysis. @@ -739,6 +814,11 @@ func (s *regAllocState) regalloc(f *Func) { s.setOrig(spill, v) s.values[v.ID].spill = spill s.values[v.ID].spillUsed = false + if loop != nil { + loop.spills = append(loop.spills, v) + nSpillsInner++ + } + nSpills++ } // Save the starting state for use by merge edges. @@ -765,26 +845,27 @@ func (s *regAllocState) regalloc(f *Func) { } } - // Compute preferred registers for each value using a backwards pass. + // Allocate space to record the desired registers for each value. + dinfo = dinfo[:0] + for i := 0; i < len(oldSched); i++ { + dinfo = append(dinfo, dentry{}) + } + + // Load static desired register info at the end of the block. + desired.copy(&s.desired[b.ID]) + + // Check actual assigned registers at the start of the next block(s). + // Dynamically assigned registers will trump the static + // desired registers computed during liveness analysis. // Note that we do this phase after startRegs is set above, so that // we get the right behavior for a block which branches to itself. for _, succ := range b.Succs { - // TODO: prioritize likely successor. + // TODO: prioritize likely successor? for _, x := range s.startRegs[succ.ID] { - v := s.orig[x.vid] - s.values[v.ID].desired = x.r - } - // Process phi ops in succ - i := -1 - for j, p := range succ.Preds { - if p == b { - i = j - break - } - } - if i == -1 { - s.f.Fatalf("can't find predecssor %s of %s\n", b, succ) + desired.add(x.vid, x.r) } + // Process phi ops in succ. + pidx := predIdx(succ, b) for _, v := range succ.Values { if v.Op != OpPhi { break @@ -792,47 +873,44 @@ func (s *regAllocState) regalloc(f *Func) { if !s.values[v.ID].needReg { continue } - r, ok := s.f.getHome(v.ID).(*Register) + rp, ok := s.f.getHome(v.ID).(*Register) if !ok { continue } - a := s.orig[v.Args[i].ID] - s.values[a.ID].desired = register(r.Num) + desired.add(v.Args[pidx].ID, register(rp.Num)) } } - - // Set avoid fields to help desired register availability. - liveSet.clear() - for _, e := range s.live[b.ID] { - liveSet.add(e.ID) - } - if v := b.Control; v != nil && s.values[v.ID].needReg { - liveSet.add(v.ID) - } + // Walk values backwards computing desired register info. + // See computeLive for more comments. for i := len(oldSched) - 1; i >= 0; i-- { v := oldSched[i] - liveSet.remove(v.ID) - - r := s.values[v.ID].desired - if r != noRegister { - m := regMask(1) << r - // All live values should avoid this register so - // it will be available at this point. - for _, w := range liveSet.contents() { - s.values[w].avoid |= m + prefs := desired.remove(v.ID) + desired.clobber(opcodeTable[v.Op].reg.clobbers) + for _, j := range opcodeTable[v.Op].reg.inputs { + if countRegs(j.regs) != 1 { + continue } + desired.clobber(j.regs) + desired.add(v.Args[j.idx].ID, pickReg(j.regs)) } - - for _, a := range v.Args { - if !s.values[a.ID].needReg { - continue + if opcodeTable[v.Op].resultInArg0 { + if opcodeTable[v.Op].commutative { + desired.addList(v.Args[1].ID, prefs) } - liveSet.add(a.ID) + desired.addList(v.Args[0].ID, prefs) + } + // Save desired registers for this value. + dinfo[i].out = prefs + for j, a := range v.Args { + if j >= len(dinfo[i].in) { + break + } + dinfo[i].in[j] = desired.get(a.ID) } } // Process all the non-phi values. - for _, v := range oldSched { + for idx, v := range oldSched { if s.f.pass.debug > regDebug { fmt.Printf(" processing %s\n", v.LongString()) } @@ -880,15 +958,132 @@ func (s *regAllocState) regalloc(f *Func) { continue } + if s.f.pass.debug > regDebug { + fmt.Printf("value %s\n", v.LongString()) + fmt.Printf(" out:") + for _, r := range dinfo[idx].out { + if r != noRegister { + fmt.Printf(" %s", s.registers[r].Name()) + } + } + fmt.Println() + for i := 0; i < len(v.Args) && i < 3; i++ { + fmt.Printf(" in%d:", i) + for _, r := range dinfo[idx].in[i] { + if r != noRegister { + fmt.Printf(" %s", s.registers[r].Name()) + } + } + fmt.Println() + } + } + // Move arguments to registers. Process in an ordering defined // by the register specification (most constrained first). args = append(args[:0], v.Args...) for _, i := range regspec.inputs { - if i.regs == flagRegMask { + mask := i.regs + if mask == flagRegMask { // TODO: remove flag input from regspec.inputs. continue } - args[i.idx] = s.allocValToReg(v.Args[i.idx], i.regs, true, v.Line) + if mask&s.values[args[i.idx].ID].regs == 0 { + // Need a new register for the input. + mask &= s.allocatable + mask &^= s.nospill + // Used desired register if available. + if i.idx < 3 { + for _, r := range dinfo[idx].in[i.idx] { + if r != noRegister && (mask&^s.used)>>r&1 != 0 { + // Desired register is allowed and unused. + mask = regMask(1) << r + break + } + } + } + // Avoid registers we're saving for other values. + if mask&^desired.avoid != 0 { + mask &^= desired.avoid + } + } + args[i.idx] = s.allocValToReg(args[i.idx], mask, true, v.Line) + } + + // If the output clobbers the input register, make sure we have + // at least two copies of the input register so we don't + // have to reload the value from the spill location. + if opcodeTable[v.Op].resultInArg0 { + var m regMask + if !s.liveAfterCurrentInstruction(v.Args[0]) { + // arg0 is dead. We can clobber its register. + goto ok + } + if countRegs(s.values[v.Args[0].ID].regs) >= 2 { + // we have at least 2 copies of arg0. We can afford to clobber one. + goto ok + } + if opcodeTable[v.Op].commutative { + if !s.liveAfterCurrentInstruction(v.Args[1]) { + args[0], args[1] = args[1], args[0] + goto ok + } + if countRegs(s.values[v.Args[1].ID].regs) >= 2 { + args[0], args[1] = args[1], args[0] + goto ok + } + } + + // We can't overwrite arg0 (or arg1, if commutative). So we + // need to make a copy of an input so we have a register we can modify. + + // Possible new registers to copy into. + m = s.compatRegs(v.Args[0].Type) &^ s.used + if m == 0 { + // No free registers. In this case we'll just clobber + // an input and future uses of that input must use a restore. + // TODO(khr): We should really do this like allocReg does it, + // spilling the value with the most distant next use. + goto ok + } + + // Try to move an input to the desired output. + for _, r := range dinfo[idx].out { + if r != noRegister && m>>r&1 != 0 { + m = regMask(1) << r + args[0] = s.allocValToReg(v.Args[0], m, true, v.Line) + // Note: we update args[0] so the instruction will + // use the register copy we just made. + goto ok + } + } + // Try to copy input to its desired location & use its old + // location as the result register. + for _, r := range dinfo[idx].in[0] { + if r != noRegister && m>>r&1 != 0 { + m = regMask(1) << r + s.allocValToReg(v.Args[0], m, true, v.Line) + // Note: no update to args[0] so the instruction will + // use the original copy. + goto ok + } + } + if opcodeTable[v.Op].commutative { + for _, r := range dinfo[idx].in[1] { + if r != noRegister && m>>r&1 != 0 { + m = regMask(1) << r + s.allocValToReg(v.Args[1], m, true, v.Line) + args[0], args[1] = args[1], args[0] + goto ok + } + } + } + // Avoid future fixed uses if we can. + if m&^desired.avoid != 0 { + m &^= desired.avoid + } + // Save input 0 to a new register so we can clobber it. + s.allocValToReg(v.Args[0], m, true, v.Line) + ok: } // Now that all args are in regs, we're ready to issue the value itself. @@ -903,24 +1098,44 @@ func (s *regAllocState) regalloc(f *Func) { // Pick register for output. if s.values[v.ID].needReg { - mask := regspec.outputs[0] &^ s.reserved() - if mask>>33&1 != 0 { - s.f.Fatalf("bad mask %s\n", v.LongString()) - } + mask := regspec.outputs[0] & s.allocatable if opcodeTable[v.Op].resultInArg0 { - r := register(s.f.getHome(args[0].ID).(*Register).Num) - if (mask&^s.used)>>r&1 != 0 { + if !opcodeTable[v.Op].commutative { + // Output must use the same register as input 0. + r := register(s.f.getHome(args[0].ID).(*Register).Num) mask = regMask(1) << r - } - if opcodeTable[v.Op].commutative { - r := register(s.f.getHome(args[1].ID).(*Register).Num) - if (mask&^s.used)>>r&1 != 0 { - mask = regMask(1) << r + } else { + // Output must use the same register as input 0 or 1. + r0 := register(s.f.getHome(args[0].ID).(*Register).Num) + r1 := register(s.f.getHome(args[1].ID).(*Register).Num) + // Check r0 and r1 for desired output register. + found := false + for _, r := range dinfo[idx].out { + if (r == r0 || r == r1) && (mask&^s.used)>>r&1 != 0 { + mask = regMask(1) << r + found = true + if r == r1 { + args[0], args[1] = args[1], args[0] + } + break + } + } + if !found { + // Neither are desired, pick r0. + mask = regMask(1) << r0 } } - // TODO: enforce resultInArg0 always, instead of treating it - // as a hint. Then we don't need the special cases adding - // moves all throughout ssa.go:genValue. + } + for _, r := range dinfo[idx].out { + if r != noRegister && (mask&^s.used)>>r&1 != 0 { + // Desired register is allowed and unused. + mask = regMask(1) << r + break + } + } + // Avoid registers we're saving for other values. + if mask&^desired.avoid != 0 { + mask &^= desired.avoid } r := s.allocReg(v, mask) s.assignReg(r, v, v) @@ -947,6 +1162,11 @@ func (s *regAllocState) regalloc(f *Func) { s.setOrig(spill, v) s.values[v.ID].spill = spill s.values[v.ID].spillUsed = false + if loop != nil { + loop.spills = append(loop.spills, v) + nSpillsInner++ + } + nSpills++ } } @@ -993,6 +1213,9 @@ func (s *regAllocState) regalloc(f *Func) { } v := s.orig[vid] m := s.compatRegs(v.Type) &^ s.used + if m&^desired.avoid != 0 { + m &^= desired.avoid + } if m != 0 { s.allocValToReg(v, m, false, b.Line) } @@ -1056,6 +1279,69 @@ func (s *regAllocState) regalloc(f *Func) { s.values[e.ID].spillUsed = true } + // Keep track of values that are spilled in the loop, but whose spill + // is not used in the loop. It may be possible to move ("sink") the + // spill out of the loop into one or more exit blocks. + if loop != nil { + loop.scratch++ // increment count of blocks in this loop that have been processed + if loop.scratch == loop.nBlocks { // just processed last block of loop, if it is an inner loop. + // This check is redundant with code at the top of the loop. + // This is definitive; the one at the top of the loop is an optimization. + if loop.isInner && // Common case, easier, most likely to be profitable + !loop.containsCall && // Calls force spills, also lead to puzzling spill info. + len(loop.exits) <= 32 { // Almost no inner loops have more than 32 exits, + // and this allows use of a bitvector and a sparseMap. + + // TODO: exit calculation is messed up for non-inner loops + // because of multilevel exits that are not part of the "exit" + // count. + + // Compute the set of spill-movement candidates live at entry to exit blocks. + // isLoopSpillCandidate filters for + // (1) defined in appropriate loop + // (2) needs a register + // (3) spill not already used (in the loop) + // Condition (3) === "in a register at all loop exits" + + entryCandidates.clear() + + for whichExit, ss := range loop.exits { + // Start with live at end. + for _, li := range s.live[ss.ID] { + if s.isLoopSpillCandidate(loop, s.orig[li.ID]) { + entryCandidates.setBit(li.ID, uint(whichExit)) + } + } + // Control can also be live. + if ss.Control != nil && s.isLoopSpillCandidate(loop, ss.Control) { + entryCandidates.setBit(ss.Control.ID, uint(whichExit)) + } + // Walk backwards, filling in locally live values, removing those defined. + for i := len(ss.Values) - 1; i >= 0; i-- { + v := ss.Values[i] + entryCandidates.remove(v.ID) // Cannot be an issue, only keeps the sets smaller. + for _, a := range v.Args { + if s.isLoopSpillCandidate(loop, a) { + entryCandidates.setBit(a.ID, uint(whichExit)) + } + } + } + } + + for _, e := range loop.spills { + whichblocks := entryCandidates.get(e.ID) + oldSpill := s.values[e.ID].spill + if whichblocks != 0 && whichblocks != -1 { // -1 = not in map. + toSink = append(toSink, spillToSink{spill: oldSpill, dests: whichblocks}) + } + } + + } // loop is inner etc + loop.scratch = 0 // Don't leave a mess, just in case. + loop.spills = nil + } // if scratch == nBlocks + } // if loop is not nil + // Clear any final uses. // All that is left should be the pseudo-uses added for values which // are live at the end of b. @@ -1078,7 +1364,7 @@ func (s *regAllocState) regalloc(f *Func) { vi := s.values[i] if vi.spillUsed { if s.f.pass.debug > logSpills { - s.f.Config.Warnl(vi.spill.Line, "spilled value") + s.f.Config.Warnl(vi.spill.Line, "spilled value at %v remains", vi.spill) } continue } @@ -1087,9 +1373,16 @@ func (s *regAllocState) regalloc(f *Func) { // Constants, SP, SB, ... continue } + loop := s.loopForBlock(spill.Block) + if loop != nil { + nSpillsInner-- + } + spill.Args[0].Uses-- f.freeValue(spill) + nSpills-- } + for _, b := range f.Blocks { i := 0 for _, v := range b.Values { @@ -1104,12 +1397,161 @@ func (s *regAllocState) regalloc(f *Func) { // Not important now because this is the last phase that manipulates Values } + // Must clear these out before any potential recycling, though that's + // not currently implemented. + for i, ts := range toSink { + vsp := ts.spill + if vsp.Op == OpInvalid { // This spill was completely eliminated + toSink[i].spill = nil + } + } + // Anything that didn't get a register gets a stack location here. // (StoreReg, stack-based phis, inputs, ...) stacklive := stackalloc(s.f, s.spillLive) // Fix up all merge edges. s.shuffle(stacklive) + + // Insert moved spills (that have not been marked invalid above) + // at start of appropriate block and remove the originals from their + // location within loops. Notice that this can break SSA form; + // if a spill is sunk to multiple exits, there will be no phi for that + // spill at a join point downstream of those two exits, though the + // two spills will target the same stack slot. Notice also that this + // takes place after stack allocation, so the stack allocator does + // not need to process these malformed flow graphs. +sinking: + for _, ts := range toSink { + vsp := ts.spill + if vsp == nil { // This spill was completely eliminated + nSpillsSunkUnused++ + continue sinking + } + e := ts.spilledValue() + if s.values[e.ID].spillUsedShuffle { + nSpillsNotSunkLateUse++ + continue sinking + } + + // move spills to a better (outside of loop) block. + // This would be costly if it occurred very often, but it doesn't. + b := vsp.Block + loop := s.loopnest.b2l[b.ID] + dests := ts.dests + + // Pre-check to be sure that spilled value is still in expected register on all exits where live. + check_val_still_in_reg: + for i := uint(0); i < 32 && dests != 0; i++ { + + if dests&(1<<i) == 0 { + continue + } + dests ^= 1 << i + d := loop.exits[i] + if len(d.Preds) > 1 { + panic("Should be impossible given critical edges removed") + } + p := d.Preds[0] // block in loop exiting to d. + + endregs := s.endRegs[p.ID] + for _, regrec := range endregs { + if regrec.v == e && regrec.r != noRegister && regrec.c == e { // TODO: regrec.c != e implies different spill possible. + continue check_val_still_in_reg + } + } + // If here, the register assignment was lost down at least one exit and it can't be sunk + if s.f.pass.debug > moveSpills { + s.f.Config.Warnl(e.Line, "lost register assignment for spill %v in %v at exit %v to %v", + vsp, b, p, d) + } + nSpillsChanged++ + continue sinking + } + + nSpillsSunk++ + nSpillsInner-- + // don't update nSpills, since spill is only moved, and if it is duplicated, the spills-on-a-path is not increased. + + dests = ts.dests + + // remove vsp from b.Values + i := 0 + for _, w := range b.Values { + if vsp == w { + continue + } + b.Values[i] = w + i++ + } + b.Values = b.Values[:i] + + first := true + for i := uint(0); i < 32 && dests != 0; i++ { + + if dests&(1<<i) == 0 { + continue + } + + dests ^= 1 << i + + d := loop.exits[i] + vspnew := vsp // reuse original for first sunk spill, saves tracking down and renaming uses + if !first { // any sunk spills after first must make a copy + vspnew = d.NewValue1(e.Line, OpStoreReg, e.Type, e) + f.setHome(vspnew, f.getHome(vsp.ID)) // copy stack home + if s.f.pass.debug > moveSpills { + s.f.Config.Warnl(e.Line, "copied spill %v in %v for %v to %v in %v", + vsp, b, e, vspnew, d) + } + } else { + first = false + vspnew.Block = d + d.Values = append(d.Values, vspnew) + if s.f.pass.debug > moveSpills { + s.f.Config.Warnl(e.Line, "moved spill %v in %v for %v to %v in %v", + vsp, b, e, vspnew, d) + } + } + + // shuffle vspnew to the beginning of its block + copy(d.Values[1:], d.Values[0:len(d.Values)-1]) + d.Values[0] = vspnew + + } + } + + if f.pass.stats > 0 { + f.logStat("spills_info", + nSpills, "spills", nSpillsInner, "inner_spills_remaining", nSpillsSunk, "inner_spills_sunk", nSpillsSunkUnused, "inner_spills_unused", nSpillsNotSunkLateUse, "inner_spills_shuffled", nSpillsChanged, "inner_spills_changed") + } +} + +// isLoopSpillCandidate indicates whether the spill for v satisfies preliminary +// spill-sinking conditions just after the last block of loop has been processed. +// In particular: +// v needs a register. +// v's spill is not (YET) used. +// v's definition is within loop. +// The spill may be used in the future, either by an outright use +// in the code, or by shuffling code inserted after stack allocation. +// Outright uses cause sinking; shuffling (within the loop) inhibits it. +func (s *regAllocState) isLoopSpillCandidate(loop *loop, v *Value) bool { + return s.values[v.ID].needReg && !s.values[v.ID].spillUsed && s.loopnest.b2l[v.Block.ID] == loop +} + +// lateSpillUse notes a late (after stack allocation) use of the spill of value with ID vid. +// This will inhibit spill sinking. +func (s *regAllocState) lateSpillUse(vid ID) { + // TODO investigate why this is necessary. + // It appears that an outside-the-loop use of + // an otherwise sinkable spill makes the spill + // a candidate for shuffling, when it would not + // otherwise have been the case (spillUsed was not + // true when isLoopSpillCandidate was called, yet + // it was shuffled). Such shuffling cuts the amount + // of spill sinking by more than half (in make.bash) + s.values[vid].spillUsedShuffle = true } // shuffle fixes up all the merge edges (those going into blocks of indegree > 1). @@ -1284,6 +1726,7 @@ func (e *edgeState) process() { if _, isReg := loc.(*Register); isReg { c = e.p.NewValue1(c.Line, OpCopy, c.Type, c) } else { + e.s.lateSpillUse(vid) c = e.p.NewValue1(c.Line, OpLoadReg, c.Type, c) } e.set(r, vid, c, false) @@ -1372,6 +1815,7 @@ func (e *edgeState) processDest(loc Location, vid ID, splice **Value) bool { } } else { if dstReg { + e.s.lateSpillUse(vid) x = e.p.NewValue1(c.Line, OpLoadReg, c.Type, c) } else { // mem->mem. Use temp register. @@ -1389,6 +1833,7 @@ func (e *edgeState) processDest(loc Location, vid ID, splice **Value) bool { e.erase(loc) r := e.findRegFor(c.Type) + e.s.lateSpillUse(vid) t := e.p.NewValue1(c.Line, OpLoadReg, c.Type, c) e.set(r, vid, t, false) x = e.p.NewValue1(c.Line, OpStoreReg, loc.(LocalSlot).Type, t) @@ -1554,24 +1999,36 @@ func (v *Value) rematerializeable() bool { } type liveInfo struct { - ID ID // ID of variable + ID ID // ID of value dist int32 // # of instructions before next use } +// dblock contains information about desired & avoid registers at the end of a block. +type dblock struct { + prefers []desiredStateEntry + avoid regMask +} + // computeLive computes a map from block ID to a list of value IDs live at the end // of that block. Together with the value ID is a count of how many instructions -// to the next use of that value. The resulting map is stored at s.live. +// to the next use of that value. The resulting map is stored in s.live. +// computeLive also computes the desired register information at the end of each block. +// This desired register information is stored in s.desired. // TODO: this could be quadratic if lots of variables are live across lots of // basic blocks. Figure out a way to make this function (or, more precisely, the user // of this function) require only linear size & time. func (s *regAllocState) computeLive() { f := s.f s.live = make([][]liveInfo, f.NumBlocks()) + s.desired = make([]desiredState, f.NumBlocks()) var phis []*Value live := newSparseMap(f.NumValues()) t := newSparseMap(f.NumValues()) + // Keep track of which value we want in each register. + var desired desiredState + // Instead of iterating over f.Blocks, iterate over their postordering. // Liveness information flows backward, so starting at the end // increases the probability that we will stabilize quickly. @@ -1594,7 +2051,7 @@ func (s *regAllocState) computeLive() { d := int32(len(b.Values)) if b.Kind == BlockCall || b.Kind == BlockDefer { // Because we keep no values in registers across a call, - // make every use past a call very far away. + // make every use past a call appear very far away. d += unlikelyDistance } for _, e := range s.live[b.ID] { @@ -1623,6 +2080,35 @@ func (s *regAllocState) computeLive() { } } } + // Propagate desired registers backwards. + desired.copy(&s.desired[b.ID]) + for i := len(b.Values) - 1; i >= 0; i-- { + v := b.Values[i] + prefs := desired.remove(v.ID) + if v.Op == OpPhi { + // TODO: if v is a phi, save desired register for phi inputs. + // For now, we just drop it and don't propagate + // desired registers back though phi nodes. + continue + } + // Cancel desired registers if they get clobbered. + desired.clobber(opcodeTable[v.Op].reg.clobbers) + // Update desired registers if there are any fixed register inputs. + for _, j := range opcodeTable[v.Op].reg.inputs { + if countRegs(j.regs) != 1 { + continue + } + desired.clobber(j.regs) + desired.add(v.Args[j.idx].ID, pickReg(j.regs)) + } + // Set desired register of input 0 if this is a 2-operand instruction. + if opcodeTable[v.Op].resultInArg0 { + if opcodeTable[v.Op].commutative { + desired.addList(v.Args[1].ID, prefs) + } + desired.addList(v.Args[0].ID, prefs) + } + } // For each predecessor of b, expand its list of live-at-end values. // invariant: live contains the values live at the start of b (excluding phi inputs) @@ -1642,6 +2128,9 @@ func (s *regAllocState) computeLive() { } } + // Update any desired registers at the end of p. + s.desired[p.ID].merge(&desired) + // Start t off with the previously known live values at the end of p. t.clear() for _, e := range s.live[p.ID] { @@ -1662,7 +2151,7 @@ func (s *regAllocState) computeLive() { // simultaneously happening at the start of the block). for _, v := range phis { id := v.Args[i].ID - if s.values[id].needReg && !t.contains(id) || delta < t.get(id) { + if s.values[id].needReg && (!t.contains(id) || delta < t.get(id)) { update = true t.set(id, delta) } @@ -1694,20 +2183,152 @@ func (s *regAllocState) computeLive() { fmt.Printf(" %s:", b) for _, x := range s.live[b.ID] { fmt.Printf(" v%d", x.ID) + for _, e := range s.desired[b.ID].entries { + if e.ID != x.ID { + continue + } + fmt.Printf("[") + first := true + for _, r := range e.regs { + if r == noRegister { + continue + } + if !first { + fmt.Printf(",") + } + fmt.Print(s.registers[r].Name()) + first = false + } + fmt.Printf("]") + } } + fmt.Printf(" avoid=%x", int64(s.desired[b.ID].avoid)) fmt.Println() } } } -// reserved returns a mask of reserved registers. -func (s *regAllocState) reserved() regMask { - var m regMask - if obj.Framepointer_enabled != 0 { - m |= 1 << 5 // BP +// A desiredState represents desired register assignments. +type desiredState struct { + // Desired assignments will be small, so we just use a list + // of valueID+registers entries. + entries []desiredStateEntry + // Registers that other values want to be in. This value will + // contain at least the union of the regs fields of entries, but + // may contain additional entries for values that were once in + // this data structure but are no longer. + avoid regMask +} +type desiredStateEntry struct { + // (pre-regalloc) value + ID ID + // Registers it would like to be in, in priority order. + // Unused slots are filled with noRegister. + regs [4]register +} + +func (d *desiredState) clear() { + d.entries = d.entries[:0] + d.avoid = 0 +} + +// get returns a list of desired registers for value vid. +func (d *desiredState) get(vid ID) [4]register { + for _, e := range d.entries { + if e.ID == vid { + return e.regs + } } - if s.f.Config.ctxt.Flag_dynlink { - m |= 1 << 15 // R15 + return [4]register{noRegister, noRegister, noRegister, noRegister} +} + +// add records that we'd like value vid to be in register r. +func (d *desiredState) add(vid ID, r register) { + d.avoid |= regMask(1) << r + for i := range d.entries { + e := &d.entries[i] + if e.ID != vid { + continue + } + if e.regs[0] == r { + // Already known and highest priority + return + } + for j := 1; j < len(e.regs); j++ { + if e.regs[j] == r { + // Move from lower priority to top priority + copy(e.regs[1:], e.regs[:j]) + e.regs[0] = r + return + } + } + copy(e.regs[1:], e.regs[:]) + e.regs[0] = r + return + } + d.entries = append(d.entries, desiredStateEntry{vid, [4]register{r, noRegister, noRegister, noRegister}}) +} + +func (d *desiredState) addList(vid ID, regs [4]register) { + // regs is in priority order, so iterate in reverse order. + for i := len(regs) - 1; i >= 0; i-- { + r := regs[i] + if r != noRegister { + d.add(vid, r) + } + } +} + +// clobber erases any desired registers in the set m. +func (d *desiredState) clobber(m regMask) { + for i := 0; i < len(d.entries); { + e := &d.entries[i] + j := 0 + for _, r := range e.regs { + if r != noRegister && m>>r&1 == 0 { + e.regs[j] = r + j++ + } + } + if j == 0 { + // No more desired registers for this value. + d.entries[i] = d.entries[len(d.entries)-1] + d.entries = d.entries[:len(d.entries)-1] + continue + } + for ; j < len(e.regs); j++ { + e.regs[j] = noRegister + } + i++ + } + d.avoid &^= m +} + +// copy copies a desired state from another desiredState x. +func (d *desiredState) copy(x *desiredState) { + d.entries = append(d.entries[:0], x.entries...) + d.avoid = x.avoid +} + +// remove removes the desired registers for vid and returns them. +func (d *desiredState) remove(vid ID) [4]register { + for i := range d.entries { + if d.entries[i].ID == vid { + regs := d.entries[i].regs + d.entries[i] = d.entries[len(d.entries)-1] + d.entries = d.entries[:len(d.entries)-1] + return regs + } + } + return [4]register{noRegister, noRegister, noRegister, noRegister} +} + +// merge merges another desired state x into d. +func (d *desiredState) merge(x *desiredState) { + d.avoid |= x.avoid + // There should only be a few desired registers, so + // linear insert is ok. + for _, e := range x.entries { + d.addList(e.ID, e.regs) } - return m } diff --git a/src/cmd/compile/internal/ssa/regalloc_test.go b/src/cmd/compile/internal/ssa/regalloc_test.go index 6f3f690f1e..cf8f452d12 100644 --- a/src/cmd/compile/internal/ssa/regalloc_test.go +++ b/src/cmd/compile/internal/ssa/regalloc_test.go @@ -11,8 +11,8 @@ func TestLiveControlOps(t *testing.T) { f := Fun(c, "entry", Bloc("entry", Valu("mem", OpInitMem, TypeMem, 0, nil), - Valu("x", OpAMD64MOVBconst, TypeInt8, 1, nil), - Valu("y", OpAMD64MOVBconst, TypeInt8, 2, nil), + Valu("x", OpAMD64MOVLconst, TypeInt8, 1, nil), + Valu("y", OpAMD64MOVLconst, TypeInt8, 2, nil), Valu("a", OpAMD64TESTB, TypeFlags, 0, nil, "x", "y"), Valu("b", OpAMD64TESTB, TypeFlags, 0, nil, "y", "x"), Eq("a", "if", "exit"), diff --git a/src/cmd/compile/internal/ssa/rewrite.go b/src/cmd/compile/internal/ssa/rewrite.go index e0cb7f517b..e9b408a86c 100644 --- a/src/cmd/compile/internal/ssa/rewrite.go +++ b/src/cmd/compile/internal/ssa/rewrite.go @@ -40,9 +40,44 @@ func applyRewrite(f *Func, rb func(*Block) bool, rv func(*Value, *Config) bool) } curb = nil for _, v := range b.Values { - change = copyelimValue(v) || change change = phielimValue(v) || change + // Eliminate copy inputs. + // If any copy input becomes unused, mark it + // as invalid and discard its argument. Repeat + // recursively on the discarded argument. + // This phase helps remove phantom "dead copy" uses + // of a value so that a x.Uses==1 rule condition + // fires reliably. + for i, a := range v.Args { + if a.Op != OpCopy { + continue + } + x := a.Args[0] + // Rewriting can generate OpCopy loops. + // They are harmless (see removePredecessor), + // but take care to stop if we find a cycle. + slow := x // advances every other iteration + var advance bool + for x.Op == OpCopy { + x = x.Args[0] + if slow == x { + break + } + if advance { + slow = slow.Args[0] + } + advance = !advance + } + v.SetArg(i, x) + change = true + for a.Uses == 0 { + b := a.Args[0] + a.reset(OpInvalid) + a = b + } + } + // apply rewrite function curv = v if rv(v, config) { @@ -52,7 +87,28 @@ func applyRewrite(f *Func, rb func(*Block) bool, rv func(*Value, *Config) bool) } } if !change { - return + break + } + } + // remove clobbered values + for _, b := range f.Blocks { + j := 0 + for i, v := range b.Values { + if v.Op == OpInvalid { + f.freeValue(v) + continue + } + if i != j { + b.Values[j] = v + } + j++ + } + if j != len(b.Values) { + tail := b.Values[j:] + for j := range tail { + tail[j] = nil + } + b.Values = b.Values[:j] } } } @@ -311,3 +367,13 @@ found: } return nil // too far away } + +// clobber invalidates v. Returns true. +// clobber is used by rewrite rules to: +// A) make sure v is really dead and never used again. +// B) decrement use counts of v's args. +func clobber(v *Value) bool { + v.reset(OpInvalid) + // Note: leave v.Block intact. The Block field is used after clobber. + return true +} diff --git a/src/cmd/compile/internal/ssa/rewriteAMD64.go b/src/cmd/compile/internal/ssa/rewriteAMD64.go index 11c2de391c..c26aeb0bd0 100644 --- a/src/cmd/compile/internal/ssa/rewriteAMD64.go +++ b/src/cmd/compile/internal/ssa/rewriteAMD64.go @@ -8,10 +8,6 @@ import "math" var _ = math.MinInt8 // in case not otherwise used func rewriteValueAMD64(v *Value, config *Config) bool { switch v.Op { - case OpAMD64ADDB: - return rewriteValueAMD64_OpAMD64ADDB(v, config) - case OpAMD64ADDBconst: - return rewriteValueAMD64_OpAMD64ADDBconst(v, config) case OpAMD64ADDL: return rewriteValueAMD64_OpAMD64ADDL(v, config) case OpAMD64ADDLconst: @@ -20,14 +16,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64ADDQ(v, config) case OpAMD64ADDQconst: return rewriteValueAMD64_OpAMD64ADDQconst(v, config) - case OpAMD64ADDW: - return rewriteValueAMD64_OpAMD64ADDW(v, config) - case OpAMD64ADDWconst: - return rewriteValueAMD64_OpAMD64ADDWconst(v, config) - case OpAMD64ANDB: - return rewriteValueAMD64_OpAMD64ANDB(v, config) - case OpAMD64ANDBconst: - return rewriteValueAMD64_OpAMD64ANDBconst(v, config) case OpAMD64ANDL: return rewriteValueAMD64_OpAMD64ANDL(v, config) case OpAMD64ANDLconst: @@ -36,10 +24,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64ANDQ(v, config) case OpAMD64ANDQconst: return rewriteValueAMD64_OpAMD64ANDQconst(v, config) - case OpAMD64ANDW: - return rewriteValueAMD64_OpAMD64ANDW(v, config) - case OpAMD64ANDWconst: - return rewriteValueAMD64_OpAMD64ANDWconst(v, config) case OpAdd16: return rewriteValueAMD64_OpAdd16(v, config) case OpAdd32: @@ -64,6 +48,8 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAnd64(v, config) case OpAnd8: return rewriteValueAMD64_OpAnd8(v, config) + case OpAndB: + return rewriteValueAMD64_OpAndB(v, config) case OpAvg64u: return rewriteValueAMD64_OpAvg64u(v, config) case OpBswap32: @@ -180,6 +166,8 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpEq64F(v, config) case OpEq8: return rewriteValueAMD64_OpEq8(v, config) + case OpEqB: + return rewriteValueAMD64_OpEqB(v, config) case OpEqPtr: return rewriteValueAMD64_OpEqPtr(v, config) case OpGeq16: @@ -458,10 +446,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64MOVWstoreidx1(v, config) case OpAMD64MOVWstoreidx2: return rewriteValueAMD64_OpAMD64MOVWstoreidx2(v, config) - case OpAMD64MULB: - return rewriteValueAMD64_OpAMD64MULB(v, config) - case OpAMD64MULBconst: - return rewriteValueAMD64_OpAMD64MULBconst(v, config) case OpAMD64MULL: return rewriteValueAMD64_OpAMD64MULL(v, config) case OpAMD64MULLconst: @@ -470,10 +454,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64MULQ(v, config) case OpAMD64MULQconst: return rewriteValueAMD64_OpAMD64MULQconst(v, config) - case OpAMD64MULW: - return rewriteValueAMD64_OpAMD64MULW(v, config) - case OpAMD64MULWconst: - return rewriteValueAMD64_OpAMD64MULWconst(v, config) case OpMod16: return rewriteValueAMD64_OpMod16(v, config) case OpMod16u: @@ -504,22 +484,14 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpMul64F(v, config) case OpMul8: return rewriteValueAMD64_OpMul8(v, config) - case OpAMD64NEGB: - return rewriteValueAMD64_OpAMD64NEGB(v, config) case OpAMD64NEGL: return rewriteValueAMD64_OpAMD64NEGL(v, config) case OpAMD64NEGQ: return rewriteValueAMD64_OpAMD64NEGQ(v, config) - case OpAMD64NEGW: - return rewriteValueAMD64_OpAMD64NEGW(v, config) - case OpAMD64NOTB: - return rewriteValueAMD64_OpAMD64NOTB(v, config) case OpAMD64NOTL: return rewriteValueAMD64_OpAMD64NOTL(v, config) case OpAMD64NOTQ: return rewriteValueAMD64_OpAMD64NOTQ(v, config) - case OpAMD64NOTW: - return rewriteValueAMD64_OpAMD64NOTW(v, config) case OpNeg16: return rewriteValueAMD64_OpNeg16(v, config) case OpNeg32: @@ -544,16 +516,14 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpNeq64F(v, config) case OpNeq8: return rewriteValueAMD64_OpNeq8(v, config) + case OpNeqB: + return rewriteValueAMD64_OpNeqB(v, config) case OpNeqPtr: return rewriteValueAMD64_OpNeqPtr(v, config) case OpNilCheck: return rewriteValueAMD64_OpNilCheck(v, config) case OpNot: return rewriteValueAMD64_OpNot(v, config) - case OpAMD64ORB: - return rewriteValueAMD64_OpAMD64ORB(v, config) - case OpAMD64ORBconst: - return rewriteValueAMD64_OpAMD64ORBconst(v, config) case OpAMD64ORL: return rewriteValueAMD64_OpAMD64ORL(v, config) case OpAMD64ORLconst: @@ -562,10 +532,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64ORQ(v, config) case OpAMD64ORQconst: return rewriteValueAMD64_OpAMD64ORQconst(v, config) - case OpAMD64ORW: - return rewriteValueAMD64_OpAMD64ORW(v, config) - case OpAMD64ORWconst: - return rewriteValueAMD64_OpAMD64ORWconst(v, config) case OpOffPtr: return rewriteValueAMD64_OpOffPtr(v, config) case OpOr16: @@ -576,6 +542,8 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpOr64(v, config) case OpOr8: return rewriteValueAMD64_OpOr8(v, config) + case OpOrB: + return rewriteValueAMD64_OpOrB(v, config) case OpRsh16Ux16: return rewriteValueAMD64_OpRsh16Ux16(v, config) case OpRsh16Ux32: @@ -680,14 +648,10 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64SETLE(v, config) case OpAMD64SETNE: return rewriteValueAMD64_OpAMD64SETNE(v, config) - case OpAMD64SHLB: - return rewriteValueAMD64_OpAMD64SHLB(v, config) case OpAMD64SHLL: return rewriteValueAMD64_OpAMD64SHLL(v, config) case OpAMD64SHLQ: return rewriteValueAMD64_OpAMD64SHLQ(v, config) - case OpAMD64SHLW: - return rewriteValueAMD64_OpAMD64SHLW(v, config) case OpAMD64SHRB: return rewriteValueAMD64_OpAMD64SHRB(v, config) case OpAMD64SHRL: @@ -696,10 +660,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64SHRQ(v, config) case OpAMD64SHRW: return rewriteValueAMD64_OpAMD64SHRW(v, config) - case OpAMD64SUBB: - return rewriteValueAMD64_OpAMD64SUBB(v, config) - case OpAMD64SUBBconst: - return rewriteValueAMD64_OpAMD64SUBBconst(v, config) case OpAMD64SUBL: return rewriteValueAMD64_OpAMD64SUBL(v, config) case OpAMD64SUBLconst: @@ -708,10 +668,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64SUBQ(v, config) case OpAMD64SUBQconst: return rewriteValueAMD64_OpAMD64SUBQconst(v, config) - case OpAMD64SUBW: - return rewriteValueAMD64_OpAMD64SUBW(v, config) - case OpAMD64SUBWconst: - return rewriteValueAMD64_OpAMD64SUBWconst(v, config) case OpSignExt16to32: return rewriteValueAMD64_OpSignExt16to32(v, config) case OpSignExt16to64: @@ -756,10 +712,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpTrunc64to32(v, config) case OpTrunc64to8: return rewriteValueAMD64_OpTrunc64to8(v, config) - case OpAMD64XORB: - return rewriteValueAMD64_OpAMD64XORB(v, config) - case OpAMD64XORBconst: - return rewriteValueAMD64_OpAMD64XORBconst(v, config) case OpAMD64XORL: return rewriteValueAMD64_OpAMD64XORL(v, config) case OpAMD64XORLconst: @@ -768,10 +720,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { return rewriteValueAMD64_OpAMD64XORQ(v, config) case OpAMD64XORQconst: return rewriteValueAMD64_OpAMD64XORQconst(v, config) - case OpAMD64XORW: - return rewriteValueAMD64_OpAMD64XORW(v, config) - case OpAMD64XORWconst: - return rewriteValueAMD64_OpAMD64XORWconst(v, config) case OpXor16: return rewriteValueAMD64_OpXor16(v, config) case OpXor32: @@ -797,105 +745,6 @@ func rewriteValueAMD64(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64ADDB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ADDB x (MOVBconst [c])) - // cond: - // result: (ADDBconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ADDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ADDB (MOVBconst [c]) x) - // cond: - // result: (ADDBconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ADDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ADDB x (NEGB y)) - // cond: - // result: (SUBB x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64NEGB { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SUBB) - v.AddArg(x) - v.AddArg(y) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ADDBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ADDBconst [c] x) - // cond: int8(c)==0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int8(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ADDBconst [c] (MOVBconst [d])) - // cond: - // result: (MOVBconst [int64(int8(c+d))]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = int64(int8(c + d)) - return true - } - // match: (ADDBconst [c] (ADDBconst [d] x)) - // cond: - // result: (ADDBconst [int64(int8(c+d))] x) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64ADDBconst { - break - } - d := v_0.AuxInt - x := v_0.Args[0] - v.reset(OpAMD64ADDBconst) - v.AuxInt = int64(int8(c + d)) - v.AddArg(x) - return true - } - return false -} func rewriteValueAMD64_OpAMD64ADDL(v *Value, config *Config) bool { b := v.Block _ = b @@ -1418,244 +1267,6 @@ func rewriteValueAMD64_OpAMD64ADDQconst(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64ADDW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ADDW x (MOVWconst [c])) - // cond: - // result: (ADDWconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ADDWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ADDW (MOVWconst [c]) x) - // cond: - // result: (ADDWconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ADDWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ADDW x (NEGW y)) - // cond: - // result: (SUBW x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64NEGW { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SUBW) - v.AddArg(x) - v.AddArg(y) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ADDWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ADDWconst [c] x) - // cond: int16(c)==0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int16(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ADDWconst [c] (MOVWconst [d])) - // cond: - // result: (MOVWconst [int64(int16(c+d))]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = int64(int16(c + d)) - return true - } - // match: (ADDWconst [c] (ADDWconst [d] x)) - // cond: - // result: (ADDWconst [int64(int16(c+d))] x) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64ADDWconst { - break - } - d := v_0.AuxInt - x := v_0.Args[0] - v.reset(OpAMD64ADDWconst) - v.AuxInt = int64(int16(c + d)) - v.AddArg(x) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ANDB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ANDB x (MOVLconst [c])) - // cond: - // result: (ANDBconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVLconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ANDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ANDB (MOVLconst [c]) x) - // cond: - // result: (ANDBconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVLconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ANDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ANDB x (MOVBconst [c])) - // cond: - // result: (ANDBconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ANDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ANDB (MOVBconst [c]) x) - // cond: - // result: (ANDBconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ANDBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ANDB x x) - // cond: - // result: x - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ANDBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ANDBconst [c] (ANDBconst [d] x)) - // cond: - // result: (ANDBconst [c & d] x) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDBconst { - break - } - d := v_0.AuxInt - x := v_0.Args[0] - v.reset(OpAMD64ANDBconst) - v.AuxInt = c & d - v.AddArg(x) - return true - } - // match: (ANDBconst [c] _) - // cond: int8(c)==0 - // result: (MOVBconst [0]) - for { - c := v.AuxInt - if !(int8(c) == 0) { - break - } - v.reset(OpAMD64MOVBconst) - v.AuxInt = 0 - return true - } - // match: (ANDBconst [c] x) - // cond: int8(c)==-1 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int8(c) == -1) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ANDBconst [c] (MOVBconst [d])) - // cond: - // result: (MOVBconst [c&d]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = c & d - return true - } - return false -} func rewriteValueAMD64_OpAMD64ANDL(v *Value, config *Config) bool { b := v.Block _ = b @@ -1838,180 +1449,77 @@ func rewriteValueAMD64_OpAMD64ANDQconst(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (ANDQconst [0] _) - // cond: - // result: (MOVQconst [0]) - for { - if v.AuxInt != 0 { - break - } - v.reset(OpAMD64MOVQconst) - v.AuxInt = 0 - return true - } - // match: (ANDQconst [-1] x) + // match: (ANDQconst [0xFF] x) // cond: - // result: x + // result: (MOVBQZX x) for { - if v.AuxInt != -1 { + if v.AuxInt != 0xFF { break } x := v.Args[0] - v.reset(OpCopy) - v.Type = x.Type + v.reset(OpAMD64MOVBQZX) v.AddArg(x) return true } - // match: (ANDQconst [c] (MOVQconst [d])) + // match: (ANDQconst [0xFFFF] x) // cond: - // result: (MOVQconst [c&d]) + // result: (MOVWQZX x) for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVQconst { + if v.AuxInt != 0xFFFF { break } - d := v_0.AuxInt - v.reset(OpAMD64MOVQconst) - v.AuxInt = c & d - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ANDW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ANDW x (MOVLconst [c])) - // cond: - // result: (ANDWconst [c] x) - for { x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVLconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ANDWconst) - v.AuxInt = c + v.reset(OpAMD64MOVWQZX) v.AddArg(x) return true } - // match: (ANDW (MOVLconst [c]) x) + // match: (ANDQconst [0xFFFFFFFF] x) // cond: - // result: (ANDWconst [c] x) + // result: (MOVLQZX x) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVLconst { + if v.AuxInt != 0xFFFFFFFF { break } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ANDWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ANDW x (MOVWconst [c])) - // cond: - // result: (ANDWconst [c] x) - for { x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ANDWconst) - v.AuxInt = c + v.reset(OpAMD64MOVLQZX) v.AddArg(x) return true } - // match: (ANDW (MOVWconst [c]) x) + // match: (ANDQconst [0] _) // cond: - // result: (ANDWconst [c] x) + // result: (MOVQconst [0]) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v.AuxInt != 0 { break } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ANDWconst) - v.AuxInt = c - v.AddArg(x) + v.reset(OpAMD64MOVQconst) + v.AuxInt = 0 return true } - // match: (ANDW x x) + // match: (ANDQconst [-1] x) // cond: // result: x for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ANDWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ANDWconst [c] (ANDWconst [d] x)) - // cond: - // result: (ANDWconst [c & d] x) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDWconst { - break - } - d := v_0.AuxInt - x := v_0.Args[0] - v.reset(OpAMD64ANDWconst) - v.AuxInt = c & d - v.AddArg(x) - return true - } - // match: (ANDWconst [c] _) - // cond: int16(c)==0 - // result: (MOVWconst [0]) - for { - c := v.AuxInt - if !(int16(c) == 0) { + if v.AuxInt != -1 { break } - v.reset(OpAMD64MOVWconst) - v.AuxInt = 0 - return true - } - // match: (ANDWconst [c] x) - // cond: int16(c)==-1 - // result: x - for { - c := v.AuxInt x := v.Args[0] - if !(int16(c) == -1) { - break - } v.reset(OpCopy) v.Type = x.Type v.AddArg(x) return true } - // match: (ANDWconst [c] (MOVWconst [d])) + // match: (ANDQconst [c] (MOVQconst [d])) // cond: - // result: (MOVWconst [c&d]) + // result: (MOVQconst [c&d]) for { c := v.AuxInt v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVQconst { break } d := v_0.AuxInt - v.reset(OpAMD64MOVWconst) + v.reset(OpAMD64MOVQconst) v.AuxInt = c & d return true } @@ -2022,11 +1530,11 @@ func rewriteValueAMD64_OpAdd16(v *Value, config *Config) bool { _ = b // match: (Add16 x y) // cond: - // result: (ADDW x y) + // result: (ADDL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ADDW) + v.reset(OpAMD64ADDL) v.AddArg(x) v.AddArg(y) return true @@ -2102,11 +1610,11 @@ func rewriteValueAMD64_OpAdd8(v *Value, config *Config) bool { _ = b // match: (Add8 x y) // cond: - // result: (ADDB x y) + // result: (ADDL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ADDB) + v.reset(OpAMD64ADDL) v.AddArg(x) v.AddArg(y) return true @@ -2150,11 +1658,11 @@ func rewriteValueAMD64_OpAnd16(v *Value, config *Config) bool { _ = b // match: (And16 x y) // cond: - // result: (ANDW x y) + // result: (ANDL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) + v.reset(OpAMD64ANDL) v.AddArg(x) v.AddArg(y) return true @@ -2198,11 +1706,27 @@ func rewriteValueAMD64_OpAnd8(v *Value, config *Config) bool { _ = b // match: (And8 x y) // cond: - // result: (ANDB x y) + // result: (ANDL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) + v.reset(OpAMD64ANDL) + v.AddArg(x) + v.AddArg(y) + return true + } + return false +} +func rewriteValueAMD64_OpAndB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (AndB x y) + // cond: + // result: (ANDL x y) + for { + x := v.Args[0] + y := v.Args[1] + v.reset(OpAMD64ANDL) v.AddArg(x) v.AddArg(y) return true @@ -2529,27 +2053,27 @@ func rewriteValueAMD64_OpAMD64CMOVWEQconst(v *Value, config *Config) bool { func rewriteValueAMD64_OpAMD64CMPB(v *Value, config *Config) bool { b := v.Block _ = b - // match: (CMPB x (MOVBconst [c])) + // match: (CMPB x (MOVLconst [c])) // cond: - // result: (CMPBconst x [c]) + // result: (CMPBconst x [int64(int8(c))]) for { x := v.Args[0] v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { + if v_1.Op != OpAMD64MOVLconst { break } c := v_1.AuxInt v.reset(OpAMD64CMPBconst) v.AddArg(x) - v.AuxInt = c + v.AuxInt = int64(int8(c)) return true } - // match: (CMPB (MOVBconst [c]) x) + // match: (CMPB (MOVLconst [c]) x) // cond: - // result: (InvertFlags (CMPBconst x [c])) + // result: (InvertFlags (CMPBconst x [int64(int8(c))])) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } c := v_0.AuxInt @@ -2557,7 +2081,7 @@ func rewriteValueAMD64_OpAMD64CMPB(v *Value, config *Config) bool { v.reset(OpAMD64InvertFlags) v0 := b.NewValue0(v.Line, OpAMD64CMPBconst, TypeFlags) v0.AddArg(x) - v0.AuxInt = c + v0.AuxInt = int64(int8(c)) v.AddArg(v0) return true } @@ -2566,12 +2090,12 @@ func rewriteValueAMD64_OpAMD64CMPB(v *Value, config *Config) bool { func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { b := v.Block _ = b - // match: (CMPBconst (MOVBconst [x]) [y]) + // match: (CMPBconst (MOVLconst [x]) [y]) // cond: int8(x)==int8(y) // result: (FlagEQ) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -2582,12 +2106,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagEQ) return true } - // match: (CMPBconst (MOVBconst [x]) [y]) + // match: (CMPBconst (MOVLconst [x]) [y]) // cond: int8(x)<int8(y) && uint8(x)<uint8(y) // result: (FlagLT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -2598,12 +2122,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_ULT) return true } - // match: (CMPBconst (MOVBconst [x]) [y]) + // match: (CMPBconst (MOVLconst [x]) [y]) // cond: int8(x)<int8(y) && uint8(x)>uint8(y) // result: (FlagLT_UGT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -2614,12 +2138,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_UGT) return true } - // match: (CMPBconst (MOVBconst [x]) [y]) + // match: (CMPBconst (MOVLconst [x]) [y]) // cond: int8(x)>int8(y) && uint8(x)<uint8(y) // result: (FlagGT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -2630,12 +2154,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_ULT) return true } - // match: (CMPBconst (MOVBconst [x]) [y]) + // match: (CMPBconst (MOVLconst [x]) [y]) // cond: int8(x)>int8(y) && uint8(x)>uint8(y) // result: (FlagGT_UGT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -2646,12 +2170,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_UGT) return true } - // match: (CMPBconst (ANDBconst _ [m]) [n]) + // match: (CMPBconst (ANDLconst _ [m]) [n]) // cond: 0 <= int8(m) && int8(m) < int8(n) // result: (FlagLT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDBconst { + if v_0.Op != OpAMD64ANDLconst { break } m := v_0.AuxInt @@ -2662,12 +2186,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_ULT) return true } - // match: (CMPBconst (ANDB x y) [0]) + // match: (CMPBconst (ANDL x y) [0]) // cond: // result: (TESTB x y) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDB { + if v_0.Op != OpAMD64ANDL { break } x := v_0.Args[0] @@ -2680,12 +2204,12 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { v.AddArg(y) return true } - // match: (CMPBconst (ANDBconst [c] x) [0]) + // match: (CMPBconst (ANDLconst [c] x) [0]) // cond: - // result: (TESTBconst [c] x) + // result: (TESTBconst [int64(int8(c))] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDBconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt @@ -2694,7 +2218,7 @@ func rewriteValueAMD64_OpAMD64CMPBconst(v *Value, config *Config) bool { break } v.reset(OpAMD64TESTBconst) - v.AuxInt = c + v.AuxInt = int64(int8(c)) v.AddArg(x) return true } @@ -2833,6 +2357,22 @@ func rewriteValueAMD64_OpAMD64CMPLconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_UGT) return true } + // match: (CMPLconst (SHRLconst _ [c]) [n]) + // cond: 0 <= n && 0 < c && c <= 32 && (1<<uint64(32-c)) <= uint64(n) + // result: (FlagLT_ULT) + for { + v_0 := v.Args[0] + if v_0.Op != OpAMD64SHRLconst { + break + } + c := v_0.AuxInt + n := v.AuxInt + if !(0 <= n && 0 < c && c <= 32 && (1<<uint64(32-c)) <= uint64(n)) { + break + } + v.reset(OpAMD64FlagLT_ULT) + return true + } // match: (CMPLconst (ANDLconst _ [m]) [n]) // cond: 0 <= int32(m) && int32(m) < int32(n) // result: (FlagLT_ULT) @@ -3026,6 +2566,67 @@ func rewriteValueAMD64_OpAMD64CMPQconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_UGT) return true } + // match: (CMPQconst (MOVBQZX _) [c]) + // cond: 0xFF < c + // result: (FlagLT_ULT) + for { + v_0 := v.Args[0] + if v_0.Op != OpAMD64MOVBQZX { + break + } + c := v.AuxInt + if !(0xFF < c) { + break + } + v.reset(OpAMD64FlagLT_ULT) + return true + } + // match: (CMPQconst (MOVWQZX _) [c]) + // cond: 0xFFFF < c + // result: (FlagLT_ULT) + for { + v_0 := v.Args[0] + if v_0.Op != OpAMD64MOVWQZX { + break + } + c := v.AuxInt + if !(0xFFFF < c) { + break + } + v.reset(OpAMD64FlagLT_ULT) + return true + } + // match: (CMPQconst (MOVLQZX _) [c]) + // cond: 0xFFFFFFFF < c + // result: (FlagLT_ULT) + for { + v_0 := v.Args[0] + if v_0.Op != OpAMD64MOVLQZX { + break + } + c := v.AuxInt + if !(0xFFFFFFFF < c) { + break + } + v.reset(OpAMD64FlagLT_ULT) + return true + } + // match: (CMPQconst (SHRQconst _ [c]) [n]) + // cond: 0 <= n && 0 < c && c <= 64 && (1<<uint64(64-c)) <= uint64(n) + // result: (FlagLT_ULT) + for { + v_0 := v.Args[0] + if v_0.Op != OpAMD64SHRQconst { + break + } + c := v_0.AuxInt + n := v.AuxInt + if !(0 <= n && 0 < c && c <= 64 && (1<<uint64(64-c)) <= uint64(n)) { + break + } + v.reset(OpAMD64FlagLT_ULT) + return true + } // match: (CMPQconst (ANDQconst _ [m]) [n]) // cond: 0 <= m && m < n // result: (FlagLT_ULT) @@ -3096,27 +2697,27 @@ func rewriteValueAMD64_OpAMD64CMPQconst(v *Value, config *Config) bool { func rewriteValueAMD64_OpAMD64CMPW(v *Value, config *Config) bool { b := v.Block _ = b - // match: (CMPW x (MOVWconst [c])) + // match: (CMPW x (MOVLconst [c])) // cond: - // result: (CMPWconst x [c]) + // result: (CMPWconst x [int64(int16(c))]) for { x := v.Args[0] v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { + if v_1.Op != OpAMD64MOVLconst { break } c := v_1.AuxInt v.reset(OpAMD64CMPWconst) v.AddArg(x) - v.AuxInt = c + v.AuxInt = int64(int16(c)) return true } - // match: (CMPW (MOVWconst [c]) x) + // match: (CMPW (MOVLconst [c]) x) // cond: - // result: (InvertFlags (CMPWconst x [c])) + // result: (InvertFlags (CMPWconst x [int64(int16(c))])) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } c := v_0.AuxInt @@ -3124,7 +2725,7 @@ func rewriteValueAMD64_OpAMD64CMPW(v *Value, config *Config) bool { v.reset(OpAMD64InvertFlags) v0 := b.NewValue0(v.Line, OpAMD64CMPWconst, TypeFlags) v0.AddArg(x) - v0.AuxInt = c + v0.AuxInt = int64(int16(c)) v.AddArg(v0) return true } @@ -3133,12 +2734,12 @@ func rewriteValueAMD64_OpAMD64CMPW(v *Value, config *Config) bool { func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { b := v.Block _ = b - // match: (CMPWconst (MOVWconst [x]) [y]) + // match: (CMPWconst (MOVLconst [x]) [y]) // cond: int16(x)==int16(y) // result: (FlagEQ) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -3149,12 +2750,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagEQ) return true } - // match: (CMPWconst (MOVWconst [x]) [y]) + // match: (CMPWconst (MOVLconst [x]) [y]) // cond: int16(x)<int16(y) && uint16(x)<uint16(y) // result: (FlagLT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -3165,12 +2766,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_ULT) return true } - // match: (CMPWconst (MOVWconst [x]) [y]) + // match: (CMPWconst (MOVLconst [x]) [y]) // cond: int16(x)<int16(y) && uint16(x)>uint16(y) // result: (FlagLT_UGT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -3181,12 +2782,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_UGT) return true } - // match: (CMPWconst (MOVWconst [x]) [y]) + // match: (CMPWconst (MOVLconst [x]) [y]) // cond: int16(x)>int16(y) && uint16(x)<uint16(y) // result: (FlagGT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -3197,12 +2798,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_ULT) return true } - // match: (CMPWconst (MOVWconst [x]) [y]) + // match: (CMPWconst (MOVLconst [x]) [y]) // cond: int16(x)>int16(y) && uint16(x)>uint16(y) // result: (FlagGT_UGT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { + if v_0.Op != OpAMD64MOVLconst { break } x := v_0.AuxInt @@ -3213,12 +2814,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagGT_UGT) return true } - // match: (CMPWconst (ANDWconst _ [m]) [n]) + // match: (CMPWconst (ANDLconst _ [m]) [n]) // cond: 0 <= int16(m) && int16(m) < int16(n) // result: (FlagLT_ULT) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDWconst { + if v_0.Op != OpAMD64ANDLconst { break } m := v_0.AuxInt @@ -3229,12 +2830,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.reset(OpAMD64FlagLT_ULT) return true } - // match: (CMPWconst (ANDW x y) [0]) + // match: (CMPWconst (ANDL x y) [0]) // cond: // result: (TESTW x y) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDW { + if v_0.Op != OpAMD64ANDL { break } x := v_0.Args[0] @@ -3247,12 +2848,12 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { v.AddArg(y) return true } - // match: (CMPWconst (ANDWconst [c] x) [0]) + // match: (CMPWconst (ANDLconst [c] x) [0]) // cond: - // result: (TESTWconst [c] x) + // result: (TESTWconst [int64(int16(c))] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDWconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt @@ -3261,7 +2862,7 @@ func rewriteValueAMD64_OpAMD64CMPWconst(v *Value, config *Config) bool { break } v.reset(OpAMD64TESTWconst) - v.AuxInt = c + v.AuxInt = int64(int16(c)) v.AddArg(x) return true } @@ -3305,10 +2906,10 @@ func rewriteValueAMD64_OpCom16(v *Value, config *Config) bool { _ = b // match: (Com16 x) // cond: - // result: (NOTW x) + // result: (NOTL x) for { x := v.Args[0] - v.reset(OpAMD64NOTW) + v.reset(OpAMD64NOTL) v.AddArg(x) return true } @@ -3347,10 +2948,10 @@ func rewriteValueAMD64_OpCom8(v *Value, config *Config) bool { _ = b // match: (Com8 x) // cond: - // result: (NOTB x) + // result: (NOTL x) for { x := v.Args[0] - v.reset(OpAMD64NOTB) + v.reset(OpAMD64NOTL) v.AddArg(x) return true } @@ -3361,10 +2962,10 @@ func rewriteValueAMD64_OpConst16(v *Value, config *Config) bool { _ = b // match: (Const16 [val]) // cond: - // result: (MOVWconst [val]) + // result: (MOVLconst [val]) for { val := v.AuxInt - v.reset(OpAMD64MOVWconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = val return true } @@ -3431,10 +3032,10 @@ func rewriteValueAMD64_OpConst8(v *Value, config *Config) bool { _ = b // match: (Const8 [val]) // cond: - // result: (MOVBconst [val]) + // result: (MOVLconst [val]) for { val := v.AuxInt - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = val return true } @@ -3445,10 +3046,10 @@ func rewriteValueAMD64_OpConstBool(v *Value, config *Config) bool { _ = b // match: (ConstBool [b]) // cond: - // result: (MOVBconst [b]) + // result: (MOVLconst [b]) for { b := v.AuxInt - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = b return true } @@ -3983,6 +3584,24 @@ func rewriteValueAMD64_OpEq8(v *Value, config *Config) bool { } return false } +func rewriteValueAMD64_OpEqB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (EqB x y) + // cond: + // result: (SETEQ (CMPB x y)) + for { + x := v.Args[0] + y := v.Args[1] + v.reset(OpAMD64SETEQ) + v0 := b.NewValue0(v.Line, OpAMD64CMPB, TypeFlags) + v0.AddArg(x) + v0.AddArg(y) + v.AddArg(v0) + return true + } + return false +} func rewriteValueAMD64_OpEqPtr(v *Value, config *Config) bool { b := v.Block _ = b @@ -5842,20 +5461,20 @@ func rewriteValueAMD64_OpLsh16x16(v *Value, config *Config) bool { _ = b // match: (Lsh16x16 <t> x y) // cond: - // result: (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) - v0 := b.NewValue0(v.Line, OpAMD64SHLW, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPWconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 16 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -5867,20 +5486,20 @@ func rewriteValueAMD64_OpLsh16x32(v *Value, config *Config) bool { _ = b // match: (Lsh16x32 <t> x y) // cond: - // result: (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPLconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) - v0 := b.NewValue0(v.Line, OpAMD64SHLW, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPLconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 16 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -5892,20 +5511,20 @@ func rewriteValueAMD64_OpLsh16x64(v *Value, config *Config) bool { _ = b // match: (Lsh16x64 <t> x y) // cond: - // result: (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPQconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) - v0 := b.NewValue0(v.Line, OpAMD64SHLW, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPQconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 16 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -5917,20 +5536,20 @@ func rewriteValueAMD64_OpLsh16x8(v *Value, config *Config) bool { _ = b // match: (Lsh16x8 <t> x y) // cond: - // result: (ANDW (SHLW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) - v0 := b.NewValue0(v.Line, OpAMD64SHLW, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPBconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 16 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -6142,20 +5761,20 @@ func rewriteValueAMD64_OpLsh8x16(v *Value, config *Config) bool { _ = b // match: (Lsh8x16 <t> x y) // cond: - // result: (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPWconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) - v0 := b.NewValue0(v.Line, OpAMD64SHLB, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPWconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 8 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -6167,20 +5786,20 @@ func rewriteValueAMD64_OpLsh8x32(v *Value, config *Config) bool { _ = b // match: (Lsh8x32 <t> x y) // cond: - // result: (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPLconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) - v0 := b.NewValue0(v.Line, OpAMD64SHLB, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPLconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 8 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -6192,20 +5811,20 @@ func rewriteValueAMD64_OpLsh8x64(v *Value, config *Config) bool { _ = b // match: (Lsh8x64 <t> x y) // cond: - // result: (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPQconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) - v0 := b.NewValue0(v.Line, OpAMD64SHLB, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPQconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 8 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -6217,20 +5836,20 @@ func rewriteValueAMD64_OpLsh8x8(v *Value, config *Config) bool { _ = b // match: (Lsh8x8 <t> x y) // cond: - // result: (ANDB (SHLB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) + // result: (ANDL (SHLL <t> x y) (SBBLcarrymask <t> (CMPBconst y [32]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) - v0 := b.NewValue0(v.Line, OpAMD64SHLB, t) + v.reset(OpAMD64ANDL) + v0 := b.NewValue0(v.Line, OpAMD64SHLL, t) v0.AddArg(x) v0.AddArg(y) v.AddArg(v0) v1 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, t) v2 := b.NewValue0(v.Line, OpAMD64CMPBconst, TypeFlags) v2.AddArg(y) - v2.AuxInt = 8 + v2.AuxInt = 32 v1.AddArg(v2) v.AddArg(v1) return true @@ -6241,7 +5860,7 @@ func rewriteValueAMD64_OpAMD64MOVBQSX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVBQSX x:(MOVBload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVBQSXload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -6252,7 +5871,7 @@ func rewriteValueAMD64_OpAMD64MOVBQSX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -6265,12 +5884,12 @@ func rewriteValueAMD64_OpAMD64MOVBQSX(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (MOVBQSX (ANDBconst [c] x)) + // match: (MOVBQSX (ANDLconst [c] x)) // cond: c & 0x80 == 0 - // result: (ANDQconst [c & 0x7f] x) + // result: (ANDLconst [c & 0x7f] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDBconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt @@ -6278,7 +5897,7 @@ func rewriteValueAMD64_OpAMD64MOVBQSX(v *Value, config *Config) bool { if !(c&0x80 == 0) { break } - v.reset(OpAMD64ANDQconst) + v.reset(OpAMD64ANDLconst) v.AuxInt = c & 0x7f v.AddArg(x) return true @@ -6318,7 +5937,7 @@ func rewriteValueAMD64_OpAMD64MOVBQZX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVBQZX x:(MOVBload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVBload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -6329,7 +5948,7 @@ func rewriteValueAMD64_OpAMD64MOVBQZX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -6343,7 +5962,7 @@ func rewriteValueAMD64_OpAMD64MOVBQZX(v *Value, config *Config) bool { return true } // match: (MOVBQZX x:(MOVBloadidx1 [off] {sym} ptr idx mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVBloadidx1 <v.Type> [off] {sym} ptr idx mem) for { x := v.Args[0] @@ -6355,7 +5974,7 @@ func rewriteValueAMD64_OpAMD64MOVBQZX(v *Value, config *Config) bool { ptr := x.Args[0] idx := x.Args[1] mem := x.Args[2] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -6369,17 +5988,17 @@ func rewriteValueAMD64_OpAMD64MOVBQZX(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (MOVBQZX (ANDBconst [c] x)) + // match: (MOVBQZX (ANDLconst [c] x)) // cond: - // result: (ANDQconst [c & 0xff] x) + // result: (ANDLconst [c & 0xff] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDBconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt x := v_0.Args[0] - v.reset(OpAMD64ANDQconst) + v.reset(OpAMD64ANDLconst) v.AuxInt = c & 0xff v.AddArg(x) return true @@ -6630,7 +6249,7 @@ func rewriteValueAMD64_OpAMD64MOVBstore(v *Value, config *Config) bool { v.AddArg(mem) return true } - // match: (MOVBstore [off] {sym} ptr (MOVBconst [c]) mem) + // match: (MOVBstore [off] {sym} ptr (MOVLconst [c]) mem) // cond: validOff(off) // result: (MOVBstoreconst [makeValAndOff(int64(int8(c)),off)] {sym} ptr mem) for { @@ -6638,7 +6257,7 @@ func rewriteValueAMD64_OpAMD64MOVBstore(v *Value, config *Config) bool { sym := v.Aux ptr := v.Args[0] v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { + if v_1.Op != OpAMD64MOVLconst { break } c := v_1.AuxInt @@ -6733,6 +6352,97 @@ func rewriteValueAMD64_OpAMD64MOVBstore(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVBstore [i] {s} p (SHRQconst [8] w) x:(MOVBstore [i-1] {s} p w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVWstore [i-1] {s} p w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + if v_1.AuxInt != 8 { + break + } + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVBstore { + break + } + if x.AuxInt != i-1 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if w != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstore) + v.AuxInt = i - 1 + v.Aux = s + v.AddArg(p) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVBstore [i] {s} p (SHRQconst [j] w) x:(MOVBstore [i-1] {s} p w0:(SHRQconst [j-8] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVWstore [i-1] {s} p w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + j := v_1.AuxInt + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVBstore { + break + } + if x.AuxInt != i-1 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + w0 := x.Args[1] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-8 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstore) + v.AuxInt = i - 1 + v.Aux = s + v.AddArg(p) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVBstoreconst(v *Value, config *Config) bool { @@ -6832,6 +6542,35 @@ func rewriteValueAMD64_OpAMD64MOVBstoreconst(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVBstoreconst [c] {s} p x:(MOVBstoreconst [a] {s} p mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 1 == ValAndOff(c).Off() && clobber(x) + // result: (MOVWstoreconst [makeValAndOff(ValAndOff(a).Val()&0xff | ValAndOff(c).Val()<<8, ValAndOff(a).Off())] {s} p mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + x := v.Args[1] + if x.Op != OpAMD64MOVBstoreconst { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + mem := x.Args[1] + if !(x.Uses == 1 && ValAndOff(a).Off()+1 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstoreconst) + v.AuxInt = makeValAndOff(ValAndOff(a).Val()&0xff|ValAndOff(c).Val()<<8, ValAndOff(a).Off()) + v.Aux = s + v.AddArg(p) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVBstoreconstidx1(v *Value, config *Config) bool { @@ -6881,6 +6620,40 @@ func rewriteValueAMD64_OpAMD64MOVBstoreconstidx1(v *Value, config *Config) bool v.AddArg(mem) return true } + // match: (MOVBstoreconstidx1 [c] {s} p i x:(MOVBstoreconstidx1 [a] {s} p i mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 1 == ValAndOff(c).Off() && clobber(x) + // result: (MOVWstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xff | ValAndOff(c).Val()<<8, ValAndOff(a).Off())] {s} p i mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + i := v.Args[1] + x := v.Args[2] + if x.Op != OpAMD64MOVBstoreconstidx1 { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if i != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && ValAndOff(a).Off()+1 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstoreconstidx1) + v.AuxInt = makeValAndOff(ValAndOff(a).Val()&0xff|ValAndOff(c).Val()<<8, ValAndOff(a).Off()) + v.Aux = s + v.AddArg(p) + v.AddArg(i) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVBstoreidx1(v *Value, config *Config) bool { @@ -6934,13 +6707,114 @@ func rewriteValueAMD64_OpAMD64MOVBstoreidx1(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVBstoreidx1 [i] {s} p idx (SHRQconst [8] w) x:(MOVBstoreidx1 [i-1] {s} p idx w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVWstoreidx1 [i-1] {s} p idx w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + if v_2.AuxInt != 8 { + break + } + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVBstoreidx1 { + break + } + if x.AuxInt != i-1 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + if w != x.Args[2] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstoreidx1) + v.AuxInt = i - 1 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVBstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVBstoreidx1 [i-1] {s} p idx w0:(SHRQconst [j-8] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVWstoreidx1 [i-1] {s} p idx w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + j := v_2.AuxInt + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVBstoreidx1 { + break + } + if x.AuxInt != i-1 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + w0 := x.Args[2] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-8 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVWstoreidx1) + v.AuxInt = i - 1 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLQSX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVLQSX x:(MOVLload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVLQSXload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -6951,7 +6825,7 @@ func rewriteValueAMD64_OpAMD64MOVLQSX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -6966,7 +6840,7 @@ func rewriteValueAMD64_OpAMD64MOVLQSX(v *Value, config *Config) bool { } // match: (MOVLQSX (ANDLconst [c] x)) // cond: c & 0x80000000 == 0 - // result: (ANDQconst [c & 0x7fffffff] x) + // result: (ANDLconst [c & 0x7fffffff] x) for { v_0 := v.Args[0] if v_0.Op != OpAMD64ANDLconst { @@ -6977,7 +6851,7 @@ func rewriteValueAMD64_OpAMD64MOVLQSX(v *Value, config *Config) bool { if !(c&0x80000000 == 0) { break } - v.reset(OpAMD64ANDQconst) + v.reset(OpAMD64ANDLconst) v.AuxInt = c & 0x7fffffff v.AddArg(x) return true @@ -7017,7 +6891,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVLQZX x:(MOVLload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVLload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -7028,7 +6902,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -7042,7 +6916,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { return true } // match: (MOVLQZX x:(MOVLloadidx1 [off] {sym} ptr idx mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVLloadidx1 <v.Type> [off] {sym} ptr idx mem) for { x := v.Args[0] @@ -7054,7 +6928,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { ptr := x.Args[0] idx := x.Args[1] mem := x.Args[2] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -7069,7 +6943,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { return true } // match: (MOVLQZX x:(MOVLloadidx4 [off] {sym} ptr idx mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVLloadidx4 <v.Type> [off] {sym} ptr idx mem) for { x := v.Args[0] @@ -7081,7 +6955,7 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { ptr := x.Args[0] idx := x.Args[1] mem := x.Args[2] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -7096,8 +6970,8 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { return true } // match: (MOVLQZX (ANDLconst [c] x)) - // cond: c & 0x80000000 == 0 - // result: (ANDQconst [c & 0x7fffffff] x) + // cond: + // result: (ANDLconst [c] x) for { v_0 := v.Args[0] if v_0.Op != OpAMD64ANDLconst { @@ -7105,11 +6979,8 @@ func rewriteValueAMD64_OpAMD64MOVLQZX(v *Value, config *Config) bool { } c := v_0.AuxInt x := v_0.Args[0] - if !(c&0x80000000 == 0) { - break - } - v.reset(OpAMD64ANDQconst) - v.AuxInt = c & 0x7fffffff + v.reset(OpAMD64ANDLconst) + v.AuxInt = c v.AddArg(x) return true } @@ -7589,6 +7460,97 @@ func rewriteValueAMD64_OpAMD64MOVLstore(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVLstore [i] {s} p (SHRQconst [32] w) x:(MOVLstore [i-4] {s} p w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstore [i-4] {s} p w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + if v_1.AuxInt != 32 { + break + } + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVLstore { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if w != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstore) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVLstore [i] {s} p (SHRQconst [j] w) x:(MOVLstore [i-4] {s} p w0:(SHRQconst [j-32] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstore [i-4] {s} p w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + j := v_1.AuxInt + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVLstore { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + w0 := x.Args[1] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-32 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstore) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLstoreconst(v *Value, config *Config) bool { @@ -7714,6 +7676,38 @@ func rewriteValueAMD64_OpAMD64MOVLstoreconst(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVLstoreconst [c] {s} p x:(MOVLstoreconst [a] {s} p mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() && clobber(x) + // result: (MOVQstore [ValAndOff(a).Off()] {s} p (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + x := v.Args[1] + if x.Op != OpAMD64MOVLstoreconst { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + mem := x.Args[1] + if !(x.Uses == 1 && ValAndOff(a).Off()+4 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstore) + v.AuxInt = ValAndOff(a).Off() + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64MOVQconst, config.fe.TypeUInt64()) + v0.AuxInt = ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32 + v.AddArg(v0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLstoreconstidx1(v *Value, config *Config) bool { @@ -7787,6 +7781,43 @@ func rewriteValueAMD64_OpAMD64MOVLstoreconstidx1(v *Value, config *Config) bool v.AddArg(mem) return true } + // match: (MOVLstoreconstidx1 [c] {s} p i x:(MOVLstoreconstidx1 [a] {s} p i mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() && clobber(x) + // result: (MOVQstoreidx1 [ValAndOff(a).Off()] {s} p i (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + i := v.Args[1] + x := v.Args[2] + if x.Op != OpAMD64MOVLstoreconstidx1 { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if i != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && ValAndOff(a).Off()+4 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = ValAndOff(a).Off() + v.Aux = s + v.AddArg(p) + v.AddArg(i) + v0 := b.NewValue0(v.Line, OpAMD64MOVQconst, config.fe.TypeUInt64()) + v0.AuxInt = ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32 + v.AddArg(v0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLstoreconstidx4(v *Value, config *Config) bool { @@ -7836,6 +7867,46 @@ func rewriteValueAMD64_OpAMD64MOVLstoreconstidx4(v *Value, config *Config) bool v.AddArg(mem) return true } + // match: (MOVLstoreconstidx4 [c] {s} p i x:(MOVLstoreconstidx4 [a] {s} p i mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 4 == ValAndOff(c).Off() && clobber(x) + // result: (MOVQstoreidx1 [ValAndOff(a).Off()] {s} p (SHLQconst <i.Type> [2] i) (MOVQconst [ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32]) mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + i := v.Args[1] + x := v.Args[2] + if x.Op != OpAMD64MOVLstoreconstidx4 { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if i != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && ValAndOff(a).Off()+4 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = ValAndOff(a).Off() + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, i.Type) + v0.AuxInt = 2 + v0.AddArg(i) + v.AddArg(v0) + v1 := b.NewValue0(v.Line, OpAMD64MOVQconst, config.fe.TypeUInt64()) + v1.AuxInt = ValAndOff(a).Val()&0xffffffff | ValAndOff(c).Val()<<32 + v.AddArg(v1) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLstoreidx1(v *Value, config *Config) bool { @@ -7915,6 +7986,107 @@ func rewriteValueAMD64_OpAMD64MOVLstoreidx1(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVLstoreidx1 [i] {s} p idx (SHRQconst [32] w) x:(MOVLstoreidx1 [i-4] {s} p idx w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstoreidx1 [i-4] {s} p idx w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + if v_2.AuxInt != 32 { + break + } + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVLstoreidx1 { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + if w != x.Args[2] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVLstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVLstoreidx1 [i-4] {s} p idx w0:(SHRQconst [j-32] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstoreidx1 [i-4] {s} p idx w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + j := v_2.AuxInt + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVLstoreidx1 { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + w0 := x.Args[2] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-32 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVLstoreidx4(v *Value, config *Config) bool { @@ -7968,6 +8140,113 @@ func rewriteValueAMD64_OpAMD64MOVLstoreidx4(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVLstoreidx4 [i] {s} p idx (SHRQconst [32] w) x:(MOVLstoreidx4 [i-4] {s} p idx w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstoreidx1 [i-4] {s} p (SHLQconst <idx.Type> [2] idx) w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + if v_2.AuxInt != 32 { + break + } + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVLstoreidx4 { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + if w != x.Args[2] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, idx.Type) + v0.AuxInt = 2 + v0.AddArg(idx) + v.AddArg(v0) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVLstoreidx4 [i] {s} p idx (SHRQconst [j] w) x:(MOVLstoreidx4 [i-4] {s} p idx w0:(SHRQconst [j-32] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVQstoreidx1 [i-4] {s} p (SHLQconst <idx.Type> [2] idx) w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + j := v_2.AuxInt + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVLstoreidx4 { + break + } + if x.AuxInt != i-4 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + w0 := x.Args[2] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-32 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVQstoreidx1) + v.AuxInt = i - 4 + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, idx.Type) + v0.AuxInt = 2 + v0.AddArg(idx) + v.AddArg(v0) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVOload(v *Value, config *Config) bool { @@ -9835,7 +10114,7 @@ func rewriteValueAMD64_OpAMD64MOVWQSX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVWQSX x:(MOVWload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVWQSXload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -9846,7 +10125,7 @@ func rewriteValueAMD64_OpAMD64MOVWQSX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -9859,12 +10138,12 @@ func rewriteValueAMD64_OpAMD64MOVWQSX(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (MOVWQSX (ANDWconst [c] x)) + // match: (MOVWQSX (ANDLconst [c] x)) // cond: c & 0x8000 == 0 - // result: (ANDQconst [c & 0x7fff] x) + // result: (ANDLconst [c & 0x7fff] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDWconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt @@ -9872,7 +10151,7 @@ func rewriteValueAMD64_OpAMD64MOVWQSX(v *Value, config *Config) bool { if !(c&0x8000 == 0) { break } - v.reset(OpAMD64ANDQconst) + v.reset(OpAMD64ANDLconst) v.AuxInt = c & 0x7fff v.AddArg(x) return true @@ -9912,7 +10191,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { b := v.Block _ = b // match: (MOVWQZX x:(MOVWload [off] {sym} ptr mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVWload <v.Type> [off] {sym} ptr mem) for { x := v.Args[0] @@ -9923,7 +10202,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { sym := x.Aux ptr := x.Args[0] mem := x.Args[1] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -9937,7 +10216,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { return true } // match: (MOVWQZX x:(MOVWloadidx1 [off] {sym} ptr idx mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVWloadidx1 <v.Type> [off] {sym} ptr idx mem) for { x := v.Args[0] @@ -9949,7 +10228,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { ptr := x.Args[0] idx := x.Args[1] mem := x.Args[2] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -9964,7 +10243,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { return true } // match: (MOVWQZX x:(MOVWloadidx2 [off] {sym} ptr idx mem)) - // cond: x.Uses == 1 + // cond: x.Uses == 1 && clobber(x) // result: @x.Block (MOVWloadidx2 <v.Type> [off] {sym} ptr idx mem) for { x := v.Args[0] @@ -9976,7 +10255,7 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { ptr := x.Args[0] idx := x.Args[1] mem := x.Args[2] - if !(x.Uses == 1) { + if !(x.Uses == 1 && clobber(x)) { break } b = x.Block @@ -9990,17 +10269,17 @@ func rewriteValueAMD64_OpAMD64MOVWQZX(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (MOVWQZX (ANDWconst [c] x)) + // match: (MOVWQZX (ANDLconst [c] x)) // cond: - // result: (ANDQconst [c & 0xffff] x) + // result: (ANDLconst [c & 0xffff] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64ANDWconst { + if v_0.Op != OpAMD64ANDLconst { break } c := v_0.AuxInt x := v_0.Args[0] - v.reset(OpAMD64ANDQconst) + v.reset(OpAMD64ANDLconst) v.AuxInt = c & 0xffff v.AddArg(x) return true @@ -10350,7 +10629,7 @@ func rewriteValueAMD64_OpAMD64MOVWstore(v *Value, config *Config) bool { v.AddArg(mem) return true } - // match: (MOVWstore [off] {sym} ptr (MOVWconst [c]) mem) + // match: (MOVWstore [off] {sym} ptr (MOVLconst [c]) mem) // cond: validOff(off) // result: (MOVWstoreconst [makeValAndOff(int64(int16(c)),off)] {sym} ptr mem) for { @@ -10358,7 +10637,7 @@ func rewriteValueAMD64_OpAMD64MOVWstore(v *Value, config *Config) bool { sym := v.Aux ptr := v.Args[0] v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { + if v_1.Op != OpAMD64MOVLconst { break } c := v_1.AuxInt @@ -10481,6 +10760,97 @@ func rewriteValueAMD64_OpAMD64MOVWstore(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVWstore [i] {s} p (SHRQconst [16] w) x:(MOVWstore [i-2] {s} p w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstore [i-2] {s} p w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + if v_1.AuxInt != 16 { + break + } + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVWstore { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if w != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstore) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVWstore [i] {s} p (SHRQconst [j] w) x:(MOVWstore [i-2] {s} p w0:(SHRQconst [j-16] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstore [i-2] {s} p w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SHRQconst { + break + } + j := v_1.AuxInt + w := v_1.Args[0] + x := v.Args[2] + if x.Op != OpAMD64MOVWstore { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + w0 := x.Args[1] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-16 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstore) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVWstoreconst(v *Value, config *Config) bool { @@ -10606,6 +10976,35 @@ func rewriteValueAMD64_OpAMD64MOVWstoreconst(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVWstoreconst [c] {s} p x:(MOVWstoreconst [a] {s} p mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() && clobber(x) + // result: (MOVLstoreconst [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + x := v.Args[1] + if x.Op != OpAMD64MOVWstoreconst { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + mem := x.Args[1] + if !(x.Uses == 1 && ValAndOff(a).Off()+2 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreconst) + v.AuxInt = makeValAndOff(ValAndOff(a).Val()&0xffff|ValAndOff(c).Val()<<16, ValAndOff(a).Off()) + v.Aux = s + v.AddArg(p) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVWstoreconstidx1(v *Value, config *Config) bool { @@ -10679,6 +11078,40 @@ func rewriteValueAMD64_OpAMD64MOVWstoreconstidx1(v *Value, config *Config) bool v.AddArg(mem) return true } + // match: (MOVWstoreconstidx1 [c] {s} p i x:(MOVWstoreconstidx1 [a] {s} p i mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() && clobber(x) + // result: (MOVLstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p i mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + i := v.Args[1] + x := v.Args[2] + if x.Op != OpAMD64MOVWstoreconstidx1 { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if i != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && ValAndOff(a).Off()+2 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreconstidx1) + v.AuxInt = makeValAndOff(ValAndOff(a).Val()&0xffff|ValAndOff(c).Val()<<16, ValAndOff(a).Off()) + v.Aux = s + v.AddArg(p) + v.AddArg(i) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVWstoreconstidx2(v *Value, config *Config) bool { @@ -10728,6 +11161,43 @@ func rewriteValueAMD64_OpAMD64MOVWstoreconstidx2(v *Value, config *Config) bool v.AddArg(mem) return true } + // match: (MOVWstoreconstidx2 [c] {s} p i x:(MOVWstoreconstidx2 [a] {s} p i mem)) + // cond: x.Uses == 1 && ValAndOff(a).Off() + 2 == ValAndOff(c).Off() && clobber(x) + // result: (MOVLstoreconstidx1 [makeValAndOff(ValAndOff(a).Val()&0xffff | ValAndOff(c).Val()<<16, ValAndOff(a).Off())] {s} p (SHLQconst <i.Type> [1] i) mem) + for { + c := v.AuxInt + s := v.Aux + p := v.Args[0] + i := v.Args[1] + x := v.Args[2] + if x.Op != OpAMD64MOVWstoreconstidx2 { + break + } + a := x.AuxInt + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if i != x.Args[1] { + break + } + mem := x.Args[2] + if !(x.Uses == 1 && ValAndOff(a).Off()+2 == ValAndOff(c).Off() && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreconstidx1) + v.AuxInt = makeValAndOff(ValAndOff(a).Val()&0xffff|ValAndOff(c).Val()<<16, ValAndOff(a).Off()) + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, i.Type) + v0.AuxInt = 1 + v0.AddArg(i) + v.AddArg(v0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVWstoreidx1(v *Value, config *Config) bool { @@ -10807,6 +11277,107 @@ func rewriteValueAMD64_OpAMD64MOVWstoreidx1(v *Value, config *Config) bool { v.AddArg(mem) return true } + // match: (MOVWstoreidx1 [i] {s} p idx (SHRQconst [16] w) x:(MOVWstoreidx1 [i-2] {s} p idx w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstoreidx1 [i-2] {s} p idx w mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + if v_2.AuxInt != 16 { + break + } + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVWstoreidx1 { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + if w != x.Args[2] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreidx1) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w) + v.AddArg(mem) + return true + } + // match: (MOVWstoreidx1 [i] {s} p idx (SHRQconst [j] w) x:(MOVWstoreidx1 [i-2] {s} p idx w0:(SHRQconst [j-16] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstoreidx1 [i-2] {s} p idx w0 mem) + for { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { + break + } + j := v_2.AuxInt + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVWstoreidx1 { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + w0 := x.Args[2] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-16 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreidx1) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v.AddArg(idx) + v.AddArg(w0) + v.AddArg(mem) + return true + } return false } func rewriteValueAMD64_OpAMD64MOVWstoreidx2(v *Value, config *Config) bool { @@ -10860,58 +11431,111 @@ func rewriteValueAMD64_OpAMD64MOVWstoreidx2(v *Value, config *Config) bool { v.AddArg(mem) return true } - return false -} -func rewriteValueAMD64_OpAMD64MULB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (MULB x (MOVBconst [c])) - // cond: - // result: (MULBconst [c] x) + // match: (MOVWstoreidx2 [i] {s} p idx (SHRQconst [16] w) x:(MOVWstoreidx2 [i-2] {s} p idx w mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstoreidx1 [i-2] {s} p (SHLQconst <idx.Type> [1] idx) w mem) for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { break } - c := v_1.AuxInt - v.reset(OpAMD64MULBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (MULB (MOVBconst [c]) x) - // cond: - // result: (MULBconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_2.AuxInt != 16 { break } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64MULBconst) - v.AuxInt = c - v.AddArg(x) + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVWstoreidx2 { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + if w != x.Args[2] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreidx1) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, idx.Type) + v0.AuxInt = 1 + v0.AddArg(idx) + v.AddArg(v0) + v.AddArg(w) + v.AddArg(mem) return true } - return false -} -func rewriteValueAMD64_OpAMD64MULBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (MULBconst [c] (MOVBconst [d])) - // cond: - // result: (MOVBconst [int64(int8(c*d))]) + // match: (MOVWstoreidx2 [i] {s} p idx (SHRQconst [j] w) x:(MOVWstoreidx2 [i-2] {s} p idx w0:(SHRQconst [j-16] w) mem)) + // cond: x.Uses == 1 && clobber(x) + // result: (MOVLstoreidx1 [i-2] {s} p (SHLQconst <idx.Type> [1] idx) w0 mem) for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + i := v.AuxInt + s := v.Aux + p := v.Args[0] + idx := v.Args[1] + v_2 := v.Args[2] + if v_2.Op != OpAMD64SHRQconst { break } - d := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = int64(int8(c * d)) + j := v_2.AuxInt + w := v_2.Args[0] + x := v.Args[3] + if x.Op != OpAMD64MOVWstoreidx2 { + break + } + if x.AuxInt != i-2 { + break + } + if x.Aux != s { + break + } + if p != x.Args[0] { + break + } + if idx != x.Args[1] { + break + } + w0 := x.Args[2] + if w0.Op != OpAMD64SHRQconst { + break + } + if w0.AuxInt != j-16 { + break + } + if w != w0.Args[0] { + break + } + mem := x.Args[3] + if !(x.Uses == 1 && clobber(x)) { + break + } + v.reset(OpAMD64MOVLstoreidx1) + v.AuxInt = i - 2 + v.Aux = s + v.AddArg(p) + v0 := b.NewValue0(v.Line, OpAMD64SHLQconst, idx.Type) + v0.AuxInt = 1 + v0.AddArg(idx) + v.AddArg(v0) + v.AddArg(w0) + v.AddArg(mem) return true } return false @@ -11382,60 +12006,6 @@ func rewriteValueAMD64_OpAMD64MULQconst(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64MULW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (MULW x (MOVWconst [c])) - // cond: - // result: (MULWconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64MULWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (MULW (MOVWconst [c]) x) - // cond: - // result: (MULWconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64MULWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64MULWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (MULWconst [c] (MOVWconst [d])) - // cond: - // result: (MOVWconst [int64(int16(c*d))]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = int64(int16(c * d)) - return true - } - return false -} func rewriteValueAMD64_OpMod16(v *Value, config *Config) bool { b := v.Block _ = b @@ -11931,11 +12501,11 @@ func rewriteValueAMD64_OpMul16(v *Value, config *Config) bool { _ = b // match: (Mul16 x y) // cond: - // result: (MULW x y) + // result: (MULL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64MULW) + v.reset(OpAMD64MULL) v.AddArg(x) v.AddArg(y) return true @@ -12011,35 +12581,17 @@ func rewriteValueAMD64_OpMul8(v *Value, config *Config) bool { _ = b // match: (Mul8 x y) // cond: - // result: (MULB x y) + // result: (MULL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64MULB) + v.reset(OpAMD64MULL) v.AddArg(x) v.AddArg(y) return true } return false } -func rewriteValueAMD64_OpAMD64NEGB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (NEGB (MOVBconst [c])) - // cond: - // result: (MOVBconst [int64(int8(-c))]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = int64(int8(-c)) - return true - } - return false -} func rewriteValueAMD64_OpAMD64NEGL(v *Value, config *Config) bool { b := v.Block _ = b @@ -12076,42 +12628,6 @@ func rewriteValueAMD64_OpAMD64NEGQ(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64NEGW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (NEGW (MOVWconst [c])) - // cond: - // result: (MOVWconst [int64(int16(-c))]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = int64(int16(-c)) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64NOTB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (NOTB (MOVBconst [c])) - // cond: - // result: (MOVBconst [^c]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = ^c - return true - } - return false -} func rewriteValueAMD64_OpAMD64NOTL(v *Value, config *Config) bool { b := v.Block _ = b @@ -12148,33 +12664,15 @@ func rewriteValueAMD64_OpAMD64NOTQ(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64NOTW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (NOTW (MOVWconst [c])) - // cond: - // result: (MOVWconst [^c]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = ^c - return true - } - return false -} func rewriteValueAMD64_OpNeg16(v *Value, config *Config) bool { b := v.Block _ = b // match: (Neg16 x) // cond: - // result: (NEGW x) + // result: (NEGL x) for { x := v.Args[0] - v.reset(OpAMD64NEGW) + v.reset(OpAMD64NEGL) v.AddArg(x) return true } @@ -12247,10 +12745,10 @@ func rewriteValueAMD64_OpNeg8(v *Value, config *Config) bool { _ = b // match: (Neg8 x) // cond: - // result: (NEGB x) + // result: (NEGL x) for { x := v.Args[0] - v.reset(OpAMD64NEGB) + v.reset(OpAMD64NEGL) v.AddArg(x) return true } @@ -12364,6 +12862,24 @@ func rewriteValueAMD64_OpNeq8(v *Value, config *Config) bool { } return false } +func rewriteValueAMD64_OpNeqB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (NeqB x y) + // cond: + // result: (SETNE (CMPB x y)) + for { + x := v.Args[0] + y := v.Args[1] + v.reset(OpAMD64SETNE) + v0 := b.NewValue0(v.Line, OpAMD64CMPB, TypeFlags) + v0.AddArg(x) + v0.AddArg(y) + v.AddArg(v0) + return true + } + return false +} func rewriteValueAMD64_OpNeqPtr(v *Value, config *Config) bool { b := v.Block _ = b @@ -12403,50 +12919,50 @@ func rewriteValueAMD64_OpNot(v *Value, config *Config) bool { _ = b // match: (Not x) // cond: - // result: (XORBconst [1] x) + // result: (XORLconst [1] x) for { x := v.Args[0] - v.reset(OpAMD64XORBconst) + v.reset(OpAMD64XORLconst) v.AuxInt = 1 v.AddArg(x) return true } return false } -func rewriteValueAMD64_OpAMD64ORB(v *Value, config *Config) bool { +func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { b := v.Block _ = b - // match: (ORB x (MOVBconst [c])) + // match: (ORL x (MOVLconst [c])) // cond: - // result: (ORBconst [c] x) + // result: (ORLconst [c] x) for { x := v.Args[0] v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { + if v_1.Op != OpAMD64MOVLconst { break } c := v_1.AuxInt - v.reset(OpAMD64ORBconst) + v.reset(OpAMD64ORLconst) v.AuxInt = c v.AddArg(x) return true } - // match: (ORB (MOVBconst [c]) x) + // match: (ORL (MOVLconst [c]) x) // cond: - // result: (ORBconst [c] x) + // result: (ORLconst [c] x) for { v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if v_0.Op != OpAMD64MOVLconst { break } c := v_0.AuxInt x := v.Args[1] - v.reset(OpAMD64ORBconst) + v.reset(OpAMD64ORLconst) v.AuxInt = c v.AddArg(x) return true } - // match: (ORB x x) + // match: (ORL x x) // cond: // result: x for { @@ -12459,112 +12975,67 @@ func rewriteValueAMD64_OpAMD64ORB(v *Value, config *Config) bool { v.AddArg(x) return true } - return false -} -func rewriteValueAMD64_OpAMD64ORBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ORBconst [c] x) - // cond: int8(c)==0 - // result: x + // match: (ORL x0:(MOVBload [i] {s} p mem) s0:(SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && s0.Uses == 1 && mergePoint(b,x0,x1) != nil && clobber(x0) && clobber(x1) && clobber(s0) + // result: @mergePoint(b,x0,x1) (MOVWload [i] {s} p mem) for { - c := v.AuxInt - x := v.Args[0] - if !(int8(c) == 0) { + x0 := v.Args[0] + if x0.Op != OpAMD64MOVBload { break } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ORBconst [c] _) - // cond: int8(c)==-1 - // result: (MOVBconst [-1]) - for { - c := v.AuxInt - if !(int8(c) == -1) { + i := x0.AuxInt + s := x0.Aux + p := x0.Args[0] + mem := x0.Args[1] + s0 := v.Args[1] + if s0.Op != OpAMD64SHLLconst { break } - v.reset(OpAMD64MOVBconst) - v.AuxInt = -1 - return true - } - // match: (ORBconst [c] (MOVBconst [d])) - // cond: - // result: (MOVBconst [c|d]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { + if s0.AuxInt != 8 { break } - d := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = c | d - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ORL x (MOVLconst [c])) - // cond: - // result: (ORLconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVLconst { + x1 := s0.Args[0] + if x1.Op != OpAMD64MOVBload { break } - c := v_1.AuxInt - v.reset(OpAMD64ORLconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ORL (MOVLconst [c]) x) - // cond: - // result: (ORLconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVLconst { + if x1.AuxInt != i+1 { break } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ORLconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ORL x x) - // cond: - // result: x - for { - x := v.Args[0] - if x != v.Args[1] { + if x1.Aux != s { + break + } + if p != x1.Args[0] { + break + } + if mem != x1.Args[1] { break } + if !(x0.Uses == 1 && x1.Uses == 1 && s0.Uses == 1 && mergePoint(b, x0, x1) != nil && clobber(x0) && clobber(x1) && clobber(s0)) { + break + } + b = mergePoint(b, x0, x1) + v0 := b.NewValue0(v.Line, OpAMD64MOVWload, config.fe.TypeUInt16()) v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) + v.AddArg(v0) + v0.AuxInt = i + v0.Aux = s + v0.AddArg(p) + v0.AddArg(mem) return true } - // match: (ORL (ORL (ORL x0:(MOVBload [i] {s} p mem) (SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) (SHLLconst [16] x2:(MOVBload [i+2] {s} p mem))) (SHLLconst [24] x3:(MOVBload [i+3] {s} p mem))) - // cond: mergePoint(b,x0,x1,x2,x3) != nil + // match: (ORL o0:(ORL o1:(ORL x0:(MOVBload [i] {s} p mem) s0:(SHLLconst [8] x1:(MOVBload [i+1] {s} p mem))) s1:(SHLLconst [16] x2:(MOVBload [i+2] {s} p mem))) s2:(SHLLconst [24] x3:(MOVBload [i+3] {s} p mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && mergePoint(b,x0,x1,x2,x3) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(o0) && clobber(o1) // result: @mergePoint(b,x0,x1,x2,x3) (MOVLload [i] {s} p mem) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64ORL { + o0 := v.Args[0] + if o0.Op != OpAMD64ORL { break } - v_0_0 := v_0.Args[0] - if v_0_0.Op != OpAMD64ORL { + o1 := o0.Args[0] + if o1.Op != OpAMD64ORL { break } - x0 := v_0_0.Args[0] + x0 := o1.Args[0] if x0.Op != OpAMD64MOVBload { break } @@ -12572,14 +13043,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { s := x0.Aux p := x0.Args[0] mem := x0.Args[1] - v_0_0_1 := v_0_0.Args[1] - if v_0_0_1.Op != OpAMD64SHLLconst { + s0 := o1.Args[1] + if s0.Op != OpAMD64SHLLconst { break } - if v_0_0_1.AuxInt != 8 { + if s0.AuxInt != 8 { break } - x1 := v_0_0_1.Args[0] + x1 := s0.Args[0] if x1.Op != OpAMD64MOVBload { break } @@ -12595,14 +13066,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x1.Args[1] { break } - v_0_1 := v_0.Args[1] - if v_0_1.Op != OpAMD64SHLLconst { + s1 := o0.Args[1] + if s1.Op != OpAMD64SHLLconst { break } - if v_0_1.AuxInt != 16 { + if s1.AuxInt != 16 { break } - x2 := v_0_1.Args[0] + x2 := s1.Args[0] if x2.Op != OpAMD64MOVBload { break } @@ -12618,14 +13089,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x2.Args[1] { break } - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLLconst { + s2 := v.Args[1] + if s2.Op != OpAMD64SHLLconst { break } - if v_1.AuxInt != 24 { + if s2.AuxInt != 24 { break } - x3 := v_1.Args[0] + x3 := s2.Args[0] if x3.Op != OpAMD64MOVBload { break } @@ -12641,7 +13112,7 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x3.Args[1] { break } - if !(mergePoint(b, x0, x1, x2, x3) != nil) { + if !(x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && mergePoint(b, x0, x1, x2, x3) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(o0) && clobber(o1)) { break } b = mergePoint(b, x0, x1, x2, x3) @@ -12654,19 +13125,72 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (ORL (ORL (ORL x0:(MOVBloadidx1 [i] {s} p idx mem) (SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) (SHLLconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) (SHLLconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) - // cond: mergePoint(b,x0,x1,x2,x3) != nil + // match: (ORL x0:(MOVBloadidx1 [i] {s} p idx mem) s0:(SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && s0.Uses == 1 && mergePoint(b,x0,x1) != nil && clobber(x0) && clobber(x1) && clobber(s0) + // result: @mergePoint(b,x0,x1) (MOVWloadidx1 <v.Type> [i] {s} p idx mem) + for { + x0 := v.Args[0] + if x0.Op != OpAMD64MOVBloadidx1 { + break + } + i := x0.AuxInt + s := x0.Aux + p := x0.Args[0] + idx := x0.Args[1] + mem := x0.Args[2] + s0 := v.Args[1] + if s0.Op != OpAMD64SHLLconst { + break + } + if s0.AuxInt != 8 { + break + } + x1 := s0.Args[0] + if x1.Op != OpAMD64MOVBloadidx1 { + break + } + if x1.AuxInt != i+1 { + break + } + if x1.Aux != s { + break + } + if p != x1.Args[0] { + break + } + if idx != x1.Args[1] { + break + } + if mem != x1.Args[2] { + break + } + if !(x0.Uses == 1 && x1.Uses == 1 && s0.Uses == 1 && mergePoint(b, x0, x1) != nil && clobber(x0) && clobber(x1) && clobber(s0)) { + break + } + b = mergePoint(b, x0, x1) + v0 := b.NewValue0(v.Line, OpAMD64MOVWloadidx1, v.Type) + v.reset(OpCopy) + v.AddArg(v0) + v0.AuxInt = i + v0.Aux = s + v0.AddArg(p) + v0.AddArg(idx) + v0.AddArg(mem) + return true + } + // match: (ORL o0:(ORL o1:(ORL x0:(MOVBloadidx1 [i] {s} p idx mem) s0:(SHLLconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) s1:(SHLLconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) s2:(SHLLconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && mergePoint(b,x0,x1,x2,x3) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(o0) && clobber(o1) // result: @mergePoint(b,x0,x1,x2,x3) (MOVLloadidx1 <v.Type> [i] {s} p idx mem) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64ORL { + o0 := v.Args[0] + if o0.Op != OpAMD64ORL { break } - v_0_0 := v_0.Args[0] - if v_0_0.Op != OpAMD64ORL { + o1 := o0.Args[0] + if o1.Op != OpAMD64ORL { break } - x0 := v_0_0.Args[0] + x0 := o1.Args[0] if x0.Op != OpAMD64MOVBloadidx1 { break } @@ -12675,14 +13199,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { p := x0.Args[0] idx := x0.Args[1] mem := x0.Args[2] - v_0_0_1 := v_0_0.Args[1] - if v_0_0_1.Op != OpAMD64SHLLconst { + s0 := o1.Args[1] + if s0.Op != OpAMD64SHLLconst { break } - if v_0_0_1.AuxInt != 8 { + if s0.AuxInt != 8 { break } - x1 := v_0_0_1.Args[0] + x1 := s0.Args[0] if x1.Op != OpAMD64MOVBloadidx1 { break } @@ -12701,14 +13225,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x1.Args[2] { break } - v_0_1 := v_0.Args[1] - if v_0_1.Op != OpAMD64SHLLconst { + s1 := o0.Args[1] + if s1.Op != OpAMD64SHLLconst { break } - if v_0_1.AuxInt != 16 { + if s1.AuxInt != 16 { break } - x2 := v_0_1.Args[0] + x2 := s1.Args[0] if x2.Op != OpAMD64MOVBloadidx1 { break } @@ -12727,14 +13251,14 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x2.Args[2] { break } - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLLconst { + s2 := v.Args[1] + if s2.Op != OpAMD64SHLLconst { break } - if v_1.AuxInt != 24 { + if s2.AuxInt != 24 { break } - x3 := v_1.Args[0] + x3 := s2.Args[0] if x3.Op != OpAMD64MOVBloadidx1 { break } @@ -12753,7 +13277,7 @@ func rewriteValueAMD64_OpAMD64ORL(v *Value, config *Config) bool { if mem != x3.Args[2] { break } - if !(mergePoint(b, x0, x1, x2, x3) != nil) { + if !(x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && mergePoint(b, x0, x1, x2, x3) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(o0) && clobber(o1)) { break } b = mergePoint(b, x0, x1, x2, x3) @@ -12866,35 +13390,35 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ x0:(MOVBload [i] {s} p mem) (SHLQconst [8] x1:(MOVBload [i+1] {s} p mem))) (SHLQconst [16] x2:(MOVBload [i+2] {s} p mem))) (SHLQconst [24] x3:(MOVBload [i+3] {s} p mem))) (SHLQconst [32] x4:(MOVBload [i+4] {s} p mem))) (SHLQconst [40] x5:(MOVBload [i+5] {s} p mem))) (SHLQconst [48] x6:(MOVBload [i+6] {s} p mem))) (SHLQconst [56] x7:(MOVBload [i+7] {s} p mem))) - // cond: mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil + // match: (ORQ o0:(ORQ o1:(ORQ o2:(ORQ o3:(ORQ o4:(ORQ o5:(ORQ x0:(MOVBload [i] {s} p mem) s0:(SHLQconst [8] x1:(MOVBload [i+1] {s} p mem))) s1:(SHLQconst [16] x2:(MOVBload [i+2] {s} p mem))) s2:(SHLQconst [24] x3:(MOVBload [i+3] {s} p mem))) s3:(SHLQconst [32] x4:(MOVBload [i+4] {s} p mem))) s4:(SHLQconst [40] x5:(MOVBload [i+5] {s} p mem))) s5:(SHLQconst [48] x6:(MOVBload [i+6] {s} p mem))) s6:(SHLQconst [56] x7:(MOVBload [i+7] {s} p mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && x4.Uses == 1 && x5.Uses == 1 && x6.Uses == 1 && x7.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && s3.Uses == 1 && s4.Uses == 1 && s5.Uses == 1 && s6.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && o2.Uses == 1 && o3.Uses == 1 && o4.Uses == 1 && o5.Uses == 1 && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(x4) && clobber(x5) && clobber(x6) && clobber(x7) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(s3) && clobber(s4) && clobber(s5) && clobber(s6) && clobber(o0) && clobber(o1) && clobber(o2) && clobber(o3) && clobber(o4) && clobber(o5) // result: @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQload [i] {s} p mem) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64ORQ { + o0 := v.Args[0] + if o0.Op != OpAMD64ORQ { break } - v_0_0 := v_0.Args[0] - if v_0_0.Op != OpAMD64ORQ { + o1 := o0.Args[0] + if o1.Op != OpAMD64ORQ { break } - v_0_0_0 := v_0_0.Args[0] - if v_0_0_0.Op != OpAMD64ORQ { + o2 := o1.Args[0] + if o2.Op != OpAMD64ORQ { break } - v_0_0_0_0 := v_0_0_0.Args[0] - if v_0_0_0_0.Op != OpAMD64ORQ { + o3 := o2.Args[0] + if o3.Op != OpAMD64ORQ { break } - v_0_0_0_0_0 := v_0_0_0_0.Args[0] - if v_0_0_0_0_0.Op != OpAMD64ORQ { + o4 := o3.Args[0] + if o4.Op != OpAMD64ORQ { break } - v_0_0_0_0_0_0 := v_0_0_0_0_0.Args[0] - if v_0_0_0_0_0_0.Op != OpAMD64ORQ { + o5 := o4.Args[0] + if o5.Op != OpAMD64ORQ { break } - x0 := v_0_0_0_0_0_0.Args[0] + x0 := o5.Args[0] if x0.Op != OpAMD64MOVBload { break } @@ -12902,14 +13426,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { s := x0.Aux p := x0.Args[0] mem := x0.Args[1] - v_0_0_0_0_0_0_1 := v_0_0_0_0_0_0.Args[1] - if v_0_0_0_0_0_0_1.Op != OpAMD64SHLQconst { + s0 := o5.Args[1] + if s0.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_0_0_1.AuxInt != 8 { + if s0.AuxInt != 8 { break } - x1 := v_0_0_0_0_0_0_1.Args[0] + x1 := s0.Args[0] if x1.Op != OpAMD64MOVBload { break } @@ -12925,14 +13449,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x1.Args[1] { break } - v_0_0_0_0_0_1 := v_0_0_0_0_0.Args[1] - if v_0_0_0_0_0_1.Op != OpAMD64SHLQconst { + s1 := o4.Args[1] + if s1.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_0_1.AuxInt != 16 { + if s1.AuxInt != 16 { break } - x2 := v_0_0_0_0_0_1.Args[0] + x2 := s1.Args[0] if x2.Op != OpAMD64MOVBload { break } @@ -12948,14 +13472,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x2.Args[1] { break } - v_0_0_0_0_1 := v_0_0_0_0.Args[1] - if v_0_0_0_0_1.Op != OpAMD64SHLQconst { + s2 := o3.Args[1] + if s2.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_1.AuxInt != 24 { + if s2.AuxInt != 24 { break } - x3 := v_0_0_0_0_1.Args[0] + x3 := s2.Args[0] if x3.Op != OpAMD64MOVBload { break } @@ -12971,14 +13495,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x3.Args[1] { break } - v_0_0_0_1 := v_0_0_0.Args[1] - if v_0_0_0_1.Op != OpAMD64SHLQconst { + s3 := o2.Args[1] + if s3.Op != OpAMD64SHLQconst { break } - if v_0_0_0_1.AuxInt != 32 { + if s3.AuxInt != 32 { break } - x4 := v_0_0_0_1.Args[0] + x4 := s3.Args[0] if x4.Op != OpAMD64MOVBload { break } @@ -12994,14 +13518,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x4.Args[1] { break } - v_0_0_1 := v_0_0.Args[1] - if v_0_0_1.Op != OpAMD64SHLQconst { + s4 := o1.Args[1] + if s4.Op != OpAMD64SHLQconst { break } - if v_0_0_1.AuxInt != 40 { + if s4.AuxInt != 40 { break } - x5 := v_0_0_1.Args[0] + x5 := s4.Args[0] if x5.Op != OpAMD64MOVBload { break } @@ -13017,14 +13541,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x5.Args[1] { break } - v_0_1 := v_0.Args[1] - if v_0_1.Op != OpAMD64SHLQconst { + s5 := o0.Args[1] + if s5.Op != OpAMD64SHLQconst { break } - if v_0_1.AuxInt != 48 { + if s5.AuxInt != 48 { break } - x6 := v_0_1.Args[0] + x6 := s5.Args[0] if x6.Op != OpAMD64MOVBload { break } @@ -13040,14 +13564,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x6.Args[1] { break } - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLQconst { + s6 := v.Args[1] + if s6.Op != OpAMD64SHLQconst { break } - if v_1.AuxInt != 56 { + if s6.AuxInt != 56 { break } - x7 := v_1.Args[0] + x7 := s6.Args[0] if x7.Op != OpAMD64MOVBload { break } @@ -13063,7 +13587,7 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x7.Args[1] { break } - if !(mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) != nil) { + if !(x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && x4.Uses == 1 && x5.Uses == 1 && x6.Uses == 1 && x7.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && s3.Uses == 1 && s4.Uses == 1 && s5.Uses == 1 && s6.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && o2.Uses == 1 && o3.Uses == 1 && o4.Uses == 1 && o5.Uses == 1 && mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(x4) && clobber(x5) && clobber(x6) && clobber(x7) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(s3) && clobber(s4) && clobber(s5) && clobber(s6) && clobber(o0) && clobber(o1) && clobber(o2) && clobber(o3) && clobber(o4) && clobber(o5)) { break } b = mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) @@ -13076,35 +13600,35 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { v0.AddArg(mem) return true } - // match: (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ (ORQ x0:(MOVBloadidx1 [i] {s} p idx mem) (SHLQconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) (SHLQconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) (SHLQconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) (SHLQconst [32] x4:(MOVBloadidx1 [i+4] {s} p idx mem))) (SHLQconst [40] x5:(MOVBloadidx1 [i+5] {s} p idx mem))) (SHLQconst [48] x6:(MOVBloadidx1 [i+6] {s} p idx mem))) (SHLQconst [56] x7:(MOVBloadidx1 [i+7] {s} p idx mem))) - // cond: mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil + // match: (ORQ o0:(ORQ o1:(ORQ o2:(ORQ o3:(ORQ o4:(ORQ o5:(ORQ x0:(MOVBloadidx1 [i] {s} p idx mem) s0:(SHLQconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) s1:(SHLQconst [16] x2:(MOVBloadidx1 [i+2] {s} p idx mem))) s2:(SHLQconst [24] x3:(MOVBloadidx1 [i+3] {s} p idx mem))) s3:(SHLQconst [32] x4:(MOVBloadidx1 [i+4] {s} p idx mem))) s4:(SHLQconst [40] x5:(MOVBloadidx1 [i+5] {s} p idx mem))) s5:(SHLQconst [48] x6:(MOVBloadidx1 [i+6] {s} p idx mem))) s6:(SHLQconst [56] x7:(MOVBloadidx1 [i+7] {s} p idx mem))) + // cond: x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && x4.Uses == 1 && x5.Uses == 1 && x6.Uses == 1 && x7.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && s3.Uses == 1 && s4.Uses == 1 && s5.Uses == 1 && s6.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && o2.Uses == 1 && o3.Uses == 1 && o4.Uses == 1 && o5.Uses == 1 && mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(x4) && clobber(x5) && clobber(x6) && clobber(x7) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(s3) && clobber(s4) && clobber(s5) && clobber(s6) && clobber(o0) && clobber(o1) && clobber(o2) && clobber(o3) && clobber(o4) && clobber(o5) // result: @mergePoint(b,x0,x1,x2,x3,x4,x5,x6,x7) (MOVQloadidx1 <v.Type> [i] {s} p idx mem) for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64ORQ { + o0 := v.Args[0] + if o0.Op != OpAMD64ORQ { break } - v_0_0 := v_0.Args[0] - if v_0_0.Op != OpAMD64ORQ { + o1 := o0.Args[0] + if o1.Op != OpAMD64ORQ { break } - v_0_0_0 := v_0_0.Args[0] - if v_0_0_0.Op != OpAMD64ORQ { + o2 := o1.Args[0] + if o2.Op != OpAMD64ORQ { break } - v_0_0_0_0 := v_0_0_0.Args[0] - if v_0_0_0_0.Op != OpAMD64ORQ { + o3 := o2.Args[0] + if o3.Op != OpAMD64ORQ { break } - v_0_0_0_0_0 := v_0_0_0_0.Args[0] - if v_0_0_0_0_0.Op != OpAMD64ORQ { + o4 := o3.Args[0] + if o4.Op != OpAMD64ORQ { break } - v_0_0_0_0_0_0 := v_0_0_0_0_0.Args[0] - if v_0_0_0_0_0_0.Op != OpAMD64ORQ { + o5 := o4.Args[0] + if o5.Op != OpAMD64ORQ { break } - x0 := v_0_0_0_0_0_0.Args[0] + x0 := o5.Args[0] if x0.Op != OpAMD64MOVBloadidx1 { break } @@ -13113,14 +13637,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { p := x0.Args[0] idx := x0.Args[1] mem := x0.Args[2] - v_0_0_0_0_0_0_1 := v_0_0_0_0_0_0.Args[1] - if v_0_0_0_0_0_0_1.Op != OpAMD64SHLQconst { + s0 := o5.Args[1] + if s0.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_0_0_1.AuxInt != 8 { + if s0.AuxInt != 8 { break } - x1 := v_0_0_0_0_0_0_1.Args[0] + x1 := s0.Args[0] if x1.Op != OpAMD64MOVBloadidx1 { break } @@ -13139,14 +13663,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x1.Args[2] { break } - v_0_0_0_0_0_1 := v_0_0_0_0_0.Args[1] - if v_0_0_0_0_0_1.Op != OpAMD64SHLQconst { + s1 := o4.Args[1] + if s1.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_0_1.AuxInt != 16 { + if s1.AuxInt != 16 { break } - x2 := v_0_0_0_0_0_1.Args[0] + x2 := s1.Args[0] if x2.Op != OpAMD64MOVBloadidx1 { break } @@ -13165,14 +13689,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x2.Args[2] { break } - v_0_0_0_0_1 := v_0_0_0_0.Args[1] - if v_0_0_0_0_1.Op != OpAMD64SHLQconst { + s2 := o3.Args[1] + if s2.Op != OpAMD64SHLQconst { break } - if v_0_0_0_0_1.AuxInt != 24 { + if s2.AuxInt != 24 { break } - x3 := v_0_0_0_0_1.Args[0] + x3 := s2.Args[0] if x3.Op != OpAMD64MOVBloadidx1 { break } @@ -13191,14 +13715,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x3.Args[2] { break } - v_0_0_0_1 := v_0_0_0.Args[1] - if v_0_0_0_1.Op != OpAMD64SHLQconst { + s3 := o2.Args[1] + if s3.Op != OpAMD64SHLQconst { break } - if v_0_0_0_1.AuxInt != 32 { + if s3.AuxInt != 32 { break } - x4 := v_0_0_0_1.Args[0] + x4 := s3.Args[0] if x4.Op != OpAMD64MOVBloadidx1 { break } @@ -13217,14 +13741,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x4.Args[2] { break } - v_0_0_1 := v_0_0.Args[1] - if v_0_0_1.Op != OpAMD64SHLQconst { + s4 := o1.Args[1] + if s4.Op != OpAMD64SHLQconst { break } - if v_0_0_1.AuxInt != 40 { + if s4.AuxInt != 40 { break } - x5 := v_0_0_1.Args[0] + x5 := s4.Args[0] if x5.Op != OpAMD64MOVBloadidx1 { break } @@ -13243,14 +13767,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x5.Args[2] { break } - v_0_1 := v_0.Args[1] - if v_0_1.Op != OpAMD64SHLQconst { + s5 := o0.Args[1] + if s5.Op != OpAMD64SHLQconst { break } - if v_0_1.AuxInt != 48 { + if s5.AuxInt != 48 { break } - x6 := v_0_1.Args[0] + x6 := s5.Args[0] if x6.Op != OpAMD64MOVBloadidx1 { break } @@ -13269,14 +13793,14 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x6.Args[2] { break } - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLQconst { + s6 := v.Args[1] + if s6.Op != OpAMD64SHLQconst { break } - if v_1.AuxInt != 56 { + if s6.AuxInt != 56 { break } - x7 := v_1.Args[0] + x7 := s6.Args[0] if x7.Op != OpAMD64MOVBloadidx1 { break } @@ -13295,7 +13819,7 @@ func rewriteValueAMD64_OpAMD64ORQ(v *Value, config *Config) bool { if mem != x7.Args[2] { break } - if !(mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) != nil) { + if !(x0.Uses == 1 && x1.Uses == 1 && x2.Uses == 1 && x3.Uses == 1 && x4.Uses == 1 && x5.Uses == 1 && x6.Uses == 1 && x7.Uses == 1 && s0.Uses == 1 && s1.Uses == 1 && s2.Uses == 1 && s3.Uses == 1 && s4.Uses == 1 && s5.Uses == 1 && s6.Uses == 1 && o0.Uses == 1 && o1.Uses == 1 && o2.Uses == 1 && o3.Uses == 1 && o4.Uses == 1 && o5.Uses == 1 && mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) != nil && clobber(x0) && clobber(x1) && clobber(x2) && clobber(x3) && clobber(x4) && clobber(x5) && clobber(x6) && clobber(x7) && clobber(s0) && clobber(s1) && clobber(s2) && clobber(s3) && clobber(s4) && clobber(s5) && clobber(s6) && clobber(o0) && clobber(o1) && clobber(o2) && clobber(o3) && clobber(o4) && clobber(o5)) { break } b = mergePoint(b, x0, x1, x2, x3, x4, x5, x6, x7) @@ -13354,200 +13878,6 @@ func rewriteValueAMD64_OpAMD64ORQconst(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64ORW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ORW x (MOVWconst [c])) - // cond: - // result: (ORWconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64ORWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ORW (MOVWconst [c]) x) - // cond: - // result: (ORWconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64ORWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (ORW x x) - // cond: - // result: x - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ORW x0:(MOVBload [i] {s} p mem) (SHLWconst [8] x1:(MOVBload [i+1] {s} p mem))) - // cond: mergePoint(b,x0,x1) != nil - // result: @mergePoint(b,x0,x1) (MOVWload [i] {s} p mem) - for { - x0 := v.Args[0] - if x0.Op != OpAMD64MOVBload { - break - } - i := x0.AuxInt - s := x0.Aux - p := x0.Args[0] - mem := x0.Args[1] - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLWconst { - break - } - if v_1.AuxInt != 8 { - break - } - x1 := v_1.Args[0] - if x1.Op != OpAMD64MOVBload { - break - } - if x1.AuxInt != i+1 { - break - } - if x1.Aux != s { - break - } - if p != x1.Args[0] { - break - } - if mem != x1.Args[1] { - break - } - if !(mergePoint(b, x0, x1) != nil) { - break - } - b = mergePoint(b, x0, x1) - v0 := b.NewValue0(v.Line, OpAMD64MOVWload, config.fe.TypeUInt16()) - v.reset(OpCopy) - v.AddArg(v0) - v0.AuxInt = i - v0.Aux = s - v0.AddArg(p) - v0.AddArg(mem) - return true - } - // match: (ORW x0:(MOVBloadidx1 [i] {s} p idx mem) (SHLWconst [8] x1:(MOVBloadidx1 [i+1] {s} p idx mem))) - // cond: mergePoint(b,x0,x1) != nil - // result: @mergePoint(b,x0,x1) (MOVWloadidx1 <v.Type> [i] {s} p idx mem) - for { - x0 := v.Args[0] - if x0.Op != OpAMD64MOVBloadidx1 { - break - } - i := x0.AuxInt - s := x0.Aux - p := x0.Args[0] - idx := x0.Args[1] - mem := x0.Args[2] - v_1 := v.Args[1] - if v_1.Op != OpAMD64SHLWconst { - break - } - if v_1.AuxInt != 8 { - break - } - x1 := v_1.Args[0] - if x1.Op != OpAMD64MOVBloadidx1 { - break - } - if x1.AuxInt != i+1 { - break - } - if x1.Aux != s { - break - } - if p != x1.Args[0] { - break - } - if idx != x1.Args[1] { - break - } - if mem != x1.Args[2] { - break - } - if !(mergePoint(b, x0, x1) != nil) { - break - } - b = mergePoint(b, x0, x1) - v0 := b.NewValue0(v.Line, OpAMD64MOVWloadidx1, v.Type) - v.reset(OpCopy) - v.AddArg(v0) - v0.AuxInt = i - v0.Aux = s - v0.AddArg(p) - v0.AddArg(idx) - v0.AddArg(mem) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64ORWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (ORWconst [c] x) - // cond: int16(c)==0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int16(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (ORWconst [c] _) - // cond: int16(c)==-1 - // result: (MOVWconst [-1]) - for { - c := v.AuxInt - if !(int16(c) == -1) { - break - } - v.reset(OpAMD64MOVWconst) - v.AuxInt = -1 - return true - } - // match: (ORWconst [c] (MOVWconst [d])) - // cond: - // result: (MOVWconst [c|d]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = c | d - return true - } - return false -} func rewriteValueAMD64_OpOffPtr(v *Value, config *Config) bool { b := v.Block _ = b @@ -13585,11 +13915,11 @@ func rewriteValueAMD64_OpOr16(v *Value, config *Config) bool { _ = b // match: (Or16 x y) // cond: - // result: (ORW x y) + // result: (ORL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ORW) + v.reset(OpAMD64ORL) v.AddArg(x) v.AddArg(y) return true @@ -13633,11 +13963,27 @@ func rewriteValueAMD64_OpOr8(v *Value, config *Config) bool { _ = b // match: (Or8 x y) // cond: - // result: (ORB x y) + // result: (ORL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ORB) + v.reset(OpAMD64ORL) + v.AddArg(x) + v.AddArg(y) + return true + } + return false +} +func rewriteValueAMD64_OpOrB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (OrB x y) + // cond: + // result: (ORL x y) + for { + x := v.Args[0] + y := v.Args[1] + v.reset(OpAMD64ORL) v.AddArg(x) v.AddArg(y) return true @@ -13649,12 +13995,12 @@ func rewriteValueAMD64_OpRsh16Ux16(v *Value, config *Config) bool { _ = b // match: (Rsh16Ux16 <t> x y) // cond: - // result: (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) + // result: (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPWconst y [16]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRW, t) v0.AddArg(x) v0.AddArg(y) @@ -13674,12 +14020,12 @@ func rewriteValueAMD64_OpRsh16Ux32(v *Value, config *Config) bool { _ = b // match: (Rsh16Ux32 <t> x y) // cond: - // result: (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) + // result: (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPLconst y [16]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRW, t) v0.AddArg(x) v0.AddArg(y) @@ -13699,12 +14045,12 @@ func rewriteValueAMD64_OpRsh16Ux64(v *Value, config *Config) bool { _ = b // match: (Rsh16Ux64 <t> x y) // cond: - // result: (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) + // result: (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPQconst y [16]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRW, t) v0.AddArg(x) v0.AddArg(y) @@ -13724,12 +14070,12 @@ func rewriteValueAMD64_OpRsh16Ux8(v *Value, config *Config) bool { _ = b // match: (Rsh16Ux8 <t> x y) // cond: - // result: (ANDW (SHRW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) + // result: (ANDL (SHRW <t> x y) (SBBLcarrymask <t> (CMPBconst y [16]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDW) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRW, t) v0.AddArg(x) v0.AddArg(y) @@ -13749,7 +14095,7 @@ func rewriteValueAMD64_OpRsh16x16(v *Value, config *Config) bool { _ = b // match: (Rsh16x16 <t> x y) // cond: - // result: (SARW <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [16]))))) + // result: (SARW <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [16]))))) for { t := v.Type x := v.Args[0] @@ -13757,7 +14103,7 @@ func rewriteValueAMD64_OpRsh16x16(v *Value, config *Config) bool { v.reset(OpAMD64SARW) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORW, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -13833,7 +14179,7 @@ func rewriteValueAMD64_OpRsh16x8(v *Value, config *Config) bool { _ = b // match: (Rsh16x8 <t> x y) // cond: - // result: (SARW <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [16]))))) + // result: (SARW <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [16]))))) for { t := v.Type x := v.Args[0] @@ -13841,7 +14187,7 @@ func rewriteValueAMD64_OpRsh16x8(v *Value, config *Config) bool { v.reset(OpAMD64SARW) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORB, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -13961,7 +14307,7 @@ func rewriteValueAMD64_OpRsh32x16(v *Value, config *Config) bool { _ = b // match: (Rsh32x16 <t> x y) // cond: - // result: (SARL <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [32]))))) + // result: (SARL <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [32]))))) for { t := v.Type x := v.Args[0] @@ -13969,7 +14315,7 @@ func rewriteValueAMD64_OpRsh32x16(v *Value, config *Config) bool { v.reset(OpAMD64SARL) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORW, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14045,7 +14391,7 @@ func rewriteValueAMD64_OpRsh32x8(v *Value, config *Config) bool { _ = b // match: (Rsh32x8 <t> x y) // cond: - // result: (SARL <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [32]))))) + // result: (SARL <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [32]))))) for { t := v.Type x := v.Args[0] @@ -14053,7 +14399,7 @@ func rewriteValueAMD64_OpRsh32x8(v *Value, config *Config) bool { v.reset(OpAMD64SARL) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORB, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14173,7 +14519,7 @@ func rewriteValueAMD64_OpRsh64x16(v *Value, config *Config) bool { _ = b // match: (Rsh64x16 <t> x y) // cond: - // result: (SARQ <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [64]))))) + // result: (SARQ <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [64]))))) for { t := v.Type x := v.Args[0] @@ -14181,7 +14527,7 @@ func rewriteValueAMD64_OpRsh64x16(v *Value, config *Config) bool { v.reset(OpAMD64SARQ) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORW, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14257,7 +14603,7 @@ func rewriteValueAMD64_OpRsh64x8(v *Value, config *Config) bool { _ = b // match: (Rsh64x8 <t> x y) // cond: - // result: (SARQ <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [64]))))) + // result: (SARQ <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [64]))))) for { t := v.Type x := v.Args[0] @@ -14265,7 +14611,7 @@ func rewriteValueAMD64_OpRsh64x8(v *Value, config *Config) bool { v.reset(OpAMD64SARQ) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORB, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14285,12 +14631,12 @@ func rewriteValueAMD64_OpRsh8Ux16(v *Value, config *Config) bool { _ = b // match: (Rsh8Ux16 <t> x y) // cond: - // result: (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) + // result: (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPWconst y [8]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRB, t) v0.AddArg(x) v0.AddArg(y) @@ -14310,12 +14656,12 @@ func rewriteValueAMD64_OpRsh8Ux32(v *Value, config *Config) bool { _ = b // match: (Rsh8Ux32 <t> x y) // cond: - // result: (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) + // result: (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPLconst y [8]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRB, t) v0.AddArg(x) v0.AddArg(y) @@ -14335,12 +14681,12 @@ func rewriteValueAMD64_OpRsh8Ux64(v *Value, config *Config) bool { _ = b // match: (Rsh8Ux64 <t> x y) // cond: - // result: (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) + // result: (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPQconst y [8]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRB, t) v0.AddArg(x) v0.AddArg(y) @@ -14360,12 +14706,12 @@ func rewriteValueAMD64_OpRsh8Ux8(v *Value, config *Config) bool { _ = b // match: (Rsh8Ux8 <t> x y) // cond: - // result: (ANDB (SHRB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) + // result: (ANDL (SHRB <t> x y) (SBBLcarrymask <t> (CMPBconst y [8]))) for { t := v.Type x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64ANDB) + v.reset(OpAMD64ANDL) v0 := b.NewValue0(v.Line, OpAMD64SHRB, t) v0.AddArg(x) v0.AddArg(y) @@ -14385,7 +14731,7 @@ func rewriteValueAMD64_OpRsh8x16(v *Value, config *Config) bool { _ = b // match: (Rsh8x16 <t> x y) // cond: - // result: (SARB <t> x (ORW <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [8]))))) + // result: (SARB <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPWconst y [8]))))) for { t := v.Type x := v.Args[0] @@ -14393,7 +14739,7 @@ func rewriteValueAMD64_OpRsh8x16(v *Value, config *Config) bool { v.reset(OpAMD64SARB) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORW, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14469,7 +14815,7 @@ func rewriteValueAMD64_OpRsh8x8(v *Value, config *Config) bool { _ = b // match: (Rsh8x8 <t> x y) // cond: - // result: (SARB <t> x (ORB <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [8]))))) + // result: (SARB <t> x (ORL <y.Type> y (NOTL <y.Type> (SBBLcarrymask <y.Type> (CMPBconst y [8]))))) for { t := v.Type x := v.Args[0] @@ -14477,7 +14823,7 @@ func rewriteValueAMD64_OpRsh8x8(v *Value, config *Config) bool { v.reset(OpAMD64SARB) v.Type = t v.AddArg(x) - v0 := b.NewValue0(v.Line, OpAMD64ORB, y.Type) + v0 := b.NewValue0(v.Line, OpAMD64ORL, y.Type) v0.AddArg(y) v1 := b.NewValue0(v.Line, OpAMD64NOTL, y.Type) v2 := b.NewValue0(v.Line, OpAMD64SBBLcarrymask, y.Type) @@ -14525,54 +14871,6 @@ func rewriteValueAMD64_OpAMD64SARB(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SARB x (MOVWconst [c])) - // cond: - // result: (SARBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SARB x (MOVBconst [c])) - // cond: - // result: (SARBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SARB x (ANDBconst [31] y)) - // cond: - // result: (SARB x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDBconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SARB) - v.AddArg(x) - v.AddArg(y) - return true - } return false } func rewriteValueAMD64_OpAMD64SARBconst(v *Value, config *Config) bool { @@ -14627,36 +14925,6 @@ func rewriteValueAMD64_OpAMD64SARL(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SARL x (MOVWconst [c])) - // cond: - // result: (SARLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SARL x (MOVBconst [c])) - // cond: - // result: (SARLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } // match: (SARL x (ANDLconst [31] y)) // cond: // result: (SARL x y) @@ -14729,36 +14997,6 @@ func rewriteValueAMD64_OpAMD64SARQ(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SARQ x (MOVWconst [c])) - // cond: - // result: (SARQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } - // match: (SARQ x (MOVBconst [c])) - // cond: - // result: (SARQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } // match: (SARQ x (ANDQconst [63] y)) // cond: // result: (SARQ x y) @@ -14831,54 +15069,6 @@ func rewriteValueAMD64_OpAMD64SARW(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SARW x (MOVWconst [c])) - // cond: - // result: (SARWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SARW x (MOVBconst [c])) - // cond: - // result: (SARWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SARWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SARW x (ANDWconst [31] y)) - // cond: - // result: (SARW x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDWconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SARW) - v.AddArg(x) - v.AddArg(y) - return true - } return false } func rewriteValueAMD64_OpAMD64SARWconst(v *Value, config *Config) bool { @@ -15048,61 +15238,61 @@ func rewriteValueAMD64_OpAMD64SETA(v *Value, config *Config) bool { } // match: (SETA (FlagEQ)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETA (FlagLT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETA (FlagLT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETA (FlagGT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETA (FlagGT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } @@ -15126,61 +15316,61 @@ func rewriteValueAMD64_OpAMD64SETAE(v *Value, config *Config) bool { } // match: (SETAE (FlagEQ)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETAE (FlagLT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETAE (FlagLT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETAE (FlagGT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETAE (FlagGT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } @@ -15204,61 +15394,61 @@ func rewriteValueAMD64_OpAMD64SETB(v *Value, config *Config) bool { } // match: (SETB (FlagEQ)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETB (FlagLT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETB (FlagLT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETB (FlagGT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETB (FlagGT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } @@ -15282,61 +15472,61 @@ func rewriteValueAMD64_OpAMD64SETBE(v *Value, config *Config) bool { } // match: (SETBE (FlagEQ)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETBE (FlagLT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETBE (FlagLT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETBE (FlagGT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETBE (FlagGT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } @@ -15360,61 +15550,61 @@ func rewriteValueAMD64_OpAMD64SETEQ(v *Value, config *Config) bool { } // match: (SETEQ (FlagEQ)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETEQ (FlagLT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETEQ (FlagLT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETEQ (FlagGT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETEQ (FlagGT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } @@ -15438,61 +15628,61 @@ func rewriteValueAMD64_OpAMD64SETG(v *Value, config *Config) bool { } // match: (SETG (FlagEQ)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETG (FlagLT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETG (FlagLT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETG (FlagGT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETG (FlagGT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } @@ -15516,61 +15706,61 @@ func rewriteValueAMD64_OpAMD64SETGE(v *Value, config *Config) bool { } // match: (SETGE (FlagEQ)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETGE (FlagLT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETGE (FlagLT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETGE (FlagGT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETGE (FlagGT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } @@ -15594,61 +15784,61 @@ func rewriteValueAMD64_OpAMD64SETL(v *Value, config *Config) bool { } // match: (SETL (FlagEQ)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETL (FlagLT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETL (FlagLT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETL (FlagGT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETL (FlagGT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } @@ -15672,61 +15862,61 @@ func rewriteValueAMD64_OpAMD64SETLE(v *Value, config *Config) bool { } // match: (SETLE (FlagEQ)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETLE (FlagLT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETLE (FlagLT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETLE (FlagGT_ULT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETLE (FlagGT_UGT)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } @@ -15750,149 +15940,66 @@ func rewriteValueAMD64_OpAMD64SETNE(v *Value, config *Config) bool { } // match: (SETNE (FlagEQ)) // cond: - // result: (MOVBconst [0]) + // result: (MOVLconst [0]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagEQ { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 0 return true } // match: (SETNE (FlagLT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETNE (FlagLT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagLT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETNE (FlagGT_ULT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_ULT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } // match: (SETNE (FlagGT_UGT)) // cond: - // result: (MOVBconst [1]) + // result: (MOVLconst [1]) for { v_0 := v.Args[0] if v_0.Op != OpAMD64FlagGT_UGT { break } - v.reset(OpAMD64MOVBconst) + v.reset(OpAMD64MOVLconst) v.AuxInt = 1 return true } return false } -func rewriteValueAMD64_OpAMD64SHLB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SHLB x (MOVQconst [c])) - // cond: - // result: (SHLBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVQconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLB x (MOVLconst [c])) - // cond: - // result: (SHLBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVLconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLB x (MOVWconst [c])) - // cond: - // result: (SHLBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLB x (MOVBconst [c])) - // cond: - // result: (SHLBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLB x (ANDBconst [31] y)) - // cond: - // result: (SHLB x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDBconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SHLB) - v.AddArg(x) - v.AddArg(y) - return true - } - return false -} func rewriteValueAMD64_OpAMD64SHLL(v *Value, config *Config) bool { b := v.Block _ = b @@ -15926,36 +16033,6 @@ func rewriteValueAMD64_OpAMD64SHLL(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHLL x (MOVWconst [c])) - // cond: - // result: (SHLLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLL x (MOVBconst [c])) - // cond: - // result: (SHLLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } // match: (SHLL x (ANDLconst [31] y)) // cond: // result: (SHLL x y) @@ -16009,36 +16086,6 @@ func rewriteValueAMD64_OpAMD64SHLQ(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHLQ x (MOVWconst [c])) - // cond: - // result: (SHLQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } - // match: (SHLQ x (MOVBconst [c])) - // cond: - // result: (SHLQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } // match: (SHLQ x (ANDQconst [63] y)) // cond: // result: (SHLQ x y) @@ -16059,89 +16106,6 @@ func rewriteValueAMD64_OpAMD64SHLQ(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64SHLW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SHLW x (MOVQconst [c])) - // cond: - // result: (SHLWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVQconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLW x (MOVLconst [c])) - // cond: - // result: (SHLWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVLconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLW x (MOVWconst [c])) - // cond: - // result: (SHLWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLW x (MOVBconst [c])) - // cond: - // result: (SHLWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHLWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHLW x (ANDWconst [31] y)) - // cond: - // result: (SHLW x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDWconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SHLW) - v.AddArg(x) - v.AddArg(y) - return true - } - return false -} func rewriteValueAMD64_OpAMD64SHRB(v *Value, config *Config) bool { b := v.Block _ = b @@ -16175,54 +16139,6 @@ func rewriteValueAMD64_OpAMD64SHRB(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHRB x (MOVWconst [c])) - // cond: - // result: (SHRBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHRB x (MOVBconst [c])) - // cond: - // result: (SHRBconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRBconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHRB x (ANDBconst [31] y)) - // cond: - // result: (SHRB x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDBconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SHRB) - v.AddArg(x) - v.AddArg(y) - return true - } return false } func rewriteValueAMD64_OpAMD64SHRL(v *Value, config *Config) bool { @@ -16258,36 +16174,6 @@ func rewriteValueAMD64_OpAMD64SHRL(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHRL x (MOVWconst [c])) - // cond: - // result: (SHRLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHRL x (MOVBconst [c])) - // cond: - // result: (SHRLconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRLconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } // match: (SHRL x (ANDLconst [31] y)) // cond: // result: (SHRL x y) @@ -16341,36 +16227,6 @@ func rewriteValueAMD64_OpAMD64SHRQ(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHRQ x (MOVWconst [c])) - // cond: - // result: (SHRQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } - // match: (SHRQ x (MOVBconst [c])) - // cond: - // result: (SHRQconst [c&63] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRQconst) - v.AuxInt = c & 63 - v.AddArg(x) - return true - } // match: (SHRQ x (ANDQconst [63] y)) // cond: // result: (SHRQ x y) @@ -16424,152 +16280,6 @@ func rewriteValueAMD64_OpAMD64SHRW(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (SHRW x (MOVWconst [c])) - // cond: - // result: (SHRWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHRW x (MOVBconst [c])) - // cond: - // result: (SHRWconst [c&31] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SHRWconst) - v.AuxInt = c & 31 - v.AddArg(x) - return true - } - // match: (SHRW x (ANDWconst [31] y)) - // cond: - // result: (SHRW x y) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64ANDWconst { - break - } - if v_1.AuxInt != 31 { - break - } - y := v_1.Args[0] - v.reset(OpAMD64SHRW) - v.AddArg(x) - v.AddArg(y) - return true - } - return false -} -func rewriteValueAMD64_OpAMD64SUBB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SUBB x (MOVBconst [c])) - // cond: - // result: (SUBBconst x [c]) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SUBBconst) - v.AddArg(x) - v.AuxInt = c - return true - } - // match: (SUBB (MOVBconst [c]) x) - // cond: - // result: (NEGB (SUBBconst <v.Type> x [c])) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64NEGB) - v0 := b.NewValue0(v.Line, OpAMD64SUBBconst, v.Type) - v0.AddArg(x) - v0.AuxInt = c - v.AddArg(v0) - return true - } - // match: (SUBB x x) - // cond: - // result: (MOVBconst [0]) - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpAMD64MOVBconst) - v.AuxInt = 0 - return true - } - return false -} -func rewriteValueAMD64_OpAMD64SUBBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SUBBconst [c] x) - // cond: int8(c) == 0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int8(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (SUBBconst (MOVBconst [d]) [c]) - // cond: - // result: (MOVBconst [int64(int8(d-c))]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - d := v_0.AuxInt - c := v.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = int64(int8(d - c)) - return true - } - // match: (SUBBconst (SUBBconst x [d]) [c]) - // cond: - // result: (ADDBconst [int64(int8(-c-d))] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64SUBBconst { - break - } - x := v_0.Args[0] - d := v_0.AuxInt - c := v.AuxInt - v.reset(OpAMD64ADDBconst) - v.AuxInt = int64(int8(-c - d)) - v.AddArg(x) - return true - } return false } func rewriteValueAMD64_OpAMD64SUBL(v *Value, config *Config) bool { @@ -16638,6 +16348,17 @@ func rewriteValueAMD64_OpAMD64SUBLconst(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (SUBLconst [c] x) + // cond: + // result: (ADDLconst [int64(int32(-c))] x) + for { + c := v.AuxInt + x := v.Args[0] + v.reset(OpAMD64ADDLconst) + v.AuxInt = int64(int32(-c)) + v.AddArg(x) + return true + } // match: (SUBLconst (MOVLconst [d]) [c]) // cond: // result: (MOVLconst [int64(int32(d-c))]) @@ -16741,6 +16462,20 @@ func rewriteValueAMD64_OpAMD64SUBQconst(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (SUBQconst [c] x) + // cond: c != -(1<<31) + // result: (ADDQconst [-c] x) + for { + c := v.AuxInt + x := v.Args[0] + if !(c != -(1 << 31)) { + break + } + v.reset(OpAMD64ADDQconst) + v.AuxInt = -c + v.AddArg(x) + return true + } // match: (SUBQconst (MOVQconst [d]) [c]) // cond: // result: (MOVQconst [d-c]) @@ -16776,104 +16511,6 @@ func rewriteValueAMD64_OpAMD64SUBQconst(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64SUBW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SUBW x (MOVWconst [c])) - // cond: - // result: (SUBWconst x [c]) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64SUBWconst) - v.AddArg(x) - v.AuxInt = c - return true - } - // match: (SUBW (MOVWconst [c]) x) - // cond: - // result: (NEGW (SUBWconst <v.Type> x [c])) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64NEGW) - v0 := b.NewValue0(v.Line, OpAMD64SUBWconst, v.Type) - v0.AddArg(x) - v0.AuxInt = c - v.AddArg(v0) - return true - } - // match: (SUBW x x) - // cond: - // result: (MOVWconst [0]) - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpAMD64MOVWconst) - v.AuxInt = 0 - return true - } - return false -} -func rewriteValueAMD64_OpAMD64SUBWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (SUBWconst [c] x) - // cond: int16(c) == 0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int16(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (SUBWconst (MOVWconst [d]) [c]) - // cond: - // result: (MOVWconst [int64(int16(d-c))]) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - d := v_0.AuxInt - c := v.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = int64(int16(d - c)) - return true - } - // match: (SUBWconst (SUBWconst x [d]) [c]) - // cond: - // result: (ADDWconst [int64(int16(-c-d))] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64SUBWconst { - break - } - x := v_0.Args[0] - d := v_0.AuxInt - c := v.AuxInt - v.reset(OpAMD64ADDWconst) - v.AuxInt = int64(int16(-c - d)) - v.AddArg(x) - return true - } - return false -} func rewriteValueAMD64_OpSignExt16to32(v *Value, config *Config) bool { b := v.Block _ = b @@ -17102,11 +16739,11 @@ func rewriteValueAMD64_OpSub16(v *Value, config *Config) bool { _ = b // match: (Sub16 x y) // cond: - // result: (SUBW x y) + // result: (SUBL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64SUBW) + v.reset(OpAMD64SUBL) v.AddArg(x) v.AddArg(y) return true @@ -17182,11 +16819,11 @@ func rewriteValueAMD64_OpSub8(v *Value, config *Config) bool { _ = b // match: (Sub8 x y) // cond: - // result: (SUBB x y) + // result: (SUBL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64SUBB) + v.reset(OpAMD64SUBL) v.AddArg(x) v.AddArg(y) return true @@ -17299,86 +16936,6 @@ func rewriteValueAMD64_OpTrunc64to8(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64XORB(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (XORB x (MOVBconst [c])) - // cond: - // result: (XORBconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVBconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64XORBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (XORB (MOVBconst [c]) x) - // cond: - // result: (XORBconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64XORBconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (XORB x x) - // cond: - // result: (MOVBconst [0]) - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpAMD64MOVBconst) - v.AuxInt = 0 - return true - } - return false -} -func rewriteValueAMD64_OpAMD64XORBconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (XORBconst [c] x) - // cond: int8(c)==0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int8(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (XORBconst [c] (MOVBconst [d])) - // cond: - // result: (MOVBconst [c^d]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVBconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVBconst) - v.AuxInt = c ^ d - return true - } - return false -} func rewriteValueAMD64_OpAMD64XORL(v *Value, config *Config) bool { b := v.Block _ = b @@ -17544,96 +17101,16 @@ func rewriteValueAMD64_OpAMD64XORQconst(v *Value, config *Config) bool { } return false } -func rewriteValueAMD64_OpAMD64XORW(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (XORW x (MOVWconst [c])) - // cond: - // result: (XORWconst [c] x) - for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpAMD64MOVWconst { - break - } - c := v_1.AuxInt - v.reset(OpAMD64XORWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (XORW (MOVWconst [c]) x) - // cond: - // result: (XORWconst [c] x) - for { - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - c := v_0.AuxInt - x := v.Args[1] - v.reset(OpAMD64XORWconst) - v.AuxInt = c - v.AddArg(x) - return true - } - // match: (XORW x x) - // cond: - // result: (MOVWconst [0]) - for { - x := v.Args[0] - if x != v.Args[1] { - break - } - v.reset(OpAMD64MOVWconst) - v.AuxInt = 0 - return true - } - return false -} -func rewriteValueAMD64_OpAMD64XORWconst(v *Value, config *Config) bool { - b := v.Block - _ = b - // match: (XORWconst [c] x) - // cond: int16(c)==0 - // result: x - for { - c := v.AuxInt - x := v.Args[0] - if !(int16(c) == 0) { - break - } - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (XORWconst [c] (MOVWconst [d])) - // cond: - // result: (MOVWconst [c^d]) - for { - c := v.AuxInt - v_0 := v.Args[0] - if v_0.Op != OpAMD64MOVWconst { - break - } - d := v_0.AuxInt - v.reset(OpAMD64MOVWconst) - v.AuxInt = c ^ d - return true - } - return false -} func rewriteValueAMD64_OpXor16(v *Value, config *Config) bool { b := v.Block _ = b // match: (Xor16 x y) // cond: - // result: (XORW x y) + // result: (XORL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64XORW) + v.reset(OpAMD64XORL) v.AddArg(x) v.AddArg(y) return true @@ -17677,11 +17154,11 @@ func rewriteValueAMD64_OpXor8(v *Value, config *Config) bool { _ = b // match: (Xor8 x y) // cond: - // result: (XORB x y) + // result: (XORL x y) for { x := v.Args[0] y := v.Args[1] - v.reset(OpAMD64XORB) + v.reset(OpAMD64XORL) v.AddArg(x) v.AddArg(y) return true @@ -18849,7 +18326,7 @@ func rewriteBlockAMD64(b *Block) bool { return true } case BlockAMD64NE: - // match: (NE (TESTB (SETL cmp)) yes no) + // match: (NE (TESTB (SETL cmp) (SETL cmp)) yes no) // cond: // result: (LT cmp yes no) for { @@ -18862,6 +18339,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETL { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64LT @@ -18870,7 +18354,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETLE cmp)) yes no) + // match: (NE (TESTB (SETLE cmp) (SETLE cmp)) yes no) // cond: // result: (LE cmp yes no) for { @@ -18883,6 +18367,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETLE { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64LE @@ -18891,7 +18382,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETG cmp)) yes no) + // match: (NE (TESTB (SETG cmp) (SETG cmp)) yes no) // cond: // result: (GT cmp yes no) for { @@ -18904,6 +18395,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETG { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64GT @@ -18912,7 +18410,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETGE cmp)) yes no) + // match: (NE (TESTB (SETGE cmp) (SETGE cmp)) yes no) // cond: // result: (GE cmp yes no) for { @@ -18925,6 +18423,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETGE { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64GE @@ -18933,7 +18438,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETEQ cmp)) yes no) + // match: (NE (TESTB (SETEQ cmp) (SETEQ cmp)) yes no) // cond: // result: (EQ cmp yes no) for { @@ -18946,6 +18451,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETEQ { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64EQ @@ -18954,7 +18466,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETNE cmp)) yes no) + // match: (NE (TESTB (SETNE cmp) (SETNE cmp)) yes no) // cond: // result: (NE cmp yes no) for { @@ -18967,6 +18479,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETNE { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64NE @@ -18975,7 +18494,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETB cmp)) yes no) + // match: (NE (TESTB (SETB cmp) (SETB cmp)) yes no) // cond: // result: (ULT cmp yes no) for { @@ -18988,6 +18507,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETB { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64ULT @@ -18996,7 +18522,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETBE cmp)) yes no) + // match: (NE (TESTB (SETBE cmp) (SETBE cmp)) yes no) // cond: // result: (ULE cmp yes no) for { @@ -19009,6 +18535,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETBE { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64ULE @@ -19017,7 +18550,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETA cmp)) yes no) + // match: (NE (TESTB (SETA cmp) (SETA cmp)) yes no) // cond: // result: (UGT cmp yes no) for { @@ -19030,6 +18563,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETA { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64UGT @@ -19038,7 +18578,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETAE cmp)) yes no) + // match: (NE (TESTB (SETAE cmp) (SETAE cmp)) yes no) // cond: // result: (UGE cmp yes no) for { @@ -19051,6 +18591,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETAE { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64UGE @@ -19059,7 +18606,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETGF cmp)) yes no) + // match: (NE (TESTB (SETGF cmp) (SETGF cmp)) yes no) // cond: // result: (UGT cmp yes no) for { @@ -19072,6 +18619,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETGF { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64UGT @@ -19080,7 +18634,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETGEF cmp)) yes no) + // match: (NE (TESTB (SETGEF cmp) (SETGEF cmp)) yes no) // cond: // result: (UGE cmp yes no) for { @@ -19093,6 +18647,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETGEF { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64UGE @@ -19101,7 +18662,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETEQF cmp)) yes no) + // match: (NE (TESTB (SETEQF cmp) (SETEQF cmp)) yes no) // cond: // result: (EQF cmp yes no) for { @@ -19114,6 +18675,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETEQF { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64EQF @@ -19122,7 +18690,7 @@ func rewriteBlockAMD64(b *Block) bool { b.Succs[1] = no return true } - // match: (NE (TESTB (SETNEF cmp)) yes no) + // match: (NE (TESTB (SETNEF cmp) (SETNEF cmp)) yes no) // cond: // result: (NEF cmp yes no) for { @@ -19135,6 +18703,13 @@ func rewriteBlockAMD64(b *Block) bool { break } cmp := v_0.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAMD64SETNEF { + break + } + if cmp != v_1.Args[0] { + break + } yes := b.Succs[0] no := b.Succs[1] b.Kind = BlockAMD64NEF diff --git a/src/cmd/compile/internal/ssa/rewritegeneric.go b/src/cmd/compile/internal/ssa/rewritegeneric.go index 932cb42235..43e87c3bf6 100644 --- a/src/cmd/compile/internal/ssa/rewritegeneric.go +++ b/src/cmd/compile/internal/ssa/rewritegeneric.go @@ -66,6 +66,8 @@ func rewriteValuegeneric(v *Value, config *Config) bool { return rewriteValuegeneric_OpEq64(v, config) case OpEq8: return rewriteValuegeneric_OpEq8(v, config) + case OpEqB: + return rewriteValuegeneric_OpEqB(v, config) case OpEqInter: return rewriteValuegeneric_OpEqInter(v, config) case OpEqPtr: @@ -218,6 +220,8 @@ func rewriteValuegeneric(v *Value, config *Config) bool { return rewriteValuegeneric_OpNeq64(v, config) case OpNeq8: return rewriteValuegeneric_OpNeq8(v, config) + case OpNeqB: + return rewriteValuegeneric_OpNeqB(v, config) case OpNeqInter: return rewriteValuegeneric_OpNeqInter(v, config) case OpNeqPtr: @@ -732,6 +736,78 @@ func rewriteValuegeneric_OpAnd16(v *Value, config *Config) bool { v.AuxInt = 0 return true } + // match: (And16 x (And16 x y)) + // cond: + // result: (And16 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd16 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpAnd16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And16 x (And16 y x)) + // cond: + // result: (And16 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd16 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpAnd16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And16 (And16 x y) x) + // cond: + // result: (And16 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpAnd16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And16 (And16 x y) y) + // cond: + // result: (And16 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpAnd16) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpAnd32(v *Value, config *Config) bool { @@ -803,6 +879,78 @@ func rewriteValuegeneric_OpAnd32(v *Value, config *Config) bool { v.AuxInt = 0 return true } + // match: (And32 x (And32 x y)) + // cond: + // result: (And32 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd32 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpAnd32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And32 x (And32 y x)) + // cond: + // result: (And32 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd32 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpAnd32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And32 (And32 x y) x) + // cond: + // result: (And32 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpAnd32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And32 (And32 x y) y) + // cond: + // result: (And32 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpAnd32) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpAnd64(v *Value, config *Config) bool { @@ -874,6 +1022,78 @@ func rewriteValuegeneric_OpAnd64(v *Value, config *Config) bool { v.AuxInt = 0 return true } + // match: (And64 x (And64 x y)) + // cond: + // result: (And64 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd64 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpAnd64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And64 x (And64 y x)) + // cond: + // result: (And64 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd64 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpAnd64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And64 (And64 x y) x) + // cond: + // result: (And64 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpAnd64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And64 (And64 x y) y) + // cond: + // result: (And64 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpAnd64) + v.AddArg(x) + v.AddArg(y) + return true + } // match: (And64 <t> (Const64 [y]) x) // cond: nlz(y) + nto(y) == 64 && nto(y) >= 32 // result: (Rsh64Ux64 (Lsh64x64 <t> x (Const64 <t> [nlz(y)])) (Const64 <t> [nlz(y)])) @@ -997,6 +1217,78 @@ func rewriteValuegeneric_OpAnd8(v *Value, config *Config) bool { v.AuxInt = 0 return true } + // match: (And8 x (And8 x y)) + // cond: + // result: (And8 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd8 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpAnd8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And8 x (And8 y x)) + // cond: + // result: (And8 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpAnd8 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpAnd8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And8 (And8 x y) x) + // cond: + // result: (And8 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpAnd8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (And8 (And8 x y) y) + // cond: + // result: (And8 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpAnd8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpAnd8) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpArg(v *Value, config *Config) bool { @@ -2060,57 +2352,6 @@ func rewriteValuegeneric_OpEq8(v *Value, config *Config) bool { v.AuxInt = 1 return true } - // match: (Eq8 (ConstBool [c]) (ConstBool [d])) - // cond: - // result: (ConstBool [b2i(c == d)]) - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - c := v_0.AuxInt - v_1 := v.Args[1] - if v_1.Op != OpConstBool { - break - } - d := v_1.AuxInt - v.reset(OpConstBool) - v.AuxInt = b2i(c == d) - return true - } - // match: (Eq8 (ConstBool [0]) x) - // cond: - // result: (Not x) - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - if v_0.AuxInt != 0 { - break - } - x := v.Args[1] - v.reset(OpNot) - v.AddArg(x) - return true - } - // match: (Eq8 (ConstBool [1]) x) - // cond: - // result: x - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - if v_0.AuxInt != 1 { - break - } - x := v.Args[1] - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } // match: (Eq8 (Const8 <t> [c]) (Add8 (Const8 <t> [d]) x)) // cond: // result: (Eq8 (Const8 <t> [int64(int8(c-d))]) x) @@ -2162,38 +2403,40 @@ func rewriteValuegeneric_OpEq8(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (Eq8 x (ConstBool <t> [c])) - // cond: x.Op != OpConstBool - // result: (Eq8 (ConstBool <t> [c]) x) + // match: (Eq8 (Const8 [c]) (Const8 [d])) + // cond: + // result: (ConstBool [b2i(c == d)]) for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpConstBool { + v_0 := v.Args[0] + if v_0.Op != OpConst8 { break } - t := v_1.Type - c := v_1.AuxInt - if !(x.Op != OpConstBool) { + c := v_0.AuxInt + v_1 := v.Args[1] + if v_1.Op != OpConst8 { break } - v.reset(OpEq8) - v0 := b.NewValue0(v.Line, OpConstBool, t) - v0.AuxInt = c - v.AddArg(v0) - v.AddArg(x) + d := v_1.AuxInt + v.reset(OpConstBool) + v.AuxInt = b2i(c == d) return true } - // match: (Eq8 (Const8 [c]) (Const8 [d])) + return false +} +func rewriteValuegeneric_OpEqB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (EqB (ConstBool [c]) (ConstBool [d])) // cond: // result: (ConstBool [b2i(c == d)]) for { v_0 := v.Args[0] - if v_0.Op != OpConst8 { + if v_0.Op != OpConstBool { break } c := v_0.AuxInt v_1 := v.Args[1] - if v_1.Op != OpConst8 { + if v_1.Op != OpConstBool { break } d := v_1.AuxInt @@ -2201,6 +2444,39 @@ func rewriteValuegeneric_OpEq8(v *Value, config *Config) bool { v.AuxInt = b2i(c == d) return true } + // match: (EqB (ConstBool [0]) x) + // cond: + // result: (Not x) + for { + v_0 := v.Args[0] + if v_0.Op != OpConstBool { + break + } + if v_0.AuxInt != 0 { + break + } + x := v.Args[1] + v.reset(OpNot) + v.AddArg(x) + return true + } + // match: (EqB (ConstBool [1]) x) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpConstBool { + break + } + if v_0.AuxInt != 1 { + break + } + x := v.Args[1] + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } return false } func rewriteValuegeneric_OpEqInter(v *Value, config *Config) bool { @@ -5419,57 +5695,6 @@ func rewriteValuegeneric_OpNeq8(v *Value, config *Config) bool { v.AuxInt = 0 return true } - // match: (Neq8 (ConstBool [c]) (ConstBool [d])) - // cond: - // result: (ConstBool [b2i(c != d)]) - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - c := v_0.AuxInt - v_1 := v.Args[1] - if v_1.Op != OpConstBool { - break - } - d := v_1.AuxInt - v.reset(OpConstBool) - v.AuxInt = b2i(c != d) - return true - } - // match: (Neq8 (ConstBool [0]) x) - // cond: - // result: x - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - if v_0.AuxInt != 0 { - break - } - x := v.Args[1] - v.reset(OpCopy) - v.Type = x.Type - v.AddArg(x) - return true - } - // match: (Neq8 (ConstBool [1]) x) - // cond: - // result: (Not x) - for { - v_0 := v.Args[0] - if v_0.Op != OpConstBool { - break - } - if v_0.AuxInt != 1 { - break - } - x := v.Args[1] - v.reset(OpNot) - v.AddArg(x) - return true - } // match: (Neq8 (Const8 <t> [c]) (Add8 (Const8 <t> [d]) x)) // cond: // result: (Neq8 (Const8 <t> [int64(int8(c-d))]) x) @@ -5521,38 +5746,40 @@ func rewriteValuegeneric_OpNeq8(v *Value, config *Config) bool { v.AddArg(x) return true } - // match: (Neq8 x (ConstBool <t> [c])) - // cond: x.Op != OpConstBool - // result: (Neq8 (ConstBool <t> [c]) x) + // match: (Neq8 (Const8 [c]) (Const8 [d])) + // cond: + // result: (ConstBool [b2i(c != d)]) for { - x := v.Args[0] - v_1 := v.Args[1] - if v_1.Op != OpConstBool { + v_0 := v.Args[0] + if v_0.Op != OpConst8 { break } - t := v_1.Type - c := v_1.AuxInt - if !(x.Op != OpConstBool) { + c := v_0.AuxInt + v_1 := v.Args[1] + if v_1.Op != OpConst8 { break } - v.reset(OpNeq8) - v0 := b.NewValue0(v.Line, OpConstBool, t) - v0.AuxInt = c - v.AddArg(v0) - v.AddArg(x) + d := v_1.AuxInt + v.reset(OpConstBool) + v.AuxInt = b2i(c != d) return true } - // match: (Neq8 (Const8 [c]) (Const8 [d])) + return false +} +func rewriteValuegeneric_OpNeqB(v *Value, config *Config) bool { + b := v.Block + _ = b + // match: (NeqB (ConstBool [c]) (ConstBool [d])) // cond: // result: (ConstBool [b2i(c != d)]) for { v_0 := v.Args[0] - if v_0.Op != OpConst8 { + if v_0.Op != OpConstBool { break } c := v_0.AuxInt v_1 := v.Args[1] - if v_1.Op != OpConst8 { + if v_1.Op != OpConstBool { break } d := v_1.AuxInt @@ -5560,6 +5787,39 @@ func rewriteValuegeneric_OpNeq8(v *Value, config *Config) bool { v.AuxInt = b2i(c != d) return true } + // match: (NeqB (ConstBool [0]) x) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpConstBool { + break + } + if v_0.AuxInt != 0 { + break + } + x := v.Args[1] + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } + // match: (NeqB (ConstBool [1]) x) + // cond: + // result: (Not x) + for { + v_0 := v.Args[0] + if v_0.Op != OpConstBool { + break + } + if v_0.AuxInt != 1 { + break + } + x := v.Args[1] + v.reset(OpNot) + v.AddArg(x) + return true + } return false } func rewriteValuegeneric_OpNeqInter(v *Value, config *Config) bool { @@ -5739,6 +5999,78 @@ func rewriteValuegeneric_OpOr16(v *Value, config *Config) bool { v.AuxInt = -1 return true } + // match: (Or16 x (Or16 x y)) + // cond: + // result: (Or16 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr16 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpOr16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or16 x (Or16 y x)) + // cond: + // result: (Or16 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr16 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpOr16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or16 (Or16 x y) x) + // cond: + // result: (Or16 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpOr16) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or16 (Or16 x y) y) + // cond: + // result: (Or16 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpOr16) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpOr32(v *Value, config *Config) bool { @@ -5810,6 +6142,78 @@ func rewriteValuegeneric_OpOr32(v *Value, config *Config) bool { v.AuxInt = -1 return true } + // match: (Or32 x (Or32 x y)) + // cond: + // result: (Or32 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr32 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpOr32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or32 x (Or32 y x)) + // cond: + // result: (Or32 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr32 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpOr32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or32 (Or32 x y) x) + // cond: + // result: (Or32 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpOr32) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or32 (Or32 x y) y) + // cond: + // result: (Or32 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpOr32) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpOr64(v *Value, config *Config) bool { @@ -5881,6 +6285,78 @@ func rewriteValuegeneric_OpOr64(v *Value, config *Config) bool { v.AuxInt = -1 return true } + // match: (Or64 x (Or64 x y)) + // cond: + // result: (Or64 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr64 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpOr64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or64 x (Or64 y x)) + // cond: + // result: (Or64 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr64 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpOr64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or64 (Or64 x y) x) + // cond: + // result: (Or64 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpOr64) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or64 (Or64 x y) y) + // cond: + // result: (Or64 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpOr64) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpOr8(v *Value, config *Config) bool { @@ -5952,6 +6428,78 @@ func rewriteValuegeneric_OpOr8(v *Value, config *Config) bool { v.AuxInt = -1 return true } + // match: (Or8 x (Or8 x y)) + // cond: + // result: (Or8 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr8 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpOr8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or8 x (Or8 y x)) + // cond: + // result: (Or8 x y) + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpOr8 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpOr8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or8 (Or8 x y) x) + // cond: + // result: (Or8 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpOr8) + v.AddArg(x) + v.AddArg(y) + return true + } + // match: (Or8 (Or8 x y) y) + // cond: + // result: (Or8 x y) + for { + v_0 := v.Args[0] + if v_0.Op != OpOr8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpOr8) + v.AddArg(x) + v.AddArg(y) + return true + } return false } func rewriteValuegeneric_OpPhi(v *Value, config *Config) bool { @@ -6185,7 +6733,7 @@ func rewriteValuegeneric_OpRsh16Ux64(v *Value, config *Config) bool { _ = b // match: (Rsh16Ux64 (Const16 [c]) (Const64 [d])) // cond: - // result: (Const16 [int64(uint16(c) >> uint64(d))]) + // result: (Const16 [int64(int16(uint16(c) >> uint64(d)))]) for { v_0 := v.Args[0] if v_0.Op != OpConst16 { @@ -6198,7 +6746,7 @@ func rewriteValuegeneric_OpRsh16Ux64(v *Value, config *Config) bool { } d := v_1.AuxInt v.reset(OpConst16) - v.AuxInt = int64(uint16(c) >> uint64(d)) + v.AuxInt = int64(int16(uint16(c) >> uint64(d))) return true } // match: (Rsh16Ux64 (Const16 [0]) _) @@ -6547,7 +7095,7 @@ func rewriteValuegeneric_OpRsh32Ux64(v *Value, config *Config) bool { _ = b // match: (Rsh32Ux64 (Const32 [c]) (Const64 [d])) // cond: - // result: (Const32 [int64(uint32(c) >> uint64(d))]) + // result: (Const32 [int64(int32(uint32(c) >> uint64(d)))]) for { v_0 := v.Args[0] if v_0.Op != OpConst32 { @@ -6560,7 +7108,7 @@ func rewriteValuegeneric_OpRsh32Ux64(v *Value, config *Config) bool { } d := v_1.AuxInt v.reset(OpConst32) - v.AuxInt = int64(uint32(c) >> uint64(d)) + v.AuxInt = int64(int32(uint32(c) >> uint64(d))) return true } // match: (Rsh32Ux64 (Const32 [0]) _) @@ -7353,7 +7901,7 @@ func rewriteValuegeneric_OpRsh8Ux64(v *Value, config *Config) bool { _ = b // match: (Rsh8Ux64 (Const8 [c]) (Const64 [d])) // cond: - // result: (Const8 [int64(uint8(c) >> uint64(d))]) + // result: (Const8 [int64(int8(uint8(c) >> uint64(d)))]) for { v_0 := v.Args[0] if v_0.Op != OpConst8 { @@ -7366,7 +7914,7 @@ func rewriteValuegeneric_OpRsh8Ux64(v *Value, config *Config) bool { } d := v_1.AuxInt v.reset(OpConst8) - v.AuxInt = int64(uint8(c) >> uint64(d)) + v.AuxInt = int64(int8(uint8(c) >> uint64(d))) return true } // match: (Rsh8Ux64 (Const8 [0]) _) @@ -8941,6 +9489,78 @@ func rewriteValuegeneric_OpXor16(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (Xor16 x (Xor16 x y)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor16 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor16 x (Xor16 y x)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor16 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor16 (Xor16 x y) x) + // cond: + // result: y + for { + v_0 := v.Args[0] + if v_0.Op != OpXor16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor16 (Xor16 x y) y) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpXor16 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } return false } func rewriteValuegeneric_OpXor32(v *Value, config *Config) bool { @@ -8996,6 +9616,78 @@ func rewriteValuegeneric_OpXor32(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (Xor32 x (Xor32 x y)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor32 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor32 x (Xor32 y x)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor32 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor32 (Xor32 x y) x) + // cond: + // result: y + for { + v_0 := v.Args[0] + if v_0.Op != OpXor32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor32 (Xor32 x y) y) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpXor32 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } return false } func rewriteValuegeneric_OpXor64(v *Value, config *Config) bool { @@ -9051,6 +9743,78 @@ func rewriteValuegeneric_OpXor64(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (Xor64 x (Xor64 x y)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor64 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor64 x (Xor64 y x)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor64 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor64 (Xor64 x y) x) + // cond: + // result: y + for { + v_0 := v.Args[0] + if v_0.Op != OpXor64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor64 (Xor64 x y) y) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpXor64 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } return false } func rewriteValuegeneric_OpXor8(v *Value, config *Config) bool { @@ -9106,6 +9870,78 @@ func rewriteValuegeneric_OpXor8(v *Value, config *Config) bool { v.AddArg(x) return true } + // match: (Xor8 x (Xor8 x y)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor8 { + break + } + if x != v_1.Args[0] { + break + } + y := v_1.Args[1] + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor8 x (Xor8 y x)) + // cond: + // result: y + for { + x := v.Args[0] + v_1 := v.Args[1] + if v_1.Op != OpXor8 { + break + } + y := v_1.Args[0] + if x != v_1.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor8 (Xor8 x y) x) + // cond: + // result: y + for { + v_0 := v.Args[0] + if v_0.Op != OpXor8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if x != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = y.Type + v.AddArg(y) + return true + } + // match: (Xor8 (Xor8 x y) y) + // cond: + // result: x + for { + v_0 := v.Args[0] + if v_0.Op != OpXor8 { + break + } + x := v_0.Args[0] + y := v_0.Args[1] + if y != v.Args[1] { + break + } + v.reset(OpCopy) + v.Type = x.Type + v.AddArg(x) + return true + } return false } func rewriteBlockgeneric(b *Block) bool { diff --git a/src/cmd/compile/internal/ssa/sparsemap.go b/src/cmd/compile/internal/ssa/sparsemap.go index 6c0043b230..0211a70f09 100644 --- a/src/cmd/compile/internal/ssa/sparsemap.go +++ b/src/cmd/compile/internal/ssa/sparsemap.go @@ -32,6 +32,8 @@ func (s *sparseMap) contains(k ID) bool { return i < len(s.dense) && s.dense[i].key == k } +// get returns the value for key k, or -1 if k does +// not appear in the map. func (s *sparseMap) get(k ID) int32 { i := s.sparse[k] if i < len(s.dense) && s.dense[i].key == k { @@ -50,6 +52,20 @@ func (s *sparseMap) set(k ID, v int32) { s.sparse[k] = len(s.dense) - 1 } +// setBit sets the v'th bit of k's value, where 0 <= v < 32 +func (s *sparseMap) setBit(k ID, v uint) { + if v >= 32 { + panic("bit index too large.") + } + i := s.sparse[k] + if i < len(s.dense) && s.dense[i].key == k { + s.dense[i].val |= 1 << v + return + } + s.dense = append(s.dense, sparseEntry{k, 1 << v}) + s.sparse[k] = len(s.dense) - 1 +} + func (s *sparseMap) remove(k ID) { i := s.sparse[k] if i < len(s.dense) && s.dense[i].key == k { diff --git a/src/cmd/compile/internal/ssa/sparsetree.go b/src/cmd/compile/internal/ssa/sparsetree.go index cae91e7ddb..45c7897496 100644 --- a/src/cmd/compile/internal/ssa/sparsetree.go +++ b/src/cmd/compile/internal/ssa/sparsetree.go @@ -116,6 +116,9 @@ func (t sparseTree) Child(x *Block) *Block { // isAncestorEq reports whether x is an ancestor of or equal to y. func (t sparseTree) isAncestorEq(x, y *Block) bool { + if x == y { + return true + } xx := &t[x.ID] yy := &t[y.ID] return xx.entry <= yy.entry && yy.exit <= xx.exit @@ -123,7 +126,16 @@ func (t sparseTree) isAncestorEq(x, y *Block) bool { // isAncestor reports whether x is a strict ancestor of y. func (t sparseTree) isAncestor(x, y *Block) bool { + if x == y { + return false + } xx := &t[x.ID] yy := &t[y.ID] return xx.entry < yy.entry && yy.exit < xx.exit } + +// maxdomorder returns a value to allow a maximal dominator first sort. maxdomorder(x) < maxdomorder(y) is true +// if x may dominate y, and false if x cannot dominate y. +func (t sparseTree) maxdomorder(x *Block) int32 { + return t[x.ID].entry +} diff --git a/src/cmd/compile/internal/ssa/stackalloc.go b/src/cmd/compile/internal/ssa/stackalloc.go index 1de22dc96e..44f4096cb2 100644 --- a/src/cmd/compile/internal/ssa/stackalloc.go +++ b/src/cmd/compile/internal/ssa/stackalloc.go @@ -22,6 +22,13 @@ type stackAllocState struct { names []LocalSlot slots []int used []bool + + nArgSlot, // Number of Values sourced to arg slot + nNotNeed, // Number of Values not needing a stack slot + nNamedSlot, // Number of Values using a named stack slot + nReuse, // Number of values reusing a stack slot + nAuto, // Number of autos allocated for stack slots. + nSelfInterfere int32 // Number of self-interferences } func newStackAllocState(f *Func) *stackAllocState { @@ -54,6 +61,7 @@ func putStackAllocState(s *stackAllocState) { s.f.Config.stackAllocState = s s.f = nil s.live = nil + s.nArgSlot, s.nNotNeed, s.nNamedSlot, s.nReuse, s.nAuto, s.nSelfInterfere = 0, 0, 0, 0, 0, 0 } type stackValState struct { @@ -75,6 +83,13 @@ func stackalloc(f *Func, spillLive [][]ID) [][]ID { defer putStackAllocState(s) s.stackalloc() + if f.pass.stats > 0 { + f.logStat("stack_alloc_stats", + s.nArgSlot, "arg_slots", s.nNotNeed, "slot_not_needed", + s.nNamedSlot, "named_slots", s.nAuto, "auto_slots", + s.nReuse, "reused_slots", s.nSelfInterfere, "self_interfering") + } + return s.live } @@ -170,9 +185,11 @@ func (s *stackAllocState) stackalloc() { for _, b := range f.Blocks { for _, v := range b.Values { if !s.values[v.ID].needSlot { + s.nNotNeed++ continue } if v.Op == OpArg { + s.nArgSlot++ continue // already picked } @@ -184,18 +201,20 @@ func (s *stackAllocState) stackalloc() { } else { name = names[v.ID] } - if name.N != nil && v.Type.Equal(name.Type) { + if name.N != nil && v.Type.Compare(name.Type) == CMPeq { for _, id := range s.interfere[v.ID] { h := f.getHome(id) if h != nil && h.(LocalSlot).N == name.N && h.(LocalSlot).Off == name.Off { // A variable can interfere with itself. // It is rare, but but it can happen. + s.nSelfInterfere++ goto noname } } if f.pass.debug > stackDebug { fmt.Printf("stackalloc %s to %s\n", v, name.Name()) } + s.nNamedSlot++ f.setHome(v, name) continue } @@ -217,11 +236,13 @@ func (s *stackAllocState) stackalloc() { var i int for i = 0; i < len(locs); i++ { if !used[i] { + s.nReuse++ break } } // If there is no unused stack slot, allocate a new one. if i == len(locs) { + s.nAuto++ locs = append(locs, LocalSlot{N: f.Config.fe.Auto(v.Type), Type: v.Type, Off: 0}) locations[v.Type] = locs } @@ -351,7 +372,7 @@ func (s *stackAllocState) buildInterferenceGraph() { if s.values[v.ID].needSlot { live.remove(v.ID) for _, id := range live.contents() { - if s.values[v.ID].typ.Equal(s.values[id].typ) { + if s.values[v.ID].typ.Compare(s.values[id].typ) == CMPeq { s.interfere[v.ID] = append(s.interfere[v.ID], id) s.interfere[id] = append(s.interfere[id], v.ID) } diff --git a/src/cmd/compile/internal/ssa/type.go b/src/cmd/compile/internal/ssa/type.go index 9643b07556..91a4efe78f 100644 --- a/src/cmd/compile/internal/ssa/type.go +++ b/src/cmd/compile/internal/ssa/type.go @@ -31,16 +31,16 @@ type Type interface { ElemType() Type // given []T or *T or [n]T, return T PtrTo() Type // given T, return *T - NumFields() int // # of fields of a struct - FieldType(i int) Type // type of ith field of the struct - FieldOff(i int) int64 // offset of ith field of the struct + NumFields() int // # of fields of a struct + FieldType(i int) Type // type of ith field of the struct + FieldOff(i int) int64 // offset of ith field of the struct + FieldName(i int) string // name of ith field of the struct NumElem() int64 // # of elements of an array String() string SimpleString() string // a coarser generic description of T, e.g. T's underlying type - Equal(Type) bool - Compare(Type) Cmp // compare types, returning one of CMPlt, CMPeq, CMPgt. + Compare(Type) Cmp // compare types, returning one of CMPlt, CMPeq, CMPgt. } // Special compiler-only types. @@ -53,30 +53,31 @@ type CompilerType struct { Int128 bool } -func (t *CompilerType) Size() int64 { return t.size } // Size in bytes -func (t *CompilerType) Alignment() int64 { return 0 } -func (t *CompilerType) IsBoolean() bool { return false } -func (t *CompilerType) IsInteger() bool { return false } -func (t *CompilerType) IsSigned() bool { return false } -func (t *CompilerType) IsFloat() bool { return false } -func (t *CompilerType) IsComplex() bool { return false } -func (t *CompilerType) IsPtrShaped() bool { return false } -func (t *CompilerType) IsString() bool { return false } -func (t *CompilerType) IsSlice() bool { return false } -func (t *CompilerType) IsArray() bool { return false } -func (t *CompilerType) IsStruct() bool { return false } -func (t *CompilerType) IsInterface() bool { return false } -func (t *CompilerType) IsMemory() bool { return t.Memory } -func (t *CompilerType) IsFlags() bool { return t.Flags } -func (t *CompilerType) IsVoid() bool { return t.Void } -func (t *CompilerType) String() string { return t.Name } -func (t *CompilerType) SimpleString() string { return t.Name } -func (t *CompilerType) ElemType() Type { panic("not implemented") } -func (t *CompilerType) PtrTo() Type { panic("not implemented") } -func (t *CompilerType) NumFields() int { panic("not implemented") } -func (t *CompilerType) FieldType(i int) Type { panic("not implemented") } -func (t *CompilerType) FieldOff(i int) int64 { panic("not implemented") } -func (t *CompilerType) NumElem() int64 { panic("not implemented") } +func (t *CompilerType) Size() int64 { return t.size } // Size in bytes +func (t *CompilerType) Alignment() int64 { return 0 } +func (t *CompilerType) IsBoolean() bool { return false } +func (t *CompilerType) IsInteger() bool { return false } +func (t *CompilerType) IsSigned() bool { return false } +func (t *CompilerType) IsFloat() bool { return false } +func (t *CompilerType) IsComplex() bool { return false } +func (t *CompilerType) IsPtrShaped() bool { return false } +func (t *CompilerType) IsString() bool { return false } +func (t *CompilerType) IsSlice() bool { return false } +func (t *CompilerType) IsArray() bool { return false } +func (t *CompilerType) IsStruct() bool { return false } +func (t *CompilerType) IsInterface() bool { return false } +func (t *CompilerType) IsMemory() bool { return t.Memory } +func (t *CompilerType) IsFlags() bool { return t.Flags } +func (t *CompilerType) IsVoid() bool { return t.Void } +func (t *CompilerType) String() string { return t.Name } +func (t *CompilerType) SimpleString() string { return t.Name } +func (t *CompilerType) ElemType() Type { panic("not implemented") } +func (t *CompilerType) PtrTo() Type { panic("not implemented") } +func (t *CompilerType) NumFields() int { panic("not implemented") } +func (t *CompilerType) FieldType(i int) Type { panic("not implemented") } +func (t *CompilerType) FieldOff(i int) int64 { panic("not implemented") } +func (t *CompilerType) FieldName(i int) string { panic("not implemented") } +func (t *CompilerType) NumElem() int64 { panic("not implemented") } // Cmp is a comparison between values a and b. // -1 if a < b @@ -115,14 +116,6 @@ func (t *CompilerType) Compare(u Type) Cmp { return CMPlt } -func (t *CompilerType) Equal(u Type) bool { - x, ok := u.(*CompilerType) - if !ok { - return false - } - return x == t -} - var ( TypeInvalid = &CompilerType{Name: "invalid"} TypeMem = &CompilerType{Name: "mem", Memory: true} diff --git a/src/cmd/compile/internal/ssa/type_test.go b/src/cmd/compile/internal/ssa/type_test.go index cd80abf03f..3b1a892083 100644 --- a/src/cmd/compile/internal/ssa/type_test.go +++ b/src/cmd/compile/internal/ssa/type_test.go @@ -24,30 +24,31 @@ type TypeImpl struct { Name string } -func (t *TypeImpl) Size() int64 { return t.Size_ } -func (t *TypeImpl) Alignment() int64 { return t.Align } -func (t *TypeImpl) IsBoolean() bool { return t.Boolean } -func (t *TypeImpl) IsInteger() bool { return t.Integer } -func (t *TypeImpl) IsSigned() bool { return t.Signed } -func (t *TypeImpl) IsFloat() bool { return t.Float } -func (t *TypeImpl) IsComplex() bool { return t.Complex } -func (t *TypeImpl) IsPtrShaped() bool { return t.Ptr } -func (t *TypeImpl) IsString() bool { return t.string } -func (t *TypeImpl) IsSlice() bool { return t.slice } -func (t *TypeImpl) IsArray() bool { return t.array } -func (t *TypeImpl) IsStruct() bool { return t.struct_ } -func (t *TypeImpl) IsInterface() bool { return t.inter } -func (t *TypeImpl) IsMemory() bool { return false } -func (t *TypeImpl) IsFlags() bool { return false } -func (t *TypeImpl) IsVoid() bool { return false } -func (t *TypeImpl) String() string { return t.Name } -func (t *TypeImpl) SimpleString() string { return t.Name } -func (t *TypeImpl) ElemType() Type { return t.Elem_ } -func (t *TypeImpl) PtrTo() Type { panic("not implemented") } -func (t *TypeImpl) NumFields() int { panic("not implemented") } -func (t *TypeImpl) FieldType(i int) Type { panic("not implemented") } -func (t *TypeImpl) FieldOff(i int) int64 { panic("not implemented") } -func (t *TypeImpl) NumElem() int64 { panic("not implemented") } +func (t *TypeImpl) Size() int64 { return t.Size_ } +func (t *TypeImpl) Alignment() int64 { return t.Align } +func (t *TypeImpl) IsBoolean() bool { return t.Boolean } +func (t *TypeImpl) IsInteger() bool { return t.Integer } +func (t *TypeImpl) IsSigned() bool { return t.Signed } +func (t *TypeImpl) IsFloat() bool { return t.Float } +func (t *TypeImpl) IsComplex() bool { return t.Complex } +func (t *TypeImpl) IsPtrShaped() bool { return t.Ptr } +func (t *TypeImpl) IsString() bool { return t.string } +func (t *TypeImpl) IsSlice() bool { return t.slice } +func (t *TypeImpl) IsArray() bool { return t.array } +func (t *TypeImpl) IsStruct() bool { return t.struct_ } +func (t *TypeImpl) IsInterface() bool { return t.inter } +func (t *TypeImpl) IsMemory() bool { return false } +func (t *TypeImpl) IsFlags() bool { return false } +func (t *TypeImpl) IsVoid() bool { return false } +func (t *TypeImpl) String() string { return t.Name } +func (t *TypeImpl) SimpleString() string { return t.Name } +func (t *TypeImpl) ElemType() Type { return t.Elem_ } +func (t *TypeImpl) PtrTo() Type { panic("not implemented") } +func (t *TypeImpl) NumFields() int { panic("not implemented") } +func (t *TypeImpl) FieldType(i int) Type { panic("not implemented") } +func (t *TypeImpl) FieldOff(i int) int64 { panic("not implemented") } +func (t *TypeImpl) FieldName(i int) string { panic("not implemented") } +func (t *TypeImpl) NumElem() int64 { panic("not implemented") } func (t *TypeImpl) Equal(u Type) bool { x, ok := u.(*TypeImpl) diff --git a/src/cmd/compile/internal/ssa/value.go b/src/cmd/compile/internal/ssa/value.go index fd4eb64db1..6c364ad932 100644 --- a/src/cmd/compile/internal/ssa/value.go +++ b/src/cmd/compile/internal/ssa/value.go @@ -185,6 +185,7 @@ func (v *Value) resetArgs() { } v.argstorage[0] = nil v.argstorage[1] = nil + v.argstorage[2] = nil v.Args = v.argstorage[:0] } diff --git a/src/cmd/compile/internal/x86/cgen64.go b/src/cmd/compile/internal/x86/cgen64.go index 61e191f87c..ea52d6951a 100644 --- a/src/cmd/compile/internal/x86/cgen64.go +++ b/src/cmd/compile/internal/x86/cgen64.go @@ -19,12 +19,12 @@ func cgen64(n *gc.Node, res *gc.Node) { if res.Op != gc.OINDREG && res.Op != gc.ONAME { gc.Dump("n", n) gc.Dump("res", res) - gc.Fatalf("cgen64 %v of %v", gc.Oconv(n.Op, 0), gc.Oconv(res.Op, 0)) + gc.Fatalf("cgen64 %v of %v", n.Op, res.Op) } switch n.Op { default: - gc.Fatalf("cgen64 %v", gc.Oconv(n.Op, 0)) + gc.Fatalf("cgen64 %v", n.Op) case gc.OMINUS: gc.Cgen(n.Left, res) @@ -531,7 +531,7 @@ func cmp64(nl *gc.Node, nr *gc.Node, op gc.Op, likely int, to *obj.Prog) { var br *obj.Prog switch op { default: - gc.Fatalf("cmp64 %v %v", gc.Oconv(op, 0), t) + gc.Fatalf("cmp64 %v %v", op, t) // cmp hi // jne L diff --git a/src/cmd/compile/internal/x86/galign.go b/src/cmd/compile/internal/x86/galign.go index 4ab72b6da7..738d887742 100644 --- a/src/cmd/compile/internal/x86/galign.go +++ b/src/cmd/compile/internal/x86/galign.go @@ -13,15 +13,10 @@ import ( ) func betypeinit() { - gc.Widthptr = 4 - gc.Widthint = 4 - gc.Widthreg = 4 } func Main() { - gc.Thearch.Thechar = '8' - gc.Thearch.Thestring = "386" - gc.Thearch.Thelinkarch = &x86.Link386 + gc.Thearch.LinkArch = &x86.Link386 gc.Thearch.REGSP = x86.REGSP gc.Thearch.REGCTXT = x86.REGCTXT gc.Thearch.REGCALLX = x86.REG_BX diff --git a/src/cmd/compile/internal/x86/ggen.go b/src/cmd/compile/internal/x86/ggen.go index 38c3f8fc0e..21d989c98d 100644 --- a/src/cmd/compile/internal/x86/ggen.go +++ b/src/cmd/compile/internal/x86/ggen.go @@ -661,7 +661,7 @@ func cgen_floatsse(n *gc.Node, res *gc.Node) { switch n.Op { default: gc.Dump("cgen_floatsse", n) - gc.Fatalf("cgen_floatsse %v", gc.Oconv(n.Op, 0)) + gc.Fatalf("cgen_floatsse %v", n.Op) return case gc.OMINUS, diff --git a/src/cmd/compile/internal/x86/gsubr.go b/src/cmd/compile/internal/x86/gsubr.go index 91c009116c..569ffd11bd 100644 --- a/src/cmd/compile/internal/x86/gsubr.go +++ b/src/cmd/compile/internal/x86/gsubr.go @@ -91,7 +91,7 @@ func optoas(op gc.Op, t *gc.Type) obj.As { a := obj.AXXX switch uint32(op)<<16 | uint32(gc.Simtype[t.Etype]) { default: - gc.Fatalf("optoas: no entry %v-%v", gc.Oconv(op, 0), t) + gc.Fatalf("optoas: no entry %v-%v", op, t) case OADDR_ | gc.TPTR32: a = x86.ALEAL @@ -454,7 +454,7 @@ func foptoas(op gc.Op, t *gc.Type, flg int) obj.As { if !gc.Thearch.Use387 { switch uint32(op)<<16 | uint32(et) { default: - gc.Fatalf("foptoas-sse: no entry %v-%v", gc.Oconv(op, 0), t) + gc.Fatalf("foptoas-sse: no entry %v-%v", op, t) case OCMP_ | gc.TFLOAT32: a = x86.AUCOMISS @@ -587,7 +587,7 @@ func foptoas(op gc.Op, t *gc.Type, flg int) obj.As { return x86.AFCHS } - gc.Fatalf("foptoas %v %v %#x", gc.Oconv(op, 0), t, flg) + gc.Fatalf("foptoas %v %v %#x", op, t, flg) return 0 } diff --git a/src/cmd/compile/internal/x86/reg.go b/src/cmd/compile/internal/x86/reg.go index 76d90b8e89..d49a1aed9d 100644 --- a/src/cmd/compile/internal/x86/reg.go +++ b/src/cmd/compile/internal/x86/reg.go @@ -62,7 +62,7 @@ func regnames(n *int) []string { } func excludedregs() uint64 { - if gc.Ctxt.Flag_shared != 0 { + if gc.Ctxt.Flag_shared { return RtoB(x86.REG_SP) | RtoB(x86.REG_CX) } else { return RtoB(x86.REG_SP) diff --git a/src/cmd/compile/main.go b/src/cmd/compile/main.go index 49c2fb6263..8b8161efd1 100644 --- a/src/cmd/compile/main.go +++ b/src/cmd/compile/main.go @@ -10,6 +10,7 @@ import ( "cmd/compile/internal/arm64" "cmd/compile/internal/mips64" "cmd/compile/internal/ppc64" + "cmd/compile/internal/s390x" "cmd/compile/internal/x86" "cmd/internal/obj" "fmt" @@ -38,5 +39,7 @@ func main() { mips64.Main() case "ppc64", "ppc64le": ppc64.Main() + case "s390x": + s390x.Main() } } |
